GB1578246A - Fluorescent lighting - Google Patents
Fluorescent lighting Download PDFInfo
- Publication number
- GB1578246A GB1578246A GB11074/77A GB1107477A GB1578246A GB 1578246 A GB1578246 A GB 1578246A GB 11074/77 A GB11074/77 A GB 11074/77A GB 1107477 A GB1107477 A GB 1107477A GB 1578246 A GB1578246 A GB 1578246A
- Authority
- GB
- United Kingdom
- Prior art keywords
- passage
- neon
- krypton
- argon
- gas
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000007789 gas Substances 0.000 claims description 34
- XKRFYHLGVUSROY-UHFFFAOYSA-N Argon Chemical compound [Ar] XKRFYHLGVUSROY-UHFFFAOYSA-N 0.000 claims description 32
- 229910052786 argon Inorganic materials 0.000 claims description 21
- 229910052743 krypton Inorganic materials 0.000 claims description 20
- 229910052754 neon Inorganic materials 0.000 claims description 20
- DNNSSWSSYDEUBZ-UHFFFAOYSA-N krypton atom Chemical compound [Kr] DNNSSWSSYDEUBZ-UHFFFAOYSA-N 0.000 claims description 16
- GKAOGPIIYCISHV-UHFFFAOYSA-N neon atom Chemical compound [Ne] GKAOGPIIYCISHV-UHFFFAOYSA-N 0.000 claims description 16
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 claims description 14
- 239000011248 coating agent Substances 0.000 claims description 12
- 238000000576 coating method Methods 0.000 claims description 12
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 claims description 8
- 229910052753 mercury Inorganic materials 0.000 claims description 8
- 239000000203 mixture Substances 0.000 claims description 8
- WYTGDNHDOZPMIW-RCBQFDQVSA-N alstonine Natural products C1=CC2=C3C=CC=CC3=NC2=C2N1C[C@H]1[C@H](C)OC=C(C(=O)OC)[C@H]1C2 WYTGDNHDOZPMIW-RCBQFDQVSA-N 0.000 claims description 2
- 238000004891 communication Methods 0.000 claims description 2
- 230000005855 radiation Effects 0.000 claims description 2
- 239000003795 chemical substances by application Substances 0.000 claims 2
- 241000721267 Macara Species 0.000 claims 1
- 238000007789 sealing Methods 0.000 description 7
- 239000011575 calcium Substances 0.000 description 5
- 239000011521 glass Substances 0.000 description 4
- 239000000463 material Substances 0.000 description 4
- 230000008033 biological extinction Effects 0.000 description 3
- -1 europium-activated yttrium Chemical class 0.000 description 3
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 2
- 229910052693 Europium Inorganic materials 0.000 description 2
- 229910052791 calcium Inorganic materials 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 230000007423 decrease Effects 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 229910052748 manganese Inorganic materials 0.000 description 2
- 230000013011 mating Effects 0.000 description 2
- 229910052761 rare earth metal Inorganic materials 0.000 description 2
- 150000002910 rare earth metals Chemical class 0.000 description 2
- 229940126062 Compound A Drugs 0.000 description 1
- 108010043121 Green Fluorescent Proteins Proteins 0.000 description 1
- NLDMNSXOCDLTTB-UHFFFAOYSA-N Heterophylliin A Natural products O1C2COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C(OC(=O)C=2C=C(O)C(O)=C(O)C=2)C(O)C1OC(=O)C1=CC(O)=C(O)C(O)=C1 NLDMNSXOCDLTTB-UHFFFAOYSA-N 0.000 description 1
- 229910052771 Terbium Inorganic materials 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 244000309466 calf Species 0.000 description 1
- 238000010276 construction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- DXNVUKXMTZHOTP-UHFFFAOYSA-N dialuminum;dimagnesium;barium(2+);oxygen(2-) Chemical class [O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[O-2].[Mg+2].[Mg+2].[Al+3].[Al+3].[Ba+2].[Ba+2] DXNVUKXMTZHOTP-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- GZCRRIHWUXGPOV-UHFFFAOYSA-N terbium atom Chemical compound [Tb] GZCRRIHWUXGPOV-UHFFFAOYSA-N 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 238000004017 vitrification Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/30—Vessels; Containers
- H01J61/32—Special longitudinal shape, e.g. for advertising purposes
Landscapes
- Vessels And Coating Films For Discharge Lamps (AREA)
- Manufacture Of Electron Tubes, Discharge Lamp Vessels, Lead-In Wires, And The Like (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP3065976A JPS52113584A (en) | 1976-03-19 | 1976-03-19 | Lamp and its production method |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1578246A true GB1578246A (en) | 1980-11-05 |
Family
ID=12309876
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB11074/77A Expired GB1578246A (en) | 1976-03-19 | 1977-03-16 | Fluorescent lighting |
Country Status (3)
| Country | Link |
|---|---|
| US (1) | US4095135A (enExample) |
| JP (1) | JPS52113584A (enExample) |
| GB (1) | GB1578246A (enExample) |
Families Citing this family (21)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS581509B2 (ja) * | 1977-08-10 | 1983-01-11 | 株式会社日立製作所 | 低圧気体放電灯 |
| NL7801635A (nl) * | 1978-02-14 | 1979-08-16 | Philips Nv | Lagedruknatriumdampontladingslamp. |
| NL7812539A (nl) * | 1978-02-14 | 1979-08-16 | Philips Nv | Lagedrukkwikdampontladingslamp. |
| NL7802511A (nl) * | 1978-03-08 | 1979-09-11 | Philips Nv | Lagedrukontladingslamp. |
| US4196374A (en) * | 1978-12-14 | 1980-04-01 | General Electric Company | Compact fluorescent lamp and method of making |
| US4319162A (en) * | 1979-02-13 | 1982-03-09 | Westinghouse Electric Corp. | Fluorescent lamp having a convoluted tubular envelope of compact tridimensional configuration |
| US4281271A (en) * | 1979-06-12 | 1981-07-28 | Westinghouse Electric Corp. | Compact fluorescent lamp having a partitioned envelope |
| NL7906202A (nl) * | 1979-08-15 | 1981-02-17 | Philips Nv | Lagedrukontladingslamp. |
| NL7906203A (nl) * | 1979-08-15 | 1981-02-17 | Philips Nv | Lagedrukkwikdampontladingslamp. |
| US4286190A (en) * | 1979-09-26 | 1981-08-25 | Westinghouse Electric Corp. | Compact fluorescent lamp having a partitioned envelope |
| NL8001280A (nl) * | 1980-03-04 | 1981-10-01 | Philips Nv | Lagedrukontladingslamp. |
| JPS56160753A (en) * | 1980-05-14 | 1981-12-10 | Matsushita Electronics Corp | Fluorescent bulb and manufacturing method |
| JPS5787059A (en) * | 1980-11-17 | 1982-05-31 | Mitsubishi Electric Corp | Discharge lamp |
| JPS57130340A (en) * | 1981-02-05 | 1982-08-12 | Matsushita Electronics Corp | Production of discharge lamp |
| JPS57134856A (en) * | 1981-02-13 | 1982-08-20 | Matsushita Electronics Corp | Discharge lamp |
| US4454448A (en) * | 1982-01-18 | 1984-06-12 | General Electric Company | Inter-channel isolation scheme for compact, folded discharge lamps |
| CH670956A5 (enExample) * | 1986-09-23 | 1989-07-31 | Friedrich Wolff | |
| DE10129464A1 (de) * | 2001-06-19 | 2003-01-02 | Philips Corp Intellectual Pty | Niederdruckgasentladungslampe mit quecksilberfreier Gasfüllung |
| DE102012103268B4 (de) * | 2012-04-16 | 2015-08-20 | Walter Wallner | Gasentladungslampe mit Verbindungsbereich zwischen Innenzylinder und Aussenrohr und Durchgangsöffnung im Verbindungsbereich |
| DE102012103272B3 (de) * | 2012-04-16 | 2013-05-23 | Walter Wallner | Lampensockel für Gasentladungslampe |
| JP6067548B2 (ja) * | 2013-12-18 | 2017-01-25 | トヨタ自動車株式会社 | 情報処理装置 |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB590703A (en) * | 1944-12-21 | 1947-07-25 | Gen Electric Co Ltd | Improvements in and relating to electric discharge lamps |
| DE906245C (de) * | 1950-06-22 | 1954-03-11 | Paul Jahn Dipl Ing | Lumineszenzlampe |
| US3551736A (en) * | 1968-04-02 | 1970-12-29 | Gunther Anthony Doehner | Fluorescent lamps constructed for use in conventional light fixtures |
| US3609436A (en) * | 1969-04-21 | 1971-09-28 | Gen Electric | Fluorescent light source with a plurality of sequentially energized electrodes |
| JPS4818021U (enExample) * | 1971-07-10 | 1973-03-01 | ||
| US3903447A (en) * | 1971-10-22 | 1975-09-02 | Westinghouse Electric Corp | Single-ended electric discharge lamp having tubular envelope with partition means that provides a helical arc path |
| US3849689A (en) * | 1973-07-02 | 1974-11-19 | Gen Electric | Sequential discharge fluorescent lamp |
-
1976
- 1976-03-19 JP JP3065976A patent/JPS52113584A/ja active Granted
-
1977
- 1977-03-16 US US05/778,146 patent/US4095135A/en not_active Expired - Lifetime
- 1977-03-16 GB GB11074/77A patent/GB1578246A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS5737105B2 (enExample) | 1982-08-07 |
| JPS52113584A (en) | 1977-09-22 |
| US4095135A (en) | 1978-06-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1578246A (en) | Fluorescent lighting | |
| GB2050046A (en) | Low-pressure discharge lamp | |
| EP0758795A1 (en) | Amalgam containing compact fluorescent lamp with improved warm-up | |
| GB2056762A (en) | Low-pressure mercury vapour discharge lamps | |
| US4142125A (en) | Fluorescent discharge lamp with inner hollow tube offset from envelope axis | |
| EP0270083A2 (en) | Low-pressure discharge lamp | |
| US4445069A (en) | Low-pressure discharge lamp | |
| US6049164A (en) | Low-pressure mercury lamp with specific electrode screens | |
| US4904900A (en) | Glow discharge lamp | |
| EP0184215B1 (en) | Low pressure arc discharge tube | |
| US5592048A (en) | Arc tube electrodeless high pressure sodium lamp | |
| EP1547125B1 (en) | Low pressure mercury vapour fluorescent lamps | |
| US6037714A (en) | Hollow electrodes for low pressure discharge lamps, particularly narrow diameter fluorescent and neon lamps and lamps containing the same | |
| GB2157883A (en) | Low-pressure mercury vapour discharge lamp | |
| US4546285A (en) | Low-pressure mercury vapor discharge lamp | |
| US5982097A (en) | Hollow electrodes for low pressure discharge lamps, particularly narrow diameter fluorescent and neon lamps and lamps containing the same | |
| GB2071407A (en) | Low-pressure discharge lamp | |
| US5218269A (en) | Negative glow discharge lamp having wire anode | |
| US4884007A (en) | Low pressure arc discharge tube having increased voltage | |
| EP0184217B1 (en) | Low pressure arc discharge tube having increased voltage | |
| EP0466138B1 (en) | Cold cathode discharge lamp | |
| US20030085655A1 (en) | Low-pressure mercury discharge lamp | |
| WO2002050871A1 (en) | Fluorescent colortone lamp with reduced mercury | |
| JPH05144412A (ja) | 蛍光ランプ | |
| EP0907961B1 (en) | Low-pressure mercury discharge lamp |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |
Effective date: 19940316 |