GB1185734A - Improvements in Controllable Semi-Conductor Devices - Google Patents
Improvements in Controllable Semi-Conductor DevicesInfo
- Publication number
- GB1185734A GB1185734A GB31187/67A GB3118767A GB1185734A GB 1185734 A GB1185734 A GB 1185734A GB 31187/67 A GB31187/67 A GB 31187/67A GB 3118767 A GB3118767 A GB 3118767A GB 1185734 A GB1185734 A GB 1185734A
- Authority
- GB
- United Kingdom
- Prior art keywords
- cathode layer
- layer
- auxiliary
- main
- layers
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 239000004065 semiconductor Substances 0.000 title abstract 3
- RJWLAIMXRBDUMH-ULQDDVLXSA-N N-Acetylleucyl-leucyl-methioninal Chemical compound CSCC[C@@H](C=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(C)=O RJWLAIMXRBDUMH-ULQDDVLXSA-N 0.000 abstract 1
- 239000002184 metal Substances 0.000 abstract 1
Classifications
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10D—INORGANIC ELECTRIC SEMICONDUCTOR DEVICES
- H10D84/00—Integrated devices formed in or on semiconductor substrates that comprise only semiconducting layers, e.g. on Si wafers or on GaAs-on-Si wafers
- H10D84/60—Integrated devices formed in or on semiconductor substrates that comprise only semiconducting layers, e.g. on Si wafers or on GaAs-on-Si wafers characterised by the integration of at least one component covered by groups H10D10/00 or H10D18/00, e.g. integration of BJTs
- H10D84/676—Combinations of only thyristors
-
- H—ELECTRICITY
- H10—SEMICONDUCTOR DEVICES; ELECTRIC SOLID-STATE DEVICES NOT OTHERWISE PROVIDED FOR
- H10D—INORGANIC ELECTRIC SEMICONDUCTOR DEVICES
- H10D18/00—Thyristors
- H10D18/221—Thyristors having amplifying gate structures, e.g. cascade configurations
Landscapes
- Thyristors (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| SE9292/66A SE311701B (enExample) | 1966-07-07 | 1966-07-07 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| GB1185734A true GB1185734A (en) | 1970-03-25 |
Family
ID=20276335
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| GB31187/67A Expired GB1185734A (en) | 1966-07-07 | 1967-07-06 | Improvements in Controllable Semi-Conductor Devices |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3526815A (enExample) |
| CH (1) | CH489912A (enExample) |
| DE (1) | DE1589455A1 (enExample) |
| GB (1) | GB1185734A (enExample) |
| NL (1) | NL6708955A (enExample) |
| SE (1) | SE311701B (enExample) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2349216A1 (fr) * | 1976-04-19 | 1977-11-18 | Gen Electric | Dispositif semi-conducteur auto-protege |
| FR2414794A1 (fr) * | 1978-01-16 | 1979-08-10 | Siemens Ag | Montage pour reduire le temps de recuperation d'un thyristor |
| US4812892A (en) * | 1978-03-30 | 1989-03-14 | Siemens Aktiengesellschaft | Light controllable thyristors |
| EP1267414A3 (en) * | 1994-02-24 | 2003-04-23 | Mitsubishi Denki Kabushiki Kaisha | Thyristor and method of fabricating the same |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3577046A (en) * | 1969-03-21 | 1971-05-04 | Gen Electric | Monolithic compound thyristor with a pilot portion having a metallic electrode with finger portions formed thereon |
| US3611066A (en) * | 1969-12-12 | 1971-10-05 | Gen Electric | Thyristor with integrated ballasted gate auxiliary thyristor portion |
| JPS541437B2 (enExample) * | 1973-04-18 | 1979-01-24 | ||
| US4028721A (en) * | 1973-08-01 | 1977-06-07 | Hitachi, Ltd. | Semiconductor controlled rectifier device |
| DE2458401C2 (de) * | 1974-12-10 | 1982-06-24 | Siemens AG, 1000 Berlin und 8000 München | Mit Licht steuerbarer Thyristor |
| JPS51142983A (en) * | 1975-06-04 | 1976-12-08 | Hitachi Ltd | Scr |
| JPS5410837B1 (enExample) * | 1976-10-29 | 1979-05-10 | ||
| JPS53110483A (en) * | 1977-03-09 | 1978-09-27 | Hitachi Ltd | Thyristor |
| JPS5942991B2 (ja) * | 1977-05-23 | 1984-10-18 | 株式会社日立製作所 | サイリスタ |
| JPS546787A (en) * | 1977-06-17 | 1979-01-19 | Matsushita Electric Ind Co Ltd | Luminous element |
| DE2730612C2 (de) * | 1977-07-07 | 1982-02-04 | Brown, Boveri & Cie Ag, 6800 Mannheim | Betriebsschaltung für einen Thyristor |
| DE3112941A1 (de) * | 1981-03-31 | 1982-10-07 | Siemens AG, 1000 Berlin und 8000 München | Thyristor mit innerer stromverstaerkung und verfahren zu seinem betrieb |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3201596A (en) * | 1959-12-17 | 1965-08-17 | Westinghouse Electric Corp | Sequential trip semiconductor device |
| US3124703A (en) * | 1960-06-13 | 1964-03-10 | Figure | |
| US3210620A (en) * | 1961-10-04 | 1965-10-05 | Westinghouse Electric Corp | Semiconductor device providing diode functions |
| BE624012A (enExample) * | 1961-10-27 | |||
| US3123750A (en) * | 1961-10-31 | 1964-03-03 | Multiple junction semiconductor device | |
| NL294340A (enExample) * | 1962-07-27 | 1900-01-01 | ||
| GB1112301A (en) * | 1964-07-27 | 1968-05-01 | Gen Electric | Controlled rectifier with improved turn-on and turn-off characteristics |
| CH495631A (de) * | 1964-11-28 | 1970-08-31 | Licentia Gmbh | Steuerbarer Halbleitergleichrichter |
-
1966
- 1966-07-07 SE SE9292/66A patent/SE311701B/xx unknown
-
1967
- 1967-06-27 NL NL6708955A patent/NL6708955A/xx unknown
- 1967-07-04 CH CH961267A patent/CH489912A/de not_active IP Right Cessation
- 1967-07-05 DE DE19671589455 patent/DE1589455A1/de active Pending
- 1967-07-06 GB GB31187/67A patent/GB1185734A/en not_active Expired
- 1967-07-07 US US651764A patent/US3526815A/en not_active Expired - Lifetime
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2349216A1 (fr) * | 1976-04-19 | 1977-11-18 | Gen Electric | Dispositif semi-conducteur auto-protege |
| FR2414794A1 (fr) * | 1978-01-16 | 1979-08-10 | Siemens Ag | Montage pour reduire le temps de recuperation d'un thyristor |
| US4812892A (en) * | 1978-03-30 | 1989-03-14 | Siemens Aktiengesellschaft | Light controllable thyristors |
| EP1267414A3 (en) * | 1994-02-24 | 2003-04-23 | Mitsubishi Denki Kabushiki Kaisha | Thyristor and method of fabricating the same |
Also Published As
| Publication number | Publication date |
|---|---|
| US3526815A (en) | 1970-09-01 |
| DE1589455A1 (de) | 1970-06-04 |
| SE311701B (enExample) | 1969-06-23 |
| NL6708955A (enExample) | 1968-01-08 |
| CH489912A (de) | 1970-04-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| GB1185734A (en) | Improvements in Controllable Semi-Conductor Devices | |
| ES390673A1 (es) | Un dispositivo tiristor-rectificador integral. | |
| GB1193096A (en) | Semi Conductor Device. | |
| GB1515836A (en) | Semiconductors | |
| GB1239067A (enExample) | ||
| GB1359076A (en) | Thyristor with firing current amplification | |
| GB935710A (en) | Improvements in controlled semiconductor rectifiers | |
| GB1485994A (en) | Thyristors | |
| GB1373158A (en) | Thyristors | |
| GB1263509A (en) | Improved thyristor circuit | |
| GB942901A (en) | Improvements in controlled semi-conductor rectifiers | |
| GB1164465A (en) | Controllable Semiconductor Rectifiers | |
| JPS5762562A (en) | Semiconductor device | |
| GB1088776A (en) | Semiconductor controlled rectifier having a shorted emitter | |
| GB1471426A (en) | Thyristors | |
| US4231054A (en) | Thyristor with starting and generating cathode base contacts for use in rectifier circuits | |
| GB1094336A (en) | Thyristors | |
| GB1376480A (en) | Thyristors | |
| GB1192814A (en) | Improvements in Semi-Conductor Devices | |
| GB1377420A (en) | Thyristors | |
| GB1208794A (en) | Improvements in thyristors | |
| GB586574A (en) | Anode tube for ionic valves for high voltage static current converters | |
| GB1015993A (en) | A controllable semiconductor rectifier | |
| GB1254500A (en) | Semiconductor device | |
| US3405332A (en) | Semi-conductor device with increased reverse and forward blocking voltages |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PS | Patent sealed [section 19, patents act 1949] |