FR2580725B1 - Module propulsif pour un moteur a turbine a gaz aeronautique - Google Patents
Module propulsif pour un moteur a turbine a gaz aeronautiqueInfo
- Publication number
- FR2580725B1 FR2580725B1 FR868605191A FR8605191A FR2580725B1 FR 2580725 B1 FR2580725 B1 FR 2580725B1 FR 868605191 A FR868605191 A FR 868605191A FR 8605191 A FR8605191 A FR 8605191A FR 2580725 B1 FR2580725 B1 FR 2580725B1
- Authority
- FR
- France
- Prior art keywords
- gas turbine
- turbine engine
- aeronautical gas
- propulsive
- module
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- RLQJEEJISHYWON-UHFFFAOYSA-N flonicamid Chemical compound FC(F)(F)C1=CC=NC=C1C(=O)NCC#N RLQJEEJISHYWON-UHFFFAOYSA-N 0.000 title 1
- 230000001141 propulsive effect Effects 0.000 title 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B64—AIRCRAFT; AVIATION; COSMONAUTICS
- B64C—AEROPLANES; HELICOPTERS
- B64C11/00—Propellers, e.g. of ducted type; Features common to propellers and rotors for rotorcraft
- B64C11/30—Blade pitch-changing mechanisms
- B64C11/306—Blade pitch-changing mechanisms specially adapted for contrarotating propellers
Landscapes
- Engineering & Computer Science (AREA)
- Aviation & Aerospace Engineering (AREA)
- Structures Of Non-Positive Displacement Pumps (AREA)
- Retarders (AREA)
- Turbine Rotor Nozzle Sealing (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8509837A GB2173863B (en) | 1985-04-17 | 1985-04-17 | A propeller module for an aero gas turbine engine |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FR2580725A1 FR2580725A1 (fr) | 1986-10-24 |
| FR2580725B1 true FR2580725B1 (fr) | 1991-05-10 |
Family
ID=10577792
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FR868605191A Expired - Fee Related FR2580725B1 (fr) | 1985-04-17 | 1986-04-11 | Module propulsif pour un moteur a turbine a gaz aeronautique |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US4688995A (enExample) |
| JP (1) | JPS61268598A (enExample) |
| DE (1) | DE3611792C2 (enExample) |
| FR (1) | FR2580725B1 (enExample) |
| GB (1) | GB2173863B (enExample) |
Families Citing this family (40)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB2182397B (en) * | 1985-11-02 | 1989-10-04 | Rolls Royce Plc | Propeller module for an aero gas turbine engine |
| GB2209575A (en) * | 1987-09-05 | 1989-05-17 | Rolls Royce Plc | A gearbox arrangement for driving contra-rotating multi-bladed rotors |
| DE3905282C1 (en) * | 1987-10-13 | 1990-05-31 | Karl Dipl.-Ing. 2742 Gnarrenburg De Kastens | Propeller fan |
| DE3812027A1 (de) * | 1988-04-11 | 1989-10-26 | Mtu Muenchen Gmbh | Propfan-turbotriebwerk |
| US4976102A (en) * | 1988-05-09 | 1990-12-11 | General Electric Company | Unducted, counterrotating gearless front fan engine |
| US4936746A (en) * | 1988-10-18 | 1990-06-26 | United Technologies Corporation | Counter-rotation pitch change system |
| DE3837994A1 (de) * | 1988-11-09 | 1990-05-10 | Mtu Muenchen Gmbh | Vorrichtung zur verstellung der rotorschaufeln eines propfan/turboproptriebwerkes |
| US5010729A (en) * | 1989-01-03 | 1991-04-30 | General Electric Company | Geared counterrotating turbine/fan propulsion system |
| US4968217A (en) * | 1989-09-06 | 1990-11-06 | Rolls-Royce Plc | Variable pitch arrangement for a gas turbine engine |
| DE3933776A1 (de) * | 1989-10-10 | 1991-04-18 | Mtu Muenchen Gmbh | Propfan-turbotriebwerk |
| US5070413A (en) * | 1989-10-10 | 1991-12-03 | Eastman Kodak Company | Color digital halftoning with vector error diffusion |
| US5954479A (en) * | 1996-12-16 | 1999-09-21 | Smith; Ronald A. | Twin engine, coaxial, dual-propeller propulsion system |
| RU2174616C2 (ru) * | 1999-09-21 | 2001-10-10 | Государственное унитарное предприятие "Завод им. В.Я. Климова" - дочернее предприятие государственного унитарного предприятия Военно-промышленный комплекс "МАПО" | Входное устройство для турбовинтового двигателя |
| KR100432490B1 (ko) | 2001-09-17 | 2004-05-22 | (주)니트 젠 | 광학식 지문취득 장치 |
| US7144349B2 (en) * | 2004-04-06 | 2006-12-05 | Pratt & Whitney Canada Corp. | Gas turbine gearbox |
| DE102005043615B4 (de) * | 2005-09-09 | 2009-11-19 | König, Christian | Propellerantriebseinheit |
| US7726113B2 (en) * | 2005-10-19 | 2010-06-01 | General Electric Company | Gas turbine engine assembly and methods of assembling same |
| US7526913B2 (en) * | 2005-10-19 | 2009-05-05 | General Electric Company | Gas turbine engine assembly and methods of assembling same |
| US7490461B2 (en) * | 2005-10-19 | 2009-02-17 | General Electric Company | Gas turbine engine assembly and methods of assembling same |
| US7493753B2 (en) * | 2005-10-19 | 2009-02-24 | General Electric Company | Gas turbine engine assembly and methods of assembling same |
| US7685808B2 (en) * | 2005-10-19 | 2010-03-30 | General Electric Company | Gas turbine engine assembly and methods of assembling same |
| US7513103B2 (en) * | 2005-10-19 | 2009-04-07 | General Electric Company | Gas turbine engine assembly and methods of assembling same |
| US8210798B2 (en) * | 2008-02-13 | 2012-07-03 | United Technologies Corporation | Cooled pusher propeller system |
| FR2928977B1 (fr) * | 2008-03-21 | 2010-04-09 | Snecma | Systeme d'helices contrarotatives disposant d'un dispositif de mise en drapeau des pales d'helices |
| FR2931797B1 (fr) * | 2008-05-29 | 2010-07-30 | Snecma | Systeme simplifie de commande de calage de pale d'une helice d'un turbomoteur pour aeronef |
| US8186951B2 (en) * | 2008-07-14 | 2012-05-29 | Hamilton Sundstrand Corporation | Mounting assembly for a propeller system component |
| FR2942203B1 (fr) * | 2009-02-13 | 2011-04-22 | Snecma | Systeme d'helices contrarotatives a encombrement reduit |
| DE102009010524A1 (de) * | 2009-02-25 | 2010-09-02 | Rolls-Royce Deutschland Ltd & Co Kg | Turbopropantrieb mit Druckpropeller |
| FR2945512B1 (fr) * | 2009-05-15 | 2012-08-24 | Snecma | Helice non carenee a pales a calage variable pour une turbomachine |
| FR2956378B1 (fr) * | 2010-02-15 | 2012-05-11 | Snecma | Turbopropulseur muni d'un dispositif d'orientation de pales |
| RU2428577C1 (ru) * | 2010-04-13 | 2011-09-10 | Открытое акционерное общество "Авиадвигатель" | Газотурбинный двигатель с двухрядным винтовентилятором |
| US8701381B2 (en) | 2010-11-24 | 2014-04-22 | Rolls-Royce Corporation | Remote shaft driven open rotor propulsion system with electrical power generation |
| BR112015007799B1 (pt) * | 2012-10-23 | 2022-01-04 | General Electric Company | Sistema de produção de empuxo não canalizado |
| WO2014143255A1 (en) * | 2013-03-15 | 2014-09-18 | United Technologies Corporation | De-icing by integral electric heat generation |
| US9701395B2 (en) | 2014-01-06 | 2017-07-11 | United Technologies Corporation | Contra-rotating open rotor distributed propulsion system |
| FR3050431B1 (fr) * | 2016-04-20 | 2018-04-27 | Safran Aircraft Engines | Systeme d'actionnement simplifie de pas pour une helice de turbomachine |
| US10618667B2 (en) | 2016-10-31 | 2020-04-14 | Rolls-Royce Corporation | Fan module with adjustable pitch blades and power system |
| US10737801B2 (en) * | 2016-10-31 | 2020-08-11 | Rolls-Royce Corporation | Fan module with rotatable vane ring power system |
| FR3087849B1 (fr) * | 2018-10-26 | 2020-11-20 | Safran Aircraft Engines | Turbomachine a double helices non carenees |
| US12510025B2 (en) * | 2023-02-17 | 2025-12-30 | General Electric Company | Reverse flow gas turbine engine having electric machine |
Family Cites Families (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB544948A (en) * | 1938-10-13 | 1942-05-05 | Daimler Benz Ag | Improvements in and connected with variable pitch airscrews |
| GB531756A (en) * | 1939-06-14 | 1941-01-10 | John Stafford Northcote | Device employing epicyclic or bevel gears or a combination of both for controlling the pitch of variable pitch airscrews |
| US2394299A (en) * | 1940-02-05 | 1946-02-05 | Friedrich Albert | Drive for oppositely rotating propellers |
| DE880103C (de) * | 1940-02-06 | 1953-06-18 | Daimler Benz Ag | Antrieb fuer gegenlaeufige Luftschrauben |
| FR865942A (fr) * | 1940-02-16 | 1941-06-09 | Dispositif de liaison entre un arbre moteur et deux hélices co-axiales et mécanisme de commande des changements de pas de ces hélices | |
| GB575765A (en) * | 1941-04-15 | 1946-03-05 | Haviland Aircraft Company Ltd | Improvements in variable pitch propellers |
| FR887543A (fr) * | 1941-11-06 | 1943-11-16 | Bmw Flugmotorenbau Gmbh | Hélices à pas variable, tournant en sens inverse |
| BE468782A (enExample) * | 1942-01-12 | |||
| FR977459A (fr) * | 1942-07-08 | 1951-04-02 | Perfectionnements aux mécanismes d'accouplement et de commande des variations de pas des hélices co-axiales | |
| FR897057A (fr) * | 1942-10-01 | 1945-03-12 | Ettore Ambrosetti Off | Moyeu d'hélice pour aéronefs |
| FR900664A (fr) * | 1943-08-24 | 1945-07-05 | équipement de piolets | |
| CH259296A (de) * | 1945-10-13 | 1949-01-15 | Svenska Turbinfab Ab | Propeller-Antriebseinrichtung an Fahrzeugen. |
| FR1005590A (fr) * | 1947-08-14 | 1952-04-11 | Cie Gen Equip Aeronautique | Perfectionnements à la commande de changement de pas des pales d'hélices coaxiales |
| FR1005734A (fr) * | 1947-09-15 | 1952-04-15 | Snecma | Machine aéronautique à hélice |
| US2679907A (en) * | 1950-05-18 | 1954-06-01 | United Aircraft Corp | Dual rotation coaxial propeller mechanism |
| US3900274A (en) * | 1974-06-25 | 1975-08-19 | Gen Electric | Remote controlled actuation system for the rotor of a gas turbine engine |
| US4486146A (en) * | 1980-08-08 | 1984-12-04 | British Aerospace Public Limited Company | Aircraft propulsion means |
| SE445107B (sv) * | 1983-06-22 | 1986-06-02 | Volvo Penta Ab | Rotoranordning |
| GB2145777B (en) * | 1983-08-29 | 1987-07-22 | Gen Electric | Aircraft propeller system |
| US4563129A (en) * | 1983-12-08 | 1986-01-07 | United Technologies Corporation | Integrated reduction gear and counterrotation propeller |
| US4591313A (en) * | 1983-12-30 | 1986-05-27 | The Boeing Company | Propeller pitch control system and apparatus |
| GB2182397B (en) * | 1985-11-02 | 1989-10-04 | Rolls Royce Plc | Propeller module for an aero gas turbine engine |
| GB2186918B (en) * | 1986-02-25 | 1989-11-15 | Rolls Royce | Propeller module for an aero gas turbine engine |
-
1985
- 1985-04-17 GB GB8509837A patent/GB2173863B/en not_active Expired
-
1986
- 1986-02-25 US US06/832,771 patent/US4688995A/en not_active Expired - Lifetime
- 1986-04-08 DE DE3611792A patent/DE3611792C2/de not_active Expired - Fee Related
- 1986-04-11 JP JP61084007A patent/JPS61268598A/ja active Granted
- 1986-04-11 FR FR868605191A patent/FR2580725B1/fr not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| FR2580725A1 (fr) | 1986-10-24 |
| GB2173863A (en) | 1986-10-22 |
| DE3611792A1 (de) | 1986-11-06 |
| JPH0533200B2 (enExample) | 1993-05-18 |
| US4688995A (en) | 1987-08-25 |
| JPS61268598A (ja) | 1986-11-28 |
| GB2173863B (en) | 1989-07-19 |
| DE3611792C2 (de) | 1994-02-17 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FR2580725B1 (fr) | Module propulsif pour un moteur a turbine a gaz aeronautique | |
| FR2594886B1 (fr) | Module propulsif pour un moteur aeronautique a turbine a gaz | |
| FR2589427B1 (fr) | Module d'helice pour un moteur a turbine a gaz aeronautique | |
| FR2586453B1 (fr) | Carburateur pour moteur a turbine a gaz | |
| FR2557212B1 (fr) | Structure de stator pour un moteur a turbine a gaz | |
| GB2165964B (en) | Combustion system for a gas turbine engine | |
| DE3665627D1 (en) | Combustion liner for a gas turbine engine | |
| FR2575221B1 (fr) | Stator refroidissable pour un moteur a turbine a gaz | |
| FR2617907B1 (fr) | Moteur a turbine a gaz | |
| DE3663847D1 (en) | Combustor for gas turbine engine | |
| GB2121613B (en) | A gas turbine engine for an aircraft | |
| FR2592092B1 (fr) | Turbine a aubes refroidies notamment pour moteur a turbine a gaz | |
| GB2182724B (en) | Gas turbine engine thrust reverser | |
| GB2150277B (en) | Combustion apparatus for a gas turbine engine | |
| FR2533620B1 (fr) | Assemblage de rotor pour un moteur a turbine a gaz | |
| FR2541371B1 (fr) | Circuit de refroidissement pour moteur a turbine a gaz | |
| GB2110762B (en) | Gas turbine engine for a v/stol aircraft | |
| GB2195712B (en) | A turbofan gas turbine engine | |
| FI871854A7 (fi) | Menetelmä kaaasuturbiinikoneikon käyttämiseksi | |
| GB2138075B (en) | Driving a turbine by ic engine exhaust gases | |
| FR2586755B1 (fr) | Systeme de carburant pour un moteur a turbine a gaz | |
| FR2583459B1 (fr) | Dispositif de regulation de carburant pour un moteur a turbine a gaz. | |
| FR2527268B1 (fr) | Prediffuseur pour un moteur a turbine a gaz | |
| IT1185058B (it) | Dispositivo di modulazione di spinta per turbomotore a gas | |
| GB2198518B (en) | Combustion apparatus for a gas turbine engine |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| ST | Notification of lapse |