GB1476797A - Cyanamide derivatives - Google Patents
Cyanamide derivativesInfo
- Publication number
- GB1476797A GB1476797A GB4967875A GB4967875A GB1476797A GB 1476797 A GB1476797 A GB 1476797A GB 4967875 A GB4967875 A GB 4967875A GB 4967875 A GB4967875 A GB 4967875A GB 1476797 A GB1476797 A GB 1476797A
- Authority
- GB
- United Kingdom
- Prior art keywords
- nov
- optionally substituted
- alkyl
- compounds
- cyanamide derivatives
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000001912 cyanamides Chemical class 0.000 title abstract 2
- 150000001875 compounds Chemical class 0.000 abstract 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000000217 alkyl group Chemical group 0.000 abstract 1
- 125000003710 aryl alkyl group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 abstract 1
- 229910052736 halogen Chemical group 0.000 abstract 1
- 150000002367 halogens Chemical group 0.000 abstract 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 abstract 1
- 125000000547 substituted alkyl group Chemical group 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/50—Compounds containing any of the groups, X being a hetero atom, Y being any atom
- C07C311/52—Y being a hetero atom
- C07C311/54—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea
- C07C311/55—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea having sulfur atoms of the sulfonylurea groups bound to acyclic carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C275/00—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups
- C07C275/46—Derivatives of urea, i.e. compounds containing any of the groups, the nitrogen atoms not being part of nitro or nitroso groups containing any of the groups, X being a hetero atom, Y being any atom, e.g. acylureas
- C07C275/58—Y being a hetero atom
- C07C275/60—Y being an oxygen atom, e.g. allophanic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/01—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms
- C07C311/12—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing rings
- C07C311/13—Sulfonamides having sulfur atoms of sulfonamide groups bound to acyclic carbon atoms of an unsaturated carbon skeleton containing rings the carbon skeleton containing six-membered aromatic rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C311/00—Amides of sulfonic acids, i.e. compounds having singly-bound oxygen atoms of sulfo groups replaced by nitrogen atoms, not being part of nitro or nitroso groups
- C07C311/50—Compounds containing any of the groups, X being a hetero atom, Y being any atom
- C07C311/52—Y being a hetero atom
- C07C311/54—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea
- C07C311/57—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea having sulfur atoms of the sulfonylurea groups bound to carbon atoms of six-membered aromatic rings
- C07C311/58—Y being a hetero atom either X or Y, but not both, being nitrogen atoms, e.g. N-sulfonylurea having sulfur atoms of the sulfonylurea groups bound to carbon atoms of six-membered aromatic rings having nitrogen atoms of the sulfonylurea groups bound to hydrogen atoms or to acyclic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7340527A FR2271202A1 (en) | 1973-11-14 | 1973-11-14 | Substituted ureas, acylureas and sulphonylureas prodn - by reacting a substituted cyanamide with a cpd forming a carbonium ion |
| FR7435907A FR2288735A2 (fr) | 1974-10-25 | 1974-10-25 | Derives de l'uree, acylurees et sulfonylurees substituees et leur procede de fabrication |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1476797A true GB1476797A (en) | 1977-06-16 |
Family
ID=26218025
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB4967875A Expired GB1476797A (en) | 1973-11-14 | 1974-11-14 | Cyanamide derivatives |
| GB4931974A Expired GB1476796A (en) | 1973-11-14 | 1974-11-14 | Derivatives of substituted ureas acyl ureas and sulphonyl ureas and a process for producing the same |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB4931974A Expired GB1476796A (en) | 1973-11-14 | 1974-11-14 | Derivatives of substituted ureas acyl ureas and sulphonyl ureas and a process for producing the same |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4013706A (enExample) |
| JP (1) | JPS5831341B2 (enExample) |
| CH (1) | CH605700A5 (enExample) |
| DE (2) | DE2454107B2 (enExample) |
| GB (2) | GB1476797A (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS6033109B2 (ja) * | 1977-04-28 | 1985-08-01 | 塩野義製薬株式会社 | 尿素誘導体の合成法 |
| DE2733181B2 (de) * | 1977-07-22 | 1979-08-30 | Deutsche Gold- Und Silber-Scheideanstalt Vormals Roessler, 6000 Frankfurt | Verfahren zur Herstellung von N-substituierten a -Ketocarbonsäureamiden |
| DE2919292A1 (de) * | 1979-05-12 | 1980-11-20 | Bayer Ag | Substituierte harnstoffe, verfahren zu ihrer herstellung und ihre verwendung als pflanzenbakterizide |
| DE2934248A1 (de) | 1979-08-24 | 1981-03-26 | Hoechst Ag, 65929 Frankfurt | Wasserloesliche phthalocyaninverbindungen, verfahren zu ihrer herstellung und ihre verwendung als farbstoffe |
| DE2934247A1 (de) * | 1979-08-24 | 1981-04-09 | Hoechst Ag, 6000 Frankfurt | Verfahren zur veredlung von faserigen materialien |
| US4399152A (en) * | 1980-04-03 | 1983-08-16 | Duphar International B.V. | Substituted benzoyl ureas as insecticides |
| DE3035393A1 (de) * | 1980-09-19 | 1982-05-06 | Bayer Ag, 5090 Leverkusen | Verfahren zur herstellung vonn-substituierten imidodicarbonsaeurediarylestern |
| US4618712A (en) * | 1982-02-23 | 1986-10-21 | Ciba-Geigy Corporation | N-cyanocarboxylic acid amides, processes for their preparation and their use |
| GB2226815A (en) * | 1989-01-06 | 1990-07-11 | Shell Int Research | Fungicidal n-acyl cyanamides |
| US5254589A (en) * | 1991-10-15 | 1993-10-19 | Warner-Lambert Company | Sulfonyl urea and carbamate ACAT inhibitors |
| HU228303B1 (hu) * | 1999-07-13 | 2013-03-28 | Lonza Ag | Eljárás 2-amino-4-(4-fluorfenil)-6-alkil-pirimidin-5-karboxilát-származékok elõállítására |
| CN106008260A (zh) * | 2016-06-08 | 2016-10-12 | 刘利楠 | 一种芳氰基化合物的合成方法 |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3427323A (en) * | 1964-07-16 | 1969-02-11 | Du Pont | Alpha-alkoxyalkylcyanamides and their preparation |
| US3332994A (en) * | 1966-06-17 | 1967-07-25 | Du Pont | Alkoxycyanamides and their preparation |
| NL160809C (nl) * | 1970-05-15 | 1979-12-17 | Duphar Int Res | Werkwijze ter bereiding van benzoylureumverbindingen, alsmede werkwijze ter bereiding van insekticide prepara- ten op basis van benzoylureumverbindingen. |
-
1974
- 1974-11-13 US US05/523,550 patent/US4013706A/en not_active Expired - Lifetime
- 1974-11-14 DE DE19742454107 patent/DE2454107B2/de active Granted
- 1974-11-14 GB GB4967875A patent/GB1476797A/en not_active Expired
- 1974-11-14 CH CH1520374A patent/CH605700A5/xx not_active IP Right Cessation
- 1974-11-14 JP JP49131845A patent/JPS5831341B2/ja not_active Expired
- 1974-11-14 DE DE2462011A patent/DE2462011C3/de not_active Expired
- 1974-11-14 GB GB4931974A patent/GB1476796A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE2454107A1 (de) | 1975-05-22 |
| CH605700A5 (enExample) | 1978-10-13 |
| JPS5831341B2 (ja) | 1983-07-05 |
| JPS5083331A (enExample) | 1975-07-05 |
| DE2462011C3 (de) | 1978-05-03 |
| US4013706A (en) | 1977-03-22 |
| DE2462011A1 (de) | 1975-06-26 |
| DE2462011B2 (de) | 1977-09-22 |
| DE2454107B2 (de) | 1977-01-13 |
| GB1476796A (en) | 1977-06-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1476797A (en) | Cyanamide derivatives | |
| GB1253931A (en) | Process for the preparation of 1,5-disubstituted 4-cyanopyrazoles | |
| GB1229141A (enExample) | ||
| GB1327227A (en) | Pharmaceutical compositions containing phthalic or quinoline and derivatives | |
| GB1375156A (enExample) | ||
| IE37270L (en) | Imino-benzimidazolines | |
| GB1428990A (en) | Arylmercaptonaphtholactams | |
| GB1226250A (enExample) | ||
| GB1437815A (enExample) | ||
| ES447910A1 (es) | Procedimiento para la preparacion de derivados de acido car-bamico que contienen nitrogeno. | |
| GB1234705A (en) | Process for the production of 2-acyloxythiobenzamides | |
| GB1205822A (en) | Azoacyl compounds | |
| GB1438129A (enExample) | ||
| GB1375707A (enExample) | ||
| GB1431260A (en) | Method of deselenizing selenocarbonyl compounds | |
| GB1345144A (en) | Sulphobenzoic acid derivatives | |
| GB1225699A (enExample) | ||
| GB1409987A (en) | Beta-amino-beta-imino-propionic acid esters | |
| FR2216271A1 (en) | 3,5-Dintro-4-amine phenyl alkyl sulphones - herbicides | |
| GB1252937A (enExample) | ||
| GB1464227A (en) | S-inosylcysteine and a process for producing the same | |
| GB1318681A (en) | Phenyl ketoxime derivatives | |
| GB1431022A (en) | Process for the production of omega-substiuted amidrazones | |
| GB1084287A (enExample) | ||
| GB1498499A (en) | Benzotriazines |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |