FI80238C - Uppteckningsmaterial. - Google Patents
Uppteckningsmaterial. Download PDFInfo
- Publication number
- FI80238C FI80238C FI844263A FI844263A FI80238C FI 80238 C FI80238 C FI 80238C FI 844263 A FI844263 A FI 844263A FI 844263 A FI844263 A FI 844263A FI 80238 C FI80238 C FI 80238C
- Authority
- FI
- Finland
- Prior art keywords
- group
- alkyl
- groups
- formula
- atom
- Prior art date
Links
- 239000000463 material Substances 0.000 title claims abstract description 29
- 150000001875 compounds Chemical class 0.000 claims abstract description 56
- -1 2,3- disubstituted-1,2,3,4-tetrahydroquinazolin-4-ones Chemical class 0.000 claims abstract description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 21
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 12
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 12
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 12
- 229910052757 nitrogen Inorganic materials 0.000 claims description 11
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 9
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 9
- XWWYZFUBBJHKSP-UHFFFAOYSA-N 2,3-dihydro-1h-quinazolin-4-one Chemical compound C1=CC=C2C(=O)NCNC2=C1 XWWYZFUBBJHKSP-UHFFFAOYSA-N 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 6
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 125000003545 alkoxy group Chemical group 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 5
- 125000005843 halogen group Chemical group 0.000 claims description 5
- 239000011241 protective layer Substances 0.000 claims description 5
- 125000005037 alkyl phenyl group Chemical group 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000004214 1-pyrrolidinyl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 2
- 125000005842 heteroatom Chemical group 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000005322 morpholin-1-yl group Chemical group 0.000 claims description 2
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 2
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 claims description 2
- 125000000587 piperidin-1-yl group Chemical group [H]C1([H])N(*)C([H])([H])C([H])([H])C([H])([H])C1([H])[H] 0.000 claims description 2
- 125000004400 (C1-C12) alkyl group Chemical group 0.000 claims 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 2
- 125000001033 ether group Chemical group 0.000 claims 2
- 125000000623 heterocyclic group Chemical group 0.000 claims 2
- 125000004642 (C1-C12) alkoxy group Chemical group 0.000 claims 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims 1
- 239000000203 mixture Substances 0.000 abstract description 16
- 238000009472 formulation Methods 0.000 abstract 1
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 24
- 239000000047 product Substances 0.000 description 17
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 15
- 238000000034 method Methods 0.000 description 15
- 239000000126 substance Substances 0.000 description 15
- 239000000243 solution Substances 0.000 description 13
- 238000000576 coating method Methods 0.000 description 12
- 238000005562 fading Methods 0.000 description 12
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 description 10
- 230000015572 biosynthetic process Effects 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- 238000002844 melting Methods 0.000 description 9
- 230000008018 melting Effects 0.000 description 9
- 239000003593 chromogenic compound Substances 0.000 description 8
- 239000011248 coating agent Substances 0.000 description 8
- 239000000543 intermediate Substances 0.000 description 7
- 230000002378 acidificating effect Effects 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 238000001228 spectrum Methods 0.000 description 6
- 230000000052 comparative effect Effects 0.000 description 5
- 229910052736 halogen Inorganic materials 0.000 description 5
- 150000002367 halogens Chemical class 0.000 description 5
- 239000003094 microcapsule Substances 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- 239000002904 solvent Substances 0.000 description 5
- 238000012546 transfer Methods 0.000 description 5
- 238000002371 ultraviolet--visible spectrum Methods 0.000 description 5
- QMNUDYFKZYBWQX-UHFFFAOYSA-N 1H-quinazolin-4-one Chemical class C1=CC=C2C(=O)N=CNC2=C1 QMNUDYFKZYBWQX-UHFFFAOYSA-N 0.000 description 4
- 235000005979 Citrus limon Nutrition 0.000 description 4
- 244000131522 Citrus pyriformis Species 0.000 description 4
- WGQKYBSKWIADBV-UHFFFAOYSA-N benzylamine Chemical group NCC1=CC=CC=C1 WGQKYBSKWIADBV-UHFFFAOYSA-N 0.000 description 4
- 239000003086 colorant Substances 0.000 description 4
- VAMXMNNIEUEQDV-UHFFFAOYSA-N methyl anthranilate Chemical compound COC(=O)C1=CC=CC=C1N VAMXMNNIEUEQDV-UHFFFAOYSA-N 0.000 description 4
- 230000001590 oxidative effect Effects 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- 238000012360 testing method Methods 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- FFRBMBIXVSCUFS-UHFFFAOYSA-N 2,4-dinitro-1-naphthol Chemical compound C1=CC=C2C(O)=C([N+]([O-])=O)C=C([N+]([O-])=O)C2=C1 FFRBMBIXVSCUFS-UHFFFAOYSA-N 0.000 description 3
- FDPVTENMNDHFNK-UHFFFAOYSA-N 2-amino-n-phenylbenzamide Chemical compound NC1=CC=CC=C1C(=O)NC1=CC=CC=C1 FDPVTENMNDHFNK-UHFFFAOYSA-N 0.000 description 3
- BGNGWHSBYQYVRX-UHFFFAOYSA-N 4-(dimethylamino)benzaldehyde Chemical compound CN(C)C1=CC=C(C=O)C=C1 BGNGWHSBYQYVRX-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 239000004927 clay Substances 0.000 description 3
- 238000001035 drying Methods 0.000 description 3
- 239000000975 dye Substances 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- HVTICUPFWKNHNG-UHFFFAOYSA-N iodoethane Chemical compound CCI HVTICUPFWKNHNG-UHFFFAOYSA-N 0.000 description 3
- 239000003960 organic solvent Substances 0.000 description 3
- 239000000376 reactant Substances 0.000 description 3
- 238000010992 reflux Methods 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 125000004070 6 membered heterocyclic group Chemical group 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- 108010010803 Gelatin Proteins 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 125000002252 acyl group Chemical group 0.000 description 2
- 150000001412 amines Chemical class 0.000 description 2
- 239000008346 aqueous phase Substances 0.000 description 2
- 239000000440 bentonite Substances 0.000 description 2
- 229910000278 bentonite Inorganic materials 0.000 description 2
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 2
- 150000001555 benzenes Chemical class 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 239000000084 colloidal system Substances 0.000 description 2
- 230000000295 complement effect Effects 0.000 description 2
- 125000000753 cycloalkyl group Chemical group 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 229920000159 gelatin Polymers 0.000 description 2
- 239000008273 gelatin Substances 0.000 description 2
- 235000019322 gelatine Nutrition 0.000 description 2
- 235000011852 gelatine desserts Nutrition 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- XPXMKIXDFWLRAA-UHFFFAOYSA-N hydrazinide Chemical compound [NH-]N XPXMKIXDFWLRAA-UHFFFAOYSA-N 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- VYFOAVADNIHPTR-UHFFFAOYSA-N isatoic anhydride Chemical compound NC1=CC=CC=C1CO VYFOAVADNIHPTR-UHFFFAOYSA-N 0.000 description 2
- 239000003350 kerosene Substances 0.000 description 2
- 239000010410 layer Substances 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 230000003647 oxidation Effects 0.000 description 2
- 238000007254 oxidation reaction Methods 0.000 description 2
- RZXMPPFPUUCRFN-UHFFFAOYSA-N p-toluidine Chemical group CC1=CC=C(N)C=C1 RZXMPPFPUUCRFN-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 238000000985 reflectance spectrum Methods 0.000 description 2
- 230000003595 spectral effect Effects 0.000 description 2
- 238000010183 spectrum analysis Methods 0.000 description 2
- 125000001424 substituent group Chemical group 0.000 description 2
- 125000001443 terpenyl group Chemical group 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 125000004343 1-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])(*)C([H])([H])[H] 0.000 description 1
- AFLKVWCEGIIHNI-UHFFFAOYSA-N 2-[(2-aminophenyl)methyl]benzamide Chemical compound NC(=O)C1=CC=CC=C1CC1=CC=CC=C1N AFLKVWCEGIIHNI-UHFFFAOYSA-N 0.000 description 1
- ANVAEYULLAJMQX-UHFFFAOYSA-N 2-amino-n-benzylbenzamide Chemical compound NC1=CC=CC=C1C(=O)NCC1=CC=CC=C1 ANVAEYULLAJMQX-UHFFFAOYSA-N 0.000 description 1
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- VMLDMNPGGINIGV-UHFFFAOYSA-N 3-benzyl-2-[4-(dimethylamino)phenyl]quinazolin-4-one Chemical compound C1=CC(N(C)C)=CC=C1C1=NC2=CC=CC=C2C(=O)N1CC1=CC=CC=C1 VMLDMNPGGINIGV-UHFFFAOYSA-N 0.000 description 1
- AVPYQKSLYISFPO-UHFFFAOYSA-N 4-chlorobenzaldehyde Chemical compound ClC1=CC=C(C=O)C=C1 AVPYQKSLYISFPO-UHFFFAOYSA-N 0.000 description 1
- 125000002373 5 membered heterocyclic group Chemical group 0.000 description 1
- OCKGFTQIICXDQW-ZEQRLZLVSA-N 5-[(1r)-1-hydroxy-2-[4-[(2r)-2-hydroxy-2-(4-methyl-1-oxo-3h-2-benzofuran-5-yl)ethyl]piperazin-1-yl]ethyl]-4-methyl-3h-2-benzofuran-1-one Chemical compound C1=C2C(=O)OCC2=C(C)C([C@@H](O)CN2CCN(CC2)C[C@H](O)C2=CC=C3C(=O)OCC3=C2C)=C1 OCKGFTQIICXDQW-ZEQRLZLVSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 239000004606 Fillers/Extenders Substances 0.000 description 1
- 101000840267 Homo sapiens Immunoglobulin lambda-like polypeptide 1 Proteins 0.000 description 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 1
- 102100029616 Immunoglobulin lambda-like polypeptide 1 Human genes 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 1
- AFBPFSWMIHJQDM-UHFFFAOYSA-N N-methyl-N-phenylamine Natural products CNC1=CC=CC=C1 AFBPFSWMIHJQDM-UHFFFAOYSA-N 0.000 description 1
- 229920001131 Pulp (paper) Polymers 0.000 description 1
- 208000033641 Ring chromosome 5 syndrome Diseases 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QFFVPLLCYGOFPU-UHFFFAOYSA-N barium chromate Chemical class [Ba+2].[O-][Cr]([O-])(=O)=O QFFVPLLCYGOFPU-UHFFFAOYSA-N 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 235000010290 biphenyl Nutrition 0.000 description 1
- 150000004074 biphenyls Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000005354 coacervation Methods 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 108010041382 compound 20 Proteins 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000003759 ester based solvent Substances 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 230000002538 fungal effect Effects 0.000 description 1
- ZZUFCTLCJUWOSV-UHFFFAOYSA-N furosemide Chemical class C1=C(Cl)C(S(=O)(=O)N)=CC(C(O)=O)=C1NCC1=CC=CO1 ZZUFCTLCJUWOSV-UHFFFAOYSA-N 0.000 description 1
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical class OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 1
- 238000013038 hand mixing Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 238000002386 leaching Methods 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- NXPHGHWWQRMDIA-UHFFFAOYSA-M magnesium;carbanide;bromide Chemical compound [CH3-].[Mg+2].[Br-] NXPHGHWWQRMDIA-UHFFFAOYSA-M 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- RCBPARPFVKNWPU-UHFFFAOYSA-N n-[4-(4-oxo-3-phenyl-1,2-dihydroquinazolin-2-yl)phenyl]acetamide Chemical compound C1=CC(NC(=O)C)=CC=C1C1N(C=2C=CC=CC=2)C(=O)C2=CC=CC=C2N1 RCBPARPFVKNWPU-UHFFFAOYSA-N 0.000 description 1
- 150000002790 naphthalenes Chemical class 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- IOQPZZOEVPZRBK-UHFFFAOYSA-N octan-1-amine Chemical compound CCCCCCCCN IOQPZZOEVPZRBK-UHFFFAOYSA-N 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 238000007248 oxidative elimination reaction Methods 0.000 description 1
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000005011 phenolic resin Substances 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 150000003014 phosphoric acid esters Chemical class 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 125000005506 phthalide group Chemical group 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 238000010944 pre-mature reactiony Methods 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 239000013055 pulp slurry Substances 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000012264 purified product Substances 0.000 description 1
- 125000004309 pyranyl group Chemical class O1C(C=CC=C1)* 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 238000007142 ring opening reaction Methods 0.000 description 1
- JZWFDVDETGFGFC-UHFFFAOYSA-N salacetamide Chemical group CC(=O)NC(=O)C1=CC=CC=C1O JZWFDVDETGFGFC-UHFFFAOYSA-N 0.000 description 1
- 150000003870 salicylic acids Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- AAAQKTZKLRYKHR-UHFFFAOYSA-N triphenylmethane Chemical compound C1=CC=CC=C1C(C=1C=CC=CC=1)C1=CC=CC=C1 AAAQKTZKLRYKHR-UHFFFAOYSA-N 0.000 description 1
- 238000002211 ultraviolet spectrum Methods 0.000 description 1
- 238000001429 visible spectrum Methods 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/124—Duplicating or marking methods; Sheet materials for use therein using pressure to make a masked colour visible, e.g. to make a coloured support visible, to create an opaque or transparent pattern, or to form colour by uniting colour-forming components
- B41M5/132—Chemical colour-forming components; Additives or binders therefor
- B41M5/136—Organic colour formers, e.g. leuco dyes
Landscapes
- Chemical & Material Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Color Printing (AREA)
- Materials For Medical Uses (AREA)
- Developing Agents For Electrophotography (AREA)
- Medicines Containing Plant Substances (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB838329361A GB8329361D0 (en) | 1983-11-03 | 1983-11-03 | Record material |
| GB8329361 | 1983-11-03 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI844263A0 FI844263A0 (fi) | 1984-10-31 |
| FI844263L FI844263L (fi) | 1985-05-04 |
| FI80238B FI80238B (fi) | 1990-01-31 |
| FI80238C true FI80238C (fi) | 1990-05-10 |
Family
ID=10551170
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI844263A FI80238C (fi) | 1983-11-03 | 1984-10-31 | Uppteckningsmaterial. |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4587538A (enExample) |
| EP (1) | EP0145225B1 (enExample) |
| JP (1) | JPS60115483A (enExample) |
| AT (1) | ATE46864T1 (enExample) |
| AU (1) | AU562427B2 (enExample) |
| CA (1) | CA1224036A (enExample) |
| DE (1) | DE3479987D1 (enExample) |
| FI (1) | FI80238C (enExample) |
| GB (1) | GB8329361D0 (enExample) |
| ZA (1) | ZA848594B (enExample) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4625027A (en) * | 1982-10-25 | 1986-11-25 | Ciba-Geigy Corporation | Bisquinazolines useful in color former systems |
| US4668966A (en) * | 1984-04-18 | 1987-05-26 | Ciba-Geigy Corporation | Aliphatic bridged chromogenic bisquinazolines substituted with phenylamine or phenyl-containing heterobicyclic radicals |
| DE3612440A1 (de) * | 1986-04-12 | 1987-10-22 | Bayer Ag | Benzimidazolo-chianzoline |
| NZ551775A (en) * | 2004-06-01 | 2010-12-24 | Univ Virginia | Dual small molecule inhibitors of cancer and angiogenesis |
| EP2722047A1 (en) * | 2012-10-19 | 2014-04-23 | Commissariat A L'energie Atomique Et Aux Energies Alternatives | 2,3-dihydroquinazolin-4(1H)-one derivatives for use in the treatment of viral infections |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3102760A1 (de) * | 1980-01-31 | 1981-11-19 | CIBA-GEIGY AG, 4002 Basel | "chromogene chinazolonverbindungen" |
| FI70036C (fi) * | 1980-01-31 | 1986-09-12 | Ciba Geigy Ag | Kromogena kinazolinfoereningar |
-
1983
- 1983-11-03 GB GB838329361A patent/GB8329361D0/en active Pending
-
1984
- 1984-10-31 EP EP84307488A patent/EP0145225B1/en not_active Expired
- 1984-10-31 DE DE8484307488T patent/DE3479987D1/de not_active Expired
- 1984-10-31 AT AT84307488T patent/ATE46864T1/de not_active IP Right Cessation
- 1984-10-31 FI FI844263A patent/FI80238C/fi not_active IP Right Cessation
- 1984-11-01 AU AU34879/84A patent/AU562427B2/en not_active Ceased
- 1984-11-02 ZA ZA848594A patent/ZA848594B/xx unknown
- 1984-11-02 CA CA000466986A patent/CA1224036A/en not_active Expired
- 1984-11-02 US US06/667,888 patent/US4587538A/en not_active Expired - Fee Related
- 1984-11-05 JP JP59233043A patent/JPS60115483A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| FI844263A0 (fi) | 1984-10-31 |
| ATE46864T1 (de) | 1989-10-15 |
| FI844263L (fi) | 1985-05-04 |
| GB8329361D0 (en) | 1983-12-07 |
| FI80238B (fi) | 1990-01-31 |
| JPS60115483A (ja) | 1985-06-21 |
| EP0145225A3 (en) | 1986-08-27 |
| EP0145225B1 (en) | 1989-10-04 |
| ZA848594B (en) | 1985-12-24 |
| EP0145225A2 (en) | 1985-06-19 |
| AU3487984A (en) | 1985-05-09 |
| CA1224036A (en) | 1987-07-14 |
| JPH0421594B2 (enExample) | 1992-04-10 |
| DE3479987D1 (en) | 1989-11-09 |
| AU562427B2 (en) | 1987-06-11 |
| US4587538A (en) | 1986-05-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4390616A (en) | Image recording members | |
| FI70036B (fi) | Kromogena kinazolinfoereningar | |
| US3839361A (en) | Dibenzylamino fluoran compounds | |
| FI62548B (fi) | Saosom faergbildare anvaendbara diaminosubstituerade fluoranfoereningar | |
| JPH03190970A (ja) | 色原体エナミン化合物およびそれらの発色剤としての使用 | |
| FI80238C (fi) | Uppteckningsmaterial. | |
| US4820841A (en) | Chromogenic quinoline compounds | |
| US4055358A (en) | Nitro-phthalides, their manufacture and their use in recording systems | |
| US4072690A (en) | Indolyl methylene leuco dyestuffs | |
| GB1590913A (en) | Process for preparing phthalide colourformrs and substituted 5-aminobenzoic acid derivatives | |
| US4073614A (en) | Mixture of benzoxazines and benzodioxanes which may be used as color formers | |
| US3884506A (en) | Pressure-sensitive copying papers containing fluoran compounds | |
| EP0430486B1 (en) | Divinyl carbinol or carbinol derivative chromogenic compounds and their use in record material | |
| US4528136A (en) | Process for preparing 2-[bis(aryl)methyl]benzoic acids | |
| US4399291A (en) | Process for the production of substituted aminophthalides | |
| JPH0239987A (ja) | 発色性記録材料 | |
| JPH03211082A (ja) | 発色剤化合物としてビニルカルビノール又はその誘導体を利用した記録材料 | |
| US5364830A (en) | Record material using vinyl carbinol color formers | |
| JPH02138368A (ja) | ロイコ染料 | |
| DE3836797C2 (enExample) | ||
| Fletcher et al. | Synthesis and properties of phthalide-type color Formers | |
| FI62491B (fi) | Tryck- eller vaermekaensligt uppteckningsmaterial | |
| US4494989A (en) | Compounds, processes and marking systems | |
| FR2622591A1 (fr) | Colorant leuco et materiau d'enregistrement le comportant, utile notamment comme feuille autocopiante sensible a la chaleur ou a la pression | |
| JPS6187758A (ja) | フタリド化合物 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed | ||
| MM | Patent lapsed |
Owner name: THE WIGGINS TEAPE GROUP LIMITED |