GB2033890A - Processes for preparing 4- monoalkylamino)benzoic acids and esters - Google Patents
Processes for preparing 4- monoalkylamino)benzoic acids and esters Download PDFInfo
- Publication number
- GB2033890A GB2033890A GB7844562A GB7844562A GB2033890A GB 2033890 A GB2033890 A GB 2033890A GB 7844562 A GB7844562 A GB 7844562A GB 7844562 A GB7844562 A GB 7844562A GB 2033890 A GB2033890 A GB 2033890A
- Authority
- GB
- United Kingdom
- Prior art keywords
- compound
- alkyl
- yield
- alkali metal
- formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000000034 method Methods 0.000 title claims abstract description 134
- 230000008569 process Effects 0.000 title claims abstract description 68
- 235000010233 benzoic acid Nutrition 0.000 title abstract description 85
- 150000001559 benzoic acids Chemical class 0.000 title abstract description 37
- 150000002148 esters Chemical class 0.000 title abstract description 11
- -1 hydroxy, sulfonyloxy, mercapto Chemical class 0.000 claims abstract description 355
- 150000001875 compounds Chemical class 0.000 claims abstract description 349
- 239000002253 acid Substances 0.000 claims abstract description 235
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 196
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims abstract description 187
- 238000006243 chemical reaction Methods 0.000 claims abstract description 113
- 239000001257 hydrogen Substances 0.000 claims abstract description 100
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 100
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims abstract description 88
- 229910000564 Raney nickel Inorganic materials 0.000 claims abstract description 87
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 86
- 239000007868 Raney catalyst Substances 0.000 claims abstract description 79
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 69
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims abstract description 61
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims abstract description 49
- 239000003054 catalyst Substances 0.000 claims abstract description 38
- 125000005843 halogen group Chemical group 0.000 claims abstract description 36
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims abstract description 33
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims abstract description 32
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 claims abstract description 32
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical compound [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 claims abstract description 29
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 claims abstract description 26
- 229910052725 zinc Inorganic materials 0.000 claims abstract description 26
- 239000011701 zinc Substances 0.000 claims abstract description 25
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 claims abstract description 24
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims abstract description 22
- OAKJQQAXSVQMHS-UHFFFAOYSA-N Hydrazine Chemical compound NN OAKJQQAXSVQMHS-UHFFFAOYSA-N 0.000 claims abstract description 22
- 229910052736 halogen Inorganic materials 0.000 claims abstract description 20
- 150000002367 halogens Chemical class 0.000 claims abstract description 20
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 claims abstract description 20
- 229910000033 sodium borohydride Inorganic materials 0.000 claims abstract description 18
- 239000012279 sodium borohydride Substances 0.000 claims abstract description 18
- 125000004391 aryl sulfonyl group Chemical group 0.000 claims abstract description 16
- 229910052751 metal Inorganic materials 0.000 claims abstract description 16
- 239000002184 metal Substances 0.000 claims abstract description 16
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims abstract description 13
- 125000005110 aryl thio group Chemical group 0.000 claims abstract description 13
- 239000012286 potassium permanganate Substances 0.000 claims abstract description 12
- 239000011734 sodium Substances 0.000 claims abstract description 12
- 229910052708 sodium Inorganic materials 0.000 claims abstract description 12
- 239000000126 substance Substances 0.000 claims abstract description 12
- 239000001569 carbon dioxide Substances 0.000 claims abstract description 11
- 229910002092 carbon dioxide Inorganic materials 0.000 claims abstract description 11
- 125000004397 aminosulfonyl group Chemical group NS(=O)(=O)* 0.000 claims abstract description 10
- 229940117975 chromium trioxide Drugs 0.000 claims abstract description 9
- WGLPBDUCMAPZCE-UHFFFAOYSA-N chromium trioxide Inorganic materials O=[Cr](=O)=O WGLPBDUCMAPZCE-UHFFFAOYSA-N 0.000 claims abstract description 9
- GAMDZJFZMJECOS-UHFFFAOYSA-N chromium(6+);oxygen(2-) Chemical compound [O-2].[O-2].[O-2].[Cr+6] GAMDZJFZMJECOS-UHFFFAOYSA-N 0.000 claims abstract description 9
- 125000004044 trifluoroacetyl group Chemical group FC(C(=O)*)(F)F 0.000 claims abstract description 9
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 claims abstract description 8
- 125000003118 aryl group Chemical group 0.000 claims abstract description 8
- 125000000020 sulfo group Chemical group O=S(=O)([*])O[H] 0.000 claims abstract description 8
- WSNMPAVSZJSIMT-UHFFFAOYSA-N COc1c(C)c2COC(=O)c2c(O)c1CC(O)C1(C)CCC(=O)O1 Chemical compound COc1c(C)c2COC(=O)c2c(O)c1CC(O)C1(C)CCC(=O)O1 WSNMPAVSZJSIMT-UHFFFAOYSA-N 0.000 claims abstract description 7
- 125000004390 alkyl sulfonyl group Chemical group 0.000 claims abstract description 7
- 229910052500 inorganic mineral Inorganic materials 0.000 claims abstract description 7
- 239000011707 mineral Substances 0.000 claims abstract description 7
- 229910052717 sulfur Inorganic materials 0.000 claims abstract description 7
- 239000011593 sulfur Substances 0.000 claims abstract description 7
- 125000005135 aryl sulfinyl group Chemical group 0.000 claims abstract description 6
- 125000001246 bromo group Chemical group Br* 0.000 claims abstract description 6
- 125000003396 thiol group Chemical class [H]S* 0.000 claims abstract description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 5
- 229910052760 oxygen Inorganic materials 0.000 claims abstract description 5
- 125000000026 trimethylsilyl group Chemical group [H]C([H])([H])[Si]([*])(C([H])([H])[H])C([H])([H])[H] 0.000 claims abstract description 5
- 125000003504 2-oxazolinyl group Chemical group O1C(=NCC1)* 0.000 claims abstract description 4
- 125000005035 acylthio group Chemical group 0.000 claims abstract description 4
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 4
- 125000003435 aroyl group Chemical group 0.000 claims abstract description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims abstract description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 claims abstract description 4
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 claims abstract description 4
- 239000001301 oxygen Substances 0.000 claims abstract description 4
- 125000006678 phenoxycarbonyl group Chemical group 0.000 claims abstract description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims abstract description 4
- 125000000475 sulfinyl group Chemical group [*:2]S([*:1])=O 0.000 claims abstract description 4
- 125000003545 alkoxy group Chemical group 0.000 claims abstract description 3
- 125000005098 aryl alkoxy carbonyl group Chemical group 0.000 claims abstract description 3
- 238000004519 manufacturing process Methods 0.000 claims abstract description 3
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims abstract 7
- 150000001340 alkali metals Chemical class 0.000 claims abstract 2
- 239000000047 product Substances 0.000 claims description 180
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical class [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 claims description 88
- 239000000203 mixture Substances 0.000 claims description 74
- 238000002360 preparation method Methods 0.000 claims description 71
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 61
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 claims description 43
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 claims description 42
- 150000001558 benzoic acid derivatives Chemical class 0.000 claims description 42
- 239000012467 final product Substances 0.000 claims description 42
- 239000003513 alkali Substances 0.000 claims description 33
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 claims description 26
- UORVGPXVDQYIDP-UHFFFAOYSA-N borane Chemical compound B UORVGPXVDQYIDP-UHFFFAOYSA-N 0.000 claims description 25
- 239000011203 carbon fibre reinforced carbon Substances 0.000 claims description 23
- 230000009467 reduction Effects 0.000 claims description 21
- 230000007062 hydrolysis Effects 0.000 claims description 19
- 238000006460 hydrolysis reaction Methods 0.000 claims description 19
- 125000003342 alkenyl group Chemical group 0.000 claims description 18
- 125000000304 alkynyl group Chemical group 0.000 claims description 16
- 239000003153 chemical reaction reagent Substances 0.000 claims description 16
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 16
- 238000005984 hydrogenation reaction Methods 0.000 claims description 15
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 claims description 14
- GNOIPBMMFNIUFM-UHFFFAOYSA-N hexamethylphosphoric triamide Chemical compound CN(C)P(=O)(N(C)C)N(C)C GNOIPBMMFNIUFM-UHFFFAOYSA-N 0.000 claims description 14
- 229910000085 borane Inorganic materials 0.000 claims description 13
- 229910052943 magnesium sulfate Inorganic materials 0.000 claims description 13
- 235000019341 magnesium sulphate Nutrition 0.000 claims description 13
- 150000003839 salts Chemical class 0.000 claims description 12
- QARBMVPHQWIHKH-UHFFFAOYSA-N methanesulfonyl chloride Chemical compound CS(Cl)(=O)=O QARBMVPHQWIHKH-UHFFFAOYSA-N 0.000 claims description 11
- 239000002585 base Substances 0.000 claims description 10
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 10
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical compound CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 claims description 10
- 239000012359 Methanesulfonyl chloride Substances 0.000 claims description 9
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 claims description 9
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 8
- JQWHASGSAFIOCM-UHFFFAOYSA-M sodium periodate Chemical compound [Na+].[O-]I(=O)(=O)=O JQWHASGSAFIOCM-UHFFFAOYSA-M 0.000 claims description 8
- ICGLPKIVTVWCFT-UHFFFAOYSA-N 4-methylbenzenesulfonohydrazide Chemical compound CC1=CC=C(S(=O)(=O)NN)C=C1 ICGLPKIVTVWCFT-UHFFFAOYSA-N 0.000 claims description 7
- MUMZUERVLWJKNR-UHFFFAOYSA-N oxoplatinum Chemical compound [Pt]=O MUMZUERVLWJKNR-UHFFFAOYSA-N 0.000 claims description 7
- 229910003446 platinum oxide Inorganic materials 0.000 claims description 7
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 7
- 150000001540 azides Chemical class 0.000 claims description 6
- 229910052987 metal hydride Inorganic materials 0.000 claims description 6
- 150000004681 metal hydrides Chemical class 0.000 claims description 6
- 235000010755 mineral Nutrition 0.000 claims description 6
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 claims description 6
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical compound S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 claims description 5
- 229910000037 hydrogen sulfide Inorganic materials 0.000 claims description 5
- VKTOBGBZBCELGC-UHFFFAOYSA-M methyl(triphenoxy)phosphanium;iodide Chemical compound [I-].C=1C=CC=CC=1O[P+](OC=1C=CC=CC=1)(C)OC1=CC=CC=C1 VKTOBGBZBCELGC-UHFFFAOYSA-M 0.000 claims description 5
- 230000003213 activating effect Effects 0.000 claims description 4
- 150000001335 aliphatic alkanes Chemical class 0.000 claims description 4
- 125000004414 alkyl thio group Chemical group 0.000 claims description 4
- 150000004945 aromatic hydrocarbons Chemical class 0.000 claims description 4
- 238000000354 decomposition reaction Methods 0.000 claims description 4
- 238000010438 heat treatment Methods 0.000 claims description 4
- MJGFBOZCAJSGQW-UHFFFAOYSA-N mercury sodium Chemical compound [Na].[Hg] MJGFBOZCAJSGQW-UHFFFAOYSA-N 0.000 claims description 4
- 125000004170 methylsulfonyl group Chemical group [H]C([H])([H])S(*)(=O)=O 0.000 claims description 4
- 239000011591 potassium Substances 0.000 claims description 4
- 229910052700 potassium Inorganic materials 0.000 claims description 4
- 229910001023 sodium amalgam Inorganic materials 0.000 claims description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- 230000002378 acidificating effect Effects 0.000 claims description 3
- 229910052799 carbon Inorganic materials 0.000 claims description 3
- UOALEFQKAOQICC-UHFFFAOYSA-N chloroborane Chemical compound ClB UOALEFQKAOQICC-UHFFFAOYSA-N 0.000 claims description 3
- QTURWMMVIIBRRP-UHFFFAOYSA-N diethoxymethoxybenzene Chemical compound CCOC(OCC)OC1=CC=CC=C1 QTURWMMVIIBRRP-UHFFFAOYSA-N 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- 239000011630 iodine Substances 0.000 claims description 3
- 229910052744 lithium Inorganic materials 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 125000001424 substituent group Chemical group 0.000 claims description 3
- QIKYZXDTTPVVAC-UHFFFAOYSA-N 4-Aminobenzamide Chemical compound NC(=O)C1=CC=C(N)C=C1 QIKYZXDTTPVVAC-UHFFFAOYSA-N 0.000 claims description 2
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 claims description 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims description 2
- 150000004791 alkyl magnesium halides Chemical class 0.000 claims description 2
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 claims description 2
- 125000002346 iodo group Chemical group I* 0.000 claims description 2
- 125000003356 phenylsulfanyl group Chemical group [*]SC1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 claims description 2
- 125000003170 phenylsulfonyl group Chemical group C1(=CC=CC=C1)S(=O)(=O)* 0.000 claims description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- 150000004678 hydrides Chemical class 0.000 abstract description 5
- 239000003795 chemical substances by application Substances 0.000 abstract description 3
- 230000000879 anti-atherosclerotic effect Effects 0.000 abstract description 2
- 230000000055 hyoplipidemic effect Effects 0.000 abstract description 2
- 150000002431 hydrogen Chemical class 0.000 abstract 3
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 abstract 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 361
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 201
- 239000007787 solid Substances 0.000 description 164
- QXWKHSSBFQDQPR-UHFFFAOYSA-N 4-(hexadecylamino)benzoic acid Chemical compound CCCCCCCCCCCCCCCCNC1=CC=C(C(O)=O)C=C1 QXWKHSSBFQDQPR-UHFFFAOYSA-N 0.000 description 96
- 239000000243 solution Substances 0.000 description 72
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 69
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 67
- BLFLLBZGZJTVJG-UHFFFAOYSA-N benzocaine Chemical compound CCOC(=O)C1=CC=C(N)C=C1 BLFLLBZGZJTVJG-UHFFFAOYSA-N 0.000 description 64
- VCFLGAOCYOZUMD-UHFFFAOYSA-N ethyl 4-(hexadecylamino)benzoate Chemical compound CCCCCCCCCCCCCCCCNC1=CC=C(C(=O)OCC)C=C1 VCFLGAOCYOZUMD-UHFFFAOYSA-N 0.000 description 58
- 239000005711 Benzoic acid Substances 0.000 description 52
- 238000002844 melting Methods 0.000 description 52
- 230000008018 melting Effects 0.000 description 52
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 48
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 45
- 238000010992 reflux Methods 0.000 description 36
- ZGUSAZNJASVWEY-UHFFFAOYSA-N 4-(tridecylamino)benzoic acid Chemical compound CCCCCCCCCCCCCNC1=CC=C(C(O)=O)C=C1 ZGUSAZNJASVWEY-UHFFFAOYSA-N 0.000 description 28
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 28
- 238000005804 alkylation reaction Methods 0.000 description 27
- 239000000543 intermediate Substances 0.000 description 27
- 230000029936 alkylation Effects 0.000 description 26
- 238000006722 reduction reaction Methods 0.000 description 25
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 23
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 23
- 229960000583 acetic acid Drugs 0.000 description 20
- 239000002904 solvent Substances 0.000 description 20
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 18
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 18
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 description 16
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 14
- 238000006214 Clemmensen reduction reaction Methods 0.000 description 13
- 239000000706 filtrate Substances 0.000 description 13
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 12
- 238000001914 filtration Methods 0.000 description 12
- 239000002244 precipitate Substances 0.000 description 11
- 239000000284 extract Substances 0.000 description 10
- 238000005932 reductive alkylation reaction Methods 0.000 description 10
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 10
- HNTGIJLWHDPAFN-UHFFFAOYSA-N 1-bromohexadecane Chemical compound CCCCCCCCCCCCCCCCBr HNTGIJLWHDPAFN-UHFFFAOYSA-N 0.000 description 9
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- KIYUCFHVASHLJW-UHFFFAOYSA-N ethyl 4-(11-oxohexadecylamino)benzoate Chemical compound CCCCCC(=O)CCCCCCCCCCNC1=CC=C(C(=O)OCC)C=C1 KIYUCFHVASHLJW-UHFFFAOYSA-N 0.000 description 9
- 230000002829 reductive effect Effects 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 208000031226 Hyperlipidaemia Diseases 0.000 description 8
- 238000002425 crystallisation Methods 0.000 description 8
- 230000008025 crystallization Effects 0.000 description 8
- 239000012044 organic layer Substances 0.000 description 8
- 150000007513 acids Chemical class 0.000 description 7
- 230000015572 biosynthetic process Effects 0.000 description 7
- LSLKURLQKLAUMD-UHFFFAOYSA-N ethyl 4-(16-bromohexadecylamino)benzoate Chemical compound CCOC(=O)C1=CC=C(NCCCCCCCCCCCCCCCCBr)C=C1 LSLKURLQKLAUMD-UHFFFAOYSA-N 0.000 description 7
- XHXFXVLFKHQFAL-UHFFFAOYSA-N phosphoryl trichloride Chemical compound ClP(Cl)(Cl)=O XHXFXVLFKHQFAL-UHFFFAOYSA-N 0.000 description 7
- 238000001953 recrystallisation Methods 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 description 6
- 201000001320 Atherosclerosis Diseases 0.000 description 6
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 6
- 235000012000 cholesterol Nutrition 0.000 description 6
- SPWVRYZQLGQKGK-UHFFFAOYSA-N dichloromethane;hexane Chemical compound ClCCl.CCCCCC SPWVRYZQLGQKGK-UHFFFAOYSA-N 0.000 description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- 235000019198 oils Nutrition 0.000 description 6
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 6
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 6
- OCHHYNXJGSPCKN-UHFFFAOYSA-N 4-(pentadecylamino)benzoic acid Chemical compound CCCCCCCCCCCCCCCNC1=CC=C(C(O)=O)C=C1 OCHHYNXJGSPCKN-UHFFFAOYSA-N 0.000 description 5
- 238000005644 Wolff-Kishner reduction reaction Methods 0.000 description 5
- 125000003282 alkyl amino group Chemical group 0.000 description 5
- 150000001408 amides Chemical class 0.000 description 5
- 210000004369 blood Anatomy 0.000 description 5
- 239000008280 blood Substances 0.000 description 5
- XJVYBGZHKKXNHA-UHFFFAOYSA-N ethyl 4-(16-ethylsulfanylhexadecylamino)benzoate Chemical compound CCOC(=O)C1=CC=C(NCCCCCCCCCCCCCCCCSCC)C=C1 XJVYBGZHKKXNHA-UHFFFAOYSA-N 0.000 description 5
- YEJDIWFPAUWJHV-UHFFFAOYSA-N ethyl 4-(6-oxohexadecylamino)benzoate Chemical compound CCCCCCCCCCC(=O)CCCCCNC1=CC=C(C(=O)OCC)C=C1 YEJDIWFPAUWJHV-UHFFFAOYSA-N 0.000 description 5
- HJGYCVSNMOFJDP-UHFFFAOYSA-N ethyl 4-(pentadecylamino)benzoate Chemical compound CCCCCCCCCCCCCCCNC1=CC=C(C(=O)OCC)C=C1 HJGYCVSNMOFJDP-UHFFFAOYSA-N 0.000 description 5
- DGGGBDLOUZPPQJ-UHFFFAOYSA-N ethyl 4-(tetradecylamino)benzoate Chemical compound CCCCCCCCCCCCCCNC1=CC=C(C(=O)OCC)C=C1 DGGGBDLOUZPPQJ-UHFFFAOYSA-N 0.000 description 5
- 238000001704 evaporation Methods 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 239000010410 layer Substances 0.000 description 5
- 230000003902 lesion Effects 0.000 description 5
- 229910052757 nitrogen Inorganic materials 0.000 description 5
- 229910052763 palladium Inorganic materials 0.000 description 5
- 239000000725 suspension Substances 0.000 description 5
- IMSODMZESSGVBE-UHFFFAOYSA-N 2-Oxazoline Chemical compound C1CN=CO1 IMSODMZESSGVBE-UHFFFAOYSA-N 0.000 description 4
- KOWBOYMQCOJEPA-UHFFFAOYSA-N 4-(11-oxohexadecylamino)benzoic acid Chemical compound CCCCCC(=O)CCCCCCCCCCNC1=CC=C(C(O)=O)C=C1 KOWBOYMQCOJEPA-UHFFFAOYSA-N 0.000 description 4
- GPUAEOZFNGTOHB-UHFFFAOYSA-N 4-(6-oxohexadecylamino)benzoic acid Chemical compound CCCCCCCCCCC(=O)CCCCCNC1=CC=C(C(O)=O)C=C1 GPUAEOZFNGTOHB-UHFFFAOYSA-N 0.000 description 4
- WOPJVBZBCIFAKI-UHFFFAOYSA-N 4-(6-sulfanylhexadecylamino)benzoic acid Chemical compound CCCCCCCCCCC(S)CCCCCNC1=CC=C(C(O)=O)C=C1 WOPJVBZBCIFAKI-UHFFFAOYSA-N 0.000 description 4
- 229910000838 Al alloy Inorganic materials 0.000 description 4
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 4
- 210000001367 artery Anatomy 0.000 description 4
- 230000003197 catalytic effect Effects 0.000 description 4
- 238000001311 chemical methods and process Methods 0.000 description 4
- 239000012230 colorless oil Substances 0.000 description 4
- 208000029078 coronary artery disease Diseases 0.000 description 4
- PUABBBQICFSTIM-UHFFFAOYSA-N ethyl 4-(6-hydroxyhexadecylamino)benzoate Chemical compound CCCCCCCCCCC(O)CCCCCNC1=CC=C(C(=O)OCC)C=C1 PUABBBQICFSTIM-UHFFFAOYSA-N 0.000 description 4
- 239000012362 glacial acetic acid Substances 0.000 description 4
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 description 4
- 208000020346 hyperlipoproteinemia Diseases 0.000 description 4
- 230000003647 oxidation Effects 0.000 description 4
- 238000007254 oxidation reaction Methods 0.000 description 4
- 230000020477 pH reduction Effects 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- MDXFLDHCQHBQAT-UHFFFAOYSA-N 1,1-dichloroethane;hexane Chemical compound CC(Cl)Cl.CCCCCC MDXFLDHCQHBQAT-UHFFFAOYSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 3
- HKHGXWLTYADJMG-UHFFFAOYSA-N 1-bromohexadecan-6-one Chemical compound CCCCCCCCCCC(=O)CCCCCBr HKHGXWLTYADJMG-UHFFFAOYSA-N 0.000 description 3
- GLPHIMRTFVXANB-UHFFFAOYSA-N 4-(16-ethylsulfanylhexadecylamino)benzoic acid Chemical compound CCSCCCCCCCCCCCCCCCCNC1=CC=C(C(O)=O)C=C1 GLPHIMRTFVXANB-UHFFFAOYSA-N 0.000 description 3
- NYGJGMARKBJCFF-UHFFFAOYSA-N 4-(16-sulfanylhexadecylamino)benzoic acid Chemical compound OC(=O)C1=CC=C(NCCCCCCCCCCCCCCCCS)C=C1 NYGJGMARKBJCFF-UHFFFAOYSA-N 0.000 description 3
- ADKLCCALIHXIED-UHFFFAOYSA-N 4-(hexadec-4-ynylamino)benzoic acid Chemical compound C(CCC#CCCCCCCCCCCC)NC1=CC=C(C(=O)O)C=C1 ADKLCCALIHXIED-UHFFFAOYSA-N 0.000 description 3
- JERBHTIKPOTHFN-UHFFFAOYSA-N 4-(tetradecylamino)benzoic acid Chemical compound CCCCCCCCCCCCCCNC1=CC=C(C(O)=O)C=C1 JERBHTIKPOTHFN-UHFFFAOYSA-N 0.000 description 3
- 229940086681 4-aminobenzoate Drugs 0.000 description 3
- AYLATYPSOIBJDE-UHFFFAOYSA-N 5-octylthiophene-2-carbaldehyde Chemical compound CCCCCCCCC1=CC=C(C=O)S1 AYLATYPSOIBJDE-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 3
- 229910000990 Ni alloy Inorganic materials 0.000 description 3
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 3
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 3
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical class [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- 230000001476 alcoholic effect Effects 0.000 description 3
- 229910052782 aluminium Inorganic materials 0.000 description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 3
- 238000005576 amination reaction Methods 0.000 description 3
- 239000003524 antilipemic agent Substances 0.000 description 3
- 229910052786 argon Inorganic materials 0.000 description 3
- 150000001541 aziridines Chemical class 0.000 description 3
- 238000010531 catalytic reduction reaction Methods 0.000 description 3
- 239000003638 chemical reducing agent Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- 238000004821 distillation Methods 0.000 description 3
- 239000012259 ether extract Substances 0.000 description 3
- MHRGEDZBZSGJPW-UHFFFAOYSA-N ethyl 4-(12-thiophen-2-yldodecylamino)benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NCCCCCCCCCCCCC1=CC=CS1 MHRGEDZBZSGJPW-UHFFFAOYSA-N 0.000 description 3
- GDTSUXZYHQWJOH-UHFFFAOYSA-N ethyl 4-(16-acetylsulfanylhexadecylamino)benzoate Chemical compound CCOC(=O)C1=CC=C(NCCCCCCCCCCCCCCCCSC(C)=O)C=C1 GDTSUXZYHQWJOH-UHFFFAOYSA-N 0.000 description 3
- AFECDAOUDGEMMD-UHFFFAOYSA-N ethyl 4-(16-bromohexadecanoylamino)benzoate Chemical compound CCOC(=O)C1=CC=C(NC(=O)CCCCCCCCCCCCCCCBr)C=C1 AFECDAOUDGEMMD-UHFFFAOYSA-N 0.000 description 3
- QRQQCSLQSCNPPV-UHFFFAOYSA-N ethyl 4-(6-acetylsulfanylhexadecylamino)benzoate Chemical compound CCCCCCCCCCC(SC(C)=O)CCCCCNC1=CC=C(C(=O)OCC)C=C1 QRQQCSLQSCNPPV-UHFFFAOYSA-N 0.000 description 3
- OFNAAZYTQPZNKY-UHFFFAOYSA-N ethyl 4-(6-chlorohexadecylamino)benzoate Chemical compound CCCCCCCCCCC(Cl)CCCCCNC1=CC=C(C(=O)OCC)C=C1 OFNAAZYTQPZNKY-UHFFFAOYSA-N 0.000 description 3
- CDFRXIVAGKDWGY-UHFFFAOYSA-N ethyl 4-azidobenzoate Chemical compound CCOC(=O)C1=CC=C(N=[N+]=[N-])C=C1 CDFRXIVAGKDWGY-UHFFFAOYSA-N 0.000 description 3
- PHWSCBWNPZDYRI-UHFFFAOYSA-N ethyl 4-nitrobenzoate Chemical compound CCOC(=O)C1=CC=C([N+]([O-])=O)C=C1 PHWSCBWNPZDYRI-UHFFFAOYSA-N 0.000 description 3
- 150000002632 lipids Chemical class 0.000 description 3
- 239000007788 liquid Substances 0.000 description 3
- 239000000463 material Substances 0.000 description 3
- 230000007935 neutral effect Effects 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 229910052697 platinum Inorganic materials 0.000 description 3
- JVBXVOWTABLYPX-UHFFFAOYSA-L sodium dithionite Chemical compound [Na+].[Na+].[O-]S(=O)S([O-])=O JVBXVOWTABLYPX-UHFFFAOYSA-L 0.000 description 3
- 150000003626 triacylglycerols Chemical class 0.000 description 3
- 239000008096 xylene Substances 0.000 description 3
- PJLHTVIBELQURV-UHFFFAOYSA-N 1-pentadecene Chemical compound CCCCCCCCCCCCCC=C PJLHTVIBELQURV-UHFFFAOYSA-N 0.000 description 2
- MZGOVCVTLWOGSG-UHFFFAOYSA-N 12-thiophen-2-yldodec-11-en-1-ol Chemical compound OCCCCCCCCCCC=CC1=CC=CS1 MZGOVCVTLWOGSG-UHFFFAOYSA-N 0.000 description 2
- YWALCJJFQUSJNF-UHFFFAOYSA-N 16-iodohexadeca-3,11-diyne Chemical compound ICCCCC#CCCCCCCC#CCC YWALCJJFQUSJNF-UHFFFAOYSA-N 0.000 description 2
- JYWKEVKEKOTYEX-UHFFFAOYSA-N 2,6-dibromo-4-chloroiminocyclohexa-2,5-dien-1-one Chemical compound ClN=C1C=C(Br)C(=O)C(Br)=C1 JYWKEVKEKOTYEX-UHFFFAOYSA-N 0.000 description 2
- IOHPVZBSOKLVMN-UHFFFAOYSA-N 2-(2-phenylethyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1CCC1=CC=CC=C1 IOHPVZBSOKLVMN-UHFFFAOYSA-N 0.000 description 2
- BYHQTRFJOGIQAO-GOSISDBHSA-N 3-(4-bromophenyl)-8-[(2R)-2-hydroxypropyl]-1-[(3-methoxyphenyl)methyl]-1,3,8-triazaspiro[4.5]decan-2-one Chemical compound C[C@H](CN1CCC2(CC1)CN(C(=O)N2CC3=CC(=CC=C3)OC)C4=CC=C(C=C4)Br)O BYHQTRFJOGIQAO-GOSISDBHSA-N 0.000 description 2
- BPFVRDLZAWCQHP-UHFFFAOYSA-N 4-(12-thiophen-2-yldodecylamino)benzoic acid Chemical compound C1=CC(C(=O)O)=CC=C1NCCCCCCCCCCCCC1=CC=CS1 BPFVRDLZAWCQHP-UHFFFAOYSA-N 0.000 description 2
- OYRLNYCZMZJEEH-UHFFFAOYSA-N 4-(6-hydroxyhexadecylamino)benzoic acid Chemical compound CCCCCCCCCCC(O)CCCCCNC1=CC=C(C(O)=O)C=C1 OYRLNYCZMZJEEH-UHFFFAOYSA-N 0.000 description 2
- IBSJUOAQRSGLBJ-UHFFFAOYSA-N 4-[3-(5-octylthiophen-2-yl)propylamino]benzoic acid Chemical compound S1C(CCCCCCCC)=CC=C1CCCNC1=CC=C(C(O)=O)C=C1 IBSJUOAQRSGLBJ-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 238000006237 Beckmann rearrangement reaction Methods 0.000 description 2
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 239000007818 Grignard reagent Substances 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- 108090001030 Lipoproteins Proteins 0.000 description 2
- 102000004895 Lipoproteins Human genes 0.000 description 2
- 241000124008 Mammalia Species 0.000 description 2
- PVNIIMVLHYAWGP-UHFFFAOYSA-N Niacin Chemical compound OC(=O)C1=CC=CN=C1 PVNIIMVLHYAWGP-UHFFFAOYSA-N 0.000 description 2
- 235000021314 Palmitic acid Nutrition 0.000 description 2
- 238000006085 Schmidt reaction Methods 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 239000003377 acid catalyst Substances 0.000 description 2
- 238000005903 acid hydrolysis reaction Methods 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 125000005907 alkyl ester group Chemical group 0.000 description 2
- 150000001350 alkyl halides Chemical class 0.000 description 2
- 150000001450 anions Chemical class 0.000 description 2
- 210000000709 aorta Anatomy 0.000 description 2
- 230000003143 atherosclerotic effect Effects 0.000 description 2
- YKYOUMDCQGMQQO-UHFFFAOYSA-L cadmium dichloride Chemical compound Cl[Cd]Cl YKYOUMDCQGMQQO-UHFFFAOYSA-L 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 125000002091 cationic group Chemical group 0.000 description 2
- 238000003776 cleavage reaction Methods 0.000 description 2
- KNHUKKLJHYUCFP-UHFFFAOYSA-N clofibrate Chemical compound CCOC(=O)C(C)(C)OC1=CC=C(Cl)C=C1 KNHUKKLJHYUCFP-UHFFFAOYSA-N 0.000 description 2
- 229960001214 clofibrate Drugs 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 238000006477 desulfuration reaction Methods 0.000 description 2
- 230000023556 desulfurization Effects 0.000 description 2
- NSSMTQDEWVTEKN-UHFFFAOYSA-N diethoxy(methyl)phosphane Chemical compound CCOP(C)OCC NSSMTQDEWVTEKN-UHFFFAOYSA-N 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003814 drug Substances 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- VYJSGJXWKSDUSG-UHFFFAOYSA-N ethyl 2-amino-1,3-benzothiazole-6-carboxylate Chemical compound CCOC(=O)C1=CC=C2N=C(N)SC2=C1 VYJSGJXWKSDUSG-UHFFFAOYSA-N 0.000 description 2
- ZKVIOBKFNGBMQE-UHFFFAOYSA-N ethyl 3-(5-octylthiophen-2-yl)prop-2-enoate Chemical compound CCCCCCCCC1=CC=C(C=CC(=O)OCC)S1 ZKVIOBKFNGBMQE-UHFFFAOYSA-N 0.000 description 2
- ZLVMJVCKNDMKTD-UHFFFAOYSA-N ethyl 4-(16-hydroxyhexadecylamino)benzoate Chemical compound CCOC(=O)C1=CC=C(NCCCCCCCCCCCCCCCCO)C=C1 ZLVMJVCKNDMKTD-UHFFFAOYSA-N 0.000 description 2
- BHCRMYUHFQWBTL-UHFFFAOYSA-N ethyl 4-(16-sulfanylhexadecylamino)benzoate Chemical compound CCOC(=O)C1=CC=C(NCCCCCCCCCCCCCCCCS)C=C1 BHCRMYUHFQWBTL-UHFFFAOYSA-N 0.000 description 2
- FRUOAAOGFLFXMB-UHFFFAOYSA-N ethyl 4-(heptadecylamino)benzoate Chemical compound CCCCCCCCCCCCCCCCCNC1=CC=C(C(=O)OCC)C=C1 FRUOAAOGFLFXMB-UHFFFAOYSA-N 0.000 description 2
- XRBOKBDWIVSMAY-UHFFFAOYSA-N ethyl 4-(hexadecanoylamino)benzoate Chemical compound CCCCCCCCCCCCCCCC(=O)NC1=CC=C(C(=O)OCC)C=C1 XRBOKBDWIVSMAY-UHFFFAOYSA-N 0.000 description 2
- WTIQBXJYUKTCPO-UHFFFAOYSA-N ethyl 4-(hydroxyamino)benzoate Chemical compound CCOC(=O)C1=CC=C(NO)C=C1 WTIQBXJYUKTCPO-UHFFFAOYSA-N 0.000 description 2
- OPXKELKVCZNZNP-UHFFFAOYSA-N ethyl 4-(octadecylamino)benzoate Chemical compound CCCCCCCCCCCCCCCCCCNC1=CC=C(C(=O)OCC)C=C1 OPXKELKVCZNZNP-UHFFFAOYSA-N 0.000 description 2
- MPKWKBNGMMLYKV-UHFFFAOYSA-N ethyl 4-(tridecylamino)benzoate Chemical compound CCCCCCCCCCCCCNC1=CC=C(C(=O)OCC)C=C1 MPKWKBNGMMLYKV-UHFFFAOYSA-N 0.000 description 2
- RGBGUGZKSXIMKW-UHFFFAOYSA-N ethyl 4-[2-(4-ethoxycarbonylphenyl)hydrazinyl]benzoate Chemical compound C1=CC(C(=O)OCC)=CC=C1NNC1=CC=C(C(=O)OCC)C=C1 RGBGUGZKSXIMKW-UHFFFAOYSA-N 0.000 description 2
- IDQBCVMRKWCDQS-UHFFFAOYSA-N ethyl 4-amino-3-thiocyanatobenzoate Chemical compound CCOC(=O)C1=CC=C(N)C(SC#N)=C1 IDQBCVMRKWCDQS-UHFFFAOYSA-N 0.000 description 2
- 150000004795 grignard reagents Chemical class 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- UFLJPANUONDNPT-UHFFFAOYSA-N hexadec-7-yn-1-ol Chemical compound CCCCCCCCC#CCCCCCCO UFLJPANUONDNPT-UHFFFAOYSA-N 0.000 description 2
- ZWMPSFHVSWYKPO-UHFFFAOYSA-N hexadeca-7,11-dien-1-ol Chemical compound CCCCC=CCCC=CCCCCCCO ZWMPSFHVSWYKPO-UHFFFAOYSA-N 0.000 description 2
- WGXGAUQEMYSVJM-UHFFFAOYSA-N hexadecanenitrile Chemical compound CCCCCCCCCCCCCCCC#N WGXGAUQEMYSVJM-UHFFFAOYSA-N 0.000 description 2
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 2
- 238000007327 hydrogenolysis reaction Methods 0.000 description 2
- 150000002463 imidates Chemical class 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 239000012280 lithium aluminium hydride Substances 0.000 description 2
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 description 2
- 208000010125 myocardial infarction Diseases 0.000 description 2
- 208000031225 myocardial ischemia Diseases 0.000 description 2
- STHNEJJEMZUFGA-UHFFFAOYSA-N n-hexadecyl-4-methylaniline Chemical compound CCCCCCCCCCCCCCCCNC1=CC=C(C)C=C1 STHNEJJEMZUFGA-UHFFFAOYSA-N 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 125000000018 nitroso group Chemical group N(=O)* 0.000 description 2
- 231100000252 nontoxic Toxicity 0.000 description 2
- 230000003000 nontoxic effect Effects 0.000 description 2
- 230000037361 pathway Effects 0.000 description 2
- 239000003208 petroleum Substances 0.000 description 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 2
- HKOOXMFOFWEVGF-UHFFFAOYSA-N phenylhydrazine Chemical class NNC1=CC=CC=C1 HKOOXMFOFWEVGF-UHFFFAOYSA-N 0.000 description 2
- 150000003904 phospholipids Chemical class 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- 125000006308 propyl amino group Chemical group 0.000 description 2
- 125000006239 protecting group Chemical group 0.000 description 2
- 239000012429 reaction media Substances 0.000 description 2
- 238000006894 reductive elimination reaction Methods 0.000 description 2
- 230000007017 scission Effects 0.000 description 2
- RIEGDRWQKNITRV-UHFFFAOYSA-M sodium;4-(hexadecylamino)benzoate Chemical compound [Na+].CCCCCCCCCCCCCCCCNC1=CC=C(C([O-])=O)C=C1 RIEGDRWQKNITRV-UHFFFAOYSA-M 0.000 description 2
- 230000009466 transformation Effects 0.000 description 2
- YIUYYQKBWGQKDR-UHFFFAOYSA-N tri(tetradecyl)borane Chemical compound CCCCCCCCCCCCCCB(CCCCCCCCCCCCCC)CCCCCCCCCCCCCC YIUYYQKBWGQKDR-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- GTVARPBALKFJJR-UHFFFAOYSA-N $l^{1}-azanylbenzene Chemical class [N]C1=CC=CC=C1 GTVARPBALKFJJR-UHFFFAOYSA-N 0.000 description 1
- SOCAXRLFGRNEPK-IFZYUDKTSA-N (1r,3s,5r)-2-n-[1-carbamoyl-5-(cyanomethoxy)indol-3-yl]-3-n-[(3-chloro-2-fluorophenyl)methyl]-2-azabicyclo[3.1.0]hexane-2,3-dicarboxamide Chemical compound O=C([C@@H]1C[C@H]2C[C@H]2N1C(=O)NC1=CN(C2=CC=C(OCC#N)C=C21)C(=O)N)NCC1=CC=CC(Cl)=C1F SOCAXRLFGRNEPK-IFZYUDKTSA-N 0.000 description 1
- DOMQFIFVDIAOOT-ROUUACIJSA-N (2S,3R)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methylpyridin-3-yl)-1,2,4-triazol-3-yl]-3-(5-methylpyrimidin-2-yl)butane-2-sulfonamide Chemical compound COC1=C(C(=CC=C1)OC)N1C(=NN=C1C=1C=NC=C(C=1)C)NS(=O)(=O)[C@@H](C)[C@H](C)C1=NC=C(C=N1)C DOMQFIFVDIAOOT-ROUUACIJSA-N 0.000 description 1
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 description 1
- UKGJZDSUJSPAJL-YPUOHESYSA-N (e)-n-[(1r)-1-[3,5-difluoro-4-(methanesulfonamido)phenyl]ethyl]-3-[2-propyl-6-(trifluoromethyl)pyridin-3-yl]prop-2-enamide Chemical compound CCCC1=NC(C(F)(F)F)=CC=C1\C=C\C(=O)N[C@H](C)C1=CC(F)=C(NS(C)(=O)=O)C(F)=C1 UKGJZDSUJSPAJL-YPUOHESYSA-N 0.000 description 1
- VYMPLPIFKRHAAC-UHFFFAOYSA-N 1,2-ethanedithiol Chemical compound SCCS VYMPLPIFKRHAAC-UHFFFAOYSA-N 0.000 description 1
- APWRZPQBPCAXFP-UHFFFAOYSA-N 1-(1-oxo-2H-isoquinolin-5-yl)-5-(trifluoromethyl)-N-[2-(trifluoromethyl)pyridin-4-yl]pyrazole-4-carboxamide Chemical compound O=C1NC=CC2=C(C=CC=C12)N1N=CC(=C1C(F)(F)F)C(=O)NC1=CC(=NC=C1)C(F)(F)F APWRZPQBPCAXFP-UHFFFAOYSA-N 0.000 description 1
- FJLUATLTXUNBOT-UHFFFAOYSA-N 1-Hexadecylamine Chemical compound CCCCCCCCCCCCCCCCN FJLUATLTXUNBOT-UHFFFAOYSA-N 0.000 description 1
- ABDDQTDRAHXHOC-QMMMGPOBSA-N 1-[(7s)-5,7-dihydro-4h-thieno[2,3-c]pyran-7-yl]-n-methylmethanamine Chemical compound CNC[C@@H]1OCCC2=C1SC=C2 ABDDQTDRAHXHOC-QMMMGPOBSA-N 0.000 description 1
- BHKKSKOHRFHHIN-MRVPVSSYSA-N 1-[[2-[(1R)-1-aminoethyl]-4-chlorophenyl]methyl]-2-sulfanylidene-5H-pyrrolo[3,2-d]pyrimidin-4-one Chemical compound N[C@H](C)C1=C(CN2C(NC(C3=C2C=CN3)=O)=S)C=CC(=C1)Cl BHKKSKOHRFHHIN-MRVPVSSYSA-N 0.000 description 1
- MYMSJFSOOQERIO-UHFFFAOYSA-N 1-bromodecane Chemical compound CCCCCCCCCCBr MYMSJFSOOQERIO-UHFFFAOYSA-N 0.000 description 1
- BKOYBCZNNLXIIO-UHFFFAOYSA-N 1-bromohexadec-7-yne Chemical compound CCCCCCCCC#CCCCCCCBr BKOYBCZNNLXIIO-UHFFFAOYSA-N 0.000 description 1
- YZWKKMVJZFACSU-UHFFFAOYSA-N 1-bromopentane Chemical compound CCCCCBr YZWKKMVJZFACSU-UHFFFAOYSA-N 0.000 description 1
- WIYCRMFQJPNOBY-UHFFFAOYSA-N 1-chlorohexadec-4-yne Chemical compound ClCCCC#CCCCCCCCCCCC WIYCRMFQJPNOBY-UHFFFAOYSA-N 0.000 description 1
- RDASLRTUJDXVHB-UHFFFAOYSA-N 1-chlorohexadec-8-yne Chemical compound CCCCCCCC#CCCCCCCCCl RDASLRTUJDXVHB-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- YKNKBBMRKMLLJS-UHFFFAOYSA-N 1-phenylaziridine Chemical class C1CN1C1=CC=CC=C1 YKNKBBMRKMLLJS-UHFFFAOYSA-N 0.000 description 1
- QWHOIFRYXGBPRO-UHFFFAOYSA-N 11-bromoundecanoyl chloride Chemical compound ClC(=O)CCCCCCCCCCBr QWHOIFRYXGBPRO-UHFFFAOYSA-N 0.000 description 1
- ZWAUHSIQWCQSIK-UHFFFAOYSA-N 12-thiophen-2-yldodec-11-enoic acid Chemical compound OC(=O)CCCCCCCCCC=CC1=CC=CS1 ZWAUHSIQWCQSIK-UHFFFAOYSA-N 0.000 description 1
- SMCYIIRDJMJWTM-UHFFFAOYSA-N 13-bromotridec-1-yne Chemical compound BrCCCCCCCCCCCC#C SMCYIIRDJMJWTM-UHFFFAOYSA-N 0.000 description 1
- LCWLAZHKTKIEPC-UHFFFAOYSA-N 16-bromohexadec-5-yne Chemical compound CCCCC#CCCCCCCCCCCBr LCWLAZHKTKIEPC-UHFFFAOYSA-N 0.000 description 1
- PFNCOYVEMJYEED-UHFFFAOYSA-N 16-bromohexadecanoic acid Chemical compound OC(=O)CCCCCCCCCCCCCCCBr PFNCOYVEMJYEED-UHFFFAOYSA-N 0.000 description 1
- PLMKTPKBEQNIPD-UHFFFAOYSA-N 16-iodohexadeca-3,9-diyne Chemical compound ICCCCCCC#CCCCCC#CCC PLMKTPKBEQNIPD-UHFFFAOYSA-N 0.000 description 1
- HIXDQWDOVZUNNA-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-hydroxy-7-methoxychromen-4-one Chemical compound C=1C(OC)=CC(O)=C(C(C=2)=O)C=1OC=2C1=CC=C(OC)C(OC)=C1 HIXDQWDOVZUNNA-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- NPHULPIAPWNOOH-UHFFFAOYSA-N 2-[4-[2-(2,3-dihydro-1H-inden-2-ylamino)pyrimidin-5-yl]-3-(2,3-dihydroindol-1-ylmethyl)pyrazol-1-yl]-1-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)ethanone Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C=1C(=NN(C=1)CC(=O)N1CC2=C(CC1)NN=N2)CN1CCC2=CC=CC=C12 NPHULPIAPWNOOH-UHFFFAOYSA-N 0.000 description 1
- GIFWAJGKWIDXMY-UHFFFAOYSA-N 2-octylthiophene Chemical compound CCCCCCCCC1=CC=CS1 GIFWAJGKWIDXMY-UHFFFAOYSA-N 0.000 description 1
- QSZYOFZEYRBLMC-UHFFFAOYSA-N 2-thiophen-2-yldodec-11-enoic acid Chemical compound S1C(=CC=C1)C(C(=O)O)CCCCCCCCC=C QSZYOFZEYRBLMC-UHFFFAOYSA-N 0.000 description 1
- SRVXSISGYBMIHR-UHFFFAOYSA-N 3-[3-[3-(2-amino-2-oxoethyl)phenyl]-5-chlorophenyl]-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid Chemical compound S1C(C)=CN=C1C(CC(O)=O)C1=CC(Cl)=CC(C=2C=C(CC(N)=O)C=CC=2)=C1 SRVXSISGYBMIHR-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- HXUIDZOMTRMIOE-UHFFFAOYSA-M 3-oxo-3-phenylpropionate Chemical compound [O-]C(=O)CC(=O)C1=CC=CC=C1 HXUIDZOMTRMIOE-UHFFFAOYSA-M 0.000 description 1
- IFZZHQCGQYHPOW-UHFFFAOYSA-N 4-(16-bromohexadecylamino)benzoic acid Chemical compound OC(=O)C1=CC=C(NCCCCCCCCCCCCCCCCBr)C=C1 IFZZHQCGQYHPOW-UHFFFAOYSA-N 0.000 description 1
- UQSLZOJAUADSBM-UHFFFAOYSA-N 4-(hexadecylamino)benzaldehyde Chemical compound CCCCCCCCCCCCCCCCNC1=CC=C(C=O)C=C1 UQSLZOJAUADSBM-UHFFFAOYSA-N 0.000 description 1
- MKGUVSFRNLBHLT-UHFFFAOYSA-N 4-(hexadecylamino)benzamide Chemical compound CCCCCCCCCCCCCCCCNC1=CC=C(C(N)=O)C=C1 MKGUVSFRNLBHLT-UHFFFAOYSA-N 0.000 description 1
- QXWKHSSBFQDQPR-UHFFFAOYSA-M 4-(hexadecylamino)benzoate Chemical compound CCCCCCCCCCCCCCCCNC1=CC=C(C([O-])=O)C=C1 QXWKHSSBFQDQPR-UHFFFAOYSA-M 0.000 description 1
- VJPPLCNBDLZIFG-ZDUSSCGKSA-N 4-[(3S)-3-(but-2-ynoylamino)piperidin-1-yl]-5-fluoro-2,3-dimethyl-1H-indole-7-carboxamide Chemical compound C(C#CC)(=O)N[C@@H]1CN(CCC1)C1=C2C(=C(NC2=C(C=C1F)C(=O)N)C)C VJPPLCNBDLZIFG-ZDUSSCGKSA-N 0.000 description 1
- YICAMJWHIUMFDI-UHFFFAOYSA-N 4-acetamidotoluene Chemical compound CC(=O)NC1=CC=C(C)C=C1 YICAMJWHIUMFDI-UHFFFAOYSA-N 0.000 description 1
- KVCQTKNUUQOELD-UHFFFAOYSA-N 4-amino-n-[1-(3-chloro-2-fluoroanilino)-6-methylisoquinolin-5-yl]thieno[3,2-d]pyrimidine-7-carboxamide Chemical compound N=1C=CC2=C(NC(=O)C=3C4=NC=NC(N)=C4SC=3)C(C)=CC=C2C=1NC1=CC=CC(Cl)=C1F KVCQTKNUUQOELD-UHFFFAOYSA-N 0.000 description 1
- ALYNCZNDIQEVRV-UHFFFAOYSA-N 4-aminobenzoic acid Chemical class NC1=CC=C(C(O)=O)C=C1 ALYNCZNDIQEVRV-UHFFFAOYSA-N 0.000 description 1
- 150000005418 4-aminobenzoic acid derivatives Chemical class 0.000 description 1
- XZBZOTJKKCXYPA-UHFFFAOYSA-N 4-trimethylsilylaniline Chemical compound C[Si](C)(C)C1=CC=C(N)C=C1 XZBZOTJKKCXYPA-UHFFFAOYSA-N 0.000 description 1
- KCBWAFJCKVKYHO-UHFFFAOYSA-N 6-(4-cyclopropyl-6-methoxypyrimidin-5-yl)-1-[[4-[1-propan-2-yl-4-(trifluoromethyl)imidazol-2-yl]phenyl]methyl]pyrazolo[3,4-d]pyrimidine Chemical compound C1(CC1)C1=NC=NC(=C1C1=NC=C2C(=N1)N(N=C2)CC1=CC=C(C=C1)C=1N(C=C(N=1)C(F)(F)F)C(C)C)OC KCBWAFJCKVKYHO-UHFFFAOYSA-N 0.000 description 1
- HBPVGJGBRWIVSX-UHFFFAOYSA-N 6-bromohexanoyl chloride Chemical compound ClC(=O)CCCCCBr HBPVGJGBRWIVSX-UHFFFAOYSA-N 0.000 description 1
- ZWMPSFHVSWYKPO-QPHGKBKNSA-N 7,11-hexadecadien-1-ol Chemical compound CCCC\C=C\CC\C=C\CCCCCCO ZWMPSFHVSWYKPO-QPHGKBKNSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- ZOXJGFHDIHLPTG-BJUDXGSMSA-N Boron-10 Chemical compound [10B] ZOXJGFHDIHLPTG-BJUDXGSMSA-N 0.000 description 1
- 239000004215 Carbon black (E152) Substances 0.000 description 1
- 206010007559 Cardiac failure congestive Diseases 0.000 description 1
- 229920001268 Cholestyramine Polymers 0.000 description 1
- XUIIKFGFIJCVMT-GFCCVEGCSA-N D-thyroxine Chemical compound IC1=CC(C[C@@H](N)C(O)=O)=CC(I)=C1OC1=CC(I)=C(O)C(I)=C1 XUIIKFGFIJCVMT-GFCCVEGCSA-N 0.000 description 1
- BDCFUHIWJODVNG-UHFFFAOYSA-N Desmosterol Natural products C1C=C2CC(O)C=CC2(C)C2C1C1CCC(C(C)CCC(CC)C(C)C)C1(C)CC2 BDCFUHIWJODVNG-UHFFFAOYSA-N 0.000 description 1
- BWGNESOTFCXPMA-UHFFFAOYSA-N Dihydrogen disulfide Chemical compound SS BWGNESOTFCXPMA-UHFFFAOYSA-N 0.000 description 1
- 206010014476 Elevated cholesterol Diseases 0.000 description 1
- VTLYFUHAOXGGBS-UHFFFAOYSA-N Fe3+ Chemical compound [Fe+3] VTLYFUHAOXGGBS-UHFFFAOYSA-N 0.000 description 1
- PNKUSGQVOMIXLU-UHFFFAOYSA-N Formamidine Chemical compound NC=N PNKUSGQVOMIXLU-UHFFFAOYSA-N 0.000 description 1
- 206010017711 Gangrene Diseases 0.000 description 1
- 206010070840 Gastrointestinal tract irritation Diseases 0.000 description 1
- 206010019280 Heart failures Diseases 0.000 description 1
- 208000035150 Hypercholesterolemia Diseases 0.000 description 1
- 206010020880 Hypertrophy Diseases 0.000 description 1
- 108010007622 LDL Lipoproteins Proteins 0.000 description 1
- 102000007330 LDL Lipoproteins Human genes 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 241001024304 Mino Species 0.000 description 1
- FEYNFHSRETUBEM-UHFFFAOYSA-N N-[3-(1,1-difluoroethyl)phenyl]-1-(4-methoxyphenyl)-3-methyl-5-oxo-4H-pyrazole-4-carboxamide Chemical compound COc1ccc(cc1)N1N=C(C)C(C(=O)Nc2cccc(c2)C(C)(F)F)C1=O FEYNFHSRETUBEM-UHFFFAOYSA-N 0.000 description 1
- MBBZMMPHUWSWHV-BDVNFPICSA-N N-methylglucamine Chemical compound CNC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO MBBZMMPHUWSWHV-BDVNFPICSA-N 0.000 description 1
- CKRZKMFTZCFYGB-UHFFFAOYSA-N N-phenylhydroxylamine Chemical class ONC1=CC=CC=C1 CKRZKMFTZCFYGB-UHFFFAOYSA-N 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 208000018262 Peripheral vascular disease Diseases 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- FQGXUHNANJFHRI-UHFFFAOYSA-N S1C(=CC=C1)C(CO)CCCCCCCCC=C Chemical compound S1C(=CC=C1)C(CO)CCCCCCCCC=C FQGXUHNANJFHRI-UHFFFAOYSA-N 0.000 description 1
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 1
- VMHLLURERBWHNL-UHFFFAOYSA-M Sodium acetate Chemical compound [Na+].CC([O-])=O VMHLLURERBWHNL-UHFFFAOYSA-M 0.000 description 1
- 229930182558 Sterol Natural products 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-N Sulfurous acid Chemical class OS(O)=O LSNNMFCWUKXFEE-UHFFFAOYSA-N 0.000 description 1
- FZWLAAWBMGSTSO-UHFFFAOYSA-N Thiazole Chemical group C1=CSC=N1 FZWLAAWBMGSTSO-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- 108010062497 VLDL Lipoproteins Proteins 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- 230000035508 accumulation Effects 0.000 description 1
- 238000009825 accumulation Methods 0.000 description 1
- 159000000021 acetate salts Chemical class 0.000 description 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 1
- 230000021736 acetylation Effects 0.000 description 1
- 238000006640 acetylation reaction Methods 0.000 description 1
- 238000010306 acid treatment Methods 0.000 description 1
- 125000002015 acyclic group Chemical group 0.000 description 1
- 125000002252 acyl group Chemical group 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 229910001854 alkali hydroxide Inorganic materials 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 125000006323 alkenyl amino group Chemical group 0.000 description 1
- 150000001356 alkyl thiols Chemical class 0.000 description 1
- 239000002168 alkylating agent Substances 0.000 description 1
- 229940100198 alkylating agent Drugs 0.000 description 1
- 125000003368 amide group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 239000011260 aqueous acid Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 206010003119 arrhythmia Diseases 0.000 description 1
- 230000006793 arrhythmia Effects 0.000 description 1
- 208000011775 arteriosclerosis disease Diseases 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000005264 aryl amine group Chemical group 0.000 description 1
- 150000007860 aryl ester derivatives Chemical class 0.000 description 1
- 230000036778 atheroma formation Effects 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 150000003935 benzaldehydes Chemical class 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 150000003938 benzyl alcohols Chemical class 0.000 description 1
- HSDAJNMJOMSNEV-UHFFFAOYSA-N benzyl chloroformate Chemical compound ClC(=O)OCC1=CC=CC=C1 HSDAJNMJOMSNEV-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 210000004556 brain Anatomy 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 229910002091 carbon monoxide Inorganic materials 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 230000002490 cerebral effect Effects 0.000 description 1
- 239000003610 charcoal Substances 0.000 description 1
- 239000007806 chemical reaction intermediate Substances 0.000 description 1
- KRVSOGSZCMJSLX-UHFFFAOYSA-L chromic acid Substances O[Cr](O)(=O)=O KRVSOGSZCMJSLX-UHFFFAOYSA-L 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000001212 derivatisation Methods 0.000 description 1
- AVSXSVCZWQODGV-DPAQBDIFSA-N desmosterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@@H](CCC=C(C)C)C)[C@@]1(C)CC2 AVSXSVCZWQODGV-DPAQBDIFSA-N 0.000 description 1
- 229960001767 dextrothyroxine Drugs 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- NCIJDYNKYJVFLR-UHFFFAOYSA-N ethyl 3-[4-(hexadecylamino)phenyl]-3-oxopropanoate Chemical compound CCCCCCCCCCCCCCCCNC1=CC=C(C(=O)CC(=O)OCC)C=C1 NCIJDYNKYJVFLR-UHFFFAOYSA-N 0.000 description 1
- KOEHTGGSAVSLRS-UHFFFAOYSA-N ethyl 4-(prop-2-ynylamino)benzoate Chemical compound CCOC(=O)C1=CC=C(NCC#C)C=C1 KOEHTGGSAVSLRS-UHFFFAOYSA-N 0.000 description 1
- MNXIPQPJRMIUPU-UHFFFAOYSA-N ethyl 4-[16-(methylsulfamoyl)hexadecylamino]benzoate Chemical compound CCOC(=O)C1=CC=C(NCCCCCCCCCCCCCCCCS(=O)(=O)NC)C=C1 MNXIPQPJRMIUPU-UHFFFAOYSA-N 0.000 description 1
- CDTIOUAGZLNMJT-UHFFFAOYSA-N ethyl 4-[3-(5-octylthiophen-2-yl)propylamino]benzoate Chemical compound S1C(CCCCCCCC)=CC=C1CCCNC1=CC=C(C(=O)OCC)C=C1 CDTIOUAGZLNMJT-UHFFFAOYSA-N 0.000 description 1
- JYYDHGMTXHCSKZ-UHFFFAOYSA-N ethyl 4-hydrazinylbenzoate Chemical compound CCOC(=O)C1=CC=C(NN)C=C1 JYYDHGMTXHCSKZ-UHFFFAOYSA-N 0.000 description 1
- QKVJSTCHTZXKHI-UHFFFAOYSA-N ethyl 4-nitrosobenzoate Chemical compound CCOC(=O)C1=CC=C(N=O)C=C1 QKVJSTCHTZXKHI-UHFFFAOYSA-N 0.000 description 1
- 125000004494 ethyl ester group Chemical group 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 229910001447 ferric ion Inorganic materials 0.000 description 1
- CNUDBTRUORMMPA-UHFFFAOYSA-N formylthiophene Chemical compound O=CC1=CC=CS1 CNUDBTRUORMMPA-UHFFFAOYSA-N 0.000 description 1
- 239000012458 free base Substances 0.000 description 1
- 238000004108 freeze drying Methods 0.000 description 1
- AWJWCTOOIBYHON-UHFFFAOYSA-N furo[3,4-b]pyrazine-5,7-dione Chemical compound C1=CN=C2C(=O)OC(=O)C2=N1 AWJWCTOOIBYHON-UHFFFAOYSA-N 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- LRHIAJIYIAQQQZ-UHFFFAOYSA-N hexadec-12-yn-1-ol Chemical compound CCCC#CCCCCCCCCCCCO LRHIAJIYIAQQQZ-UHFFFAOYSA-N 0.000 description 1
- WUYAZKLSIGJCPM-UHFFFAOYSA-N hexadec-4-en-1-ol Chemical compound CCCCCCCCCCCC=CCCCO WUYAZKLSIGJCPM-UHFFFAOYSA-N 0.000 description 1
- SIHWESHIQGPCBP-UHFFFAOYSA-N hexadec-4-ene Chemical compound CCCCCCCCCCCC=CCCC SIHWESHIQGPCBP-UHFFFAOYSA-N 0.000 description 1
- UINODNIHQJYZEH-UHFFFAOYSA-N hexadec-4-enyl methanesulfonate Chemical compound CS(=O)(=O)OCCCC=CCCCCCCCCCCC UINODNIHQJYZEH-UHFFFAOYSA-N 0.000 description 1
- RAFYBBFFLHLMJT-UHFFFAOYSA-N hexadec-4-ynoic acid Chemical compound CCCCCCCCCCCC#CCCC(O)=O RAFYBBFFLHLMJT-UHFFFAOYSA-N 0.000 description 1
- ARBOVOVUTSQWSS-UHFFFAOYSA-N hexadecanoyl chloride Chemical compound CCCCCCCCCCCCCCCC(Cl)=O ARBOVOVUTSQWSS-UHFFFAOYSA-N 0.000 description 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 description 1
- 125000000717 hydrazino group Chemical group [H]N([*])N([H])[H] 0.000 description 1
- 238000006197 hydroboration reaction Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- JUINSXZKUKVTMD-UHFFFAOYSA-N hydrogen azide Chemical compound N=[N+]=[N-] JUINSXZKUKVTMD-UHFFFAOYSA-N 0.000 description 1
- 230000000871 hypocholesterolemic effect Effects 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 238000010952 in-situ formation Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 230000006372 lipid accumulation Effects 0.000 description 1
- 150000002642 lithium compounds Chemical class 0.000 description 1
- 210000004185 liver Anatomy 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 230000007246 mechanism Effects 0.000 description 1
- 125000000250 methylamino group Chemical group [H]N(*)C([H])([H])[H] 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000003541 multi-stage reaction Methods 0.000 description 1
- 210000004165 myocardium Anatomy 0.000 description 1
- WQEPLUUGTLDZJY-UHFFFAOYSA-N n-Pentadecanoic acid Natural products CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 description 1
- VFBILHPIHUPBPZ-UHFFFAOYSA-N n-[[2-[4-(difluoromethoxy)-3-propan-2-yloxyphenyl]-1,3-oxazol-4-yl]methyl]-2-ethoxybenzamide Chemical compound CCOC1=CC=CC=C1C(=O)NCC1=COC(C=2C=C(OC(C)C)C(OC(F)F)=CC=2)=N1 VFBILHPIHUPBPZ-UHFFFAOYSA-N 0.000 description 1
- SVYHKSYGLHIYEJ-UHFFFAOYSA-N n-chlorohexadecan-1-amine Chemical compound CCCCCCCCCCCCCCCCNCl SVYHKSYGLHIYEJ-UHFFFAOYSA-N 0.000 description 1
- 229960003512 nicotinic acid Drugs 0.000 description 1
- 235000001968 nicotinic acid Nutrition 0.000 description 1
- 239000011664 nicotinic acid Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 150000007530 organic bases Chemical class 0.000 description 1
- 150000002905 orthoesters Chemical class 0.000 description 1
- 150000002918 oxazolines Chemical class 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- KDLHZDBZIXYQEI-VENIDDJXSA-N palladium-100 Chemical compound [100Pd] KDLHZDBZIXYQEI-VENIDDJXSA-N 0.000 description 1
- 239000001814 pectin Substances 0.000 description 1
- 235000010987 pectin Nutrition 0.000 description 1
- 229920001277 pectin Polymers 0.000 description 1
- YZTRLSJPHLYCEC-UHFFFAOYSA-N pentadec-4-enal Chemical compound CCCCCCCCCCC=CCCC=O YZTRLSJPHLYCEC-UHFFFAOYSA-N 0.000 description 1
- QJAGZXXTTGCVGV-UHFFFAOYSA-N pentadeca-4,14-dien-1-ol Chemical compound OCCCC=CCCCCCCCCC=C QJAGZXXTTGCVGV-UHFFFAOYSA-N 0.000 description 1
- 230000002093 peripheral effect Effects 0.000 description 1
- 230000000144 pharmacologic effect Effects 0.000 description 1
- CTRLRINCMYICJO-UHFFFAOYSA-N phenyl azide Chemical class [N-]=[N+]=NC1=CC=CC=C1 CTRLRINCMYICJO-UHFFFAOYSA-N 0.000 description 1
- 210000002381 plasma Anatomy 0.000 description 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 230000003449 preventive effect Effects 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000008707 rearrangement Effects 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 210000002966 serum Anatomy 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000001632 sodium acetate Substances 0.000 description 1
- 235000017281 sodium acetate Nutrition 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000012312 sodium hydride Substances 0.000 description 1
- 229910000104 sodium hydride Inorganic materials 0.000 description 1
- XETSAYZRDCRPJY-UHFFFAOYSA-M sodium;4-aminobenzoate Chemical compound [Na+].NC1=CC=C(C([O-])=O)C=C1 XETSAYZRDCRPJY-UHFFFAOYSA-M 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 150000003432 sterols Chemical class 0.000 description 1
- 235000003702 sterols Nutrition 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- HXJUTPCZVOIRIF-UHFFFAOYSA-N sulfolane Chemical compound O=S1(=O)CCCC1 HXJUTPCZVOIRIF-UHFFFAOYSA-N 0.000 description 1
- 150000003871 sulfonates Chemical class 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 239000010414 supernatant solution Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- ISHLCKAQWKBMAU-UHFFFAOYSA-N tert-butyl n-diazocarbamate Chemical compound CC(C)(C)OC(=O)N=[N+]=[N-] ISHLCKAQWKBMAU-UHFFFAOYSA-N 0.000 description 1
- 230000001225 therapeutic effect Effects 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 150000003567 thiocyanates Chemical class 0.000 description 1
- BDZBKCUKTQZUTL-UHFFFAOYSA-N triethyl phosphite Chemical compound CCOP(OCC)OCC BDZBKCUKTQZUTL-UHFFFAOYSA-N 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical class OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- KXFSUVJPEQYUGN-UHFFFAOYSA-N trimethyl(phenyl)silane Chemical compound C[Si](C)(C)C1=CC=CC=C1 KXFSUVJPEQYUGN-UHFFFAOYSA-N 0.000 description 1
- GFZYVUABIYOLNS-UHFFFAOYSA-N undecanoyl bromide Chemical compound CCCCCCCCCCC(Br)=O GFZYVUABIYOLNS-UHFFFAOYSA-N 0.000 description 1
- 208000019553 vascular disease Diseases 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D339/00—Heterocyclic compounds containing rings having two sulfur atoms as the only ring hetero atoms
- C07D339/02—Five-membered rings
- C07D339/06—Five-membered rings having the hetero atoms in positions 1 and 3, e.g. cyclic dithiocarbonates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C29/00—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring
- C07C29/132—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group
- C07C29/136—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH
- C07C29/143—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of ketones
- C07C29/145—Preparation of compounds having hydroxy or O-metal groups bound to a carbon atom not belonging to a six-membered aromatic ring by reduction of an oxygen containing functional group of >C=O containing groups, e.g. —COOH of ketones with hydrogen or hydrogen-containing gases
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C309/00—Sulfonic acids; Halides, esters, or anhydrides thereof
- C07C309/63—Esters of sulfonic acids
- C07C309/64—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to acyclic carbon atoms
- C07C309/65—Esters of sulfonic acids having sulfur atoms of esterified sulfo groups bound to acyclic carbon atoms of a saturated carbon skeleton
- C07C309/66—Methanesulfonates
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C317/00—Sulfones; Sulfoxides
- C07C317/26—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C317/28—Sulfones; Sulfoxides having sulfone or sulfoxide groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton with sulfone or sulfoxide groups bound to acyclic carbon atoms of the carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C323/00—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups
- C07C323/23—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton
- C07C323/24—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton
- C07C323/25—Thiols, sulfides, hydropolysulfides or polysulfides substituted by halogen, oxygen or nitrogen atoms, or by sulfur atoms not being part of thio groups containing thio groups and nitrogen atoms, not being part of nitro or nitroso groups, bound to the same carbon skeleton having the sulfur atoms of the thio groups bound to acyclic carbon atoms of the carbon skeleton the carbon skeleton being acyclic and saturated
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C325/00—Thioaldehydes; Thioketones; Thioquinones; Oxides thereof
- C07C325/02—Thioketones; Oxides thereof
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C327/00—Thiocarboxylic acids
- C07C327/02—Monothiocarboxylic acids
- C07C327/04—Monothiocarboxylic acids having carbon atoms of thiocarboxyl groups bound to hydrogen atoms or to acyclic carbon atoms
- C07C327/06—Monothiocarboxylic acids having carbon atoms of thiocarboxyl groups bound to hydrogen atoms or to acyclic carbon atoms to hydrogen atoms or to carbon atoms of an acyclic saturated carbon skeleton
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C327/00—Thiocarboxylic acids
- C07C327/38—Amides of thiocarboxylic acids
- C07C327/40—Amides of thiocarboxylic acids having carbon atoms of thiocarboxamide groups bound to hydrogen atoms or to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/004—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reaction with organometalhalides
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/27—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation
- C07C45/29—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation of hydroxy groups
- C07C45/298—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by oxidation of hydroxy groups with manganese derivatives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C45/00—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds
- C07C45/61—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups
- C07C45/62—Preparation of compounds having >C = O groups bound only to carbon or hydrogen atoms; Preparation of chelates of such compounds by reactions not involving the formation of >C = O groups by hydrogenation of carbon-to-carbon double or triple bonds
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C49/00—Ketones; Ketenes; Dimeric ketenes; Ketonic chelates
- C07C49/04—Saturated compounds containing keto groups bound to acyclic carbon atoms
- C07C49/16—Saturated compounds containing keto groups bound to acyclic carbon atoms containing halogen
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D331/00—Heterocyclic compounds containing rings of less than five members, having one sulfur atom as the only ring hetero atom
- C07D331/02—Three-membered rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/16—Radicals substituted by singly bound hetero atoms other than halogen by oxygen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/14—Radicals substituted by singly bound hetero atoms other than halogen
- C07D333/20—Radicals substituted by singly bound hetero atoms other than halogen by nitrogen atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/22—Radicals substituted by doubly bound hetero atoms, or by two hetero atoms other than halogen singly bound to the same carbon atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D333/00—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom
- C07D333/02—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings
- C07D333/04—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom
- C07D333/06—Heterocyclic compounds containing five-membered rings having one sulfur atom as the only ring hetero atom not condensed with other rings not substituted on the ring sulphur atom with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to the ring carbon atoms
- C07D333/24—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (5)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
GB7844562A GB2033890A (en) | 1978-11-15 | 1978-11-15 | Processes for preparing 4- monoalkylamino)benzoic acids and esters |
IT50816/79A IT1120626B (it) | 1978-11-15 | 1979-11-13 | Procedimento per la preparazione di acidi 4-(ammino-alchilammino)-benzoici dotati di attivita'ipolipidemica ed antiaterosclerotica |
SE7909398A SE7909398L (sv) | 1978-11-15 | 1979-11-14 | Forfarande for framstellning av 4-(monoalkylamino)-bensoesyraderivat |
ES485942A ES8100248A1 (es) | 1978-11-15 | 1979-11-14 | Procedimiento para la preparacion de derivados de acido 4-(monoalquilamino)-benzoico |
DK481579A DK481579A (da) | 1978-11-15 | 1979-11-14 | Fremgangsmaade til fremstilling af 4-(monoalkylamino)benzoesyrer eller salte eller derivater deraf |
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
GB7844562A GB2033890A (en) | 1978-11-15 | 1978-11-15 | Processes for preparing 4- monoalkylamino)benzoic acids and esters |
Publications (1)
Publication Number | Publication Date |
---|---|
GB2033890A true GB2033890A (en) | 1980-05-29 |
Family
ID=10501050
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
GB7844562A Withdrawn GB2033890A (en) | 1978-11-15 | 1978-11-15 | Processes for preparing 4- monoalkylamino)benzoic acids and esters |
Country Status (5)
Country | Link |
---|---|
DK (1) | DK481579A (sv) |
ES (1) | ES8100248A1 (sv) |
GB (1) | GB2033890A (sv) |
IT (1) | IT1120626B (sv) |
SE (1) | SE7909398L (sv) |
Cited By (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4616086A (en) * | 1981-10-08 | 1986-10-07 | Boehringer Mannheim Gmbh | Piperazine-substituted aryl and aralkyl carboxylic acids useful for treating infirmaties caused by excess lipids or thrombocyte |
-
1978
- 1978-11-15 GB GB7844562A patent/GB2033890A/en not_active Withdrawn
-
1979
- 1979-11-13 IT IT50816/79A patent/IT1120626B/it active
- 1979-11-14 ES ES485942A patent/ES8100248A1/es not_active Expired
- 1979-11-14 SE SE7909398A patent/SE7909398L/sv not_active Application Discontinuation
- 1979-11-14 DK DK481579A patent/DK481579A/da unknown
Cited By (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US4616086A (en) * | 1981-10-08 | 1986-10-07 | Boehringer Mannheim Gmbh | Piperazine-substituted aryl and aralkyl carboxylic acids useful for treating infirmaties caused by excess lipids or thrombocyte |
Also Published As
Publication number | Publication date |
---|---|
SE7909398L (sv) | 1980-07-04 |
ES485942A0 (es) | 1980-11-01 |
ES8100248A1 (es) | 1980-11-01 |
DK481579A (da) | 1980-05-16 |
IT1120626B (it) | 1986-03-26 |
IT7950816A0 (it) | 1979-11-13 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
KR910002892B1 (ko) | 술포늄 화합물의 제조방법 | |
DE69431517T2 (de) | Hypolipemische verbindungen | |
DE69529892T2 (de) | BINDUNG VON E-SELECTIN, P-SELECTIN ODER L-SELECTIN AN SIALYL-LEWISx ODER AN SIALYL-LEWISa | |
DE69410956T2 (de) | Naphthylessigsäurederivate als PGEZ Agonisten und Antagonisten | |
DE3000377A1 (de) | Neue sulfonamide, verfahren zu deren herstellung sowie diese verbindungen enthaltende arzneimittel | |
US3795698A (en) | Acetoxy methyl and pivaloyloxymethyl 5-acetamido-2,4,6-triiodo-n-methylisophthalamates | |
CS236484B2 (en) | Method of 9-fluorprostaglandine derivatives production | |
US4022794A (en) | Novel analogs of prostaglandins with 4-oxo-thiazolidinyl nucleus and method of preparation thereof | |
EP0131221A2 (de) | Thioether, Verfahren zu deren Herstellung sowie diese Verbindungen enthaltende Arzneimittel | |
NO147836B (no) | Nye 16-aryloksy-substituerte omega-tetranorprostaglandiner for anvendelse som fruktbarhetsregulerende middel, svangerskapsavbrytende middel eller middel for synkronisering av brunstcyklusen hos husdyr | |
CH637932A5 (de) | Verfahren zur herstellung neuer derivate von perhydro-aza-heterocyclen. | |
DE2540736A1 (de) | Secoprostaglandine | |
CH647511A5 (en) | Process for the preparation of hydantoin derivatives | |
DE69108408T2 (de) | 4,5-dihydroxy und 4,5,8-trihydroxy-9,10-dioxo-2-anthracencarbonsäure-dikohlensäureester und urethane mit therapeutischer wirkung. | |
DD294935A5 (de) | Verfahren zur herstellung von halogensubstituierten diphenylsulfiden und einer sie enthaltenden pharmazeutischen zubereitung | |
JPS60174792A (ja) | メチレンジホスホン酸誘導体、その製造方法および抗リウマチ用薬剤組成物 | |
DE69414194T2 (de) | Aminosäurederivate und ihre Verwendung als Enkephalinase-Inhibitoren | |
US3882230A (en) | Substituted benzoic acid hypolipemic agents | |
DE3613573A1 (de) | Cyclopentylether und ihre herstellung sowie pharmazeutische formulierung | |
GB2033890A (en) | Processes for preparing 4- monoalkylamino)benzoic acids and esters | |
SU730309A3 (ru) | Способ получени 3-алкил-5-изохинолилиминотиазоло-(3,4-б) изохинолинов, или их оптических изомеров, или смесей их оптических изомеров или их солей | |
US3923855A (en) | 2-sulfonyloxyethyl 3-trifluoromethylphenoxy-4{40 -chlorophenyl acetate | |
ES2228028T3 (es) | Derivados de acido 2-metilpropionico y composiciones medicinales que los contienen. | |
IE50767B1 (en) | 5-amino-tetrazole derivatives of retinoic acids,their preparation,and pharmaceutical formulations containing these derivatives | |
DD142186A5 (de) | Verfahren zur herstellung von neuen substituierten aminobenzoesaeuren und deren derivaten |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
WAP | Application withdrawn, taken to be withdrawn or refused ** after publication under section 16(1) |