GB940573A - Electrophotographic material - Google Patents
Electrophotographic materialInfo
- Publication number
- GB940573A GB940573A GB11436/60A GB1143660A GB940573A GB 940573 A GB940573 A GB 940573A GB 11436/60 A GB11436/60 A GB 11436/60A GB 1143660 A GB1143660 A GB 1143660A GB 940573 A GB940573 A GB 940573A
- Authority
- GB
- United Kingdom
- Prior art keywords
- phenyl
- methylenedioxyphenyl
- aryl
- chlorophenyl
- methoxyphenyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 p-dimethylaminophenyl Chemical group 0.000 abstract 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 4
- 125000004172 4-methoxyphenyl group Chemical group [H]C1=C([H])C(OC([H])([H])[H])=C([H])C([H])=C1* 0.000 abstract 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 abstract 3
- 125000003118 aryl group Chemical group 0.000 abstract 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 abstract 3
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 abstract 2
- 125000000217 alkyl group Chemical group 0.000 abstract 2
- JKTORXLUQLQJCM-UHFFFAOYSA-N 4-phosphonobutylphosphonic acid Chemical class OP(O)(=O)CCCCP(O)(O)=O JKTORXLUQLQJCM-UHFFFAOYSA-N 0.000 abstract 1
- 101100037762 Caenorhabditis elegans rnh-2 gene Proteins 0.000 abstract 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 abstract 1
- 235000000126 Styrax benzoin Nutrition 0.000 abstract 1
- 244000028419 Styrax benzoin Species 0.000 abstract 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 abstract 1
- 235000008411 Sumatra benzointree Nutrition 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 150000001351 alkyl iodides Chemical class 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 235000019382 gum benzoic Nutrition 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 238000010438 heat treatment Methods 0.000 abstract 1
- JZMJDSHXVKJFKW-UHFFFAOYSA-M methyl sulfate(1-) Chemical compound COS([O-])(=O)=O JZMJDSHXVKJFKW-UHFFFAOYSA-M 0.000 abstract 1
- 229910052760 oxygen Inorganic materials 0.000 abstract 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 abstract 1
- 229910052698 phosphorus Inorganic materials 0.000 abstract 1
- 239000011574 phosphorus Substances 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- 229910052717 sulfur Inorganic materials 0.000 abstract 1
- 239000001117 sulphuric acid Substances 0.000 abstract 1
- 235000011149 sulphuric acid Nutrition 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/323—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with only hydrogen atoms or radicals containing only hydrogen and carbon atoms directly attached to the ring nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/325—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/36—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D307/00—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom
- C07D307/02—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings
- C07D307/34—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D307/38—Heterocyclic compounds containing five-membered rings having one oxygen atom as the only ring hetero atom not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D307/52—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/08—Hydrogen atoms or radicals containing only hydrogen and carbon atoms
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03G—ELECTROGRAPHY; ELECTROPHOTOGRAPHY; MAGNETOGRAPHY
- G03G5/00—Recording members for original recording by exposure, e.g. to light, to heat, to electrons; Manufacture thereof; Selection of materials therefor
- G03G5/02—Charge-receiving layers
- G03G5/04—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor
- G03G5/06—Photoconductive layers; Charge-generation layers or charge-transporting layers; Additives therefor; Binders therefor characterised by the photoconductive material being organic
- G03G5/0622—Heterocyclic compounds
- G03G5/0624—Heterocyclic compounds containing one hetero ring
- G03G5/0627—Heterocyclic compounds containing one hetero ring being five-membered
- G03G5/0629—Heterocyclic compounds containing one hetero ring being five-membered containing one hetero atom
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Physics & Mathematics (AREA)
- General Physics & Mathematics (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Photoreceptors In Electrophotography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEK37423A DE1105714B (de) | 1959-04-08 | 1959-04-08 | Material fuer elektrophotographische Reproduktion |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB940573A true GB940573A (en) | 1963-10-30 |
Family
ID=7221012
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB11436/60A Expired GB940573A (en) | 1959-04-08 | 1960-03-31 | Electrophotographic material |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3174854A (enExample) |
| DE (1) | DE1105714B (enExample) |
| GB (1) | GB940573A (enExample) |
| LU (1) | LU38469A1 (enExample) |
| NL (2) | NL126228C (enExample) |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1250736B (enExample) * | 1962-10-13 | |||
| US3485625A (en) * | 1966-06-09 | 1969-12-23 | Eastman Kodak Co | Photoconductive elements containing 2,3,4,5-tetraaryl pyrrole |
| GB1258244A (enExample) * | 1968-06-10 | 1971-12-22 | ||
| US3655378A (en) * | 1971-03-01 | 1972-04-11 | Eastman Kodak Co | Charge-transfer complexes of dibenzofuran-formaldehyde or dibenzothiophene-formaldehyde resins as photoconductive materials |
| US3784376A (en) * | 1972-02-04 | 1974-01-08 | Eastman Kodak Co | Photoconductive element containing furans, indoles, or thiophenes |
| US3765882A (en) * | 1972-08-07 | 1973-10-16 | Eastman Kodak Co | Heterocyclic photoconductor containing o, s or se |
| NL168059C (nl) * | 1972-09-15 | 1982-02-16 | Oce Van Der Grinten Nv | Elektrofotografisch donor-acceptor complex bevattend reproduktie-element, en werkwijze ter bereiding van een fotogeleidend preparaat. |
| JPS56156832A (en) * | 1980-05-08 | 1981-12-03 | Fuji Photo Film Co Ltd | Photoconductive composition and electrophotographic sensitive material using it |
| US5089365A (en) * | 1987-10-07 | 1992-02-18 | Fuji Electric Co., Ltd. | Photosensitive member for electrophotography with thiophene containing moiety on charge transport compound |
| JPH027061A (ja) * | 1988-06-27 | 1990-01-11 | Fuji Electric Co Ltd | 電子写真用感光体 |
| US5275898A (en) * | 1989-06-06 | 1994-01-04 | Fuji Electric Co., Ltd. | Bisazo photoconductor for electrophotography |
| US5132189A (en) * | 1989-09-07 | 1992-07-21 | Fuji Electric Co., Ltd. | Photoconductor for electrophotography |
| US5316881A (en) * | 1991-12-27 | 1994-05-31 | Fuji Electric Co., Ltd. | Photoconductor for electrophotgraphy containing benzidine derivative |
| JPH05224439A (ja) * | 1992-02-12 | 1993-09-03 | Fuji Electric Co Ltd | 電子写真用感光体 |
| JP2817822B2 (ja) * | 1992-05-14 | 1998-10-30 | 富士電機株式会社 | 電子写真用感光体 |
| US5906606A (en) * | 1995-12-04 | 1999-05-25 | Target Therapuetics, Inc. | Braided body balloon catheter |
| EP1928827B1 (en) * | 2005-09-27 | 2012-08-22 | Myriad Genetics, Inc. | Pyrrole derivatives as therapeutic compounds |
| EP1889617A1 (en) * | 2006-07-11 | 2008-02-20 | Freie Universität Berlin | Triphenyl modified 5-membered heterocycles and their use as anticancer and antiflammatory agents |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE332468A (enExample) * | 1922-11-18 | |||
| US2297691A (en) * | 1939-04-04 | 1942-10-06 | Chester F Carlson | Electrophotography |
| NL160533B (nl) * | 1950-05-19 | Apothekers Coop Vereen | Capsule kantelapparaat. | |
| US2852503A (en) * | 1953-12-31 | 1958-09-16 | American Cyanamid Co | 2, 5-bis (p-aminophenyl) furan azo derivatives |
| US2915534A (en) * | 1953-12-31 | 1959-12-01 | American Cyanamid Co | 2, 5-bis(rho-aminophenyl) furan derivatives |
| LU35237A1 (enExample) * | 1956-06-27 | |||
| NL218635A (enExample) * | 1956-07-04 | |||
| LU35567A1 (enExample) * | 1956-11-21 | |||
| DE1029229B (de) * | 1956-12-22 | 1958-04-30 | Agfa Ag | Photographischer Entwickler |
| US2954291A (en) * | 1957-01-04 | 1960-09-27 | Haloid Xerox Inc | Method for preparing a spirit duplicating master |
-
0
- LU LU38469D patent/LU38469A1/xx unknown
- NL NL250328D patent/NL250328A/xx unknown
- NL NL126228D patent/NL126228C/xx active
-
1959
- 1959-04-08 DE DEK37423A patent/DE1105714B/de active Pending
-
1960
- 1960-03-31 GB GB11436/60A patent/GB940573A/en not_active Expired
- 1960-04-06 US US20283A patent/US3174854A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| DE1105714B (de) | 1961-04-27 |
| NL250328A (enExample) | |
| US3174854A (en) | 1965-03-23 |
| NL126228C (enExample) | |
| LU38469A1 (enExample) |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB940573A (en) | Electrophotographic material | |
| GB1312536A (en) | Hydantoin derivatives | |
| ES8501754A1 (es) | "un metodo de preparacion de nuevas sulfonamidas sustituidas" nota: se solicita como divisional de la patente de invencion n 516.504. | |
| GB1133013A (en) | Process of preparing amides | |
| GB1078338A (en) | New alpha acylated acetamides and their use as photographic colour couplers | |
| GB965009A (en) | New 2,3-dimercapto-quinoxalines | |
| GB1111990A (en) | O,2'-anhydro-1-(ª‰-d-ribofuranosyl)-uracils | |
| GB982144A (en) | Antifoggants and stabilizers for photographic silver halide emulsions | |
| GB1031270A (en) | New anthraquinone dyes and their production | |
| SE7501375L (enExample) | ||
| GB925612A (en) | Process for stabilising aromatic polymers | |
| GB972966A (en) | A process for the manufacture of benzodiazepine derivatives | |
| GB1052567A (enExample) | ||
| GB1040166A (en) | Penicillins | |
| GB1251547A (enExample) | ||
| GB1393750A (en) | Bis-1,2,4-triazolyl 5- compounds and their use as optical brightening agents | |
| GB1226251A (enExample) | ||
| GB897488A (en) | New anthraquinone dyestuffs and process for their manufacture | |
| EP0122587A3 (en) | Process for preparing organic chlorophosphanes | |
| GB962734A (en) | A process for the production of acetoacetic acid amides | |
| GB1098598A (en) | Substituted n-tertiary-aminoalkyl-benzamides and their preparation | |
| GB1019779A (en) | Preparation of guanamines | |
| GB1111987A (en) | Ribonucleosides | |
| GB1022040A (en) | Process for the preparation of sulphonyl carbodiimides and of n-sulphonyl ureas | |
| GB1230473A (enExample) |