HUP0200420A2 - Eljárás 3,4-dehidroprolin- és 3,4-dehidropiperidin-származékok előállítására - Google Patents
Eljárás 3,4-dehidroprolin- és 3,4-dehidropiperidin-származékok előállítására Download PDFInfo
- Publication number
- HUP0200420A2 HUP0200420A2 HU0200420A HUP0200420A HUP0200420A2 HU P0200420 A2 HUP0200420 A2 HU P0200420A2 HU 0200420 A HU0200420 A HU 0200420A HU P0200420 A HUP0200420 A HU P0200420A HU P0200420 A2 HUP0200420 A2 HU P0200420A2
- Authority
- HU
- Hungary
- Prior art keywords
- alkyl
- group
- general formula
- hydrogen atom
- compound
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 15
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims abstract description 19
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 14
- 108090000765 processed proteins & peptides Proteins 0.000 claims abstract description 8
- 125000004191 (C1-C6) alkoxy group Chemical group 0.000 claims abstract description 6
- -1 hydroxy, amino group Chemical group 0.000 claims abstract description 6
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 claims abstract description 5
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims abstract description 4
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims abstract description 4
- 125000002088 tosyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1C([H])([H])[H])S(*)(=O)=O 0.000 claims abstract description 4
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 claims abstract description 4
- 150000001875 compounds Chemical class 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 7
- 125000000217 alkyl group Chemical group 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 238000002360 preparation method Methods 0.000 claims description 5
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 4
- 229910052783 alkali metal Inorganic materials 0.000 claims description 3
- 125000003277 amino group Chemical group 0.000 claims description 3
- 239000002585 base Substances 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- DWKUKQRKVCMOLP-UHFFFAOYSA-N 1-piperideine Chemical class C1CCN=CC1 DWKUKQRKVCMOLP-UHFFFAOYSA-N 0.000 claims description 2
- RSEBUVRVKCANEP-UHFFFAOYSA-N 2-pyrroline Chemical compound C1CC=CN1 RSEBUVRVKCANEP-UHFFFAOYSA-N 0.000 claims description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 claims description 2
- 125000002252 acyl group Chemical group 0.000 claims description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 2
- 229910052794 bromium Inorganic materials 0.000 claims description 2
- 239000001569 carbon dioxide Substances 0.000 claims description 2
- 229910002092 carbon dioxide Inorganic materials 0.000 claims description 2
- 230000003301 hydrolyzing effect Effects 0.000 claims description 2
- 229910052740 iodine Inorganic materials 0.000 claims description 2
- ZVJHJDDKYZXRJI-UHFFFAOYSA-N pyrroline Natural products C1CC=NC1 ZVJHJDDKYZXRJI-UHFFFAOYSA-N 0.000 claims description 2
- 101150096839 Fcmr gene Proteins 0.000 claims 1
- 239000007795 chemical reaction product Substances 0.000 claims 1
- 125000002827 triflate group Chemical group FC(S(=O)(=O)O*)(F)F 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 abstract description 2
- 239000000243 solution Substances 0.000 description 14
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 10
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 10
- ZCSHNCUQKCANBX-UHFFFAOYSA-N lithium diisopropylamide Chemical compound [Li+].CC(C)[N-]C(C)C ZCSHNCUQKCANBX-UHFFFAOYSA-N 0.000 description 8
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- 239000000203 mixture Substances 0.000 description 6
- 238000003786 synthesis reaction Methods 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- 150000001413 amino acids Chemical class 0.000 description 5
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 4
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- IEJIGPNLZYLLBP-UHFFFAOYSA-N dimethyl carbonate Chemical compound COC(=O)OC IEJIGPNLZYLLBP-UHFFFAOYSA-N 0.000 description 4
- 239000012074 organic phase Substances 0.000 description 4
- 239000012071 phase Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- JVQIKJMSUIMUDI-UHFFFAOYSA-N 3-pyrroline Chemical compound C1NCC=C1 JVQIKJMSUIMUDI-UHFFFAOYSA-N 0.000 description 3
- 238000006027 Birch reduction reaction Methods 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 239000012043 crude product Substances 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 239000003921 oil Substances 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- OMGHIGVFLOPEHJ-UHFFFAOYSA-N 2,5-dihydro-1h-pyrrol-1-ium-2-carboxylate Chemical compound OC(=O)C1NCC=C1 OMGHIGVFLOPEHJ-UHFFFAOYSA-N 0.000 description 2
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 238000002425 crystallisation Methods 0.000 description 2
- 230000008025 crystallization Effects 0.000 description 2
- PMMYEEVYMWASQN-UHFFFAOYSA-N dl-hydroxyproline Natural products OC1C[NH2+]C(C([O-])=O)C1 PMMYEEVYMWASQN-UHFFFAOYSA-N 0.000 description 2
- 230000002255 enzymatic effect Effects 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 238000004817 gas chromatography Methods 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 2
- 229960002591 hydroxyproline Drugs 0.000 description 2
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 2
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical class CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- WRHZVMBBRYBTKZ-UHFFFAOYSA-N pyrrole-2-carboxylic acid Chemical class OC(=O)C1=CC=CN1 WRHZVMBBRYBTKZ-UHFFFAOYSA-N 0.000 description 2
- 239000000741 silica gel Substances 0.000 description 2
- 229910002027 silica gel Inorganic materials 0.000 description 2
- YZSOPZXHDQUUJP-BYPYZUCNSA-N (2s)-2-(1h-imidazol-2-ylamino)propanoic acid Chemical class OC(=O)[C@H](C)NC1=NC=CN1 YZSOPZXHDQUUJP-BYPYZUCNSA-N 0.000 description 1
- XGUIFUMAHBYCME-YFKPBYRVSA-N (2s)-2-(1h-pyrrol-2-ylamino)propanoic acid Chemical class OC(=O)[C@H](C)NC1=CC=CN1 XGUIFUMAHBYCME-YFKPBYRVSA-N 0.000 description 1
- BURVSCKWRUZTPY-YFKPBYRVSA-N (2s)-2-(cyclobutylamino)propanoic acid Chemical compound OC(=O)[C@H](C)NC1CCC1 BURVSCKWRUZTPY-YFKPBYRVSA-N 0.000 description 1
- VQDMQFJXWAHHJA-QMMMGPOBSA-N (2s)-2-(cycloheptylamino)propanoic acid Chemical compound OC(=O)[C@H](C)NC1CCCCCC1 VQDMQFJXWAHHJA-QMMMGPOBSA-N 0.000 description 1
- BVAUMRCGVHUWOZ-ZETCQYMHSA-N (2s)-2-(cyclohexylazaniumyl)propanoate Chemical compound OC(=O)[C@H](C)NC1CCCCC1 BVAUMRCGVHUWOZ-ZETCQYMHSA-N 0.000 description 1
- LDUWTIUXPVCEQF-LURJTMIESA-N (2s)-2-(cyclopentylamino)propanoic acid Chemical compound OC(=O)[C@H](C)NC1CCCC1 LDUWTIUXPVCEQF-LURJTMIESA-N 0.000 description 1
- AKESDYBVYQSCNP-QMMMGPOBSA-N (2s)-2-(isoquinolin-1-ylamino)propanoic acid Chemical compound C1=CC=C2C(N[C@@H](C)C(O)=O)=NC=CC2=C1 AKESDYBVYQSCNP-QMMMGPOBSA-N 0.000 description 1
- IYKLZBIWFXPUCS-VIFPVBQESA-N (2s)-2-(naphthalen-1-ylamino)propanoic acid Chemical compound C1=CC=C2C(N[C@@H](C)C(O)=O)=CC=CC2=C1 IYKLZBIWFXPUCS-VIFPVBQESA-N 0.000 description 1
- HOBACDWMUXDSHY-QMMMGPOBSA-N (2s)-2-(quinolin-2-ylamino)propanoic acid Chemical compound C1=CC=CC2=NC(N[C@@H](C)C(O)=O)=CC=C21 HOBACDWMUXDSHY-QMMMGPOBSA-N 0.000 description 1
- LPBSHGLDBQBSPI-YFKPBYRVSA-N (2s)-2-amino-4,4-dimethylpentanoic acid Chemical compound CC(C)(C)C[C@H](N)C(O)=O LPBSHGLDBQBSPI-YFKPBYRVSA-N 0.000 description 1
- WAMWSIDTKSNDCU-ZETCQYMHSA-N (2s)-2-azaniumyl-2-cyclohexylacetate Chemical compound OC(=O)[C@@H](N)C1CCCCC1 WAMWSIDTKSNDCU-ZETCQYMHSA-N 0.000 description 1
- XGUXJMWPVJQIHI-YFKPBYRVSA-N (2s)-2-azaniumyl-3-cyclopropylpropanoate Chemical compound [O-]C(=O)[C@@H]([NH3+])CC1CC1 XGUXJMWPVJQIHI-YFKPBYRVSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- XSOFQSXSWSGGAS-UHFFFAOYSA-N 1-methoxycarbonyl-2,5-dihydropyrrole-3-carboxylic acid Chemical compound COC(=O)N1CC(=CC1)C(=O)O XSOFQSXSWSGGAS-UHFFFAOYSA-N 0.000 description 1
- RLOQBKJCOAXOLR-UHFFFAOYSA-N 1h-pyrrole-2-carboxamide Chemical class NC(=O)C1=CC=CN1 RLOQBKJCOAXOLR-UHFFFAOYSA-N 0.000 description 1
- LTHGZYQCFFPTAJ-UHFFFAOYSA-N 2-(1-adamantylamino)acetic acid Chemical compound C1C(C2)CC3CC2CC1(NCC(=O)O)C3 LTHGZYQCFFPTAJ-UHFFFAOYSA-N 0.000 description 1
- VIXMOEKUHKZJMV-UHFFFAOYSA-N 2-(1h-imidazol-2-ylamino)acetic acid Chemical class OC(=O)CNC1=NC=CN1 VIXMOEKUHKZJMV-UHFFFAOYSA-N 0.000 description 1
- SEPZVWYNULYCQA-UHFFFAOYSA-N 2-(1h-pyrrol-2-ylamino)acetic acid Chemical compound OC(=O)CNC1=CC=CN1 SEPZVWYNULYCQA-UHFFFAOYSA-N 0.000 description 1
- KQLGGQARRCMYGD-UHFFFAOYSA-N 2-(cyclobutylamino)acetic acid Chemical compound OC(=O)CNC1CCC1 KQLGGQARRCMYGD-UHFFFAOYSA-N 0.000 description 1
- NPLBBQAAYSJEMO-UHFFFAOYSA-N 2-(cycloheptylazaniumyl)acetate Chemical compound OC(=O)CNC1CCCCCC1 NPLBBQAAYSJEMO-UHFFFAOYSA-N 0.000 description 1
- LRHRHAWNXCGABU-UHFFFAOYSA-N 2-(cyclopentylazaniumyl)acetate Chemical compound OC(=O)CNC1CCCC1 LRHRHAWNXCGABU-UHFFFAOYSA-N 0.000 description 1
- DXQCCQKRNWMECV-UHFFFAOYSA-N 2-(cyclopropylazaniumyl)acetate Chemical compound OC(=O)CNC1CC1 DXQCCQKRNWMECV-UHFFFAOYSA-N 0.000 description 1
- DUJAUTCYDLIGAY-UHFFFAOYSA-N 2-(furan-2-ylamino)acetic acid Chemical compound OC(=O)CNC1=CC=CO1 DUJAUTCYDLIGAY-UHFFFAOYSA-N 0.000 description 1
- XSUNEBYPANHKCT-UHFFFAOYSA-N 2-(isoquinolin-1-ylamino)acetic acid Chemical compound C1=CC=C2C(NCC(=O)O)=NC=CC2=C1 XSUNEBYPANHKCT-UHFFFAOYSA-N 0.000 description 1
- TXHAHOVNFDVCCC-UHFFFAOYSA-N 2-(tert-butylazaniumyl)acetate Chemical compound CC(C)(C)NCC(O)=O TXHAHOVNFDVCCC-UHFFFAOYSA-N 0.000 description 1
- ZAQXSMCYFQJRCQ-UHFFFAOYSA-N 3-(1-adamantyl)-2-azaniumylpropanoate Chemical compound C1C(C2)CC3CC2CC1(CC(N)C(O)=O)C3 ZAQXSMCYFQJRCQ-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- 238000006376 Chugaev elimination reaction Methods 0.000 description 1
- OIFBSDVPJOWBCH-UHFFFAOYSA-N Diethyl carbonate Chemical compound CCOC(=O)OCC OIFBSDVPJOWBCH-UHFFFAOYSA-N 0.000 description 1
- PMMYEEVYMWASQN-DMTCNVIQSA-N Hydroxyproline Chemical compound O[C@H]1CN[C@H](C(O)=O)C1 PMMYEEVYMWASQN-DMTCNVIQSA-N 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- BZLVMXJERCGZMT-UHFFFAOYSA-N Methyl tert-butyl ether Chemical compound COC(C)(C)C BZLVMXJERCGZMT-UHFFFAOYSA-N 0.000 description 1
- 239000005922 Phosphane Substances 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- 229940122388 Thrombin inhibitor Drugs 0.000 description 1
- HOBWAPHTEJGALG-JKCMADFCSA-N [(1r,5s)-8-methyl-8-azoniabicyclo[3.2.1]octan-3-yl] 3-hydroxy-2-phenylpropanoate;sulfate Chemical compound [O-]S([O-])(=O)=O.C([C@H]1CC[C@@H](C2)[NH+]1C)C2OC(=O)C(CO)C1=CC=CC=C1.C([C@H]1CC[C@@H](C2)[NH+]1C)C2OC(=O)C(CO)C1=CC=CC=C1 HOBWAPHTEJGALG-JKCMADFCSA-N 0.000 description 1
- 239000004480 active ingredient Substances 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 244000309464 bull Species 0.000 description 1
- QGJOPFRUJISHPQ-NJFSPNSNSA-N carbon disulfide-14c Chemical compound S=[14C]=S QGJOPFRUJISHPQ-NJFSPNSNSA-N 0.000 description 1
- 230000021523 carboxylation Effects 0.000 description 1
- 238000006473 carboxylation reaction Methods 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 231100000481 chemical toxicant Toxicity 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 230000005595 deprotonation Effects 0.000 description 1
- 238000010537 deprotonation reaction Methods 0.000 description 1
- 238000004821 distillation Methods 0.000 description 1
- GUVUOGQBMYCBQP-UHFFFAOYSA-N dmpu Chemical compound CN1CCCN(C)C1=O GUVUOGQBMYCBQP-UHFFFAOYSA-N 0.000 description 1
- 239000000975 dye Substances 0.000 description 1
- 230000008030 elimination Effects 0.000 description 1
- 238000003379 elimination reaction Methods 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000004128 high performance liquid chromatography Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 238000007037 hydroformylation reaction Methods 0.000 description 1
- 229910000043 hydrogen iodide Inorganic materials 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 150000002641 lithium Chemical group 0.000 description 1
- AFRJJFRNGGLMDW-UHFFFAOYSA-N lithium amide Chemical class [Li+].[NH2-] AFRJJFRNGGLMDW-UHFFFAOYSA-N 0.000 description 1
- 238000005649 metathesis reaction Methods 0.000 description 1
- VCXZJBRVEJBECK-UHFFFAOYSA-N methyl 2,5-dihydropyrrole-1-carboxylate Chemical class COC(=O)N1CC=CC1 VCXZJBRVEJBECK-UHFFFAOYSA-N 0.000 description 1
- XKLJHFLUAHKGGU-UHFFFAOYSA-N nitrous amide Chemical class ON=N XKLJHFLUAHKGGU-UHFFFAOYSA-N 0.000 description 1
- 239000000816 peptidomimetic Substances 0.000 description 1
- 239000000575 pesticide Substances 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229910000064 phosphane Inorganic materials 0.000 description 1
- 150000003147 proline derivatives Chemical class 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- FDDQRDMHICUGQC-UHFFFAOYSA-N pyrrole-1-carboxylic acid Chemical compound OC(=O)N1C=CC=C1 FDDQRDMHICUGQC-UHFFFAOYSA-N 0.000 description 1
- 150000003233 pyrroles Chemical class 0.000 description 1
- 150000003236 pyrrolines Chemical class 0.000 description 1
- ZIJTYIRGFVHPHZ-UHFFFAOYSA-N selenium oxide(seo) Chemical class [Se]=O ZIJTYIRGFVHPHZ-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical class [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 1
- 125000004436 sodium atom Chemical group 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- 238000001149 thermolysis Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 239000003868 thrombin inhibitor Substances 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 231100000167 toxic agent Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
- 239000003440 toxic substance Substances 0.000 description 1
- 231100000419 toxicity Toxicity 0.000 description 1
- 230000001988 toxicity Effects 0.000 description 1
- FGMPLJWBKKVCDB-UHFFFAOYSA-N trans-L-hydroxy-proline Natural products ON1CCCC1C(O)=O FGMPLJWBKKVCDB-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/72—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with hetero atoms or with carbon atoms having three bonds to hetero atoms, with at the most one bond to halogen, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/68—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D211/70—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/18—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member
- C07D207/20—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having one double bond between ring members or between a ring member and a non-ring member with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pyrrole Compounds (AREA)
- Peptides Or Proteins (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19913699A DE19913699A1 (de) | 1999-03-26 | 1999-03-26 | Verfahren zur Herstellung von 3,4-Dihydroprolinen und 3,4-Dehydropiperidinen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HUP0200420A2 true HUP0200420A2 (hu) | 2002-05-29 |
Family
ID=7902464
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU0200420A HUP0200420A2 (hu) | 1999-03-26 | 2000-03-17 | Eljárás 3,4-dehidroprolin- és 3,4-dehidropiperidin-származékok előállítására |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US6579971B1 (https=) |
| EP (1) | EP1165509B1 (https=) |
| JP (1) | JP3868210B2 (https=) |
| KR (1) | KR20010104730A (https=) |
| CN (1) | CN1345310A (https=) |
| AT (1) | ATE278665T1 (https=) |
| AU (1) | AU3962500A (https=) |
| BR (1) | BR0009330A (https=) |
| CA (1) | CA2368479C (https=) |
| CZ (1) | CZ20013456A3 (https=) |
| DE (2) | DE19913699A1 (https=) |
| ES (1) | ES2230088T3 (https=) |
| HK (1) | HK1045156A1 (https=) |
| HU (1) | HUP0200420A2 (https=) |
| IL (1) | IL145525A0 (https=) |
| MX (1) | MXPA01009679A (https=) |
| NO (1) | NO20014645L (https=) |
| RU (1) | RU2001129097A (https=) |
| TR (1) | TR200102747T2 (https=) |
| TW (1) | TWI276626B (https=) |
| WO (1) | WO2000058284A1 (https=) |
| ZA (1) | ZA200107629B (https=) |
Families Citing this family (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CN100396666C (zh) * | 2005-12-14 | 2008-06-25 | 郑州大学 | (4s)-1-叔丁氧羰基-4-氨基-l-脯氨酸乙酯及其合成工艺 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4291040A (en) * | 1979-10-22 | 1981-09-22 | E. R. Squibb & Sons, Inc. | Mercaptoacyl derivatives of 4-disubstituted prolines and 4-substituted dehydroprolines |
| US5580575A (en) | 1989-12-22 | 1996-12-03 | Imarx Pharmaceutical Corp. | Therapeutic drug delivery systems |
| AU7655194A (en) | 1993-09-09 | 1995-03-27 | Schering Aktiengesellschaft | Active principles and gas containing microparticles |
| DE19630082A1 (de) * | 1996-07-26 | 1998-01-29 | Basf Ag | Verfahren zur Herstellung von 3-Pyrrolin-2-carbonsäure-Derivaten |
| US6090800A (en) | 1997-05-06 | 2000-07-18 | Imarx Pharmaceutical Corp. | Lipid soluble steroid prodrugs |
| DE19723473A1 (de) * | 1997-06-04 | 1998-12-10 | Basf Ag | Verfahren zur Herstellung von chiralen 3,4-Didehydroprolinen |
| JP4772958B2 (ja) | 1998-02-09 | 2011-09-14 | ブラッコ・リサーチ・ソシエテ・アノニム | 生物学的に活性な媒質の標的に向けた送達 |
-
1999
- 1999-03-26 DE DE19913699A patent/DE19913699A1/de not_active Withdrawn
-
2000
- 2000-03-09 TW TW089104251A patent/TWI276626B/zh not_active IP Right Cessation
- 2000-03-17 MX MXPA01009679A patent/MXPA01009679A/es unknown
- 2000-03-17 CA CA002368479A patent/CA2368479C/en not_active Expired - Fee Related
- 2000-03-17 EP EP00918809A patent/EP1165509B1/de not_active Expired - Lifetime
- 2000-03-17 AU AU39625/00A patent/AU3962500A/en not_active Abandoned
- 2000-03-17 HK HK02106153.8A patent/HK1045156A1/zh unknown
- 2000-03-17 BR BR0009330-0A patent/BR0009330A/pt not_active IP Right Cessation
- 2000-03-17 KR KR1020017012187A patent/KR20010104730A/ko not_active Abandoned
- 2000-03-17 CZ CZ20013456A patent/CZ20013456A3/cs unknown
- 2000-03-17 ES ES00918809T patent/ES2230088T3/es not_active Expired - Lifetime
- 2000-03-17 US US09/937,312 patent/US6579971B1/en not_active Expired - Lifetime
- 2000-03-17 HU HU0200420A patent/HUP0200420A2/hu unknown
- 2000-03-17 RU RU2001129097/04A patent/RU2001129097A/ru unknown
- 2000-03-17 CN CN00805579A patent/CN1345310A/zh active Pending
- 2000-03-17 IL IL14552599A patent/IL145525A0/xx unknown
- 2000-03-17 JP JP2000607987A patent/JP3868210B2/ja not_active Expired - Fee Related
- 2000-03-17 DE DE50008117T patent/DE50008117D1/de not_active Expired - Fee Related
- 2000-03-17 WO PCT/EP2000/002377 patent/WO2000058284A1/de not_active Ceased
- 2000-03-17 AT AT00918809T patent/ATE278665T1/de not_active IP Right Cessation
- 2000-03-17 TR TR2001/02747T patent/TR200102747T2/xx unknown
-
2001
- 2001-09-17 ZA ZA200107629A patent/ZA200107629B/en unknown
- 2001-09-25 NO NO20014645A patent/NO20014645L/no unknown
Also Published As
| Publication number | Publication date |
|---|---|
| NO20014645D0 (no) | 2001-09-25 |
| CA2368479A1 (en) | 2000-10-05 |
| ZA200107629B (en) | 2002-09-17 |
| BR0009330A (pt) | 2002-01-08 |
| WO2000058284A1 (de) | 2000-10-05 |
| KR20010104730A (ko) | 2001-11-26 |
| MXPA01009679A (es) | 2002-03-14 |
| EP1165509A1 (de) | 2002-01-02 |
| DE50008117D1 (de) | 2004-11-11 |
| DE19913699A1 (de) | 2000-09-28 |
| TR200102747T2 (tr) | 2002-02-21 |
| JP3868210B2 (ja) | 2007-01-17 |
| US6579971B1 (en) | 2003-06-17 |
| RU2001129097A (ru) | 2004-03-20 |
| CN1345310A (zh) | 2002-04-17 |
| AU3962500A (en) | 2000-10-16 |
| EP1165509B1 (de) | 2004-10-06 |
| JP2002540190A (ja) | 2002-11-26 |
| TWI276626B (en) | 2007-03-21 |
| NO20014645L (no) | 2001-09-25 |
| CZ20013456A3 (cs) | 2002-05-15 |
| HK1045156A1 (zh) | 2002-11-15 |
| ES2230088T3 (es) | 2005-05-01 |
| CA2368479C (en) | 2005-03-01 |
| IL145525A0 (en) | 2002-06-30 |
| ATE278665T1 (de) | 2004-10-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1124725A (en) | Alkanoyl-thio-acyl derivatives of dehydrocyclicimino acids | |
| EP0082088B1 (fr) | Nouveaux dérivés d'aminoacides, et leur application thérapeutique | |
| CA2339273C (en) | Branched alkyl pyrrolidine-3-carboxylic acids | |
| EP0877737B1 (fr) | Nouveaux derives de n-(arylsulfonyl)aminoacides ayant une affinite pour les recepteurs de la bradykinine | |
| CA1246056A (en) | Anti-hypertensive agents | |
| CA1244041A (en) | Process for the preparation of cis, endo- octahydrocyclopenta¬b|pyrrole-2-carboxylate | |
| DE2801911A1 (de) | (acyl-)-mercaptoacylaminosaeurederivate, verfahren zu deren herstellung und ihre verwendung bei der bekaempfung von durch angiotensin bedingtem hochdruck | |
| CZ4994A3 (en) | Pyrrolidine derivatives, process of their preparation and medicaments in which said derivatives are comprised | |
| FI90773C (fi) | Bisyklisten aminokarboksyylihappojen johdannaiset, menetelmä niiden valmistamiseksi ja niiden valmistuksessa käytettävät välituotteet, sekä niiden käyttö | |
| IE49123B1 (en) | (1,4)thiazines or thiazepines | |
| US5770732A (en) | Pyrrolinone-based peptidomimetics | |
| AU716319B2 (en) | The preparation of 3-pyrroline-2-carboxylic acid derivatives | |
| HUP0200420A2 (hu) | Eljárás 3,4-dehidroprolin- és 3,4-dehidropiperidin-származékok előállítására | |
| CH639370A5 (fr) | Acides mercaptoacylamines halogenes et procede pour leur preparation. | |
| US5514814A (en) | Pyrrolinone-based compounds | |
| CH653017A5 (fr) | Derives s-acyles d'acides mercaptoacylamines ayant une activite inhibitrice de l'enzyme de conversion de l'angiotensine. | |
| IE48497B1 (en) | Derivatives of pyrrolidinecarboxaldehyde and piperidinecarboxaldehyde and intermediates therefor | |
| NZ213317A (en) | Amino acid derivatives and pharmaceutical compositions | |
| HU214581B (hu) | N2-(1S)-(1-/Etoxi-karbonil/-3-fenil-propil)-N6-(trifluor-acetil)-(L)-lizil-(L)-prolin-benzil-észter és eljárás előállítására | |
| EP0771792A1 (de) | Verfahren zur Herstellung von (4,5)-trans-Oxazolidin-derivaten | |
| AU748779B2 (en) | The preparation of 3-pyroline-2-carboxylic acid amine derivatives | |
| KR100225459B1 (ko) | 술포닐발린계 펩타이드 화합물의 제조방법 | |
| SE426698B (sv) | Nya terapeutiskt aktiva derivat av 3,4-dehydroprolin | |
| IE50531B1 (en) | Mercaptoacyl derivatives of keto substituted proline and pipecolic acid |