GB1558754A - Recursive programmable logic arrays - Google Patents
Recursive programmable logic arrays Download PDFInfo
- Publication number
- GB1558754A GB1558754A GB15489/78A GB1548978A GB1558754A GB 1558754 A GB1558754 A GB 1558754A GB 15489/78 A GB15489/78 A GB 15489/78A GB 1548978 A GB1548978 A GB 1548978A GB 1558754 A GB1558754 A GB 1558754A
- Authority
- GB
- United Kingdom
- Prior art keywords
- array
- matrix
- input
- programmable logic
- recursive
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000003491 array Methods 0.000 title description 4
- 239000011159 matrix material Substances 0.000 claims description 43
- 230000006870 function Effects 0.000 claims description 30
- 230000015654 memory Effects 0.000 claims description 11
- 238000010586 diagram Methods 0.000 description 7
- 238000000034 method Methods 0.000 description 7
- 230000000306 recurrent effect Effects 0.000 description 2
- 101000697597 Rattus norvegicus Alcohol sulfotransferase A Proteins 0.000 description 1
- 238000010420 art technique Methods 0.000 description 1
- HPNSNYBUADCFDR-UHFFFAOYSA-N chromafenozide Chemical compound CC1=CC(C)=CC(C(=O)N(NC(=O)C=2C(=C3CCCOC3=CC=2)C)C(C)(C)C)=C1 HPNSNYBUADCFDR-UHFFFAOYSA-N 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 230000014509 gene expression Effects 0.000 description 1
- 238000012905 input function Methods 0.000 description 1
- 238000012432 intermediate storage Methods 0.000 description 1
- GQNZGCARKRHPOH-RQIKCTSVSA-N miocamycin Chemical compound C1[C@](OC(C)=O)(C)[C@@H](OC(=O)CC)[C@H](C)O[C@H]1O[C@H]1[C@H](N(C)C)[C@@H](O)[C@H](O[C@@H]2[C@H]([C@H](OC(=O)CC)CC(=O)O[C@H](C)C/C=C/C=C/[C@H](OC(C)=O)[C@H](C)C[C@@H]2CC=O)OC)O[C@@H]1C GQNZGCARKRHPOH-RQIKCTSVSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
Classifications
-
- G—PHYSICS
- G04—HOROLOGY
- G04G—ELECTRONIC TIME-PIECES
- G04G99/00—Subject matter not provided for in other groups of this subclass
- G04G99/006—Electronic time-pieces using a microcomputer, e.g. for multi-function clocks
-
- H—ELECTRICITY
- H03—ELECTRONIC CIRCUITRY
- H03K—PULSE TECHNIQUE
- H03K19/00—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits
- H03K19/02—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components
- H03K19/173—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components
- H03K19/177—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components arranged in matrix form
- H03K19/17704—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components arranged in matrix form the logic functions being realised by the interconnection of rows and columns
- H03K19/17708—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components arranged in matrix form the logic functions being realised by the interconnection of rows and columns using an AND matrix followed by an OR matrix, i.e. programmable logic arrays
- H03K19/17712—Logic circuits, i.e. having at least two inputs acting on one output; Inverting circuits using specified components using elementary logic circuits as components arranged in matrix form the logic functions being realised by the interconnection of rows and columns using an AND matrix followed by an OR matrix, i.e. programmable logic arrays one of the matrices at least being reprogrammable
Landscapes
- Physics & Mathematics (AREA)
- Mathematical Physics (AREA)
- Engineering & Computer Science (AREA)
- Computer Hardware Design (AREA)
- Computing Systems (AREA)
- General Engineering & Computer Science (AREA)
- General Physics & Mathematics (AREA)
- Logic Circuits (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7720729A FR2396468A1 (fr) | 1977-06-30 | 1977-06-30 | Perfectionnement aux reseaux logiques programmables |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1558754A true GB1558754A (en) | 1980-01-09 |
Family
ID=9193033
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB15489/78A Expired GB1558754A (en) | 1977-06-30 | 1978-04-19 | Recursive programmable logic arrays |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4237542A (enExample) |
| JP (1) | JPS5413240A (enExample) |
| DE (1) | DE2825190C3 (enExample) |
| FR (1) | FR2396468A1 (enExample) |
| GB (1) | GB1558754A (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS558135A (en) * | 1978-07-04 | 1980-01-21 | Mamoru Tanaka | Rewritable programable logic array |
| US4415818A (en) * | 1979-01-16 | 1983-11-15 | Nippon Telegraph & Telephone Corp. | Programmable sequential logic circuit devices |
| JPS5616243A (en) * | 1979-07-18 | 1981-02-17 | Matsushita Electric Ind Co Ltd | Microaddress production system |
| US4354228A (en) * | 1979-12-20 | 1982-10-12 | International Business Machines Corporation | Flexible processor on a single semiconductor substrate using a plurality of arrays |
| US4578771A (en) * | 1980-12-29 | 1986-03-25 | International Business Machines Corporation | Dynamically reprogrammable array logic system |
| US4399516A (en) * | 1981-02-10 | 1983-08-16 | Bell Telephone Laboratories, Incorporated | Stored-program control machine |
| USRE32858E (en) * | 1981-02-10 | 1989-02-07 | American Telephone And Telegraph Company, At&T Bell Laboratories | Stored-program control machine |
| DE3121562A1 (de) * | 1981-05-30 | 1983-01-05 | Ibm Deutschland Gmbh, 7000 Stuttgart | Programmierbare logische hochintegrierte schaltungsanordnung |
| US4484268A (en) * | 1982-02-22 | 1984-11-20 | Thoma Nandor G | Apparatus and method for decoding an operation code using a plurality of multiplexed programmable logic arrays |
| US4506341A (en) * | 1982-06-10 | 1985-03-19 | International Business Machines Corporation | Interlaced programmable logic array having shared elements |
| USRE34363E (en) * | 1984-03-12 | 1993-08-31 | Xilinx, Inc. | Configurable electrical circuit having configurable logic elements and configurable interconnects |
| US4617479B1 (en) * | 1984-05-03 | 1993-09-21 | Altera Semiconductor Corp. | Programmable logic array device using eprom technology |
| US4609986A (en) * | 1984-06-14 | 1986-09-02 | Altera Corporation | Programmable logic array device using EPROM technology |
| US4766532A (en) * | 1985-04-30 | 1988-08-23 | International Business Machines Corporation | Sequential array logic |
| US4763020B1 (en) * | 1985-09-06 | 1997-07-08 | Ricoh Kk | Programmable logic device having plural programmable function cells |
| EP0328450B1 (en) * | 1988-02-08 | 1996-08-28 | Fujitsu Limited | Direct memory access controller |
| KR20040014060A (ko) * | 2002-08-09 | 2004-02-14 | 삼성전자주식회사 | 효율적인 다이내믹 pla 디코더 |
| US8438522B1 (en) | 2008-09-24 | 2013-05-07 | Iowa State University Research Foundation, Inc. | Logic element architecture for generic logic chains in programmable devices |
| US8661394B1 (en) | 2008-09-24 | 2014-02-25 | Iowa State University Research Foundation, Inc. | Depth-optimal mapping of logic chains in reconfigurable fabrics |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3230355A (en) * | 1962-12-04 | 1966-01-18 | Melpar Inc | Matrix logic computer |
| DE2455178C2 (de) * | 1974-11-21 | 1982-12-23 | Siemens AG, 1000 Berlin und 8000 München | Integrierte, programmierbare Logikanordnung |
| US3987287A (en) * | 1974-12-30 | 1976-10-19 | International Business Machines Corporation | High density logic array |
| IT1063025B (it) * | 1975-04-29 | 1985-02-11 | Siemens Ag | Disposizione circuitale logica integrata e programmabile |
| JPS5354936A (en) * | 1976-10-29 | 1978-05-18 | Toshiba Corp | Programable logical array |
| US4132979A (en) * | 1976-12-15 | 1979-01-02 | Teletype Corporation | Method and apparatus for controlling a programmable logic array |
| US4114143A (en) * | 1977-05-12 | 1978-09-12 | International Business Machines Corporation | Modular switching system |
-
1977
- 1977-06-30 FR FR7720729A patent/FR2396468A1/fr active Granted
-
1978
- 1978-04-19 GB GB15489/78A patent/GB1558754A/en not_active Expired
- 1978-04-28 US US05/901,166 patent/US4237542A/en not_active Expired - Lifetime
- 1978-06-08 DE DE2825190A patent/DE2825190C3/de not_active Expired
- 1978-06-19 JP JP7333678A patent/JPS5413240A/ja active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| DE2825190A1 (de) | 1979-01-04 |
| JPS5413240A (en) | 1979-01-31 |
| DE2825190C3 (de) | 1980-11-20 |
| FR2396468A1 (fr) | 1979-01-26 |
| FR2396468B1 (enExample) | 1980-02-08 |
| US4237542A (en) | 1980-12-02 |
| DE2825190B2 (de) | 1980-03-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1558754A (en) | Recursive programmable logic arrays | |
| US6573749B2 (en) | Method and apparatus for incorporating a multiplier into an FPGA | |
| US7111224B1 (en) | FPGA configuration memory with built-in error correction mechanism | |
| AU624524B2 (en) | Simplified synchronous mesh processor | |
| US5570039A (en) | Programmable function unit as parallel multiplier cell | |
| US3304418A (en) | Binary-coded decimal adder with radix correction | |
| JPH05508499A (ja) | 特殊目的ブール演算装置のための方法およびその装置 | |
| JPS58144971A (ja) | アレイプロセツサ装置 | |
| US4566075A (en) | Table lookup multiplier employing compressed data read only memory | |
| JPH0157814B2 (enExample) | ||
| US9372665B2 (en) | Method and apparatus for multiplying binary operands | |
| EP0303009B1 (en) | Signal generator for circular addressing | |
| US3495222A (en) | Program controlled electronic computer | |
| US4348737A (en) | Multiple-function programmable logic arrays | |
| EP1012700B1 (en) | Multiple parallel identical finite state machines which share combinatorial logic | |
| US20060097750A1 (en) | Electronic circuit with array of programmable logic cells | |
| EP0357342B1 (en) | Processor array system | |
| US7296049B2 (en) | Fast multiplication circuits | |
| US3229078A (en) | Code converter | |
| US3260840A (en) | Variable mode arithmetic circuits with carry select | |
| US3845290A (en) | Decimal-to-binary converter | |
| US3641330A (en) | Microprogrammed digital computer providing various operations by word circulation | |
| US5291457A (en) | Sequentially accessible non-volatile circuit for storing data | |
| GB871386A (en) | Data processing system | |
| WO1989008293A1 (en) | Bit blitter with narrow shift register |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |