HU189226B - Process for producing basic oxime-ethers - Google Patents
Process for producing basic oxime-ethers Download PDFInfo
- Publication number
- HU189226B HU189226B HU83415A HU41583A HU189226B HU 189226 B HU189226 B HU 189226B HU 83415 A HU83415 A HU 83415A HU 41583 A HU41583 A HU 41583A HU 189226 B HU189226 B HU 189226B
- Authority
- HU
- Hungary
- Prior art keywords
- reaction
- oxime
- formula
- carried out
- mol
- Prior art date
Links
- 238000000034 method Methods 0.000 title claims abstract description 34
- 229910052757 nitrogen Inorganic materials 0.000 claims abstract description 31
- -1 oxime ethers Chemical class 0.000 claims abstract description 27
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 21
- 150000001875 compounds Chemical class 0.000 claims abstract description 18
- 150000003839 salts Chemical class 0.000 claims abstract description 16
- 239000002253 acid Substances 0.000 claims abstract description 14
- 150000002923 oximes Chemical class 0.000 claims abstract description 13
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 12
- 239000004215 Carbon black (E152) Substances 0.000 claims abstract description 9
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 9
- 229930195733 hydrocarbon Natural products 0.000 claims abstract description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims abstract description 9
- 150000002430 hydrocarbons Chemical class 0.000 claims abstract description 8
- 239000001257 hydrogen Substances 0.000 claims abstract description 8
- 238000002360 preparation method Methods 0.000 claims abstract description 8
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 7
- 150000001340 alkali metals Chemical class 0.000 claims abstract description 7
- 125000003118 aryl group Chemical group 0.000 claims abstract description 7
- 125000005843 halogen group Chemical group 0.000 claims abstract description 5
- 125000004433 nitrogen atom Chemical group N* 0.000 claims abstract description 5
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 5
- 239000001301 oxygen Substances 0.000 claims abstract description 5
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 4
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 45
- 238000006243 chemical reaction Methods 0.000 claims description 25
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims description 18
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical group [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 claims description 16
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 claims description 9
- 239000008096 xylene Substances 0.000 claims description 9
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 7
- DMEGYFMYUHOHGS-UHFFFAOYSA-N cycloheptane Chemical compound C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 claims description 7
- 239000011541 reaction mixture Substances 0.000 claims description 7
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 claims description 5
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 4
- 229910052736 halogen Inorganic materials 0.000 claims description 4
- 150000002367 halogens Chemical class 0.000 claims description 4
- RXYQHVMJQFHKDX-UHFFFAOYSA-N 3-chloro-n,n-di(propan-2-yl)propan-1-amine Chemical compound CC(C)N(C(C)C)CCCCl RXYQHVMJQFHKDX-UHFFFAOYSA-N 0.000 claims description 3
- 238000009835 boiling Methods 0.000 claims description 3
- 150000002366 halogen compounds Chemical class 0.000 claims description 3
- 125000000623 heterocyclic group Chemical group 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 238000010438 heat treatment Methods 0.000 claims description 2
- DBVADBHSJCWFKI-UHFFFAOYSA-N n-(2-chloroethyl)-n-propan-2-ylpropan-2-amine Chemical compound CC(C)N(C(C)C)CCCl DBVADBHSJCWFKI-UHFFFAOYSA-N 0.000 claims description 2
- KGJPPTQTKGKOOY-UHFFFAOYSA-N n-(2-benzylidenecycloheptylidene)hydroxylamine Chemical compound ON=C1CCCCCC1=CC1=CC=CC=C1 KGJPPTQTKGKOOY-UHFFFAOYSA-N 0.000 claims 1
- 239000002904 solvent Substances 0.000 abstract description 5
- 125000002947 alkylene group Chemical group 0.000 abstract description 4
- MYMOFIZGZYHOMD-UHFFFAOYSA-N Dioxygen Chemical compound O=O MYMOFIZGZYHOMD-UHFFFAOYSA-N 0.000 abstract 1
- 150000004703 alkoxides Chemical class 0.000 abstract 1
- 239000000460 chlorine Substances 0.000 description 21
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 20
- 229910052801 chlorine Inorganic materials 0.000 description 11
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- GLUUGHFHXGJENI-UHFFFAOYSA-N diethylenediamine Natural products C1CNCCN1 GLUUGHFHXGJENI-UHFFFAOYSA-N 0.000 description 5
- BQCRDGOBIZRDJH-ACCUITESSA-N (2e)-2-benzylidenecycloheptan-1-one Chemical compound O=C1CCCCC\C1=C/C1=CC=CC=C1 BQCRDGOBIZRDJH-ACCUITESSA-N 0.000 description 4
- VCDPHYIZVFJQCD-ZRDIBKRKSA-N (2e)-2-benzylidenecyclohexan-1-one Chemical compound O=C1CCCC\C1=C/C1=CC=CC=C1 VCDPHYIZVFJQCD-ZRDIBKRKSA-N 0.000 description 4
- 239000007858 starting material Substances 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000004914 cyclooctane Substances 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 230000035484 reaction time Effects 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- VTVVPTRDNLXHFT-PKNBQFBNSA-N (2e)-2-[(4-chlorophenyl)methylidene]cyclohexan-1-one Chemical compound C1=CC(Cl)=CC=C1\C=C/1C(=O)CCCC\1 VTVVPTRDNLXHFT-PKNBQFBNSA-N 0.000 description 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 description 2
- WQMAANNAZKNUDL-UHFFFAOYSA-N 2-dimethylaminoethyl chloride Chemical compound CN(C)CCCl WQMAANNAZKNUDL-UHFFFAOYSA-N 0.000 description 2
- LQLJZSJKRYTKTP-UHFFFAOYSA-N 2-dimethylaminoethyl chloride hydrochloride Chemical compound Cl.CN(C)CCCl LQLJZSJKRYTKTP-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 229960003750 ethyl chloride Drugs 0.000 description 2
- 239000002360 explosive Substances 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 150000007522 mineralic acids Chemical class 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 238000007086 side reaction Methods 0.000 description 2
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 2
- 229910000104 sodium hydride Inorganic materials 0.000 description 2
- 239000012312 sodium hydride Substances 0.000 description 2
- 238000005292 vacuum distillation Methods 0.000 description 2
- VTDQASDBYAELFK-FMIVXFBMSA-N (2e)-2-[(3-chlorophenyl)methylidene]cycloheptan-1-one Chemical compound ClC1=CC=CC(\C=C/2C(CCCCC\2)=O)=C1 VTDQASDBYAELFK-FMIVXFBMSA-N 0.000 description 1
- UHBAGVCCVHTJFI-DHZHZOJOSA-N (2e)-2-[(3-chlorophenyl)methylidene]cyclohexan-1-one Chemical compound ClC1=CC=CC(\C=C/2C(CCCC\2)=O)=C1 UHBAGVCCVHTJFI-DHZHZOJOSA-N 0.000 description 1
- ADVRWTWVDZKNFF-WYMLVPIESA-N (2e)-2-benzylidenecyclooctan-1-one Chemical compound O=C1CCCCCC\C1=C/C1=CC=CC=C1 ADVRWTWVDZKNFF-WYMLVPIESA-N 0.000 description 1
- BQCRDGOBIZRDJH-QBFSEMIESA-N (2z)-2-benzylidenecycloheptan-1-one Chemical compound O=C1CCCCC\C1=C\C1=CC=CC=C1 BQCRDGOBIZRDJH-QBFSEMIESA-N 0.000 description 1
- AUERUDPETOKUPT-UHFFFAOYSA-N 1-(3-chloropropyl)-4-methylpiperazine Chemical compound CN1CCN(CCCCl)CC1 AUERUDPETOKUPT-UHFFFAOYSA-N 0.000 description 1
- PZPFCXFBXLZYMQ-UHFFFAOYSA-N 1-benzyl-4-(3-chloropropyl)piperazine;dihydrochloride Chemical compound Cl.Cl.C1CN(CCCCl)CCN1CC1=CC=CC=C1 PZPFCXFBXLZYMQ-UHFFFAOYSA-N 0.000 description 1
- 125000004806 1-methylethylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- BQCRDGOBIZRDJH-UHFFFAOYSA-N 2-benzylidenecycloheptan-1-one Chemical compound O=C1CCCCCC1=CC1=CC=CC=C1 BQCRDGOBIZRDJH-UHFFFAOYSA-N 0.000 description 1
- XPUSSRPNEKRUOB-UHFFFAOYSA-N 2-chloroethanamine;hydrobromide Chemical compound Br.NCCCl XPUSSRPNEKRUOB-UHFFFAOYSA-N 0.000 description 1
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 1
- RAGSWDIQBBZLLL-UHFFFAOYSA-N 2-chloroethyl(diethyl)azanium;chloride Chemical compound Cl.CCN(CC)CCCl RAGSWDIQBBZLLL-UHFFFAOYSA-N 0.000 description 1
- NYYRRBOMNHUCLB-UHFFFAOYSA-N 3-chloro-n,n-dimethylpropan-1-amine Chemical compound CN(C)CCCCl NYYRRBOMNHUCLB-UHFFFAOYSA-N 0.000 description 1
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- WLJWJNVRHSXTIL-LNZAWAQUSA-N C1(=CC=CC=C1)\C=C/1\C(\CCCCC1)=N\OCCCN1CCN(CC1)C Chemical compound C1(=CC=CC=C1)\C=C/1\C(\CCCCC1)=N\OCCCN1CCN(CC1)C WLJWJNVRHSXTIL-LNZAWAQUSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- OTMSDBZUPAUEDD-UHFFFAOYSA-N Ethane Chemical compound CC OTMSDBZUPAUEDD-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical class Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- GHVZOJONCUEWAV-UHFFFAOYSA-N [K].CCO Chemical compound [K].CCO GHVZOJONCUEWAV-UHFFFAOYSA-N 0.000 description 1
- 150000001242 acetic acid derivatives Chemical class 0.000 description 1
- 230000002378 acidificating effect Effects 0.000 description 1
- 230000001476 alcoholic effect Effects 0.000 description 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- 230000003444 anaesthetic effect Effects 0.000 description 1
- 230000001430 anti-depressive effect Effects 0.000 description 1
- 230000000648 anti-parkinson Effects 0.000 description 1
- 239000000935 antidepressant agent Substances 0.000 description 1
- 229940005513 antidepressants Drugs 0.000 description 1
- 239000000939 antiparkinson agent Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 238000006471 dimerization reaction Methods 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-OWOJBTEDSA-L fumarate(2-) Chemical class [O-]C(=O)\C=C\C([O-])=O VZCYOOQTPOCHFL-OWOJBTEDSA-L 0.000 description 1
- 150000003840 hydrochlorides Chemical class 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 238000006317 isomerization reaction Methods 0.000 description 1
- 125000003253 isopropoxy group Chemical group [H]C([H])([H])C([H])(O*)C([H])([H])[H] 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000003893 lactate salts Chemical class 0.000 description 1
- 239000003589 local anesthetic agent Substances 0.000 description 1
- 150000002688 maleic acid derivatives Chemical class 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- SNMVRZFUUCLYTO-UHFFFAOYSA-N n-propyl chloride Chemical compound CCCCl SNMVRZFUUCLYTO-UHFFFAOYSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 235000005985 organic acids Nutrition 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- 238000006116 polymerization reaction Methods 0.000 description 1
- BDAWXSQJJCIFIK-UHFFFAOYSA-N potassium methoxide Chemical compound [K+].[O-]C BDAWXSQJJCIFIK-UHFFFAOYSA-N 0.000 description 1
- LPNYRYFBWFDTMA-UHFFFAOYSA-N potassium tert-butoxide Chemical compound [K+].CC(C)(C)[O-] LPNYRYFBWFDTMA-UHFFFAOYSA-N 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/08—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms
- C07D295/084—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/088—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by singly bound oxygen or sulfur atoms with the ring nitrogen atoms and the oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU83415A HU189226B (en) | 1983-02-08 | 1983-02-08 | Process for producing basic oxime-ethers |
| CH480/84A CH659063A5 (de) | 1983-02-08 | 1984-02-02 | Verfahren zur herstellung von basischen oximaethern. |
| BE1/010951A BE898834A (fr) | 1983-02-08 | 1984-02-03 | Procede pour la preparation d'oxime ethers basiques |
| IT19469/84A IT1196016B (it) | 1983-02-08 | 1984-02-07 | Procedimento per la preparazione di eteri ossimici basici |
| FR8401832A FR2540492B1 (fr) | 1983-02-08 | 1984-02-07 | Procede pour la preparation d'oxime ethers basiques |
| GB08403234A GB2135994B (en) | 1983-02-08 | 1984-02-07 | Process for the preparation of basic oxime ethers |
| AT0038784A AT385508B (de) | 1983-02-08 | 1984-02-07 | Verfahren zur herstellung von basischen oximaethern und deren salzen |
| SU843703074A SU1299502A3 (ru) | 1983-02-08 | 1984-02-08 | Способ получени @ -алкилоксимов или их солей |
| DE19843404424 DE3404424A1 (de) | 1983-02-08 | 1984-02-08 | Verfahren zur herstellung von basischen oximaethern |
| ES529566A ES529566A0 (es) | 1983-02-08 | 1984-02-08 | Procedimiento de preparacion de eteres oximas basicos y de sus sales de adicion acidas |
| JP59021514A JPS59172453A (ja) | 1983-02-08 | 1984-02-08 | 塩基性オキシムエ−テルの製造方法 |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HU83415A HU189226B (en) | 1983-02-08 | 1983-02-08 | Process for producing basic oxime-ethers |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| HU189226B true HU189226B (en) | 1986-06-30 |
Family
ID=10949516
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| HU83415A HU189226B (en) | 1983-02-08 | 1983-02-08 | Process for producing basic oxime-ethers |
Country Status (11)
| Country | Link |
|---|---|
| JP (1) | JPS59172453A (de) |
| AT (1) | AT385508B (de) |
| BE (1) | BE898834A (de) |
| CH (1) | CH659063A5 (de) |
| DE (1) | DE3404424A1 (de) |
| ES (1) | ES529566A0 (de) |
| FR (1) | FR2540492B1 (de) |
| GB (1) | GB2135994B (de) |
| HU (1) | HU189226B (de) |
| IT (1) | IT1196016B (de) |
| SU (1) | SU1299502A3 (de) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| HU197205B (en) * | 1984-07-10 | 1989-03-28 | Egyt Gyogyszervegyeszeti Gyar | Process for production of medical compositions against angine |
| HU202195B (en) * | 1987-12-31 | 1991-02-28 | Egyt Gyogyszervegyeszeti Gyar | Process for producing new substituted styrene derivatives and medical compositions comprising such compounds |
| US5180736A (en) * | 1989-03-23 | 1993-01-19 | Warner-Lambert Company | Polycyclic amines useful as cerebrovascular agents |
| US5071853A (en) * | 1989-03-23 | 1991-12-10 | Bigge Christopher F | Polycyclic amines useful as cerebrovascular agents |
| HU212415B (en) * | 1989-08-25 | 1996-06-28 | Egyt Gyogyszervegyeszeti Gyar | Process for producing new cyclic oxym derivatives and pharmaceutical compositions containing them as active components |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1493222A (en) * | 1976-01-27 | 1977-11-30 | Egyt Gyogyszervegyeszeti Gyar | Cycloalkanone oxime ethers and process for the preparation thereof |
| US4083978A (en) * | 1976-01-27 | 1978-04-11 | Egyt Gyogyszervegyeszeti Gyar | Oxime ethers |
| HU178518B (en) * | 1978-12-19 | 1982-05-28 | Egyt Gyogyszervegyeszeti Gyar | Process for preparing cyclododekanone oxime ethers |
-
1983
- 1983-02-08 HU HU83415A patent/HU189226B/hu not_active IP Right Cessation
-
1984
- 1984-02-02 CH CH480/84A patent/CH659063A5/de not_active IP Right Cessation
- 1984-02-03 BE BE1/010951A patent/BE898834A/fr not_active IP Right Cessation
- 1984-02-07 GB GB08403234A patent/GB2135994B/en not_active Expired
- 1984-02-07 FR FR8401832A patent/FR2540492B1/fr not_active Expired
- 1984-02-07 AT AT0038784A patent/AT385508B/de not_active IP Right Cessation
- 1984-02-07 IT IT19469/84A patent/IT1196016B/it active
- 1984-02-08 SU SU843703074A patent/SU1299502A3/ru active
- 1984-02-08 DE DE19843404424 patent/DE3404424A1/de not_active Withdrawn
- 1984-02-08 JP JP59021514A patent/JPS59172453A/ja active Pending
- 1984-02-08 ES ES529566A patent/ES529566A0/es active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FR2540492A1 (fr) | 1984-08-10 |
| DE3404424A1 (de) | 1984-08-16 |
| SU1299502A3 (ru) | 1987-03-23 |
| IT8419469A0 (it) | 1984-02-07 |
| JPS59172453A (ja) | 1984-09-29 |
| BE898834A (fr) | 1984-08-03 |
| GB2135994A (en) | 1984-09-12 |
| GB2135994B (en) | 1986-08-20 |
| GB8403234D0 (en) | 1984-03-14 |
| AT385508B (de) | 1988-04-11 |
| IT1196016B (it) | 1988-11-10 |
| ATA38784A (de) | 1987-09-15 |
| FR2540492B1 (fr) | 1988-02-19 |
| CH659063A5 (de) | 1986-12-31 |
| ES8506605A1 (es) | 1985-08-01 |
| ES529566A0 (es) | 1985-08-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IE46278B1 (en) | Piperazine derivatives | |
| JPH04270257A (ja) | 尿素類のｎ−アルキル化法 | |
| HU189226B (en) | Process for producing basic oxime-ethers | |
| CA1326484C (en) | Substituted styrene derivatives | |
| US4249003A (en) | Process for polycyclic amines | |
| EP0017217B1 (de) | Diphenylalkanäther- und Diphenylalkanonoximäther-Derivate, Verfahren zu ihrer Herstellung, pharmazeutische Zusammensetzungen und ihre Verwendung | |
| US4064347A (en) | Bis-basic ketones of fluorene and fluorenone | |
| US3355457A (en) | Substituted 2-imidazolinones | |
| US4208410A (en) | Dibenzo[d,g][1,3,6]dioxazocine derivatives | |
| US3159634A (en) | New aminoalkylindenes and aminoalkyl indanyl ethers | |
| NO793473L (no) | Fremgangsmaate til fremstilling av terapeutisk virksomme fenylalkylaminer | |
| HU189227B (en) | Process for preparing basic oxime-ethers | |
| US3671544A (en) | 3,4,4a,9a-tetrahydro-2-(1h)carbazolones | |
| US3709938A (en) | 2,6-dihalo-m-substituted-benzoic acid amides | |
| US3668206A (en) | Heterocyclic amine derivatives of 5,8-dihydronaphthyloxy propanols | |
| US4831132A (en) | Ortho-mono-substituted amino)phenylimines | |
| HU219493B (hu) | Alkil-trazodon-származékok előállítására alkalmazható piperazinszármazékok és eljárás előállításukra | |
| SE435507B (sv) | Forfarande for framstellning av trimetoxifenoxi-propyl-piperezinderivat | |
| US2947747A (en) | Trifluoromethyl substituted phenoxazines | |
| EP0099017A2 (de) | Neue Phenylessigsäure-Derivate, ihre Herstellung und diese Verbindungen enthaltende Arzneimittel | |
| Mathapati et al. | Synthesis of Some New N-Mannich Bases Derivatives of Phenytoin | |
| HU188250B (en) | Process for producing of basical oxim-ethers | |
| US2740795A (en) | Isoindolineicompounds | |
| US4002611A (en) | Preparation of benzodiazepines | |
| IL24146A (en) | Substituted 3,4-dihydro-2-benzothiopyrans and a process for their production |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| HU90 | Patent valid on 900628 | ||
| HMM4 | Cancellation of final prot. due to non-payment of fee |