GB1312620A - Xanthone derivatives - Google Patents
Xanthone derivativesInfo
- Publication number
- GB1312620A GB1312620A GB5812169A GB1312620DA GB1312620A GB 1312620 A GB1312620 A GB 1312620A GB 5812169 A GB5812169 A GB 5812169A GB 1312620D A GB1312620D A GB 1312620DA GB 1312620 A GB1312620 A GB 1312620A
- Authority
- GB
- United Kingdom
- Prior art keywords
- alkyl
- meo
- acid
- group
- prepared
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 150000007964 xanthones Chemical class 0.000 title abstract 2
- 125000000217 alkyl group Chemical group 0.000 abstract 6
- 150000001875 compounds Chemical class 0.000 abstract 4
- 150000002148 esters Chemical class 0.000 abstract 3
- 230000003301 hydrolyzing effect Effects 0.000 abstract 3
- 239000002253 acid Substances 0.000 abstract 2
- 125000003545 alkoxy group Chemical group 0.000 abstract 2
- 150000002825 nitriles Chemical class 0.000 abstract 2
- PJUJNJLLEULKHR-UHFFFAOYSA-N 2-(2h-tetrazol-5-yl)xanthen-9-one Chemical class C1=C2C(=O)C3=CC=CC=C3OC2=CC=C1C1=NN=NN1 PJUJNJLLEULKHR-UHFFFAOYSA-N 0.000 abstract 1
- HKCHVPVYZXFTQZ-UHFFFAOYSA-N 2-[4-(2H-tetrazol-5-yl)phenoxy]benzoic acid Chemical compound N1N=NN=C1C1=CC=C(OC2=C(C(=O)O)C=CC=C2)C=C1 HKCHVPVYZXFTQZ-UHFFFAOYSA-N 0.000 abstract 1
- QHOHOOCXVFEPQA-UHFFFAOYSA-N 2-amino-7-methoxyxanthen-9-one Chemical compound COC1=CC=C2OC=3C=CC(=CC3C(C2=C1)=O)N QHOHOOCXVFEPQA-UHFFFAOYSA-N 0.000 abstract 1
- YNOPZLWHBMWCPX-UHFFFAOYSA-N 2-chloro-4,5-dinitrobenzoic acid Chemical compound OC(=O)C1=CC([N+]([O-])=O)=C([N+]([O-])=O)C=C1Cl YNOPZLWHBMWCPX-UHFFFAOYSA-N 0.000 abstract 1
- WDHCRWZNSBIWKL-UHFFFAOYSA-N 2-chloro-4-methoxy-5-nitrobenzoic acid Chemical compound COC1=CC(Cl)=C(C(O)=O)C=C1[N+]([O-])=O WDHCRWZNSBIWKL-UHFFFAOYSA-N 0.000 abstract 1
- XXCOTUOKWGZKHS-UHFFFAOYSA-N 2-methoxy-7-nitroxanthen-9-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)C3=CC(OC)=CC=C3OC2=C1 XXCOTUOKWGZKHS-UHFFFAOYSA-N 0.000 abstract 1
- DVKKFDYVLKKUTL-UHFFFAOYSA-N 2-methyl-7-nitroxanthen-9-one Chemical compound C1=C([N+]([O-])=O)C=C2C(=O)C3=CC(C)=CC=C3OC2=C1 DVKKFDYVLKKUTL-UHFFFAOYSA-N 0.000 abstract 1
- -1 5-[1H]-tetrazolyl Chemical group 0.000 abstract 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 abstract 1
- GUGOEEXESWIERI-UHFFFAOYSA-N Terfenadine Chemical compound C1=CC(C(C)(C)C)=CC=C1C(O)CCCN1CCC(C(O)(C=2C=CC=CC=2)C=2C=CC=CC=2)CC1 GUGOEEXESWIERI-UHFFFAOYSA-N 0.000 abstract 1
- 150000007513 acids Chemical class 0.000 abstract 1
- 239000000443 aerosol Substances 0.000 abstract 1
- 150000001408 amides Chemical class 0.000 abstract 1
- 230000001387 anti-histamine Effects 0.000 abstract 1
- 239000000739 antihistaminic agent Substances 0.000 abstract 1
- 239000002249 anxiolytic agent Substances 0.000 abstract 1
- 230000000949 anxiolytic effect Effects 0.000 abstract 1
- 229940124630 bronchodilator Drugs 0.000 abstract 1
- 238000006243 chemical reaction Methods 0.000 abstract 1
- 230000032050 esterification Effects 0.000 abstract 1
- 238000005886 esterification reaction Methods 0.000 abstract 1
- 229910052736 halogen Inorganic materials 0.000 abstract 1
- 150000002367 halogens Chemical class 0.000 abstract 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 1
- 239000000543 intermediate Substances 0.000 abstract 1
- 238000000034 method Methods 0.000 abstract 1
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 abstract 1
- 230000001035 methylating effect Effects 0.000 abstract 1
- 239000000203 mixture Substances 0.000 abstract 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 1
- 231100000252 nontoxic Toxicity 0.000 abstract 1
- 230000003000 nontoxic effect Effects 0.000 abstract 1
- 230000001590 oxidative effect Effects 0.000 abstract 1
- 239000000843 powder Substances 0.000 abstract 1
- 238000007363 ring formation reaction Methods 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 229910052708 sodium Inorganic materials 0.000 abstract 1
- 239000011734 sodium Substances 0.000 abstract 1
- 239000003506 spasmogen Substances 0.000 abstract 1
- 125000003831 tetrazolyl group Chemical group 0.000 abstract 1
- 230000001225 therapeutic effect Effects 0.000 abstract 1
- 239000003204 tranquilizing agent Substances 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D311/00—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings
- C07D311/02—Heterocyclic compounds containing six-membered rings having one oxygen atom as the only hetero atom, condensed with other rings ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D311/78—Ring systems having three or more relevant rings
- C07D311/80—Dibenzopyrans; Hydrogenated dibenzopyrans
- C07D311/82—Xanthenes
- C07D311/84—Xanthenes with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached in position 9
- C07D311/86—Oxygen atoms, e.g. xanthones
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Oxygen Or Sulfur (AREA)
- Pyrane Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB5812169 | 1969-11-27 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1312620A true GB1312620A (en) | 1973-04-04 |
Family
ID=10480814
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB5812169A Expired GB1312620A (en) | 1969-11-27 | 1969-11-27 | Xanthone derivatives |
Country Status (21)
| Country | Link |
|---|---|
| US (2) | US3706768A (enExample) |
| AT (1) | AT304547B (enExample) |
| BE (1) | BE759292A (enExample) |
| CA (1) | CA930743A (enExample) |
| CH (1) | CH557347A (enExample) |
| CS (1) | CS172918B4 (enExample) |
| DE (1) | DE2058295C3 (enExample) |
| DK (1) | DK130740B (enExample) |
| ES (1) | ES385927A1 (enExample) |
| FI (1) | FI56005C (enExample) |
| FR (1) | FR2073425B1 (enExample) |
| GB (1) | GB1312620A (enExample) |
| HU (1) | HU162579B (enExample) |
| IE (1) | IE34720B1 (enExample) |
| IL (1) | IL35668A (enExample) |
| NL (1) | NL7017336A (enExample) |
| NO (1) | NO133367C (enExample) |
| PH (1) | PH11097A (enExample) |
| PL (1) | PL81223B1 (enExample) |
| SE (1) | SE382459B (enExample) |
| ZA (1) | ZA707727B (enExample) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0142303A3 (en) * | 1983-10-25 | 1986-02-05 | The Wellcome Foundation Limited | Pharmacologically active benzo - and dibenzo - pyrones and use |
| EP0430881A3 (en) * | 1989-11-29 | 1991-10-23 | Ciba-Geigy Ag | Photochromic compounds, process for their preparation and their use |
Families Citing this family (65)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1362782A (en) * | 1970-08-26 | 1974-08-07 | Fisons Ltd | Tetrazole derivatives |
| US4064256A (en) * | 1970-08-26 | 1977-12-20 | Fisons Limited | Benzopyranyltetrazoles as antiasthma agents |
| US3818042A (en) * | 1972-01-12 | 1974-06-18 | Syntex Inc | Xanthone carboxylic acids and derivatives |
| US3873714A (en) * | 1971-07-14 | 1975-03-25 | Syntex Inc | Xanthone carboxylic acids and derivatives |
| GB1389827A (en) * | 1971-07-23 | 1975-04-09 | Fisons Ltd | Tetrazolyl benzopyrans |
| CA988525A (en) * | 1971-07-23 | 1976-05-04 | Fisons Limited | 4 oxo-2(tetrazol-5-yl)4h-1-benzopyrans for treating allergic asthma |
| US3859442A (en) * | 1971-08-23 | 1975-01-07 | Syntex Inc | A method of inhibiting symptoms of asthma |
| US3885038A (en) * | 1971-08-23 | 1975-05-20 | Syntex Inc | Method of using substituted xanthone carboxylic acid |
| US3867407A (en) * | 1971-08-23 | 1975-02-18 | Jurg R Pfister | Substituted xanthone carboxylic acid compounds |
| BE787843A (fr) * | 1971-08-23 | 1973-02-22 | Syntex Corp | Nouveaux composes d'acides xanthone-carboxyliques substitues |
| US3959482A (en) * | 1971-09-08 | 1976-05-25 | Burroughs Wellcome Co. | Fluorenone carboxylic acids for the prevention of the symptoms of asthma and allergin rhinitis |
| US4061768A (en) * | 1971-09-08 | 1977-12-06 | Burroughs Wellcome Co. | Certain cyclic carbonyl compounds used in the prophylaxis of allergic conditions |
| US3950342A (en) * | 1971-09-08 | 1976-04-13 | Burroughs Wellcome Co. | Acridone-dicarboxylic acids |
| BE789822A (fr) * | 1971-10-08 | 1973-04-06 | Allen & Hanburys Ltd | Nouveaux composes heterocycliques |
| JPS4880534A (enExample) * | 1972-01-12 | 1973-10-29 | ||
| US3886181A (en) * | 1972-01-12 | 1975-05-27 | Syntex Inc | Disubstituted xanthone carboxylic acid compounds |
| US3894049A (en) * | 1972-06-05 | 1975-07-08 | Syntex Inc | Disubstituted xanthone carboxylic acid compounds |
| BE793751A (fr) * | 1972-01-12 | 1973-07-09 | Syntex Corp | Nouveaux composes d'acides xanthone-carboxyliques disubstitues |
| BE793749A (fr) * | 1972-01-12 | 1973-07-09 | Syntex Corp | Nouveaux composes d'acides xanthone-carboxyliques disubstitues |
| US4250182A (en) * | 1972-02-24 | 1981-02-10 | Burroughs Wellcome Co. | Pharmaceutical composition containing acridone compounds and method of using same |
| US3949084A (en) * | 1972-03-03 | 1976-04-06 | Syntex (U.S.A.) Inc. | Novel substituted xanthone carboxylic acid compounds |
| US3928379A (en) * | 1972-03-03 | 1975-12-23 | Mead Johnson & Co | N-phenyl amidines |
| US3835157A (en) * | 1972-05-17 | 1974-09-10 | Syntex Inc | Heterocyclic substituted xanthone carboxylic acid compounds |
| US3835158A (en) * | 1972-05-17 | 1974-09-10 | Syntex Inc | Heterocyclic substituted xanthone carboxylic acid compounds |
| US4012499A (en) * | 1972-05-19 | 1977-03-15 | Burroughs Wellcome Co. | Cyclic sulphur compounds |
| GB1447031A (en) * | 1972-05-19 | 1976-08-25 | Wellcome Found | Tricyclic sulphones and pharmaceutical compositions containing them |
| US3910957A (en) * | 1972-06-05 | 1975-10-07 | Syntex Inc | Xanthone carboxylic acids and derivatives |
| BE793954A (fr) * | 1972-07-19 | 1973-07-12 | Syntex Corp | Acides thioxanthone-carboxyliques et leurs derives |
| US3835139A (en) * | 1972-07-19 | 1974-09-10 | Syntex Inc | N-substituted acridone carboxylic acids and derivatives |
| US4025635A (en) * | 1972-09-06 | 1977-05-24 | Burroughs Wellcome Co. | Cyclic sulphur compounds |
| US4127573A (en) * | 1972-09-06 | 1978-11-28 | Burroughs Wellcome Co. | Ditetrazole substituted acridone compounds |
| GB1452891A (en) * | 1972-09-06 | 1976-10-20 | Wellcome Found | Tricyclic tetrazole derivatives their synthesis and compositions containing them |
| US4039556A (en) * | 1972-09-06 | 1977-08-02 | Burroughs Wellcome Co. | Substituted carbonyl compounds |
| US4094968A (en) * | 1972-09-06 | 1978-06-13 | Burroughs Wellcome Co. | Treatment for allergy and method of composition thereof |
| US3939276A (en) * | 1972-09-07 | 1976-02-17 | Burroughs Wellcome Co. | Cyclic carbonyl compounds |
| BE793864A (fr) * | 1972-09-25 | 1973-07-10 | Syntex Corp | Derives d'acide xanthone-carboxylique substitues par un groupement ether non sature |
| BE793865A (fr) * | 1972-09-25 | 1973-07-10 | Syntex Corp | Composes d'acides xanthone-carboxyliques substitues par des groupes alcenyles et alcynyles |
| US3919211A (en) * | 1973-02-12 | 1975-11-11 | American Home Prod | 9-Oxoxanthene-N,N{40 -bis(substituted)-2,7-disulfonamides |
| NL7403583A (enExample) * | 1973-03-19 | 1974-09-23 | ||
| US3963753A (en) * | 1974-01-08 | 1976-06-15 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3965115A (en) * | 1974-01-08 | 1976-06-22 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3963752A (en) * | 1974-01-08 | 1976-06-15 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US4107172A (en) * | 1974-03-01 | 1978-08-15 | Abbott Laboratories | Uricosuric diuretic composition |
| US3951618A (en) * | 1974-03-12 | 1976-04-20 | Syntex (U.S.A.) Inc. | Method of use of, and compositions containing, disubstituted xanthone carboxylic acid compounds |
| JPS5516432B2 (enExample) * | 1974-05-28 | 1980-05-01 | ||
| US3920826A (en) * | 1974-07-01 | 1975-11-18 | American Home Prod | Method of treating antiarrhythmic activity with bis(2-(dialkylamino)ethoxy)xanthen-9-one antiarrhythmic agents |
| US3989720A (en) * | 1975-03-13 | 1976-11-02 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3989721A (en) * | 1975-03-13 | 1976-11-02 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3979414A (en) * | 1975-03-13 | 1976-09-07 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US3988352A (en) * | 1975-03-13 | 1976-10-26 | Syntex (U.S.A.) Inc. | Disubstituted xanthone carboxylic acid compounds |
| US4035368A (en) * | 1975-04-02 | 1977-07-12 | Riker Laboratories, Inc. | Substituted 3-(1H-tetrazol-5-yl)-quinoline compounds |
| US4103015A (en) * | 1975-06-12 | 1978-07-25 | Burroughs Wellcome Co. | Antiallergic cyclic sulphur compounds |
| US4007205A (en) * | 1976-03-16 | 1977-02-08 | Warner-Lambert Company | 7-Substituted-9-oxoxanthene-2-carboxaldehydes |
| US4221800A (en) * | 1977-12-23 | 1980-09-09 | Miles Laboratories, Inc. | Cycloalkenochromone |
| US4232040A (en) * | 1978-03-08 | 1980-11-04 | Syntex (U.S.A.) Inc. | Compositions for and a method of preventing diabetic complications |
| US4217361A (en) * | 1978-05-22 | 1980-08-12 | Syntex (U.S.A.) Inc. | Disubstituted xanthone-2-carboxylic acid antiallergy agents |
| US4282365A (en) * | 1978-11-24 | 1981-08-04 | Merck & Co., Inc. | Dibenz[b,e]oxepin compounds |
| JPS5576873A (en) * | 1978-11-30 | 1980-06-10 | Kaken Pharmaceut Co Ltd | Coumarin derivative, its preparation, and antiallergic drugs containing it as active constituent |
| IL59104A (en) * | 1979-02-09 | 1984-02-29 | Roussel Uclaf | Heterotricyclic derivatives,process for their preparation and pharmaceutical compositions incorporating them |
| FR2492372A1 (fr) * | 1980-10-21 | 1982-04-23 | Cird | Dihydroxy-1,8 anthrones-9 substituees en position 10 et leur utilisation en medecine humaine ou veterinaire et en cosmetique |
| DE3364674D1 (en) * | 1982-04-27 | 1986-08-28 | Wellcome Found | Tricyclic compounds, preparation, use and intermediates |
| US4544557A (en) * | 1982-07-29 | 1985-10-01 | Merck & Co., Inc. | 6-(1-Hydroxyethyl)-2-(2-aminoethylthio)-3-tetrazoly-1-carbadethiapen-2-em |
| CN102180858A (zh) * | 2011-04-08 | 2011-09-14 | 华东师范大学 | 一取代或二取代呫吨酮化合物及合成方法 |
| AU2017355603A1 (en) | 2016-11-04 | 2019-06-20 | Auckland Uniservices Limited | Tricyclic heterocyclic derivatives and uses thereof |
| US11970505B1 (en) | 2023-11-07 | 2024-04-30 | King Faisal University | Pyridino-2,16-dioxapentacyclo[7.7.5.01,21.03,8.010,15]henicosa3(8),10,12,14-tetraene-7,20-dione as an antimicrobial compound |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB708917A (en) * | 1951-01-29 | 1954-05-12 | Ward Blenkinsop & Co Ltd | Xanthones and process for the production thereof |
| FR1417961A (fr) * | 1961-01-19 | 1965-11-19 | Cassella Farbwerke Mainkur Ag | Procédé de préparation de dérivés d'hydroxy-xanthones |
-
0
- BE BE759292D patent/BE759292A/xx unknown
-
1969
- 1969-11-27 GB GB5812169A patent/GB1312620A/en not_active Expired
-
1970
- 1970-11-12 IE IE1448/70A patent/IE34720B1/xx unknown
- 1970-11-16 IL IL35668A patent/IL35668A/xx unknown
- 1970-11-16 ZA ZA707727A patent/ZA707727B/xx unknown
- 1970-11-16 AT AT1028170A patent/AT304547B/de not_active IP Right Cessation
- 1970-11-17 US US90444A patent/US3706768A/en not_active Expired - Lifetime
- 1970-11-18 FI FI3099/70A patent/FI56005C/fi active
- 1970-11-19 CA CA098544A patent/CA930743A/en not_active Expired
- 1970-11-23 PL PL1970144588A patent/PL81223B1/pl unknown
- 1970-11-25 CS CS7950A patent/CS172918B4/cs unknown
- 1970-11-26 ES ES385927A patent/ES385927A1/es not_active Expired
- 1970-11-26 NL NL7017336A patent/NL7017336A/xx not_active Application Discontinuation
- 1970-11-26 NO NO4538/70A patent/NO133367C/no unknown
- 1970-11-26 SE SE7016049A patent/SE382459B/xx unknown
- 1970-11-26 DE DE2058295A patent/DE2058295C3/de not_active Expired
- 1970-11-26 PH PH11987A patent/PH11097A/en unknown
- 1970-11-27 DK DK607370AA patent/DK130740B/da unknown
- 1970-11-27 HU HUHA902A patent/HU162579B/hu unknown
- 1970-11-27 FR FR707042706A patent/FR2073425B1/fr not_active Expired
- 1970-11-27 CH CH1760070A patent/CH557347A/xx not_active IP Right Cessation
-
1972
- 1972-03-08 US US00232954A patent/US3755319A/en not_active Expired - Lifetime
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0142303A3 (en) * | 1983-10-25 | 1986-02-05 | The Wellcome Foundation Limited | Pharmacologically active benzo - and dibenzo - pyrones and use |
| US4626432A (en) * | 1983-10-25 | 1986-12-02 | Burroughs Wellcome Co. | Storage of red blood cells |
| US4626431A (en) * | 1983-10-25 | 1986-12-02 | Burroughs Wellcome Co. | Storage of red blood cells |
| US4791136A (en) * | 1983-10-25 | 1988-12-13 | Burroughs Wellcome Co. | Pharmacologically active ketones and use |
| EP0430881A3 (en) * | 1989-11-29 | 1991-10-23 | Ciba-Geigy Ag | Photochromic compounds, process for their preparation and their use |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2058295C3 (de) | 1980-06-19 |
| DK130740B (da) | 1975-04-07 |
| NL7017336A (enExample) | 1971-06-01 |
| CS172918B4 (enExample) | 1977-01-28 |
| HU162579B (enExample) | 1973-03-28 |
| FI56005B (fi) | 1979-07-31 |
| US3755319A (en) | 1973-08-28 |
| IE34720B1 (en) | 1975-07-23 |
| SE382459B (sv) | 1976-02-02 |
| PL81223B1 (enExample) | 1975-08-30 |
| NO133367C (enExample) | 1976-04-21 |
| ES385927A1 (es) | 1973-12-01 |
| IL35668A0 (en) | 1971-01-28 |
| FR2073425A1 (enExample) | 1971-10-01 |
| AT304547B (de) | 1973-01-10 |
| ZA707727B (en) | 1971-08-25 |
| FI56005C (fi) | 1979-11-12 |
| CA930743A (en) | 1973-07-24 |
| NO133367B (enExample) | 1976-01-12 |
| PH11097A (en) | 1977-10-25 |
| IL35668A (en) | 1973-08-29 |
| US3706768A (en) | 1972-12-19 |
| DE2058295A1 (de) | 1971-06-03 |
| FR2073425B1 (enExample) | 1974-06-21 |
| DE2058295B2 (de) | 1979-10-04 |
| CH557347A (de) | 1974-12-31 |
| BE759292A (fr) | 1971-05-24 |
| IE34720L (en) | 1971-05-27 |
| DK130740C (enExample) | 1975-09-08 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1312620A (en) | Xanthone derivatives | |
| US4650812A (en) | 4-oxo-3,4-dihydro-2H-1-benzopyranyloxy alkanoic acid derivatives | |
| GB1209946A (en) | Homopyrimidazole derivatives | |
| GB1324469A (en) | Derivatives of benzodiazepines | |
| SE7506327L (sv) | Forfarande for framstellning av 8-tiometylergoliner | |
| GB1359563A (en) | Pyrazolo-pyrimidines useful as xanthine oxidase inhibitors | |
| GB1337280A (en) | 5-phenyl-isoxazole-3-carboxylic acids and their derivatives | |
| JPS61118366A (ja) | 2−メチルジヒドロピリジン誘導体の中間体 | |
| GB1314428A (en) | Pyridine-substituted chromenol derivatives | |
| IE37795B1 (en) | Pharmacologically active quinaldamide derivatives | |
| SE7705637L (sv) | Forfarande for framstellning av dibensoxepinderivat med terapeutisk verkan | |
| GB1334705A (en) | Pharmaceutical compositions containing kynurenic acid derivatives | |
| GB1234490A (enExample) | ||
| GB1239553A (enExample) | ||
| GB1303171A (enExample) | ||
| GB1455524A (en) | Aryl-substituted oxo-alkanoic and oxo-alkenoic acids and derivatives of such acids | |
| GB1241637A (en) | Improvements in or relating to anti-inflammatory compositions | |
| GB1408964A (en) | 1-aralkyl-indenyl-3-acetic acids methods for their preparation and compositions containing them | |
| GB1273705A (en) | A method for producing 3,5-diaryl-4-pyrazole acetic acids | |
| IE35569B1 (en) | Derivatives of 2-phenyl-5-aminoimidazole and compositions thereof | |
| GB1445765A (en) | Phenoxy-substituted malonic acid derivatives their prepration and pharmaceutical compositions containing them | |
| GB1453417A (en) | Nitroimidazoles | |
| GB1441184A (en) | Esters of 2- 4-quinolyl- amino- benzoic acids | |
| GB1411700A (en) | Penicillins and production thereof | |
| GB1395416A (en) | Diazepine derivatives and processes for their production |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PCNP | Patent ceased through non-payment of renewal fee |