GB1229413A - - Google Patents
Info
- Publication number
- GB1229413A GB1229413A GB2748267A GB1229413DA GB1229413A GB 1229413 A GB1229413 A GB 1229413A GB 2748267 A GB2748267 A GB 2748267A GB 1229413D A GB1229413D A GB 1229413DA GB 1229413 A GB1229413 A GB 1229413A
- Authority
- GB
- United Kingdom
- Prior art keywords
- alkyl
- dimethylamino
- appropriate
- radical
- group
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 125000000217 alkyl group Chemical group 0.000 abstract 5
- -1 alkenyl radical Chemical class 0.000 abstract 4
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 abstract 2
- 150000001412 amines Chemical class 0.000 abstract 2
- 150000003230 pyrimidines Chemical class 0.000 abstract 2
- NWZSZGALRFJKBT-KNIFDHDWSA-N (2s)-2,6-diaminohexanoic acid;(2s)-2-hydroxybutanedioic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O.NCCCC[C@H](N)C(O)=O NWZSZGALRFJKBT-KNIFDHDWSA-N 0.000 abstract 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 abstract 1
- UKWHLLHXLXIYPM-UHFFFAOYSA-N 4-N-(benzylideneamino)-2-N,2-N,6-trimethyl-5-propylpyrimidine-2,4-diamine Chemical compound C(C1=CC=CC=C1)=NNC1=NC(=NC(=C1CCC)C)N(C)C UKWHLLHXLXIYPM-UHFFFAOYSA-N 0.000 abstract 1
- TXISUWMGJKJINA-UHFFFAOYSA-N N'-[2-(dimethylamino)-6-methyl-5-propylpyrimidin-4-yl]benzenesulfonohydrazide Chemical compound CN(C1=NC(=C(C(=N1)NNS(=O)(=O)C1=CC=CC=C1)CCC)C)C TXISUWMGJKJINA-UHFFFAOYSA-N 0.000 abstract 1
- QPVSMQSPKGOMFY-UHFFFAOYSA-N [[2-(dimethylamino)-6-methyl-5-propylpyrimidin-4-yl]amino]thiourea Chemical compound CN(C1=NC(=C(C(=N1)NNC(=S)N)CCC)C)C QPVSMQSPKGOMFY-UHFFFAOYSA-N 0.000 abstract 1
- 150000001299 aldehydes Chemical class 0.000 abstract 1
- 125000003545 alkoxy group Chemical group 0.000 abstract 1
- 125000003277 amino group Chemical group 0.000 abstract 1
- 125000003118 aryl group Chemical group 0.000 abstract 1
- 150000005840 aryl radicals Chemical class 0.000 abstract 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 abstract 1
- IKDUDTNKRLTJSI-UHFFFAOYSA-N hydrazine monohydrate Substances O.NN IKDUDTNKRLTJSI-UHFFFAOYSA-N 0.000 abstract 1
- 150000002429 hydrazines Chemical class 0.000 abstract 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 abstract 1
- 125000001841 imino group Chemical group [H]N=* 0.000 abstract 1
- 150000002576 ketones Chemical class 0.000 abstract 1
- LFGREXWGYUGZLY-UHFFFAOYSA-N phosphoryl Chemical group [P]=O LFGREXWGYUGZLY-UHFFFAOYSA-N 0.000 abstract 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 1
- QDGHXQFTWKRQTG-UHFFFAOYSA-N pyrimidin-2-ylhydrazine Chemical class NNC1=NC=CC=N1 QDGHXQFTWKRQTG-UHFFFAOYSA-N 0.000 abstract 1
- QIEQDFYXVYQLLU-UHFFFAOYSA-N pyrimidin-4-ylhydrazine Chemical compound NNC1=CC=NC=N1 QIEQDFYXVYQLLU-UHFFFAOYSA-N 0.000 abstract 1
- 229940083082 pyrimidine derivative acting on arteriolar smooth muscle Drugs 0.000 abstract 1
- 150000003839 salts Chemical class 0.000 abstract 1
- 239000000126 substance Substances 0.000 abstract 1
- 125000002813 thiocarbonyl group Chemical group *C(*)=S 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D239/00—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings
- C07D239/02—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings
- C07D239/24—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members
- C07D239/28—Heterocyclic compounds containing 1,3-diazine or hydrogenated 1,3-diazine rings not condensed with other rings having three or more double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, directly attached to ring carbon atoms
- C07D239/46—Two or more oxygen, sulphur or nitrogen atoms
- C07D239/48—Two nitrogen atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2748267 | 1967-06-14 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1229413A true GB1229413A (enExample) | 1971-04-21 |
Family
ID=10260315
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB2748267A Expired GB1229413A (enExample) | 1967-06-14 | 1967-06-14 |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3670077A (enExample) |
| JP (1) | JPS5026617B1 (enExample) |
| CA (1) | CA925507A (enExample) |
| DE (1) | DE1770637A1 (enExample) |
| DK (1) | DK133099C (enExample) |
| ES (2) | ES355005A1 (enExample) |
| FR (1) | FR1572620A (enExample) |
| GB (1) | GB1229413A (enExample) |
| IL (1) | IL30145A (enExample) |
| NL (1) | NL6808306A (enExample) |
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1990012790A1 (en) * | 1989-04-21 | 1990-11-01 | Imperial Chemical Industries Plc | Pyrimidine derivatives |
| WO1991018887A1 (en) * | 1990-06-06 | 1991-12-12 | Smithkline Beecham Intercredit B.V. | Diaminopyrimidine compounds |
| US5654298A (en) * | 1990-04-19 | 1997-08-05 | Imperial Chemical Industries | Amine derivatives |
| WO2000027826A1 (de) * | 1998-11-07 | 2000-05-18 | Boehringer Ingelheim Pharma Kg | Neue pyrimidine, deren herstellung und verwendung |
| WO2009048751A1 (en) | 2007-10-09 | 2009-04-16 | Dow Agrosciences Llc | Insecticidal pyrimidinyl aryl hydrazones |
Families Citing this family (18)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| AR207561A1 (es) * | 1973-03-17 | 1976-10-15 | Heumann Ludwig & Co Gmbh | Procedimiento para la sintesis de 2,4-diamino 5(3'-metoxi-5'-substituido o no-4'alquildioxial-quilen-bencil)pirimidina |
| GB1523274A (en) * | 1974-08-05 | 1978-08-31 | Ici Ltd | Herbicidal compositions containing substituted pyrimidine |
| JPS5233118U (enExample) * | 1975-08-30 | 1977-03-08 | ||
| JPS5234519U (enExample) * | 1975-09-03 | 1977-03-11 | ||
| US4339453A (en) * | 1979-07-23 | 1982-07-13 | Merck & Co., Inc. | Antimicrobial aminopyrimidinium salts |
| DE3620841A1 (de) * | 1986-06-21 | 1987-12-23 | Basf Ag | 4-aminopyrimidinderivate |
| US5491234A (en) * | 1992-03-30 | 1996-02-13 | Pfizer Inc. | Pyrimidine derivatives for enhancing antitumor activity |
| RU95113597A (ru) * | 1992-12-02 | 1997-06-10 | ФМК Корпорейшн (US) | Инсектицидная композиция, способы борьбы с насекомыми |
| US5622954A (en) * | 1994-05-11 | 1997-04-22 | Fmc Corporation | 5[W(substituted aryl)alkenylene and alkynylene]-2,4-diaminopyrimidines as pesticides |
| US5935966A (en) * | 1995-09-01 | 1999-08-10 | Signal Pharmaceuticals, Inc. | Pyrimidine carboxylates and related compounds and methods for treating inflammatory conditions |
| US6893815B1 (en) * | 1997-06-30 | 2005-05-17 | Isis Pharmaceuticals, Inc. | Nucleobase heterocyclic combinatorialization |
| CA2383466C (en) * | 1999-09-16 | 2009-08-25 | Tanabe Seiyaku Co., Ltd. | Aromatic nitrogen-containing 6-membered cyclic compounds |
| CN1503797A (zh) * | 2001-02-26 | 2004-06-09 | 田边制药株式会社 | 吡啶并嘧啶或二氮杂萘衍生物 |
| WO2002074753A2 (de) * | 2001-03-15 | 2002-09-26 | Basf Aktiengesellschaft | 5-phenylpyrimidine, verfahren und zwischenprodukte zu ihrer herstellung und ihre verwendung zur bekaempfung von schadpilzen |
| EP1678168B1 (en) * | 2003-10-24 | 2012-07-11 | Exelixis, Inc. | P70s6 kinase modulators and method of use |
| DE102004003428A1 (de) * | 2004-01-23 | 2005-08-11 | Boehringer Ingelheim Pharma Gmbh & Co. Kg | Neue langwirksame Beta-2-Agonisten, und deren Verwendung als Arzneimittel |
| RU2375351C2 (ru) * | 2004-06-28 | 2009-12-10 | Ф.Хоффманн-Ля Рош Аг | ПРОИЗВОДНЫЕ ПИРИМИДИНА, ОБЛАДАЮЩИЕ ИНГИБИРУЮЩИМ ДЕЙСТВИЕМ В ОТНОШЕНИИ 11b-HSD1 |
| BRPI0608411A2 (pt) * | 2005-03-10 | 2009-12-29 | Basf Ag | uso de um composto, composto, processo para preparar compostos, agente, semente, e, processo para combater fungos nocivos fitopatogênicos |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2832782A (en) * | 1956-06-04 | 1958-04-29 | Bristol Lab Inc | Antifungal agent |
| US2994637A (en) * | 1957-11-13 | 1961-08-01 | Diamond Alkali Co | Aminopyrimidines as fungicides |
| US3045016A (en) * | 1958-10-03 | 1962-07-17 | Ici Ltd | 6-hydrazinopyrimidine derivatives |
| NL129225C (enExample) * | 1963-03-28 | 1900-01-01 |
-
1967
- 1967-06-14 GB GB2748267A patent/GB1229413A/en not_active Expired
-
1968
- 1968-06-03 US US733770A patent/US3670077A/en not_active Expired - Lifetime
- 1968-06-09 IL IL30145A patent/IL30145A/en unknown
- 1968-06-12 CA CA022437A patent/CA925507A/en not_active Expired
- 1968-06-12 DE DE19681770637 patent/DE1770637A1/de active Pending
- 1968-06-13 NL NL6808306A patent/NL6808306A/xx unknown
- 1968-06-14 JP JP43040626A patent/JPS5026617B1/ja active Pending
- 1968-06-14 DK DK279568A patent/DK133099C/da active
- 1968-06-14 ES ES355005A patent/ES355005A1/es not_active Expired
- 1968-06-14 FR FR1572620D patent/FR1572620A/fr not_active Expired
-
1969
- 1969-06-21 ES ES368669A patent/ES368669A1/es not_active Expired
Cited By (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| WO1990012790A1 (en) * | 1989-04-21 | 1990-11-01 | Imperial Chemical Industries Plc | Pyrimidine derivatives |
| GR900100304A (en) * | 1989-04-21 | 1991-09-27 | Ici Plc | Method for producing pyrimidine derivatives |
| US5223505A (en) * | 1989-04-21 | 1993-06-29 | Imperial Chemical Industries Plc | Pyrimidine derivatives |
| US5654298A (en) * | 1990-04-19 | 1997-08-05 | Imperial Chemical Industries | Amine derivatives |
| WO1991018887A1 (en) * | 1990-06-06 | 1991-12-12 | Smithkline Beecham Intercredit B.V. | Diaminopyrimidine compounds |
| WO2000027826A1 (de) * | 1998-11-07 | 2000-05-18 | Boehringer Ingelheim Pharma Kg | Neue pyrimidine, deren herstellung und verwendung |
| WO2009048751A1 (en) | 2007-10-09 | 2009-04-16 | Dow Agrosciences Llc | Insecticidal pyrimidinyl aryl hydrazones |
Also Published As
| Publication number | Publication date |
|---|---|
| ES355005A1 (es) | 1969-11-16 |
| US3670077A (en) | 1972-06-13 |
| NL6808306A (enExample) | 1968-12-16 |
| DK133099B (da) | 1976-03-22 |
| FR1572620A (enExample) | 1969-06-27 |
| JPS5026617B1 (enExample) | 1975-09-02 |
| IL30145A (en) | 1972-07-26 |
| CA925507A (en) | 1973-05-01 |
| IL30145A0 (en) | 1968-08-22 |
| DK133099C (da) | 1976-09-06 |
| DE1770637A1 (de) | 1972-01-05 |
| ES368669A1 (es) | 1971-05-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1229413A (enExample) | ||
| GB1418120A (en) | 2,6-diaminoneburlarine derivatives | |
| GB1161801A (en) | 1,3,4-Oxadiazoles | |
| GB1433920A (en) | Alkanolamine derivatives | |
| GB1336947A (en) | N-organo-thio formamides | |
| GB1222672A (en) | Novel cyclopropanecarboxanilides | |
| GB1207788A (en) | Phenyl ketoxime carbamates and their use as herbicides | |
| GB1134381A (en) | Isothiuronium salts used to combat algae pests | |
| GB1209146A (en) | Substituted tetraazaindene compounds and their use as stabilizers for photographic silver halide emulsions | |
| GB1381755A (en) | Substituted n-alkylamino-acrylamides | |
| GB1451478A (en) | Phenylguanidine derivatives and processes for their preparation | |
| GB1205029A (en) | New carbamoyloxy-phenylureas | |
| GB1381210A (en) | Azomethines of 4-amino-5-h-1,2,4-triazin-5-ones process for their production and their use as herbicides | |
| GB1398655A (en) | Process for the production of lactam hydrazones of aromatic systems | |
| GB1159493A (en) | Metal Chelates | |
| GB1469226A (en) | Process for the preparation of 2-2-thienyl-ethylamine and derivatives thereof | |
| GB1416463A (en) | Bis-acylamino sulphones | |
| GB1141249A (en) | New quinazoline compounds and methods for their production | |
| GB1230429A (enExample) | ||
| GB1200970A (en) | Process for producing benzyl cyanides and their homologues | |
| GB1296371A (enExample) | ||
| GB1233420A (enExample) | ||
| GB1129334A (en) | Alkyl n-substituted-ªß-amino-ªß-alkoxyacrylates | |
| JOHNSON et al. | 2, 6-Dicyanopiperidines | |
| GB1197815A (en) | Production of Substituted Phenylalanines and Aziridine Intermediates |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] | ||
| PLNP | Patent lapsed through nonpayment of renewal fees |