GB1551799A - Chromium complexes of azo pyrazole dyes - Google Patents
Chromium complexes of azo pyrazole dyesInfo
- Publication number
- GB1551799A GB1551799A GB35514/76A GB3551476A GB1551799A GB 1551799 A GB1551799 A GB 1551799A GB 35514/76 A GB35514/76 A GB 35514/76A GB 3551476 A GB3551476 A GB 3551476A GB 1551799 A GB1551799 A GB 1551799A
- Authority
- GB
- United Kingdom
- Prior art keywords
- chromium complexes
- pyrazole dyes
- azo
- azo pyrazole
- dyes
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- XNQLMPZKLZSICC-UHFFFAOYSA-N bis(1H-pyrazol-5-yl)diazene Chemical compound c1cc(N=Nc2cc[nH]n2)n[nH]1 XNQLMPZKLZSICC-UHFFFAOYSA-N 0.000 title 1
- 150000001844 chromium Chemical class 0.000 title 1
- 239000000975 dye Substances 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09B—ORGANIC DYES OR CLOSELY-RELATED COMPOUNDS FOR PRODUCING DYES, e.g. PIGMENTS; MORDANTS; LAKES
- C09B45/00—Complex metal compounds of azo dyes
- C09B45/02—Preparation from dyes containing in o-position a hydroxy group and in o'-position hydroxy, alkoxy, carboxyl, amino or keto groups
- C09B45/14—Monoazo compounds
- C09B45/16—Monoazo compounds containing chromium
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1109975A CH616953A5 (cg-RX-API-DMAC7.html) | 1975-08-27 | 1975-08-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1551799A true GB1551799A (en) | 1979-08-30 |
Family
ID=4370043
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB35514/76A Expired GB1551799A (en) | 1975-08-27 | 1976-08-26 | Chromium complexes of azo pyrazole dyes |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4618673A (cg-RX-API-DMAC7.html) |
| JP (1) | JPS5943500B2 (cg-RX-API-DMAC7.html) |
| AR (1) | AR210896A1 (cg-RX-API-DMAC7.html) |
| AU (1) | AU504714B2 (cg-RX-API-DMAC7.html) |
| BE (1) | BE845508A (cg-RX-API-DMAC7.html) |
| BR (1) | BR7605627A (cg-RX-API-DMAC7.html) |
| CA (1) | CA1070297A (cg-RX-API-DMAC7.html) |
| CH (1) | CH616953A5 (cg-RX-API-DMAC7.html) |
| DE (1) | DE2636798C2 (cg-RX-API-DMAC7.html) |
| ES (1) | ES451017A1 (cg-RX-API-DMAC7.html) |
| FR (1) | FR2322179A1 (cg-RX-API-DMAC7.html) |
| GB (1) | GB1551799A (cg-RX-API-DMAC7.html) |
| HK (1) | HK30380A (cg-RX-API-DMAC7.html) |
| IT (1) | IT1065824B (cg-RX-API-DMAC7.html) |
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0000331B1 (de) * | 1977-06-23 | 1983-12-28 | Ciba-Geigy Ag | Verfahren zum Färben linearer Polyamide in der Masse mit Salzen von 1:2 Chromkomplex-monoazofarbstoffen; die damit erzeugten Fasern |
| FR2525226A1 (fr) * | 1982-04-16 | 1983-10-21 | Ici Francolor | Nouveaux complexes de chrome de colorants, leur preparation et leur utilisation |
| DE4130806A1 (de) * | 1991-09-17 | 1993-03-18 | Bayer Ag | Unsymmetrische 1:2-chromkomplexfarbstoffe |
| BR9909564B1 (pt) | 1998-08-14 | 2009-01-13 | tintas de complexo de cromo a 1:2, bem como processo para a produÇço e uso das mesmas, composiÇço de tinta e camadas de àxido. | |
| US6235100B1 (en) * | 1999-06-24 | 2001-05-22 | Engelhard Corporation | Metallized azo yellow pigments |
| GB0123150D0 (en) | 2001-09-27 | 2001-11-21 | Clariant Int Ltd | Organic compounds |
| DE602006006837D1 (en) * | 2005-07-21 | 2009-06-25 | Clariant Finance Bvi Ltd | Chromkomplexfarbstoffe |
Family Cites Families (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3041327A (en) * | 1962-06-26 | Chj sojh | ||
| US2673201A (en) * | 1954-03-23 | Cobaltiferous azo-dyestuffs | ||
| US2906746A (en) * | 1959-09-29 | Metalliferous azo dyestuffs | ||
| US3005813A (en) * | 1953-05-22 | 1961-10-24 | Ciba Ltd | Metalliferous azo-dyestuffs |
| US2806760A (en) * | 1953-06-10 | 1957-09-17 | Ciba Ltd | Process for dyeing nitrogenous fibers with metalliferous monoazo dyestuffs |
| DE2500550C2 (de) * | 1974-01-10 | 1983-11-03 | CIBA-GEIGY AG, 4002 Basel | Neue Chromkomplexfarbstoffe, deren Herstellung und Verwendung |
| US3062806A (en) * | 1959-08-07 | 1962-11-06 | Geigy Ag J R | 1:2-metal complexes of monoazo dyes containing a 1, 2-diphenyl-3, 5-diketopyrazolidine coupling component |
| DE1151078B (de) * | 1960-01-13 | 1963-07-04 | Wolfen Filmfab Veb | Verfahren zur Herstellung chromhaltiger Azofarbstoffkomplex-verbindungen |
| DE1271857B (de) * | 1962-10-17 | 1968-07-04 | Ciba Geigy | Verfahren zur Herstellung chromhaltiger Azofarbstoffe |
| BE638749A (cg-RX-API-DMAC7.html) * | 1963-10-11 | |||
| FR1518833A (fr) * | 1967-02-10 | 1968-03-29 | Ugine Kuhlmann | Nouveaux complexes métallifères mixtes |
| JPS4952219A (cg-RX-API-DMAC7.html) * | 1972-09-18 | 1974-05-21 | ||
| CH583285A5 (cg-RX-API-DMAC7.html) * | 1974-01-15 | 1976-12-31 | Ciba Geigy Ag | |
| US4083839A (en) * | 1974-01-15 | 1978-04-11 | Ciba-Geigy Corporation | Unsymmetrical mono sulfo containing 1:2 azo, azo chromium complex dyes |
| CH589126A5 (cg-RX-API-DMAC7.html) * | 1974-01-17 | 1977-06-30 | Ciba Geigy Ag | |
| JPS5833263B2 (ja) * | 1974-01-30 | 1983-07-19 | バイエル アクチエンゲゼルシヤフト | 金属錯塩染料濃厚溶液の製造方法 |
| CH593323A5 (cg-RX-API-DMAC7.html) * | 1974-01-30 | 1977-11-30 | Ciba Geigy Ag | |
| FR2271267B1 (cg-RX-API-DMAC7.html) * | 1974-02-06 | 1976-10-08 | Ugine Kuhlmann | |
| DE2408224A1 (de) * | 1974-02-21 | 1975-10-02 | Bayer Ag | Azochrommischkomplex-farbstoffe |
| FR2300779A1 (fr) * | 1975-02-13 | 1976-09-10 | Ugine Kuhlmann | Procede pour l |
-
1975
- 1975-08-27 CH CH1109975A patent/CH616953A5/de not_active IP Right Cessation
-
1976
- 1976-08-12 FR FR7624658A patent/FR2322179A1/fr active Granted
- 1976-08-16 DE DE2636798A patent/DE2636798C2/de not_active Expired
- 1976-08-25 BE BE170068A patent/BE845508A/xx not_active IP Right Cessation
- 1976-08-25 AR AR264455A patent/AR210896A1/es active
- 1976-08-25 CA CA259,829A patent/CA1070297A/en not_active Expired
- 1976-08-25 JP JP51100706A patent/JPS5943500B2/ja not_active Expired
- 1976-08-26 AU AU17206/76A patent/AU504714B2/en not_active Expired
- 1976-08-26 ES ES451017A patent/ES451017A1/es not_active Expired
- 1976-08-26 BR BR7605627A patent/BR7605627A/pt unknown
- 1976-08-26 GB GB35514/76A patent/GB1551799A/en not_active Expired
- 1976-08-27 IT IT26636/76A patent/IT1065824B/it active
-
1980
- 1980-06-05 HK HK303/80A patent/HK30380A/xx unknown
-
1981
- 1981-09-22 US US06/304,621 patent/US4618673A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| DE2636798C2 (de) | 1984-07-12 |
| AU504714B2 (en) | 1979-10-25 |
| ES451017A1 (es) | 1978-10-16 |
| FR2322179A1 (fr) | 1977-03-25 |
| BR7605627A (pt) | 1977-08-09 |
| DE2636798A1 (de) | 1977-03-03 |
| CA1070297A (en) | 1980-01-22 |
| JPS5943500B2 (ja) | 1984-10-22 |
| AR210896A1 (es) | 1977-09-30 |
| BE845508A (fr) | 1977-02-25 |
| US4618673A (en) | 1986-10-21 |
| CH616953A5 (cg-RX-API-DMAC7.html) | 1980-04-30 |
| AU1720676A (en) | 1978-03-02 |
| HK30380A (en) | 1980-06-13 |
| FR2322179B1 (cg-RX-API-DMAC7.html) | 1980-05-09 |
| JPS5228522A (en) | 1977-03-03 |
| IT1065824B (it) | 1985-03-04 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1540447A (en) | Chromium complex dyes their manufacture and use | |
| JPS51119718A (en) | Azo dyes | |
| JPS51136724A (en) | Monoazo dyes having dyeing stability | |
| AU1064376A (en) | Laked azo dyestuffs | |
| JPS5333225A (en) | Azo dyes | |
| GB1551799A (en) | Chromium complexes of azo pyrazole dyes | |
| JPS5250321A (en) | Azo dyes | |
| PT66143B (en) | Process for the preparation of novel chromium complex dyes | |
| JPS5225827A (en) | Waterrsoluble azo dyes | |
| JPS537731A (en) | Azo dyes | |
| JPS5319343A (en) | Azo dyes | |
| GB1553432A (en) | Stillbene tetrakis azo dyes | |
| AU8274675A (en) | Chromium complex azo and azomethine dyes | |
| JPS5263222A (en) | Azo compounds for dyes | |
| AU501564B2 (en) | Coppering azo dyes | |
| JPS52934A (en) | Diazo dyestuffs | |
| AU7681674A (en) | Chromium complex dyes | |
| AU501397B2 (en) | Chromium dyes | |
| GB1544981A (en) | Basic azo dyes their manufacture and use | |
| JPS5240531A (en) | Mixed chrome complex dyes | |
| AU7681774A (en) | Chromium complex dyes | |
| AU460103B2 (en) | Chromium containing azo dyes | |
| JPS51116829A (en) | Monoazo dyes having dyeing stability | |
| JPS5276332A (en) | Waterrinsoluble azo dyes derivatived from 11aryll33 trifluoromethyll55pyrazolone | |
| AU501133B2 (en) | Azo dye cobalt complexes |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |
Effective date: 19920826 |