GB1430912A - 8-beta-hydroxyethyl-ergoline derivatives - Google Patents
8-beta-hydroxyethyl-ergoline derivativesInfo
- Publication number
- GB1430912A GB1430912A GB388774A GB388774A GB1430912A GB 1430912 A GB1430912 A GB 1430912A GB 388774 A GB388774 A GB 388774A GB 388774 A GB388774 A GB 388774A GB 1430912 A GB1430912 A GB 1430912A
- Authority
- GB
- United Kingdom
- Prior art keywords
- pyrrolyl
- methyl
- dimethyl
- give
- hydrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- CYZQTYWZYIAALO-SKNXHYNKSA-N 2-[(6ar,10ar)-4,6,6a,7,8,9,10,10a-octahydroindolo[4,3-fg]quinoline-9-yl]ethanol Chemical class C1=CC([C@@H]2[C@H](NCC(C2)CCO)C2)=C3C2=CNC3=C1 CYZQTYWZYIAALO-SKNXHYNKSA-N 0.000 title 1
- 150000001875 compounds Chemical class 0.000 abstract 6
- -1 2 - methyl - 3 - pyrrolyl Chemical group 0.000 abstract 4
- 239000002253 acid Substances 0.000 abstract 4
- 229910052739 hydrogen Inorganic materials 0.000 abstract 4
- 239000001257 hydrogen Substances 0.000 abstract 4
- 125000000217 alkyl group Chemical group 0.000 abstract 3
- 150000002431 hydrogen Chemical group 0.000 abstract 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 abstract 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N Furan Chemical compound C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 abstract 2
- 229910052736 halogen Inorganic materials 0.000 abstract 2
- 150000002367 halogens Chemical class 0.000 abstract 2
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 2
- 150000003839 salts Chemical class 0.000 abstract 2
- KAESVJOAVNADME-UHFFFAOYSA-N 1H-pyrrole Natural products C=1C=CNC=1 KAESVJOAVNADME-UHFFFAOYSA-N 0.000 abstract 1
- 125000002941 2-furyl group Chemical group O1C([*])=C([H])C([H])=C1[H] 0.000 abstract 1
- 125000003349 3-pyridyl group Chemical group N1=C([H])C([*])=C([H])C([H])=C1[H] 0.000 abstract 1
- 125000001397 3-pyrrolyl group Chemical group [H]N1C([H])=C([*])C([H])=C1[H] 0.000 abstract 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 abstract 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 abstract 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 abstract 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 abstract 1
- XFXPMWWXUTWYJX-UHFFFAOYSA-N Cyanide Chemical group N#[C-] XFXPMWWXUTWYJX-UHFFFAOYSA-N 0.000 abstract 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 1
- 229910010082 LiAlH Inorganic materials 0.000 abstract 1
- 150000007513 acids Chemical class 0.000 abstract 1
- 230000002908 adrenolytic effect Effects 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000003282 alkyl amino group Chemical group 0.000 abstract 1
- 150000008064 anhydrides Chemical class 0.000 abstract 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 abstract 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 abstract 1
- 229910052794 bromium Chemical group 0.000 abstract 1
- 238000005660 chlorination reaction Methods 0.000 abstract 1
- 229910052801 chlorine Inorganic materials 0.000 abstract 1
- 239000000460 chlorine Chemical group 0.000 abstract 1
- 125000004093 cyano group Chemical group *C#N 0.000 abstract 1
- 230000000694 effects Effects 0.000 abstract 1
- 230000032050 esterification Effects 0.000 abstract 1
- 238000005886 esterification reaction Methods 0.000 abstract 1
- 150000002148 esters Chemical class 0.000 abstract 1
- 125000003754 ethoxycarbonyl group Chemical group C(=O)(OCC)* 0.000 abstract 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 1
- 150000004702 methyl esters Chemical class 0.000 abstract 1
- 239000008194 pharmaceutical composition Substances 0.000 abstract 1
- 125000000168 pyrrolyl group Chemical group 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D457/00—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid
- C07D457/02—Heterocyclic compounds containing indolo [4, 3-f, g] quinoline ring systems, e.g. derivatives of ergoline, of the formula:, e.g. lysergic acid with hydrocarbon or substituted hydrocarbon radicals, attached in position 8
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT1994173 | 1973-02-02 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1430912A true GB1430912A (en) | 1976-04-07 |
Family
ID=11162515
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB388774A Expired GB1430912A (en) | 1973-02-02 | 1974-01-28 | 8-beta-hydroxyethyl-ergoline derivatives |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US3972883A (https=) |
| JP (1) | JPS49102700A (https=) |
| AT (1) | AT336201B (https=) |
| BE (1) | BE810510A (https=) |
| CA (1) | CA1022549A (https=) |
| CH (1) | CH599956A5 (https=) |
| DE (1) | DE2404924B2 (https=) |
| ES (1) | ES422837A1 (https=) |
| FR (1) | FR2215957B1 (https=) |
| GB (1) | GB1430912A (https=) |
| HU (1) | HU166851B (https=) |
| IL (1) | IL44119A (https=) |
| NL (1) | NL7400790A (https=) |
| SU (1) | SU557757A3 (https=) |
| YU (1) | YU19774A (https=) |
| ZA (1) | ZA74675B (https=) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CS177530B1 (en) * | 1974-07-19 | 1977-07-29 | Miroslav Semonsky | New nbeta-substituted derivatives of b-beta-aminoethyl-ergoline-i their salts and methods for the production thereof |
| CS195905B1 (en) * | 1976-12-06 | 1980-02-29 | Milos Beran | 6-substituted derivatives of d-8-ergolin-i-ylacetic acid amide and process for preparing thereof |
| IT1193467B (it) * | 1978-01-26 | 1988-07-08 | Simes | Carbammati di omolisergoli (8 beta-idrossietilergoline) |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3228943A (en) * | 1962-06-11 | 1966-01-11 | Lumilysergol derivatives | |
| CH507248A (de) * | 1967-03-16 | 1971-05-15 | Spofa Vereinigte Pharma Werke | Verfahren zur Herstellung von D-6-Methylergolin(I)ylessigsäure |
| FR7775M (https=) * | 1967-06-28 | 1970-03-23 | ||
| DE1942785A1 (de) * | 1968-08-27 | 1970-03-05 | Spofa Vereinigte Pharma Werke | D-6-Methyl-8-beta-hydroxyaethylergolen und Verfahren zur Herstellung desselben |
| NL7102982A (https=) * | 1970-03-20 | 1971-09-22 | Farmaceutici Italia | |
| NL159384B (nl) * | 1971-03-13 | 1979-02-15 | Farmaceutici Italia | Werkwijze voor het bereiden van een geneesmiddel met een adrenolytische activiteit, alsmede werkwijze voor het bereiden van een ester van 1-methyl-10-methoxylumilysergol. |
-
1974
- 1974-01-21 NL NL7400790A patent/NL7400790A/xx not_active Application Discontinuation
- 1974-01-28 GB GB388774A patent/GB1430912A/en not_active Expired
- 1974-01-28 US US05/436,927 patent/US3972883A/en not_active Expired - Lifetime
- 1974-01-28 YU YU00197/74A patent/YU19774A/xx unknown
- 1974-01-29 FR FR7402829A patent/FR2215957B1/fr not_active Expired
- 1974-01-29 JP JP49011529A patent/JPS49102700A/ja active Pending
- 1974-01-29 CA CA191,132A patent/CA1022549A/en not_active Expired
- 1974-01-30 HU HUFA959A patent/HU166851B/hu unknown
- 1974-01-30 IL IL44119A patent/IL44119A/en unknown
- 1974-01-30 SU SU1990334A patent/SU557757A3/ru active
- 1974-01-30 AT AT74574A patent/AT336201B/de not_active IP Right Cessation
- 1974-02-01 BE BE140467A patent/BE810510A/xx unknown
- 1974-02-01 DE DE2404924A patent/DE2404924B2/de active Granted
- 1974-02-01 ES ES422837A patent/ES422837A1/es not_active Expired
- 1974-02-01 ZA ZA740675A patent/ZA74675B/xx unknown
- 1974-02-01 CH CH145674A patent/CH599956A5/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| CA1022549A (en) | 1977-12-13 |
| AT336201B (de) | 1977-04-25 |
| JPS49102700A (https=) | 1974-09-27 |
| IL44119A0 (en) | 1974-05-16 |
| DE2404924B2 (de) | 1978-08-03 |
| YU19774A (en) | 1982-05-31 |
| NL7400790A (https=) | 1974-08-06 |
| IL44119A (en) | 1977-01-31 |
| DE2404924C3 (https=) | 1979-03-29 |
| AU6498474A (en) | 1975-07-31 |
| BE810510A (fr) | 1974-08-01 |
| SU557757A3 (ru) | 1977-05-05 |
| DE2404924A1 (de) | 1974-08-22 |
| FR2215957A1 (https=) | 1974-08-30 |
| HU166851B (https=) | 1975-06-28 |
| US3972883A (en) | 1976-08-03 |
| ATA74574A (de) | 1976-08-15 |
| ES422837A1 (es) | 1976-09-16 |
| FR2215957B1 (https=) | 1978-01-06 |
| CH599956A5 (https=) | 1978-06-15 |
| ZA74675B (en) | 1974-12-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1432576A (en) | Substituted phenylacetic acids | |
| IE41474L (en) | Thiomethylergolines | |
| GB1269551A (en) | New tricyclic derivatives and process for their manufacture | |
| GB1492579A (en) | Vincamine derivatives | |
| GB1430912A (en) | 8-beta-hydroxyethyl-ergoline derivatives | |
| GB1496491A (en) | Dihydroergopeptine derivatives | |
| GB1265279A (https=) | ||
| GB1291644A (en) | Substituted 1-indancarboxylic acids, their esters and salts | |
| GB1453643A (en) | Bis-benzyl-acetic acid derivatives | |
| GB1237054A (en) | Derivatives of the 2-(lower alkyl)-3-(lower alkyl)-4-phenyl-3- or 4-cyclohexenecarboxylic acids | |
| GB1432503A (en) | Cycloalkylalkylesters and process for their preparation | |
| GB1273705A (en) | A method for producing 3,5-diaryl-4-pyrazole acetic acids | |
| GB1174349A (en) | Novel 2-Anilinomethylimidazoline Derivatives and process for the preparation thereof | |
| GB1427114A (en) | Derivatives of 3- p-chlorobenoyl-2-methyl-phenylacetic acid | |
| GB1481780A (en) | Oxathiino-and dithiino-aminoacetic acids and their preparation | |
| GB1352245A (en) | Azabicyclo-3.3.1-nonan-3-ol ester derivatives | |
| GB1369580A (en) | Tricyclic diphenylamine derivatives | |
| GB1411700A (en) | Penicillins and production thereof | |
| GB1478374A (en) | Piperidyl-methylenedioxybenzene derivatives | |
| GB1139164A (en) | New heterocyclic acetic acid compounds and methods for their production | |
| IE32859L (en) | Penicilloic acid derivatives. | |
| GB1384843A (en) | Benzofuran derivatives their preparation and compositions containing them | |
| GB1306404A (en) | Indenopyridine derivatives | |
| GB1219387A (en) | Bicyclo[2.2.2]oct-2-ene-amino acid compounds | |
| GB1450543A (en) | Indole derivatives |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |