GB1587573A - 2-cyclo-propylamino-4,6-diamino-s-triazine derivatives and their use as insecticides - Google Patents
2-cyclo-propylamino-4,6-diamino-s-triazine derivatives and their use as insecticides Download PDFInfo
- Publication number
- GB1587573A GB1587573A GB34793/77A GB3479377A GB1587573A GB 1587573 A GB1587573 A GB 1587573A GB 34793/77 A GB34793/77 A GB 34793/77A GB 3479377 A GB3479377 A GB 3479377A GB 1587573 A GB1587573 A GB 1587573A
- Authority
- GB
- United Kingdom
- Prior art keywords
- cyclopropylamino
- represents hydrogen
- methyl
- triazine
- ethyl
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- LVQDKIWDGQRHTE-UHFFFAOYSA-N cyromazine Chemical class NC1=NC(N)=NC(NC2CC2)=N1 LVQDKIWDGQRHTE-UHFFFAOYSA-N 0.000 title claims description 11
- 239000002917 insecticide Substances 0.000 title description 6
- 239000000203 mixture Substances 0.000 claims abstract description 28
- 150000003839 salts Chemical class 0.000 claims abstract description 13
- 239000002253 acid Substances 0.000 claims abstract description 11
- 241000238631 Hexapoda Species 0.000 claims abstract description 9
- 239000001257 hydrogen Substances 0.000 claims description 55
- 229910052739 hydrogen Inorganic materials 0.000 claims description 55
- 239000013543 active substance Substances 0.000 claims description 43
- 150000001875 compounds Chemical class 0.000 claims description 43
- -1 1-piperazinyl Chemical group 0.000 claims description 38
- 150000002431 hydrogen Chemical class 0.000 claims description 37
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 35
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 claims description 30
- 229910052757 nitrogen Inorganic materials 0.000 claims description 27
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 27
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 24
- 238000012360 testing method Methods 0.000 claims description 19
- 238000000034 method Methods 0.000 claims description 18
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 18
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 claims description 14
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 13
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 239000008187 granular material Substances 0.000 claims description 9
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 9
- 239000000126 substance Substances 0.000 claims description 8
- 241000255925 Diptera Species 0.000 claims description 7
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 7
- 239000000758 substrate Substances 0.000 claims description 7
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 6
- 125000002373 5 membered heterocyclic group Chemical group 0.000 claims description 6
- 125000004070 6 membered heterocyclic group Chemical group 0.000 claims description 6
- 229910021529 ammonia Inorganic materials 0.000 claims description 6
- 125000005842 heteroatom Chemical group 0.000 claims description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 claims description 6
- 238000004519 manufacturing process Methods 0.000 claims description 6
- 125000004573 morpholin-4-yl group Chemical group N1(CCOCC1)* 0.000 claims description 6
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 6
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 6
- 150000003335 secondary amines Chemical class 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 5
- 230000018109 developmental process Effects 0.000 claims description 5
- 229910052736 halogen Inorganic materials 0.000 claims description 5
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 5
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 5
- 241000257226 Muscidae Species 0.000 claims description 4
- 239000003795 chemical substances by application Substances 0.000 claims description 4
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 4
- 239000004495 emulsifiable concentrate Substances 0.000 claims description 4
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 4
- 238000011156 evaluation Methods 0.000 claims description 4
- 239000007921 spray Substances 0.000 claims description 4
- 238000010998 test method Methods 0.000 claims description 4
- 235000013618 yogurt Nutrition 0.000 claims description 4
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 3
- 239000000428 dust Substances 0.000 claims description 3
- 230000000694 effects Effects 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 3
- 150000003840 hydrochlorides Chemical class 0.000 claims description 3
- 230000000749 insecticidal effect Effects 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- 230000029052 metamorphosis Effects 0.000 claims description 3
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 2
- ZYFPMEKJGJOIRP-UHFFFAOYSA-N 2-N-cyclopropyl-4-N-ethyl-1,3,5-triazine-2,4,6-triamine dihydrochloride Chemical compound Cl.Cl.CCNC1=NC(N)=NC(NC2CC2)=N1 ZYFPMEKJGJOIRP-UHFFFAOYSA-N 0.000 claims description 2
- SRDNQMPCQFDOJE-UHFFFAOYSA-N 2-n,4-n-dicyclopropyl-1,3,5-triazine-2,4,6-triamine Chemical compound N=1C(NC2CC2)=NC(N)=NC=1NC1CC1 SRDNQMPCQFDOJE-UHFFFAOYSA-N 0.000 claims description 2
- PDEAKEHGTLHCBC-UHFFFAOYSA-N 4-n-cyclopropyl-2-n,2-n-dimethyl-1,3,5-triazine-2,4,6-triamine Chemical compound CN(C)C1=NC(N)=NC(NC2CC2)=N1 PDEAKEHGTLHCBC-UHFFFAOYSA-N 0.000 claims description 2
- ISULFBJTXXCURV-UHFFFAOYSA-N 4-n-cyclopropyl-2-n-ethyl-2-n-methyl-1,3,5-triazine-2,4,6-triamine Chemical compound CCN(C)C1=NC(N)=NC(NC2CC2)=N1 ISULFBJTXXCURV-UHFFFAOYSA-N 0.000 claims description 2
- 241000256118 Aedes aegypti Species 0.000 claims description 2
- 241000554155 Andes Species 0.000 claims description 2
- 241000257161 Calliphoridae Species 0.000 claims description 2
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 claims description 2
- 241000256113 Culicidae Species 0.000 claims description 2
- 241000256103 Simuliidae Species 0.000 claims description 2
- 241000131339 Tipulidae Species 0.000 claims description 2
- 229910052802 copper Inorganic materials 0.000 claims description 2
- 239000010949 copper Substances 0.000 claims description 2
- 238000011010 flushing procedure Methods 0.000 claims description 2
- 230000002401 inhibitory effect Effects 0.000 claims description 2
- 231100000331 toxic Toxicity 0.000 claims description 2
- 230000002588 toxic effect Effects 0.000 claims description 2
- 239000000243 solution Substances 0.000 claims 3
- 239000007864 aqueous solution Substances 0.000 claims 2
- 239000007900 aqueous suspension Substances 0.000 claims 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims 2
- 239000004563 wettable powder Substances 0.000 claims 2
- GGDSREHMWWSRBZ-UHFFFAOYSA-N 2-N-cyclopropyl-4-N-methyl-1,3,5-triazine-2,4,6-triamine dihydrochloride Chemical compound Cl.Cl.C1(CC1)NC1=NC(=NC(=N1)N)NC GGDSREHMWWSRBZ-UHFFFAOYSA-N 0.000 claims 1
- BDCJLBOSMJBNFM-UHFFFAOYSA-N 2-cyclopropyl-2h-1,3,5-triazine-1,4,6-triamine Chemical class N1=C(N)N=C(N)N(N)C1C1CC1 BDCJLBOSMJBNFM-UHFFFAOYSA-N 0.000 claims 1
- ITCZQLULVGXLSG-UHFFFAOYSA-N 6-n-cyclopropyl-2-n,2-n,4-n,4-n-tetramethyl-1,3,5-triazine-2,4,6-triamine Chemical compound CN(C)C1=NC(N(C)C)=NC(NC2CC2)=N1 ITCZQLULVGXLSG-UHFFFAOYSA-N 0.000 claims 1
- GCUXLQJDOSGYOL-UHFFFAOYSA-N Cl.Cl.C1(CC1)NC1=NC(=NC(=N1)NCC)NCC Chemical compound Cl.Cl.C1(CC1)NC1=NC(=NC(=N1)NCC)NCC GCUXLQJDOSGYOL-UHFFFAOYSA-N 0.000 claims 1
- 241000257162 Lucilia <blowfly> Species 0.000 claims 1
- 241000920471 Lucilia caesar Species 0.000 claims 1
- 241000736227 Lucilia sericata Species 0.000 claims 1
- 235000019730 animal feed additive Nutrition 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 229940126214 compound 3 Drugs 0.000 claims 1
- 239000001963 growth medium Substances 0.000 claims 1
- 239000008240 homogeneous mixture Substances 0.000 claims 1
- 125000002883 imidazolyl group Chemical group 0.000 claims 1
- 230000019617 pupation Effects 0.000 claims 1
- 241001465754 Metazoa Species 0.000 abstract description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 abstract description 3
- 230000000974 larvacidal effect Effects 0.000 abstract description 3
- 239000011707 mineral Substances 0.000 abstract description 3
- 241000607479 Yersinia pestis Species 0.000 abstract description 2
- 244000078703 ectoparasite Species 0.000 abstract description 2
- 230000012447 hatching Effects 0.000 abstract description 2
- XVQJMTYDCUOMOO-UHFFFAOYSA-N N-[4-amino-6-(cyclopropylamino)-1,3,5-triazin-2-yl]hydroxylamine Chemical compound C1(CC1)NC1=NC(=NC(=N1)N)NO XVQJMTYDCUOMOO-UHFFFAOYSA-N 0.000 abstract 1
- 239000004480 active ingredient Substances 0.000 abstract 1
- 230000006378 damage Effects 0.000 abstract 1
- 239000000575 pesticide Substances 0.000 abstract 1
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 16
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 15
- 239000002904 solvent Substances 0.000 description 12
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 10
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 10
- 239000002270 dispersing agent Substances 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- 239000000654 additive Substances 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- SZTNFYPHSWHKLS-UHFFFAOYSA-N 1,3,5-triazin-2-amine;dihydrochloride Chemical compound Cl.Cl.NC1=NC=NC=N1 SZTNFYPHSWHKLS-UHFFFAOYSA-N 0.000 description 5
- RHRQKRJGORZWEV-UHFFFAOYSA-N 4-(1,3,5-triazin-2-yl)morpholine Chemical compound C1COCCN1C1=NC=NC=N1 RHRQKRJGORZWEV-UHFFFAOYSA-N 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 230000000996 additive effect Effects 0.000 description 5
- 239000000969 carrier Substances 0.000 description 5
- 238000009472 formulation Methods 0.000 description 5
- 239000006072 paste Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- KCZIUKYAJJEIQG-UHFFFAOYSA-N 1,3,5-triazin-2-amine Chemical compound NC1=NC=NC=N1 KCZIUKYAJJEIQG-UHFFFAOYSA-N 0.000 description 4
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 4
- 229910052783 alkali metal Inorganic materials 0.000 description 4
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 4
- 239000004202 carbamide Substances 0.000 description 4
- 239000007859 condensation product Substances 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- 238000002844 melting Methods 0.000 description 4
- 230000008018 melting Effects 0.000 description 4
- 235000015097 nutrients Nutrition 0.000 description 4
- 239000003960 organic solvent Substances 0.000 description 4
- 239000000843 powder Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- KKVNELLMUOYULB-UHFFFAOYSA-N 1,3,5-triazine;dihydrochloride Chemical compound Cl.Cl.C1=NC=NC=N1 KKVNELLMUOYULB-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- CDYGHSOADWXSHA-UHFFFAOYSA-N 2-pyrrolidin-1-yl-1,3,5-triazine Chemical compound C1CCCN1C1=NC=NC=N1 CDYGHSOADWXSHA-UHFFFAOYSA-N 0.000 description 3
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 3
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- 239000002202 Polyethylene glycol Substances 0.000 description 3
- JASUJWJNQHKHBI-UHFFFAOYSA-N [Cl-].N1=C(N=CN=C1)[NH+]1CCOCC1 Chemical compound [Cl-].N1=C(N=CN=C1)[NH+]1CCOCC1 JASUJWJNQHKHBI-UHFFFAOYSA-N 0.000 description 3
- 150000001340 alkali metals Chemical class 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 230000003559 chemosterilizing effect Effects 0.000 description 3
- 239000012141 concentrate Substances 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- LYCAIKOWRPUZTN-UHFFFAOYSA-N ethylene glycol Natural products OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 3
- 150000002367 halogens Chemical group 0.000 description 3
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- QZXRFOHTSOCLGK-UHFFFAOYSA-N n-propyl-1,3,5-triazin-2-amine Chemical compound CCCNC1=NC=NC=N1 QZXRFOHTSOCLGK-UHFFFAOYSA-N 0.000 description 3
- 229920001223 polyethylene glycol Polymers 0.000 description 3
- 229920000642 polymer Polymers 0.000 description 3
- 239000003206 sterilizing agent Substances 0.000 description 3
- 239000000454 talc Substances 0.000 description 3
- 229910052623 talc Inorganic materials 0.000 description 3
- JYEUMXHLPRZUAT-UHFFFAOYSA-N 1,2,3-triazine Chemical compound C1=CN=NN=C1 JYEUMXHLPRZUAT-UHFFFAOYSA-N 0.000 description 2
- DQUDKYAOQDREIB-UHFFFAOYSA-N 1,3,5-triazin-1-ium;chloride Chemical compound Cl.C1=NC=NC=N1 DQUDKYAOQDREIB-UHFFFAOYSA-N 0.000 description 2
- JCRNSBKSAQHNIN-UHFFFAOYSA-N 2,4-dibutylnaphthalene-1-sulfonic acid Chemical class C1=CC=CC2=C(S(O)(=O)=O)C(CCCC)=CC(CCCC)=C21 JCRNSBKSAQHNIN-UHFFFAOYSA-N 0.000 description 2
- GJVAYPWJOBBCKD-UHFFFAOYSA-N 2-n-cyclopropyl-6-morpholin-4-yl-1,3,5-triazine-2,4-diamine Chemical compound N=1C(N2CCOCC2)=NC(N)=NC=1NC1CC1 GJVAYPWJOBBCKD-UHFFFAOYSA-N 0.000 description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 2
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 101100172132 Mus musculus Eif3a gene Proteins 0.000 description 2
- 241000257159 Musca domestica Species 0.000 description 2
- UFWIBTONFRDIAS-UHFFFAOYSA-N Naphthalene Chemical compound C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 2
- 235000011941 Tilia x europaea Nutrition 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 239000003674 animal food additive Substances 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- 150000002170 ethers Chemical class 0.000 description 2
- 150000002191 fatty alcohols Chemical class 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 2
- 239000004571 lime Substances 0.000 description 2
- 235000012054 meals Nutrition 0.000 description 2
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical class NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 2
- 235000010755 mineral Nutrition 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 150000002790 naphthalenes Chemical class 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- JIHQDMXYYFUGFV-UHFFFAOYSA-N 1,3,5-triazine Chemical compound C1=NC=NC=N1 JIHQDMXYYFUGFV-UHFFFAOYSA-N 0.000 description 1
- PAWQVTBBRAZDMG-UHFFFAOYSA-N 2-(3-bromo-2-fluorophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC(Br)=C1F PAWQVTBBRAZDMG-UHFFFAOYSA-N 0.000 description 1
- 125000004200 2-methoxyethyl group Chemical group [H]C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- IJEHQXQJOALZHG-UHFFFAOYSA-N 2-n,4-n,6-n-tricyclohexyl-1,3,5-triazine-2,4,6-triamine Chemical compound C1CCCCC1NC1=NC(NC2CCCCC2)=NC(NC2CCCCC2)=N1 IJEHQXQJOALZHG-UHFFFAOYSA-N 0.000 description 1
- PSUUJJDPUSEFPD-UHFFFAOYSA-N 2-n,4-n,6-n-tricyclopropyl-1,3,5-triazine-2,4,6-triamine Chemical compound C1CC1NC1=NC(NC2CC2)=NC(NC2CC2)=N1 PSUUJJDPUSEFPD-UHFFFAOYSA-N 0.000 description 1
- FHEJGRHXJIQFRP-UHFFFAOYSA-N 2-n-cyclohexyl-1,3,5-triazine-2,4,6-triamine Chemical compound NC1=NC(N)=NC(NC2CCCCC2)=N1 FHEJGRHXJIQFRP-UHFFFAOYSA-N 0.000 description 1
- NSXXHPWWTOOLGX-UHFFFAOYSA-N 2-n-cyclohexyl-4-n,6-n-dihexyl-1,3,5-triazine-2,4,6-triamine Chemical compound CCCCCCNC1=NC(NCCCCCC)=NC(NC2CCCCC2)=N1 NSXXHPWWTOOLGX-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- 125000001494 2-propynyl group Chemical group [H]C#CC([H])([H])* 0.000 description 1
- YLZOPXRUQYQQID-UHFFFAOYSA-N 3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)-1-[4-[2-[[3-(trifluoromethoxy)phenyl]methylamino]pyrimidin-5-yl]piperazin-1-yl]propan-1-one Chemical compound N1N=NC=2CN(CCC=21)CCC(=O)N1CCN(CC1)C=1C=NC(=NC=1)NCC1=CC(=CC=C1)OC(F)(F)F YLZOPXRUQYQQID-UHFFFAOYSA-N 0.000 description 1
- BFZPFVIKDQXXKY-UHFFFAOYSA-N 4,6-dichloro-n-cyclopropyl-1,3,5-triazin-2-amine Chemical compound ClC1=NC(Cl)=NC(NC2CC2)=N1 BFZPFVIKDQXXKY-UHFFFAOYSA-N 0.000 description 1
- OFMQRQUUPYBUND-UHFFFAOYSA-N 6-chloro-2-n-cyclopropyl-1,3,5-triazine-2,4-diamine Chemical compound NC1=NC(Cl)=NC(NC2CC2)=N1 OFMQRQUUPYBUND-UHFFFAOYSA-N 0.000 description 1
- OOHIAOSLOGDBCE-UHFFFAOYSA-N 6-chloro-4-n-cyclopropyl-2-n-propan-2-yl-1,3,5-triazine-2,4-diamine Chemical compound CC(C)NC1=NC(Cl)=NC(NC2CC2)=N1 OOHIAOSLOGDBCE-UHFFFAOYSA-N 0.000 description 1
- 229910002012 Aerosil® Inorganic materials 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- 239000004254 Ammonium phosphate Substances 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- YIFJZLTZJLGECF-UHFFFAOYSA-N Cl.Cl.CN(C)C1=NC=NC=N1 Chemical compound Cl.Cl.CN(C)C1=NC=NC=N1 YIFJZLTZJLGECF-UHFFFAOYSA-N 0.000 description 1
- HTJDQJBWANPRPF-UHFFFAOYSA-N Cyclopropylamine Chemical compound NC1CC1 HTJDQJBWANPRPF-UHFFFAOYSA-N 0.000 description 1
- ZAKOWWREFLAJOT-CEFNRUSXSA-N D-alpha-tocopherylacetate Chemical compound CC(=O)OC1=C(C)C(C)=C2O[C@@](CCC[C@H](C)CCC[C@H](C)CCCC(C)C)(C)CCC2=C1C ZAKOWWREFLAJOT-CEFNRUSXSA-N 0.000 description 1
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical class [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- 241000257229 Musca <genus> Species 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- 125000000304 alkynyl group Chemical group 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 229910000148 ammonium phosphate Inorganic materials 0.000 description 1
- 235000019289 ammonium phosphates Nutrition 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 239000001166 ammonium sulphate Substances 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 230000003115 biocidal effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- FUFJGUQYACFECW-UHFFFAOYSA-L calcium hydrogenphosphate Chemical compound [Ca+2].OP([O-])([O-])=O FUFJGUQYACFECW-UHFFFAOYSA-L 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 125000002091 cationic group Chemical group 0.000 description 1
- 239000001913 cellulose Substances 0.000 description 1
- 229920002678 cellulose Polymers 0.000 description 1
- 239000007931 coated granule Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- MNNHAPBLZZVQHP-UHFFFAOYSA-N diammonium hydrogen phosphate Chemical compound [NH4+].[NH4+].OP([O-])([O-])=O MNNHAPBLZZVQHP-UHFFFAOYSA-N 0.000 description 1
- QGBSISYHAICWAH-UHFFFAOYSA-N dicyandiamide Chemical compound NC(N)=NC#N QGBSISYHAICWAH-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- 238000007865 diluting Methods 0.000 description 1
- 229960001760 dimethyl sulfoxide Drugs 0.000 description 1
- 239000004491 dispersible concentrate Substances 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 125000000031 ethylamino group Chemical group [H]C([H])([H])C([H])([H])N([H])[*] 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- 239000010433 feldspar Substances 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000006260 foam Substances 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- IVJISJACKSSFGE-UHFFFAOYSA-N formaldehyde;1,3,5-triazine-2,4,6-triamine Chemical compound O=C.NC1=NC(N)=NC(N)=N1 IVJISJACKSSFGE-UHFFFAOYSA-N 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- GOQYKNQRPGWPLP-UHFFFAOYSA-N heptadecan-1-ol Chemical class CCCCCCCCCCCCCCCCCO GOQYKNQRPGWPLP-UHFFFAOYSA-N 0.000 description 1
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical class CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 239000002949 juvenile hormone Substances 0.000 description 1
- 229930014550 juvenile hormone Natural products 0.000 description 1
- 150000003633 juvenile hormone derivatives Chemical class 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 239000012669 liquid formulation Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- 235000012245 magnesium oxide Nutrition 0.000 description 1
- 235000019341 magnesium sulphate Nutrition 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- 150000007974 melamines Chemical class 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- BOIGFJNPJFOCRH-UHFFFAOYSA-N n,n-diethyl-1,3,5-triazin-2-amine Chemical compound CCN(CC)C1=NC=NC=N1 BOIGFJNPJFOCRH-UHFFFAOYSA-N 0.000 description 1
- FMRBCDBWXGFHHC-UHFFFAOYSA-N n,n-dimethyl-1,3,5-triazin-2-amine Chemical compound CN(C)C1=NC=NC=N1 FMRBCDBWXGFHHC-UHFFFAOYSA-N 0.000 description 1
- WJLQLSUBVBWUKS-UHFFFAOYSA-N n-(1,3,5-triazin-2-yl)hydroxylamine Chemical compound ONC1=NC=NC=N1 WJLQLSUBVBWUKS-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- PUPPKTICUIGNCI-UHFFFAOYSA-N n-butyl-1,3,5-triazin-2-amine Chemical compound CCCCNC1=NC=NC=N1 PUPPKTICUIGNCI-UHFFFAOYSA-N 0.000 description 1
- VXMGBSXIKBWFBU-UHFFFAOYSA-N n-methyl-1,3,5-triazin-2-amine Chemical compound CNC1=NC=NC=N1 VXMGBSXIKBWFBU-UHFFFAOYSA-N 0.000 description 1
- NKUXJZGXSINEMP-UHFFFAOYSA-N n-propan-2-yl-1,3,5-triazin-2-amine Chemical compound CC(C)NC1=NC=NC=N1 NKUXJZGXSINEMP-UHFFFAOYSA-N 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- 229920002239 polyacrylonitrile Polymers 0.000 description 1
- 229920000728 polyester Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 235000012219 potassium aluminium silicate Nutrition 0.000 description 1
- 244000144977 poultry Species 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 235000012217 sodium aluminium silicate Nutrition 0.000 description 1
- 159000000000 sodium salts Chemical class 0.000 description 1
- 238000002336 sorption--desorption measurement Methods 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000001117 sulphuric acid Substances 0.000 description 1
- 235000011149 sulphuric acid Nutrition 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 229920002994 synthetic fiber Polymers 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- PHYFQTYBJUILEZ-IUPFWZBJSA-N triolein Chemical compound CCCCCCCC\C=C/CCCCCCCC(=O)OCC(OC(=O)CCCCCCC\C=C/CCCCCCCC)COC(=O)CCCCCCC\C=C/CCCCCCCC PHYFQTYBJUILEZ-IUPFWZBJSA-N 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/54—Three nitrogen atoms
- C07D251/70—Other substituted melamines
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/64—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with three nitrogen atoms as the only ring hetero atoms
- A01N43/66—1,3,5-Triazines, not hydrogenated and not substituted at the ring nitrogen atoms
- A01N43/68—1,3,5-Triazines, not hydrogenated and not substituted at the ring nitrogen atoms with two or three nitrogen atoms directly attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D251/00—Heterocyclic compounds containing 1,3,5-triazine rings
- C07D251/02—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings
- C07D251/12—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members
- C07D251/26—Heterocyclic compounds containing 1,3,5-triazine rings not condensed with other rings having three double bonds between ring members or between ring members and non-ring members with only hetero atoms directly attached to ring carbon atoms
- C07D251/40—Nitrogen atoms
- C07D251/54—Three nitrogen atoms
- C07D251/66—Derivatives of melamine in which a hetero atom is directly attached to a nitrogen atom of melamine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1055876A CH604517A5 (enExample) | 1976-08-19 | 1976-08-19 | |
| CH271877A CH609835A5 (en) | 1976-08-19 | 1977-03-04 | Pesticide |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1587573A true GB1587573A (en) | 1981-04-08 |
Family
ID=25691226
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB34793/77A Expired GB1587573A (en) | 1976-08-19 | 1977-08-18 | 2-cyclo-propylamino-4,6-diamino-s-triazine derivatives and their use as insecticides |
Country Status (19)
| Country | Link |
|---|---|
| JP (1) | JPS6052705B2 (enExample) |
| AT (1) | AT361249B (enExample) |
| AU (1) | AU518896B2 (enExample) |
| BE (1) | BE857896A (enExample) |
| CA (1) | CA1084921A (enExample) |
| CH (1) | CH609835A5 (enExample) |
| CY (1) | CY1248A (enExample) |
| DE (1) | DE2736876A1 (enExample) |
| ES (1) | ES461715A1 (enExample) |
| FR (1) | FR2362134A1 (enExample) |
| GB (1) | GB1587573A (enExample) |
| HK (1) | HK25382A (enExample) |
| IL (1) | IL52765A (enExample) |
| KE (1) | KE3216A (enExample) |
| MY (1) | MY8300055A (enExample) |
| NL (3) | NL184894B (enExample) |
| NZ (1) | NZ184953A (enExample) |
| SU (1) | SU727104A3 (enExample) |
| YU (2) | YU41077B (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2167960A (en) * | 1984-12-06 | 1986-06-11 | Ciba Geigy Ag | Dressing seeds with pesticidal triamino triazines |
| DE102007045957A1 (de) | 2007-09-26 | 2009-04-09 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden und akarziden Eigenschaften |
| EP2460408A1 (en) | 2004-12-17 | 2012-06-06 | deVGen N.V. | Nematicidal compositions |
| US8828907B2 (en) | 2009-03-25 | 2014-09-09 | Bayer Cropscience Ag | Active ingredient combinations having insecticidal and acaricidal properties |
| CN108276351A (zh) * | 2018-02-11 | 2018-07-13 | 天津大学 | 具有潜在抗癌效果化合物及其测定方法 |
Families Citing this family (16)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4187305A (en) * | 1978-02-17 | 1980-02-05 | Ciba-Geigy Corporation | Procedure for treating mammals to control parasitic diptera larvae |
| US4187304A (en) * | 1978-02-17 | 1980-02-05 | Ciba-Geigy Corporation | Procedure for treating mammals to control parasitic diptera larvae |
| JPS5622731A (en) * | 1979-08-03 | 1981-03-03 | Ciba Geigy Ag | Method of treating mammals to repel parasites |
| JPS5626883A (en) * | 1979-08-11 | 1981-03-16 | Ciba Geigy Ag | Compound and composition for treating mammal to expel parasite |
| US4402954A (en) | 1980-11-24 | 1983-09-06 | Ciba-Geigy Corporation | Synergistic pesticidal compositions comprising N-(2-methyl-4-chlorophenyl)-N',N'-dimethylthiourea and 2,4-diamino-6-cyclopropylamino-2-triazine or 2,4-diamino-6-isopropylamino-2-triazine |
| DE3166207D1 (en) * | 1980-11-25 | 1984-10-25 | Ciba Geigy Ag | Pesticide agents |
| ATE9428T1 (de) * | 1980-11-25 | 1984-10-15 | Ciba-Geigy Ag | Schaedlingsbekaempfungsmittel. |
| JPS5840314A (ja) * | 1981-09-04 | 1983-03-09 | Mitsui Toatsu Chem Inc | プロピレンブロツク共重合体組成物 |
| JPS5941317A (ja) * | 1982-08-31 | 1984-03-07 | Mitsui Toatsu Chem Inc | プロピレン―エチレンブロック共重合体の製造法 |
| NZ221262A (en) * | 1986-08-06 | 1990-08-28 | Ciba Geigy Ag | Preventing the reinfestation of dogs and cats by fleas by administering to the host a flea growth inhibiting substance orally, parenterally or by implant |
| JPS6415408U (enExample) * | 1987-07-15 | 1989-01-26 | ||
| US4967158A (en) * | 1989-03-31 | 1990-10-30 | Hydro-Quebec | Portable detector device for detecting partial electrical discharge in live voltage distribution cables and/or equipment |
| DE19825379A1 (de) * | 1998-06-06 | 1999-12-09 | Bayer Ag | Verwendung von substituierten 2,4-Diamino-1,3,5-triazinen zur Bekämpfung tierischer Schädlinge |
| DE102007045922A1 (de) | 2007-09-26 | 2009-04-02 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| EP2127522A1 (de) | 2008-05-29 | 2009-12-02 | Bayer CropScience AG | Wirkstoffkombinationen mit insektiziden und akariziden Eigenschaften |
| EP2382865A1 (de) | 2010-04-28 | 2011-11-02 | Bayer CropScience AG | Synergistische Wirkstoffkombinationen |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2567847A (en) * | 1951-09-11 | Preparation of substituted | ||
| US3189521A (en) * | 1964-12-24 | 1965-06-15 | Alexej B Borkovec | Diamino- and triamino-s-triazines as chemosterilants for insects |
| IL39385A (en) * | 1971-06-01 | 1974-12-31 | Ciba Geigy Ag | A method for combating insects by the use of 4-azido-2,6-diamino triazine derivatives,certain such novel derivatives and their manufacture |
-
1977
- 1977-03-04 CH CH271877A patent/CH609835A5/xx active Protection Beyond IP Right Term
- 1977-08-16 DE DE19772736876 patent/DE2736876A1/de active Granted
- 1977-08-17 SU SU772511554A patent/SU727104A3/ru active
- 1977-08-17 CA CA284,903A patent/CA1084921A/en not_active Expired
- 1977-08-17 NL NLAANVRAGE7709096,A patent/NL184894B/xx active Protection Beyond IP Right Term
- 1977-08-17 YU YU1988/77A patent/YU41077B/xx unknown
- 1977-08-17 IL IL52765A patent/IL52765A/xx unknown
- 1977-08-18 CY CY1248A patent/CY1248A/xx unknown
- 1977-08-18 AT AT598677A patent/AT361249B/de not_active IP Right Cessation
- 1977-08-18 BE BE180257A patent/BE857896A/xx not_active IP Right Cessation
- 1977-08-18 ES ES461715A patent/ES461715A1/es not_active Expired
- 1977-08-18 NZ NZ184953A patent/NZ184953A/xx unknown
- 1977-08-18 FR FR7725247A patent/FR2362134A1/fr active Granted
- 1977-08-18 GB GB34793/77A patent/GB1587573A/en not_active Expired
- 1977-08-19 JP JP52099398A patent/JPS6052705B2/ja not_active Expired
- 1977-08-19 AU AU28041/77A patent/AU518896B2/en not_active Expired
-
1982
- 1982-05-31 KE KE3216A patent/KE3216A/xx unknown
- 1982-06-04 YU YU1191/82A patent/YU41270B/xx unknown
- 1982-06-10 HK HK253/82A patent/HK25382A/en not_active IP Right Cessation
-
1983
- 1983-12-30 MY MY55/83A patent/MY8300055A/xx unknown
-
1993
- 1993-06-22 NL NL930086C patent/NL930086I2/nl unknown
-
1997
- 1997-08-08 NL NL971032C patent/NL971032I2/nl unknown
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2167960A (en) * | 1984-12-06 | 1986-06-11 | Ciba Geigy Ag | Dressing seeds with pesticidal triamino triazines |
| EP2460408A1 (en) | 2004-12-17 | 2012-06-06 | deVGen N.V. | Nematicidal compositions |
| DE102007045957A1 (de) | 2007-09-26 | 2009-04-09 | Bayer Cropscience Ag | Wirkstoffkombinationen mit insektiziden und akarziden Eigenschaften |
| US8828907B2 (en) | 2009-03-25 | 2014-09-09 | Bayer Cropscience Ag | Active ingredient combinations having insecticidal and acaricidal properties |
| CN108276351A (zh) * | 2018-02-11 | 2018-07-13 | 天津大学 | 具有潜在抗癌效果化合物及其测定方法 |
Also Published As
| Publication number | Publication date |
|---|---|
| YU41077B (en) | 1986-12-31 |
| ES461715A1 (es) | 1978-10-01 |
| HK25382A (en) | 1982-06-18 |
| FR2362134B1 (enExample) | 1980-02-01 |
| NL971032I2 (nl) | 1998-03-02 |
| BE857896A (fr) | 1978-02-20 |
| JPS6052705B2 (ja) | 1985-11-20 |
| AT361249B (de) | 1981-02-25 |
| MY8300055A (en) | 1983-12-31 |
| IL52765A (en) | 1981-12-31 |
| CA1084921A (en) | 1980-09-02 |
| SU727104A3 (ru) | 1980-04-05 |
| YU119182A (en) | 1984-06-30 |
| NL930086I2 (nl) | 1995-03-01 |
| NZ184953A (en) | 1980-08-26 |
| YU198877A (en) | 1982-10-31 |
| CH609835A5 (en) | 1979-03-30 |
| AU518896B2 (en) | 1981-10-29 |
| AU2804177A (en) | 1979-02-22 |
| NL184894B (nl) | 1989-07-03 |
| NL971032I1 (nl) | 1997-10-01 |
| ATA598677A (de) | 1980-07-15 |
| FR2362134A1 (fr) | 1978-03-17 |
| KE3216A (en) | 1982-07-09 |
| DE2736876A1 (de) | 1978-02-23 |
| IL52765A0 (en) | 1977-10-31 |
| CY1248A (en) | 1984-08-31 |
| DE2736876C2 (enExample) | 1989-01-19 |
| NL7709096A (nl) | 1978-02-21 |
| NL930086I1 (nl) | 1993-09-16 |
| YU41270B (en) | 1986-12-31 |
| JPS5325585A (en) | 1978-03-09 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4225598A (en) | 2-Cyclopropylamino-4,6-diamino-s-triazine | |
| CA1084921A (en) | Derivatives of 2-cyclopropylamino-4,6-diamino-s- triazine as insecticides | |
| CS235984B2 (en) | Herbicide agent and method of its effective component production | |
| US3696101A (en) | Tetrahydrobenzothiazolyl derivatives and their use as herbicides | |
| SK279496B6 (sk) | Herbicídny prostriedok a jeho použitie | |
| US4160832A (en) | Novel insecticides | |
| US4160831A (en) | Novel insecticides | |
| US3853868A (en) | Azido-s-triazines | |
| US3830810A (en) | S-triazine derivatives | |
| US3753986A (en) | Triazine herbicides | |
| CA1084922A (en) | Derivatives of 2-cyclopropylamino-4-formamidino-6- amino-s-triazine as insecticides | |
| CA1084923A (en) | Derivatives of 2-cyclopropylamino-4-formylamino-6- amino-s-triazine as insecticides | |
| US3899489A (en) | Hexahydrotriazinone derivatives | |
| US4020066A (en) | Formylamino-2-triazines | |
| US4020067A (en) | Triazinyl-amidines | |
| CH638376A5 (en) | Pesticide | |
| US4000272A (en) | Control of certain insects of the order diptera with diamino-azido-s-triazines | |
| US3927087A (en) | New thiourea derivatives | |
| CH604518A5 (en) | Insecticidal cyclopropyl-amino-formamidino amino triazine cpds. | |
| SU741774A3 (ru) | Инсектицидное средство | |
| US3856950A (en) | Method of combating insects | |
| IL39386A (en) | Method of combating insects using 2-azido-4-alkoxymethylamino-6-alkylamino-s-triazine derivatives | |
| SU715007A1 (ru) | Инсектоакарицидное средство | |
| US3641035A (en) | Pesticidal compounds and compositions containing them | |
| SI7711988A8 (sl) | Novi insekticidi |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| 704A | Declaration that licence is not available as of right for an excepted use (par. 4a/1977) | ||
| CTFF | Supplementary protection certificate filed |
Free format text: SPC/GB93/039, 930512 |
|
| CTFF | Supplementary protection certificate filed |
Free format text: SPC/GB93/039, 930701 |
|
| CTFG | Supplementary protection certificate granted |
Free format text: SPC/GB93/039, 930701, EXPIRES:20020817 |
|
| CTFE | Supplementary protection certificate entered into force |
Free format text: SPC/GB93/039, 970818, EXPIRES:20020817 |
|
| PE20 | Patent expired after termination of 20 years |
Effective date: 19970817 |
|
| SPCE | Supplementary protection certificate expired |
Free format text: SPC/GB93/039: 20020817 |