GB787369A - Quaternary ammonium salts of benzthiazole azo dyestuffs - Google Patents
Quaternary ammonium salts of benzthiazole azo dyestuffsInfo
- Publication number
- GB787369A GB787369A GB35891/55A GB3589155A GB787369A GB 787369 A GB787369 A GB 787369A GB 35891/55 A GB35891/55 A GB 35891/55A GB 3589155 A GB3589155 A GB 3589155A GB 787369 A GB787369 A GB 787369A
- Authority
- GB
- United Kingdom
- Prior art keywords
- methyl
- ethyl
- alkyl
- methoxy
- benzyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- IOJUPLGTWVMSFF-UHFFFAOYSA-N cyclobenzothiazole Natural products C1=CC=C2SC=NC2=C1 IOJUPLGTWVMSFF-UHFFFAOYSA-N 0.000 title abstract 3
- 150000003242 quaternary ammonium salts Chemical class 0.000 title abstract 2
- -1 methoxy, ethoxy, phenoxy, benzyloxy Chemical group 0.000 abstract 10
- 125000001424 substituent group Chemical group 0.000 abstract 8
- 125000000217 alkyl group Chemical group 0.000 abstract 6
- 239000000975 dye Substances 0.000 abstract 6
- 150000003839 salts Chemical class 0.000 abstract 6
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 5
- 229940100198 alkylating agent Drugs 0.000 abstract 4
- 239000002168 alkylating agent Substances 0.000 abstract 4
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 abstract 4
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 4
- UHGULLIUJBCTEF-UHFFFAOYSA-N 2-aminobenzothiazole Chemical class C1=CC=C2SC(N)=NC2=C1 UHGULLIUJBCTEF-UHFFFAOYSA-N 0.000 abstract 3
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 abstract 3
- 239000002253 acid Substances 0.000 abstract 3
- 125000003545 alkoxy group Chemical group 0.000 abstract 3
- 230000029936 alkylation Effects 0.000 abstract 3
- 238000005804 alkylation reaction Methods 0.000 abstract 3
- 125000003277 amino group Chemical group 0.000 abstract 3
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 abstract 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 abstract 3
- 229910052736 halogen Inorganic materials 0.000 abstract 3
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 abstract 2
- 125000004442 acylamino group Chemical group 0.000 abstract 2
- 125000001931 aliphatic group Chemical group 0.000 abstract 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 abstract 2
- 150000001450 anions Chemical group 0.000 abstract 2
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 abstract 2
- 150000001768 cations Chemical class 0.000 abstract 2
- 230000008878 coupling Effects 0.000 abstract 2
- 238000010168 coupling process Methods 0.000 abstract 2
- 238000005859 coupling reaction Methods 0.000 abstract 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 abstract 2
- 125000001033 ether group Chemical group 0.000 abstract 2
- 150000002367 halogens Chemical class 0.000 abstract 2
- 229930195733 hydrocarbon Natural products 0.000 abstract 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 abstract 2
- 229940075566 naphthalene Drugs 0.000 abstract 2
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 2
- 239000002904 solvent Substances 0.000 abstract 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 abstract 2
- 125000001140 1,4-phenylene group Chemical group [H]C1=C([H])C([*:2])=C([H])C([H])=C1[*:1] 0.000 abstract 1
- HYZJCKYKOHLVJF-UHFFFAOYSA-N 1H-benzimidazole Chemical compound C1=CC=C2NC=NC2=C1 HYZJCKYKOHLVJF-UHFFFAOYSA-N 0.000 abstract 1
- OYDRPVHDRYKTLR-UHFFFAOYSA-N 4-(2-piperidin-1-yl-3,4-dihydro-2H-quinolin-1-yl)morpholine Chemical compound N1(CCCCC1)C1N(C2=CC=CC=C2CC1)N1CCOCC1 OYDRPVHDRYKTLR-UHFFFAOYSA-N 0.000 abstract 1
- FHQRDEDZJIFJAL-UHFFFAOYSA-N 4-phenylmorpholine Chemical compound C1COCCN1C1=CC=CC=C1 FHQRDEDZJIFJAL-UHFFFAOYSA-N 0.000 abstract 1
- QCCKSFHMARIKSK-UHFFFAOYSA-N 5,6-dihydro-4h-pyrrolo[3,2,1-ij]quinoline Chemical compound C1CCC2=CC=CC3=C2N1C=C3 QCCKSFHMARIKSK-UHFFFAOYSA-N 0.000 abstract 1
- GAWIXWVDTYZWAW-UHFFFAOYSA-N C[CH]O Chemical group C[CH]O GAWIXWVDTYZWAW-UHFFFAOYSA-N 0.000 abstract 1
- 229920000742 Cotton Polymers 0.000 abstract 1
- 208000006558 Dental Calculus Diseases 0.000 abstract 1
- JSUUDOCDEOTQJD-UHFFFAOYSA-N N,N-diethyl-2-methyl-5-methylsulfonylaniline Chemical class C(C)N(C1=C(C=CC(=C1)S(=O)(=O)C)C)CC JSUUDOCDEOTQJD-UHFFFAOYSA-N 0.000 abstract 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric Acid Chemical class [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 abstract 1
- 235000011054 acetic acid Nutrition 0.000 abstract 1
- 150000007513 acids Chemical class 0.000 abstract 1
- 230000010933 acylation Effects 0.000 abstract 1
- 238000005917 acylation reaction Methods 0.000 abstract 1
- 230000001476 alcoholic effect Effects 0.000 abstract 1
- 150000001298 alcohols Chemical class 0.000 abstract 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 abstract 1
- 125000006307 alkoxy benzyl group Chemical group 0.000 abstract 1
- 125000005036 alkoxyphenyl group Chemical group 0.000 abstract 1
- 150000001348 alkyl chlorides Chemical class 0.000 abstract 1
- 125000005037 alkyl phenyl group Chemical group 0.000 abstract 1
- 230000002152 alkylating effect Effects 0.000 abstract 1
- QRUDEWIWKLJBPS-UHFFFAOYSA-N benzotriazole Chemical compound C1=CC=C2N[N][N]C2=C1 QRUDEWIWKLJBPS-UHFFFAOYSA-N 0.000 abstract 1
- HCAUQPZEWLULFJ-UHFFFAOYSA-N beta-naphthoquinoline Natural products C1=CC=C2C3=CC=CC=C3C=CC2=N1 HCAUQPZEWLULFJ-UHFFFAOYSA-N 0.000 abstract 1
- QAOWNCQODCNURD-UHFFFAOYSA-M bisulphate group Chemical group S([O-])(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-M 0.000 abstract 1
- 238000009835 boiling Methods 0.000 abstract 1
- 150000001649 bromium compounds Chemical class 0.000 abstract 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 abstract 1
- KMGBZBJJOKUPIA-UHFFFAOYSA-N butyl iodide Chemical class CCCCI KMGBZBJJOKUPIA-UHFFFAOYSA-N 0.000 abstract 1
- 229910052799 carbon Inorganic materials 0.000 abstract 1
- 125000004432 carbon atom Chemical group C* 0.000 abstract 1
- 150000001733 carboxylic acid esters Chemical class 0.000 abstract 1
- 238000009833 condensation Methods 0.000 abstract 1
- 230000005494 condensation Effects 0.000 abstract 1
- 238000007796 conventional method Methods 0.000 abstract 1
- 125000004122 cyclic group Chemical group 0.000 abstract 1
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 abstract 1
- DENRZWYUOJLTMF-UHFFFAOYSA-N diethyl sulfate Chemical class CCOS(=O)(=O)OCC DENRZWYUOJLTMF-UHFFFAOYSA-N 0.000 abstract 1
- VZOMUUKAVRPMBY-UHFFFAOYSA-N dihydroxymethylidene Chemical compound O[C]O VZOMUUKAVRPMBY-UHFFFAOYSA-N 0.000 abstract 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 abstract 1
- QKIUAMUSENSFQQ-UHFFFAOYSA-N dimethylazanide Chemical compound C[N-]C QKIUAMUSENSFQQ-UHFFFAOYSA-N 0.000 abstract 1
- 125000000597 dioxinyl group Chemical group 0.000 abstract 1
- 238000004043 dyeing Methods 0.000 abstract 1
- 239000002895 emetic Substances 0.000 abstract 1
- 150000002148 esters Chemical class 0.000 abstract 1
- VRZVPALEJCLXPR-UHFFFAOYSA-N ethyl 4-methylbenzenesulfonate Chemical compound CCOS(=O)(=O)C1=CC=C(C)C=C1 VRZVPALEJCLXPR-UHFFFAOYSA-N 0.000 abstract 1
- 235000019253 formic acid Nutrition 0.000 abstract 1
- 125000002541 furyl group Chemical group 0.000 abstract 1
- 125000005843 halogen group Chemical group 0.000 abstract 1
- 125000005842 heteroatom Chemical group 0.000 abstract 1
- 125000000623 heterocyclic group Chemical group 0.000 abstract 1
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 1
- 125000003453 indazolyl group Chemical group N1N=C(C2=C1C=CC=C2)* 0.000 abstract 1
- 150000002484 inorganic compounds Chemical class 0.000 abstract 1
- 229910010272 inorganic material Inorganic materials 0.000 abstract 1
- 229910052500 inorganic mineral Inorganic materials 0.000 abstract 1
- 150000004694 iodide salts Chemical class 0.000 abstract 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 abstract 1
- DZFWNZJKBJOGFQ-UHFFFAOYSA-N julolidine Chemical compound C1CCC2=CC=CC3=C2N1CCC3 DZFWNZJKBJOGFQ-UHFFFAOYSA-N 0.000 abstract 1
- 235000014655 lactic acid Nutrition 0.000 abstract 1
- 239000010985 leather Substances 0.000 abstract 1
- 239000000463 material Substances 0.000 abstract 1
- 238000000034 method Methods 0.000 abstract 1
- 239000011707 mineral Substances 0.000 abstract 1
- 235000010755 mineral Nutrition 0.000 abstract 1
- DYFFAVRFJWYYQO-UHFFFAOYSA-N n-methyl-n-phenylaniline Chemical compound C=1C=CC=CC=1N(C)C1=CC=CC=C1 DYFFAVRFJWYYQO-UHFFFAOYSA-N 0.000 abstract 1
- 230000007935 neutral effect Effects 0.000 abstract 1
- 150000005181 nitrobenzenes Chemical class 0.000 abstract 1
- 239000003960 organic solvent Substances 0.000 abstract 1
- 235000006408 oxalic acid Nutrition 0.000 abstract 1
- 125000005327 perimidinyl group Chemical class N1C(=NC2=CC=CC3=CC=CC1=C23)* 0.000 abstract 1
- 125000005359 phenoxyalkyl group Chemical group 0.000 abstract 1
- 229920002239 polyacrylonitrile Polymers 0.000 abstract 1
- 230000001376 precipitating effect Effects 0.000 abstract 1
- 238000002360 preparation method Methods 0.000 abstract 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 abstract 1
- FDDDEECHVMSUSB-UHFFFAOYSA-N sulfanilamide Chemical compound NC1=CC=C(S(N)(=O)=O)C=C1 FDDDEECHVMSUSB-UHFFFAOYSA-N 0.000 abstract 1
- 229940124530 sulfonamide Drugs 0.000 abstract 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 abstract 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 abstract 1
- 229910021653 sulphate ion Inorganic materials 0.000 abstract 1
- 235000018553 tannin Nutrition 0.000 abstract 1
- 229920001864 tannin Polymers 0.000 abstract 1
- 239000001648 tannin Substances 0.000 abstract 1
- 235000002906 tartaric acid Nutrition 0.000 abstract 1
- CXWXQJXEFPUFDZ-UHFFFAOYSA-N tetralin Chemical compound C1=CC=C2CCCCC2=C1 CXWXQJXEFPUFDZ-UHFFFAOYSA-N 0.000 abstract 1
- 125000000383 tetramethylene group Chemical group [H]C([H])([*:1])C([H])([H])C([H])([H])C([H])([H])[*:2] 0.000 abstract 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 abstract 1
- 239000011592 zinc chloride Substances 0.000 abstract 1
- 235000005074 zinc chloride Nutrition 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B44/00—Azo dyes containing onium groups
- C09B44/10—Azo dyes containing onium groups containing cyclammonium groups attached to an azo group by a carbon atom of the ring system
- C09B44/20—Thiazoles or hydrogenated thiazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Paper (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH787369X | 1954-12-15 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB787369A true GB787369A (en) | 1957-12-04 |
Family
ID=4536686
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB35891/55A Expired GB787369A (en) | 1954-12-15 | 1955-12-14 | Quaternary ammonium salts of benzthiazole azo dyestuffs |
Country Status (8)
| Country | Link |
|---|---|
| US (1) | US2889315A (https=) |
| BE (1) | BE543604A (https=) |
| CA (1) | CA570913A (https=) |
| CH (1) | CH331521A (https=) |
| DE (1) | DE1050940B (https=) |
| FR (1) | FR1145235A (https=) |
| GB (1) | GB787369A (https=) |
| IT (1) | IT545975A (https=) |
Cited By (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1135593B (de) * | 1958-11-03 | 1962-08-30 | Ici Ltd | Verfahren zur Herstellung von wasserunloeslichen Azofarbstoffen |
| US3132133A (en) * | 1962-02-28 | 1964-05-05 | American Cyanamid Co | Blue cationic azo dye |
| US3342800A (en) * | 1962-06-26 | 1967-09-19 | Kewanee Oil Co | Benzothiazole monoazo dyes |
| US3958287A (en) | 1974-05-24 | 1976-05-25 | Sumitomo Chemical Company, Limited | Dischargeable black dyeing on acid modified polyester fiber |
| US3977827A (en) | 1974-02-25 | 1976-08-31 | Sumitomo Chemical Company, Limited | Process for dyeing acid-modified polyester fibers |
| US4638053A (en) * | 1977-07-22 | 1987-01-20 | Hoechstaktiengesellschaft | Process for the preparation of chlorozincate salts of benzo thiazolium azo dyestuffs by alkylating with dialkylsulfate in aqueous medium in the presence of Zn-containing acid acceptor at pH≦7 |
| US5635607A (en) * | 1994-04-26 | 1997-06-03 | Ciba-Geigy Corporation | Cationic or basic azo dyes consisting of an amino benzothiazole diazo component and a disubstituted aniline component, which dyes contain at least one aromatic radical |
| CN105176133A (zh) * | 2014-08-13 | 2015-12-23 | 东华大学 | 一种可交联活性分散染料化合物及其制备和应用 |
Families Citing this family (30)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1117233B (de) | 1955-06-14 | 1961-11-16 | Basf Ag | Verfahren zur Herstellung basischer sulfonsaeuregruppenfreier Azofarbstoffe |
| CH418492A (de) * | 1957-05-29 | 1966-08-15 | Sandoz Ag | Verfahren zur Herstellung in Wasser schwer löslicher Azofarbstoffe |
| DE1105540B (de) * | 1957-10-24 | 1961-04-27 | Basf Ag | Verfahren zur Herstellung von Diazapolymethinfarbstoffen |
| DE1088631B (de) * | 1957-10-24 | 1960-09-08 | Basf Ag | Verfahren zur Herstellung von Diazapolymethinfarbstoffen |
| DE1127015B (de) * | 1957-12-04 | 1962-04-05 | Basf Ag | Verfahren zur Herstellung von wasserloeslichen basischen Farbstoffen |
| CH381344A (de) * | 1958-02-05 | 1964-08-31 | Sandoz Ag | Verfahren zur Herstellung von Monoazofarbstoffen |
| DE1218634B (de) * | 1958-10-02 | 1966-06-08 | Kuhlmann Ets | Verfahren zur Herstellung von basischen Azofarbstoffen |
| US3121710A (en) * | 1958-10-02 | 1964-02-18 | Cfmc | Quaternized monoazo dyes containing a 6-hydroxy-indazole radical |
| NL240434A (https=) * | 1959-04-23 | |||
| US3033847A (en) * | 1959-11-30 | 1962-05-08 | Du Pont | Cationic monoazo dyes for acrylic and polyester fibers |
| US3160467A (en) * | 1960-05-06 | 1964-12-08 | Cfmc | New azo dyestuffs and a process for dyeing polyacrylic fibres |
| US3107968A (en) * | 1961-02-17 | 1963-10-22 | Du Pont | Dyeing of acid-modified acrylic and polyester fibers |
| DE1271858B (de) * | 1962-02-28 | 1968-07-04 | American Cyanamid Co | Verfahren zur Herstellung von kationischen Azofarbstoffen |
| DE1282814B (de) * | 1962-04-04 | 1968-11-14 | Basf Ag | Verfahren zur Herstellung von Diazapolymethinfarbstoffen |
| US3179486A (en) * | 1962-07-30 | 1965-04-20 | American Cyanamid Co | Propylene dyeing method |
| NL302826A (https=) * | 1963-01-03 | |||
| DE1544375B1 (de) * | 1965-06-10 | 1969-12-11 | Basf Ag | Wasserunloesliche Monoazofarbstoffe |
| US3405118A (en) * | 1965-12-21 | 1968-10-08 | Du Pont | 4-methoxy-6-nitrobenzothiazolylazo disperse dyes |
| DE1619328B1 (de) * | 1966-03-10 | 1970-02-26 | Basf Ag | Verwendung eines quaternisierten Benzthiazolazofarbstoffes zu Färben von Textilmaterialien aus Polyacrylnitril |
| US3502645A (en) * | 1968-02-16 | 1970-03-24 | Martin Marietta Corp | Water-insoluble benzothiazole monoazo dyes |
| DE1927416C3 (de) * | 1969-05-29 | 1978-09-28 | Hoechst Ag, 6000 Frankfurt | Basische Azofarbstoffe, Verfahren zu ihrer Herstellung und ihre Verwendung |
| US4041024A (en) * | 1970-04-30 | 1977-08-09 | Bayer Aktiengesellschaft | Sulfo containing monoazo dyestuffs containing a benzthiazole diazo moiety and an N-benzylamino anilino coupling component |
| DE2221989A1 (de) * | 1972-05-05 | 1973-11-15 | Hoechst Ag | Basische azofarbstoffe, verfahren zu ihrer herstellung und ihre verwendung |
| DE2255059A1 (de) * | 1972-11-10 | 1974-05-22 | Bayer Ag | Basische farbstoffe |
| CH602886A5 (https=) * | 1974-05-04 | 1978-08-15 | Sandoz Ag | |
| DE2623162A1 (de) * | 1976-05-22 | 1977-12-01 | Bayer Ag | Alkylierung von azofarbstoffen |
| US4488992A (en) * | 1978-12-25 | 1984-12-18 | Sumitomo Chemical Company, Limited | Monoazo dyestuffs derived from benzothiazole |
| EP0105031B1 (de) * | 1982-08-30 | 1989-01-04 | Ciba-Geigy Ag | Kationische Azoverbindungen |
| EP0434609B1 (de) * | 1989-12-06 | 1994-09-21 | Ciba-Geigy Ag | Verfahren zum Färben von Polyacrylnitrilmaterialien |
| US20170283618A1 (en) * | 2016-04-04 | 2017-10-05 | Capacitor Sciences Incorporated | Non-linear dielectric materials and capacitor |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH136921A (de) * | 1927-05-21 | 1929-12-15 | Ig Farbenindustrie Ag | Verfahren zur Herstellung eines basischen Azofarbstoffes. |
| US2135293A (en) * | 1936-08-20 | 1938-11-01 | Pyridium Corp | Medicinal azo dyes |
| US2441612A (en) * | 1941-07-23 | 1948-05-18 | Celanese Corp | Benzthiazole azo dye |
| FR1049896A (fr) * | 1952-01-26 | 1954-01-04 | Cfmc | Nouveaux colorants azoïques, leurs procédés de préparation et leurs applications |
-
0
- IT IT545975D patent/IT545975A/it unknown
- DE DENDAT1050940D patent/DE1050940B/de active Pending
- CA CA570913A patent/CA570913A/en not_active Expired
- BE BE543604D patent/BE543604A/xx unknown
-
1954
- 1954-12-15 CH CH331521D patent/CH331521A/de unknown
-
1955
- 1955-12-12 US US552294A patent/US2889315A/en not_active Expired - Lifetime
- 1955-12-14 FR FR1145235D patent/FR1145235A/fr not_active Expired
- 1955-12-14 GB GB35891/55A patent/GB787369A/en not_active Expired
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1135593B (de) * | 1958-11-03 | 1962-08-30 | Ici Ltd | Verfahren zur Herstellung von wasserunloeslichen Azofarbstoffen |
| US3132133A (en) * | 1962-02-28 | 1964-05-05 | American Cyanamid Co | Blue cationic azo dye |
| US3342800A (en) * | 1962-06-26 | 1967-09-19 | Kewanee Oil Co | Benzothiazole monoazo dyes |
| US3977827A (en) | 1974-02-25 | 1976-08-31 | Sumitomo Chemical Company, Limited | Process for dyeing acid-modified polyester fibers |
| US3958287A (en) | 1974-05-24 | 1976-05-25 | Sumitomo Chemical Company, Limited | Dischargeable black dyeing on acid modified polyester fiber |
| US4638053A (en) * | 1977-07-22 | 1987-01-20 | Hoechstaktiengesellschaft | Process for the preparation of chlorozincate salts of benzo thiazolium azo dyestuffs by alkylating with dialkylsulfate in aqueous medium in the presence of Zn-containing acid acceptor at pH≦7 |
| US5635607A (en) * | 1994-04-26 | 1997-06-03 | Ciba-Geigy Corporation | Cationic or basic azo dyes consisting of an amino benzothiazole diazo component and a disubstituted aniline component, which dyes contain at least one aromatic radical |
| CN105176133A (zh) * | 2014-08-13 | 2015-12-23 | 东华大学 | 一种可交联活性分散染料化合物及其制备和应用 |
| CN105176133B (zh) * | 2014-08-13 | 2017-12-22 | 东华大学 | 一种可交联活性分散染料化合物及其制备和应用 |
Also Published As
| Publication number | Publication date |
|---|---|
| BE543604A (https=) | |
| DE1050940B (de) | 1959-02-19 |
| CH331521A (de) | 1958-07-31 |
| IT545975A (https=) | |
| US2889315A (en) | 1959-06-02 |
| FR1145235A (fr) | 1957-10-23 |
| CA570913A (en) | 1959-02-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB787369A (en) | Quaternary ammonium salts of benzthiazole azo dyestuffs | |
| GB791932A (en) | Quaternary ammonium salts of n-heterocyclic monoazo dyestuffs and their use | |
| GB793587A (en) | Quaternary ammonium monoazo dye salts and their use | |
| GB918128A (en) | Pyrazolino-benzimidazole colour couples | |
| US2864812A (en) | Water soluble dye salts | |
| US2785133A (en) | Compositions for a method of whitening fine fabrics | |
| US2283220A (en) | Azo compounds and material colored therewith | |
| US2224144A (en) | Azo compounds and material colored therewith | |
| US3627751A (en) | Basic azo dyestuffs containing etherified hydroxylamine groups | |
| GB1094309A (en) | Basic azo dyestuffs and processes for their manufacture | |
| US2231021A (en) | Azo compounds and material colored therewith | |
| GB786929A (en) | Improvements relating to quaternary ammonium salts of thiazole monazo dyestuffs | |
| US3635942A (en) | Basic ioninotriazole azoindole dyestuffs | |
| US2130358A (en) | Azo compounds and process for coloring therewith | |
| US3826800A (en) | Basic indazole azo compounds | |
| GB862269A (en) | New azo dyestuffs | |
| US2338639A (en) | Manufacture of azo dyestuffs | |
| US4035144A (en) | Dyeing preparations containing boric acid for preparing water-insoluble azo dyestuffs on fiber | |
| EP0036505B1 (de) | Verfahren zur Herstellung kationischer Farbstoffe sowie ihre Verwendung zum Färben von sauermodifizierten Synthesefasern | |
| US3957752A (en) | Quaternized azoanilino toluene sulfonamidoalkylene-amine dyes | |
| GB1087068A (en) | Basic benzimidazole monoazo dyestuffs and processes for their manufacture | |
| ES255366A1 (es) | Procedimiento para la preparacion de sales hidrosolubles de monoazocolorantes | |
| US1991313A (en) | Arylide of pyrazalone-carboxylic acids and process of making same | |
| GB977472A (en) | New monoazo compounds containing halogeno-triazinylamino groups | |
| GB1134175A (en) | Basic azo dyestuffs and processes for preparing them |