FR2373157A1 - Lampe a decharge a haute pression contenant des halogenures metalliques - Google Patents
Lampe a decharge a haute pression contenant des halogenures metalliquesInfo
- Publication number
- FR2373157A1 FR2373157A1 FR7736530A FR7736530A FR2373157A1 FR 2373157 A1 FR2373157 A1 FR 2373157A1 FR 7736530 A FR7736530 A FR 7736530A FR 7736530 A FR7736530 A FR 7736530A FR 2373157 A1 FR2373157 A1 FR 2373157A1
- Authority
- FR
- France
- Prior art keywords
- high pressure
- discharge lamp
- containing metal
- pressure discharge
- lamp containing
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 229910052751 metal Inorganic materials 0.000 title abstract 2
- 239000002184 metal Substances 0.000 title abstract 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 abstract 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 abstract 1
- 150000003842 bromide salts Chemical class 0.000 abstract 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 abstract 1
- 150000004694 iodide salts Chemical class 0.000 abstract 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 abstract 1
- 229910052753 mercury Inorganic materials 0.000 abstract 1
- 229910001507 metal halide Inorganic materials 0.000 abstract 1
- 150000005309 metal halides Chemical class 0.000 abstract 1
- 150000002739 metals Chemical class 0.000 abstract 1
- 238000009877 rendering Methods 0.000 abstract 1
- 229910052708 sodium Inorganic materials 0.000 abstract 1
- 239000011734 sodium Substances 0.000 abstract 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01J—ELECTRIC DISCHARGE TUBES OR DISCHARGE LAMPS
- H01J61/00—Gas-discharge or vapour-discharge lamps
- H01J61/02—Details
- H01J61/12—Selection of substances for gas fillings; Specified operating pressure or temperature
- H01J61/18—Selection of substances for gas fillings; Specified operating pressure or temperature having a metallic vapour as the principal constituent
Landscapes
- Discharge Lamp (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2655167A DE2655167C2 (de) | 1976-12-06 | 1976-12-06 | Hochdruckentladungslampe mit Metallhalogeniden |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FR2373157A1 true FR2373157A1 (fr) | 1978-06-30 |
| FR2373157B1 FR2373157B1 (en:Method) | 1983-01-07 |
Family
ID=5994768
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FR7736530A Granted FR2373157A1 (fr) | 1976-12-06 | 1977-12-05 | Lampe a decharge a haute pression contenant des halogenures metalliques |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US4171498A (en:Method) |
| DE (1) | DE2655167C2 (en:Method) |
| FR (1) | FR2373157A1 (en:Method) |
| GB (1) | GB1584417A (en:Method) |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0535311A1 (de) * | 1991-09-30 | 1993-04-07 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH | Hochdruckentladungslampe kleiner Leistung |
Families Citing this family (38)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2840771A1 (de) * | 1978-09-19 | 1980-03-27 | Patra Patent Treuhand | Hochdruckentladungslampe mit metallhalogeniden |
| US4360756A (en) * | 1979-11-13 | 1982-11-23 | General Electric Company | Metal halide lamp containing ThI4 with added elemental cadmium or zinc |
| US4387319A (en) * | 1981-03-30 | 1983-06-07 | General Electric Company | Metal halide lamp containing ScI3 with added cadmium or zinc |
| US4469980A (en) * | 1981-12-21 | 1984-09-04 | General Electric Company | Fluorescent lamp with non-scattering phosphor |
| JPS58112239A (ja) * | 1981-12-25 | 1983-07-04 | Toshiba Corp | 小形メタルハライドランプ |
| DD203430A1 (de) * | 1982-01-19 | 1983-10-19 | Kloss | Elektrodenstabilisierte hochdruckentladungslampe mit leuchtzusaetzen |
| US4557700A (en) * | 1983-06-09 | 1985-12-10 | Gte Products Corporation | Metal halide discharge lamp gas fill process to provide minimal color separation |
| US4612000A (en) * | 1983-06-09 | 1986-09-16 | Gte Products Corporation | Single-ended metal halide discharge lamps and process of manufacture |
| US4605881A (en) * | 1984-11-29 | 1986-08-12 | General Electric Company | High pressure sodium iodide arc lamp with excess iodine |
| US4801846A (en) * | 1986-12-19 | 1989-01-31 | Gte Laboratories Incorporated | Rare earth halide light source with enhanced red emission |
| HU196861B (en) * | 1987-01-23 | 1989-01-30 | Tungsram Reszvenytarsasag | Low colour-temperature high-pressure metal-halide lamp with good colour reproduction |
| NL191812C (nl) * | 1987-09-04 | 1996-08-02 | Philips Electronics Nv | Hogedrukgasontladingslamp en armatuur voorzien van die lamp. |
| US4866328A (en) * | 1988-04-15 | 1989-09-12 | North American Philips Corp. | Electric lamp with reduced internal photoelectron production |
| KR0167339B1 (ko) * | 1989-02-07 | 1999-01-15 | 스루오 스토무 | 금속 할라이드 램프 |
| US4992700A (en) * | 1989-03-10 | 1991-02-12 | General Electric Company | Reprographic metal halide lamps having high blue emission |
| US5013968A (en) * | 1989-03-10 | 1991-05-07 | General Electric Company | Reprographic metal halide lamps having long life and maintenance |
| JP2650463B2 (ja) * | 1989-05-31 | 1997-09-03 | 岩崎電気株式会社 | メタルハライドランプ |
| US5021703A (en) * | 1989-06-06 | 1991-06-04 | Gte Products Corporation | Metal halide lamp |
| US5159229A (en) * | 1989-06-06 | 1992-10-27 | Gte Products Corporation | Metal halide lamp having CO in gas fill |
| JPH03152852A (ja) * | 1989-11-08 | 1991-06-28 | Matsushita Electric Works Ltd | 高輝度放電ランプ及び無電極放電灯装置 |
| US5256940A (en) * | 1989-11-08 | 1993-10-26 | Matsushita Electric Works, Ltd. | High intensity discharge lamp device |
| DE4013039A1 (de) * | 1990-04-24 | 1991-10-31 | Patent Treuhand Ges Fuer Elektrische Gluehlampen Mbh | Hochdruckentladungslampe |
| US5272407A (en) * | 1991-12-18 | 1993-12-21 | North American Philips Corporation | Electric lamp having screens for reducing photo electron emission |
| US5708328A (en) * | 1992-06-03 | 1998-01-13 | General Electric Company | Universal burn metal halide lamp |
| GB2284704B (en) * | 1993-12-10 | 1998-07-08 | Gen Electric | Patterned optical interference coatings for electric lamps |
| US5972442A (en) * | 1996-08-23 | 1999-10-26 | Advanced Lighting Technologies, Inc. | Strengthening agent, strengthened metal halide particles, and improved lamp fill material |
| US6284165B1 (en) * | 1996-08-23 | 2001-09-04 | Scott Anderson | Methods of strengthening metal halide particles, and improved lamp fill material |
| JPH1092385A (ja) * | 1996-09-12 | 1998-04-10 | Matsushita Electron Corp | 管 球 |
| CA2398677A1 (en) * | 2000-01-20 | 2001-07-26 | Osram Sylvania Inc. | High pressure sodium lamp having reduced arc tube size |
| DE10234758B4 (de) * | 2002-07-30 | 2006-02-16 | Sli Lichtsysteme Gmbh | Metall-Halogendampflampe niedriger Leistung |
| DE10254969A1 (de) * | 2002-11-26 | 2004-06-03 | Philips Intellectual Property & Standards Gmbh | Hochdruckentladungslampe mit Quecksilberchlorid bei begrenztem Chlorgehalt |
| US20090015162A1 (en) * | 2003-06-30 | 2009-01-15 | Koninklijke Philips Electronics N.V. | Electric Lamp Having Strapless Support Mount for Mh Arc Tubes |
| DE102004019185A1 (de) * | 2004-04-16 | 2005-11-10 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH | Hochdruckentladungslampe |
| US20060132043A1 (en) * | 2004-12-20 | 2006-06-22 | Srivastava Alok M | Mercury-free discharge compositions and lamps incorporating gallium |
| US7633226B2 (en) * | 2005-11-30 | 2009-12-15 | General Electric Company | Electrode materials for electric lamps and methods of manufacture thereof |
| DE102006034833A1 (de) * | 2006-07-27 | 2008-01-31 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH | Hochdruckentladungslampe |
| DE102008049476A1 (de) * | 2008-09-29 | 2010-04-01 | Osram Gesellschaft mit beschränkter Haftung | Hochdruckentladungslampe |
| US9171712B2 (en) | 2014-07-05 | 2015-10-27 | National Institute Of Standards And Technology | Lamp having a secondary halide that improves luminous efficiency |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2103731A5 (en:Method) * | 1970-07-31 | 1972-04-14 | Philips Nv |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3398312A (en) * | 1965-11-24 | 1968-08-20 | Westinghouse Electric Corp | High pressure vapor discharge lamp having a fill including sodium iodide and a free metal |
| US3521110A (en) * | 1967-09-25 | 1970-07-21 | Gen Electric | Mercury-metallic halide vapor lamp with regenerative cycle |
| US3781586A (en) * | 1972-12-04 | 1973-12-25 | Gen Electric | Long lifetime mercury-metal halide discharge lamps |
| NL7303079A (en:Method) * | 1973-03-06 | 1974-09-10 | ||
| DE2422411A1 (de) * | 1974-05-09 | 1975-12-11 | Philips Patentverwaltung | Hochdruckquecksilberdampfentladungslampe |
| GB1541437A (en) * | 1975-02-13 | 1979-02-28 | Thorn Electrical Ind Ltd | Electrical discharge lamp |
-
1976
- 1976-12-06 DE DE2655167A patent/DE2655167C2/de not_active Expired
-
1977
- 1977-11-25 US US05/854,765 patent/US4171498A/en not_active Expired - Lifetime
- 1977-11-29 GB GB49568/77A patent/GB1584417A/en not_active Expired
- 1977-12-05 FR FR7736530A patent/FR2373157A1/fr active Granted
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2103731A5 (en:Method) * | 1970-07-31 | 1972-04-14 | Philips Nv |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0535311A1 (de) * | 1991-09-30 | 1993-04-07 | Patent-Treuhand-Gesellschaft für elektrische Glühlampen mbH | Hochdruckentladungslampe kleiner Leistung |
| US5363007A (en) * | 1991-09-30 | 1994-11-08 | Patent-Treuhand-Gesellschaft Fuer Elektrische Gluehlampen Mbh | Low-power, high-pressure discharge lamp, particularly for general service illumination use |
Also Published As
| Publication number | Publication date |
|---|---|
| DE2655167A1 (de) | 1978-06-08 |
| FR2373157B1 (en:Method) | 1983-01-07 |
| DE2655167C2 (de) | 1986-12-18 |
| US4171498A (en) | 1979-10-16 |
| GB1584417A (en) | 1981-02-11 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FR2373157A1 (fr) | Lampe a decharge a haute pression contenant des halogenures metalliques | |
| ES2076199T3 (es) | Lampara de descarga en vapor de mercurio a alta presion. | |
| GB965225A (en) | Improvements in metal vapor lamps | |
| DE59803262D1 (de) | Leuchtstofflampe | |
| DE3670925D1 (de) | Kompakte hochdruckentladungslampe. | |
| ES412802A1 (es) | Un dispositivo de lampara de descarga en vapor de mercurio de alta presion. | |
| KR920007059A (ko) | 저수은 증기압 방전램프 | |
| EP1349197A3 (en) | Metal halide lamp and automotive headlamp apparatus | |
| FR2437063A2 (fr) | Lampe a decharge a haute pression et a halogenures | |
| ES423866A1 (es) | Una lampara de descarga en vapor de mercurio a alta pre- sion. | |
| ES458101A1 (es) | Perfeccionamientos en lamparas de descarga de vapor haloge- no-metalico. | |
| EP0183247A3 (en) | High pressure metal halide lamp with xenon buffer gas | |
| FR2408213A1 (fr) | Lampe a decharge dans la vapeur de mercure a basse pression | |
| FR2441920A1 (fr) | Lampe a decharge dans la vapeur de mercure a basse pression | |
| JPS5562653A (en) | Metal halide lamp | |
| JPS57113550A (en) | Discharge lamp | |
| JPS5725665A (en) | Metal halide lamp | |
| JPS54119783A (en) | Electrodeless discharge lamp | |
| JPS563962A (en) | High-pressure metal vapor discharge lamp | |
| JPS5753062A (en) | Halide lamp | |
| JPS5790860A (en) | Metal halide lamp | |
| BE899492A (fr) | Lampe a decharge dans la vapeur de metal alcalin a basse pression. | |
| JPS5749156A (en) | Discharge lamp | |
| JPS55163760A (en) | High pressure metallic gas discharge lamp | |
| RU93043800A (ru) | Металлогалогенная лампа |