GB859345A - Process for the production of new aryl sulphonic acid arylamides - Google Patents
Process for the production of new aryl sulphonic acid arylamidesInfo
- Publication number
- GB859345A GB859345A GB28860/58A GB2886058A GB859345A GB 859345 A GB859345 A GB 859345A GB 28860/58 A GB28860/58 A GB 28860/58A GB 2886058 A GB2886058 A GB 2886058A GB 859345 A GB859345 A GB 859345A
- Authority
- GB
- United Kingdom
- Prior art keywords
- aryl
- trifluoromethyl
- sulphonic acid
- hal
- radicals
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- -1 aryl sulphonic acid Chemical compound 0.000 title abstract 17
- 238000000034 method Methods 0.000 title abstract 3
- 125000005843 halogen group Chemical group 0.000 abstract 3
- 229910052739 hydrogen Inorganic materials 0.000 abstract 3
- 239000001257 hydrogen Substances 0.000 abstract 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 3
- 150000003254 radicals Chemical class 0.000 abstract 3
- SUQWINLDJOTVAP-UHFFFAOYSA-N 4-chloro-3-(trifluoromethyl)benzenesulfonic acid Chemical compound OS(=O)(=O)C1=CC=C(Cl)C(C(F)(F)F)=C1 SUQWINLDJOTVAP-UHFFFAOYSA-N 0.000 abstract 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 abstract 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 abstract 2
- 150000001408 amides Chemical class 0.000 abstract 2
- 150000004982 aromatic amines Chemical class 0.000 abstract 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 abstract 2
- 229910052794 bromium Inorganic materials 0.000 abstract 2
- 229910052801 chlorine Inorganic materials 0.000 abstract 2
- 239000000460 chlorine Substances 0.000 abstract 2
- 239000012286 potassium permanganate Substances 0.000 abstract 2
- 239000000047 product Substances 0.000 abstract 2
- 125000001424 substituent group Chemical group 0.000 abstract 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 2
- RFFLAFLAYFXFSW-UHFFFAOYSA-N 1,2-dichlorobenzene Chemical compound ClC1=CC=CC=C1Cl RFFLAFLAYFXFSW-UHFFFAOYSA-N 0.000 abstract 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 abstract 1
- DGRVQOKCSKDWIH-UHFFFAOYSA-N 1-chloro-2-(trifluoromethyl)benzene Chemical compound FC(F)(F)C1=CC=CC=C1Cl DGRVQOKCSKDWIH-UHFFFAOYSA-N 0.000 abstract 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 abstract 1
- WZKSXHQDXQKIQJ-UHFFFAOYSA-N F[C](F)F Chemical compound F[C](F)F WZKSXHQDXQKIQJ-UHFFFAOYSA-N 0.000 abstract 1
- 241000238631 Hexapoda Species 0.000 abstract 1
- 102000011782 Keratins Human genes 0.000 abstract 1
- 108010076876 Keratins Proteins 0.000 abstract 1
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical group [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 abstract 1
- 239000003513 alkali Substances 0.000 abstract 1
- 229910052783 alkali metal Inorganic materials 0.000 abstract 1
- 239000012670 alkaline solution Substances 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 125000003368 amide group Chemical group 0.000 abstract 1
- 150000001412 amines Chemical class 0.000 abstract 1
- 239000007795 chemical reaction product Substances 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 abstract 1
- VAYGXNSJCAHWJZ-UHFFFAOYSA-N dimethyl sulfate Chemical compound COS(=O)(=O)OC VAYGXNSJCAHWJZ-UHFFFAOYSA-N 0.000 abstract 1
- WQYVRQLZKVEZGA-UHFFFAOYSA-N hypochlorite Chemical class Cl[O-] WQYVRQLZKVEZGA-UHFFFAOYSA-N 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 abstract 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 1
- 239000003960 organic solvent Substances 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/15—Sulfonamides having sulfur atoms of sulfonamide groups bound to carbon atoms of six-membered aromatic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH5034457 | 1957-09-10 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB859345A true GB859345A (en) | 1961-01-18 |
Family
ID=4517016
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB28860/58A Expired GB859345A (en) | 1957-09-10 | 1958-09-09 | Process for the production of new aryl sulphonic acid arylamides |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3034955A (enExample) |
| CH (2) | CH362688A (enExample) |
| DE (1) | DE1418217A1 (enExample) |
| GB (1) | GB859345A (enExample) |
| NL (1) | NL114027C (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1999010320A1 (en) * | 1997-08-22 | 1999-03-04 | Tularik Inc. | Substituted benzene compounds as antiproliferative and cholesterol lowering agents |
| US6153585A (en) * | 1998-07-20 | 2000-11-28 | Tularik Inc. | Arylsulfonanilide derivatives |
| US6211167B1 (en) | 1998-06-25 | 2001-04-03 | Tularik Inc. | Arylsulfonanilide phosphates |
| US6214880B1 (en) | 1998-09-23 | 2001-04-10 | Tularik Inc. | Arylsulfonanilide ureas |
| US6822001B2 (en) | 2000-11-03 | 2004-11-23 | Tularik Inc. | Combination therapy using pentafluorobenzenesulfonamides and antineoplastic agents |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| NL301745A (enExample) * | 1962-12-17 | |||
| US3284498A (en) * | 1964-01-07 | 1966-11-08 | Bristol Myers Co | Substituted benzene sulfonyl urea |
| US3505455A (en) * | 1966-12-15 | 1970-04-07 | Ansul Co | Nematocidal method |
| BE758231A (fr) * | 1969-10-29 | 1971-04-29 | Bayer Ag | Procede de preparation d'halogenures d'acides trihalomethylbenzene - sulfoniques |
| JPS58219159A (ja) * | 1982-06-16 | 1983-12-20 | Mitsui Toatsu Chem Inc | スルホンアミド系化合物 |
| JPS58118558A (ja) * | 1982-01-05 | 1983-07-14 | Mitsui Toatsu Chem Inc | ３−ニトロ−４−メチルベンゼンスルホン−２−クロル−４−ニトロアニライドと農園芸用殺菌剤 |
| NZ215272A (en) * | 1985-02-27 | 1989-08-29 | Mitsui Toatsu Chemicals | Fungicidal n-(2-chloro-4-nitrophenyl)-benzenesulphonamide derivatives and compositions thereof |
| US4692466A (en) * | 1985-02-28 | 1987-09-08 | Mitsui Toatsu Chemicals, Incorporated | N-(2-chloro-4-trifluoromethylphenyl)-3-trifluoromethylbenzenesulfonamide derivative and agricultural fungicide containing same |
| DE3626309A1 (de) * | 1986-08-02 | 1988-02-18 | Stockhausen Chem Fab Gmbh | Antivirusmittel |
| US5068427A (en) * | 1989-11-16 | 1991-11-26 | Atochem North America, Inc. | Process for the preparation of alkane- and arenesulfonamides |
| EP1334719A3 (en) | 1996-02-22 | 2003-09-24 | Tularik, Inc. | Pentafluorobenzenesulfonamides and analogs |
| US6482860B1 (en) * | 1996-07-19 | 2002-11-19 | Tularik Inc. | Pentafluorobenzenesulfonamides and analogs |
| EP1053227B1 (en) | 1998-01-29 | 2008-11-05 | Amgen Inc. | Ppar-gamma modulators |
| US6583157B2 (en) | 1998-01-29 | 2003-06-24 | Tularik Inc. | Quinolinyl and benzothiazolyl modulators |
| US7041691B1 (en) * | 1999-06-30 | 2006-05-09 | Amgen Inc. | Compounds for the modulation of PPARγ activity |
| DK1206256T3 (da) | 1999-07-29 | 2005-08-15 | Amgen Inc | Kombinationsbehandling under anvendelse af pentafluorbenzensulfonamid og platinforbindelse |
| AU6118001A (en) | 2000-05-03 | 2001-11-12 | Tularik Inc | Combination therapeutic compositions and methods of use |
| US20030171399A1 (en) * | 2000-06-28 | 2003-09-11 | Tularik Inc. | Quinolinyl and benzothiazolyl modulators |
| US20050250854A1 (en) * | 2000-11-03 | 2005-11-10 | Amgen Inc. | Combination therapy using pentafluorobenzenesulfonamides and antineoplastic agents |
| GB0215650D0 (en) * | 2002-07-05 | 2002-08-14 | Cyclacel Ltd | Bisarylsufonamide compounds |
| US7223761B2 (en) * | 2003-10-03 | 2007-05-29 | Amgen Inc. | Salts and polymorphs of a potent antidiabetic compound |
| US20050250820A1 (en) * | 2004-03-08 | 2005-11-10 | Amgen Inc. | Therapeutic modulation of PPARgamma activity |
| WO2021243319A1 (en) * | 2020-05-29 | 2021-12-02 | Novomedix, Llc | Biarylsulfonamides and pharmaceutical compositions thereof, and their use for treating fibrotic lung disease |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US800913A (en) * | 1904-09-30 | 1905-10-03 | Agfa Ag | Process of nitrating aromatic amins. |
| US1962276A (en) * | 1928-06-22 | 1934-06-12 | Ig Farbenindustrie Ag | Moth-protecting media |
| US2409883A (en) * | 1940-02-03 | 1946-10-22 | American Cyanamid Co | Resinous dibasic carboxylic acid salts of a guanidine as mothproofers |
| US2392733A (en) * | 1940-06-27 | 1946-01-08 | Du Pont | Mothproofing |
| US2435274A (en) * | 1943-06-24 | 1948-02-03 | Rohm & Haas | Control of insects |
| US2450777A (en) * | 1944-04-20 | 1948-10-05 | Eastman Kodak Co | Sulfamyl-2-mercaptobenzothiazoles |
| US2577256A (en) * | 1949-04-09 | 1951-12-04 | Wyandotte Chemicals Corp | Polyoxypropylene-benzenesulfonamides |
| BE510816A (enExample) * | 1951-04-21 | |||
| US2921945A (en) * | 1954-05-17 | 1960-01-19 | Celanese Corp | Yellow diphenylamine dyes |
| US2759019A (en) * | 1954-08-09 | 1956-08-14 | Minnesota Mining & Mfg | Perfluoro amine compounds and quaternary derivatives |
| US2867658A (en) * | 1956-05-18 | 1959-01-06 | Geigy Ag J R | Halo substituted sulfanilides |
| US2937202A (en) * | 1958-05-19 | 1960-05-17 | Dow Chemical Co | Substituted benzenesulfonanilides |
-
1957
- 1957-09-10 CH CH376462A patent/CH362688A/de unknown
- 1957-09-10 CH CH361275D patent/CH361275A/de unknown
-
1958
- 1958-09-08 US US759430A patent/US3034955A/en not_active Expired - Lifetime
- 1958-09-09 DE DE19581418217 patent/DE1418217A1/de active Pending
- 1958-09-09 NL NL231226A patent/NL114027C/xx active
- 1958-09-09 GB GB28860/58A patent/GB859345A/en not_active Expired
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1999010320A1 (en) * | 1997-08-22 | 1999-03-04 | Tularik Inc. | Substituted benzene compounds as antiproliferative and cholesterol lowering agents |
| AU748826B2 (en) * | 1997-08-22 | 2002-06-13 | Tularik Inc. | Substituted benzene compounds as antiproliferative and cholesterol lowering agents |
| US6211167B1 (en) | 1998-06-25 | 2001-04-03 | Tularik Inc. | Arylsulfonanilide phosphates |
| US6417176B2 (en) | 1998-06-25 | 2002-07-09 | Tularik, Inc. | Arylsulfonanilide phosphates |
| US6153585A (en) * | 1998-07-20 | 2000-11-28 | Tularik Inc. | Arylsulfonanilide derivatives |
| US6630513B1 (en) | 1998-07-20 | 2003-10-07 | Tularix Inc. | Arylsulfonanilide derivates |
| US6214880B1 (en) | 1998-09-23 | 2001-04-10 | Tularik Inc. | Arylsulfonanilide ureas |
| US6583165B2 (en) | 1998-09-23 | 2003-06-24 | Tularik Inc. | Arylsulfonanilide ureas |
| US7060718B2 (en) | 1998-09-23 | 2006-06-13 | Amgen Inc. | Arylsulfonanilide ureas |
| US6822001B2 (en) | 2000-11-03 | 2004-11-23 | Tularik Inc. | Combination therapy using pentafluorobenzenesulfonamides and antineoplastic agents |
Also Published As
| Publication number | Publication date |
|---|---|
| CH361275A (de) | 1962-04-15 |
| US3034955A (en) | 1962-05-15 |
| DE1418217A1 (de) | 1968-10-24 |
| NL114027C (enExample) | 1968-09-17 |
| CH362688A (de) | 1962-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB859345A (en) | Process for the production of new aryl sulphonic acid arylamides | |
| GB965009A (en) | New 2,3-dimercapto-quinoxalines | |
| GB1398201A (en) | N-sulphenylated carbamidoximes a process for their preparation and their fungicidal and bactericidal use | |
| US2844628A (en) | Perchloro-methyl-mercaptan derivatives and productions | |
| GB1207975A (en) | Hydroxyalkylene bis(acylamino-2,4,6-triiodobenzoic acid) derivatives for use as x-ray visualization agents | |
| GB1461729A (en) | 3-sulphonamidothiophenes having gungicidal activity | |
| GB1080806A (en) | Heterocyclic nitro-isobutyl compounds | |
| US2256959A (en) | Hypochlorite of quaternary ammonium hydroxide and production thereof | |
| GB884847A (en) | Mercapto compounds | |
| GB777544A (en) | Water soluble organic copper compounds and a process for their production | |
| GB808636A (en) | Basically substituted heterocyclic compounds | |
| GB844946A (en) | New 2-(n-substituted)-acylamino-1,3,4-thiadiazole-5-sulfonamides | |
| US2467893A (en) | Piperazine carboxamides and method of preparing same | |
| ES8502103A1 (es) | Procedimiento para la obtencion de amidas del acido piperazin-1-il-acetico substituido | |
| GB1011555A (en) | Process for the production of organic nitrogen compounds containing the imide-chloride group | |
| GB1011845A (en) | Heterocyclic propinyl thioethers | |
| GB1254928A (en) | beta-ALKOXYACRYLIC ACID AMIDES | |
| GB1383523A (en) | Diphenylamine derivatives and pesticidal compositions thereof | |
| GB773152A (en) | Improvements relating to bis-triazinylamino stilbene compounds and their use as optical brightening agents | |
| SU384827A1 (ru) | Способ получения диорганотиофосфорил- сульфениламидов | |
| Rakhmatullin et al. | Synthesis and properties of quaternary ammonium salts on the basis of piperidine | |
| US3367967A (en) | Treatment of sulfonamides | |
| GB1000662A (en) | Process for rendering cellulosic materials resistant to the attack of micro-organisms | |
| GB1082060A (en) | Aminopyrazinoic acids and their esters | |
| GB1063528A (en) | A process for the preparation of anilide derivatives |