FI79022C - Mun- och tandvaordsmedel. - Google Patents
Mun- och tandvaordsmedel. Download PDFInfo
- Publication number
- FI79022C FI79022C FI844958A FI844958A FI79022C FI 79022 C FI79022 C FI 79022C FI 844958 A FI844958 A FI 844958A FI 844958 A FI844958 A FI 844958A FI 79022 C FI79022 C FI 79022C
- Authority
- FI
- Finland
- Prior art keywords
- group
- oral
- quaternary ammonium
- ammonium compounds
- cooh
- Prior art date
Links
- 150000003856 quaternary ammonium compounds Chemical class 0.000 claims abstract description 32
- -1 organic acid anion Chemical class 0.000 claims abstract description 21
- 125000004432 carbon atom Chemical group C* 0.000 claims abstract description 13
- 238000002360 preparation method Methods 0.000 claims abstract description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims abstract description 11
- 239000001257 hydrogen Substances 0.000 claims abstract description 10
- 150000001450 anions Chemical class 0.000 claims abstract description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims abstract description 6
- 150000007522 mineralic acids Chemical class 0.000 claims abstract description 5
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 claims abstract description 3
- 239000000203 mixture Substances 0.000 claims description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 14
- 239000000243 solution Substances 0.000 claims description 13
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- 239000002324 mouth wash Substances 0.000 claims description 9
- 239000002253 acid Substances 0.000 claims description 7
- 239000000606 toothpaste Substances 0.000 claims description 7
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 claims description 6
- 235000012239 silicon dioxide Nutrition 0.000 claims description 6
- 229940051866 mouthwash Drugs 0.000 claims description 5
- 125000005624 silicic acid group Chemical class 0.000 claims description 5
- KRHYYFGTRYWZRS-UHFFFAOYSA-M Fluoride anion Chemical compound [F-] KRHYYFGTRYWZRS-UHFFFAOYSA-M 0.000 claims description 4
- 125000003277 amino group Chemical group 0.000 claims description 4
- 239000012459 cleaning agent Substances 0.000 claims description 4
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 239000003082 abrasive agent Substances 0.000 claims description 3
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 3
- 235000013355 food flavoring agent Nutrition 0.000 claims description 3
- 239000003906 humectant Substances 0.000 claims description 3
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 3
- 239000002562 thickening agent Substances 0.000 claims description 3
- 150000003976 azacycloalkanes Chemical group 0.000 claims description 2
- 229910052799 carbon Inorganic materials 0.000 claims description 2
- 239000000017 hydrogel Substances 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 229910052757 nitrogen Inorganic materials 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 239000002736 nonionic surfactant Substances 0.000 claims description 2
- 150000004684 trihydrates Chemical class 0.000 claims description 2
- 229910018828 PO3H2 Inorganic materials 0.000 claims 2
- 239000005454 flavour additive Substances 0.000 claims 2
- 101100516554 Caenorhabditis elegans nhr-5 gene Proteins 0.000 claims 1
- 150000002431 hydrogen Chemical group 0.000 claims 1
- 229940034610 toothpaste Drugs 0.000 claims 1
- 230000000845 anti-microbial effect Effects 0.000 abstract description 4
- 150000002222 fluorine compounds Chemical class 0.000 abstract description 3
- 230000002401 inhibitory effect Effects 0.000 abstract description 3
- GBHRVZIGDIUCJB-UHFFFAOYSA-N hydrogenphosphite Chemical class OP([O-])[O-] GBHRVZIGDIUCJB-UHFFFAOYSA-N 0.000 abstract 1
- 150000001875 compounds Chemical class 0.000 description 16
- KRHYYFGTRYWZRS-UHFFFAOYSA-N Fluorane Chemical compound F KRHYYFGTRYWZRS-UHFFFAOYSA-N 0.000 description 8
- 230000000694 effects Effects 0.000 description 8
- 239000007864 aqueous solution Substances 0.000 description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 238000000034 method Methods 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 5
- 238000002474 experimental method Methods 0.000 description 5
- 239000011541 reaction mixture Substances 0.000 description 5
- OBFSQMXGZIYMMN-UHFFFAOYSA-N 3-chloro-2-hexadecylpyridine Chemical compound CCCCCCCCCCCCCCCCC1=NC=CC=C1Cl OBFSQMXGZIYMMN-UHFFFAOYSA-N 0.000 description 4
- GHXZTYHSJHQHIJ-UHFFFAOYSA-N Chlorhexidine Chemical compound C=1C=C(Cl)C=CC=1NC(N)=NC(N)=NCCCCCCN=C(N)N=C(N)NC1=CC=C(Cl)C=C1 GHXZTYHSJHQHIJ-UHFFFAOYSA-N 0.000 description 4
- 208000002064 Dental Plaque Diseases 0.000 description 4
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 4
- 241000194019 Streptococcus mutans Species 0.000 description 4
- 239000013543 active substance Substances 0.000 description 4
- 230000002882 anti-plaque Effects 0.000 description 4
- 229960003260 chlorhexidine Drugs 0.000 description 4
- 238000004140 cleaning Methods 0.000 description 4
- 229960002887 deanol Drugs 0.000 description 4
- 239000012972 dimethylethanolamine Substances 0.000 description 4
- 150000003839 salts Chemical class 0.000 description 4
- 239000004094 surface-active agent Substances 0.000 description 4
- MPGABYXKKCLIRW-UHFFFAOYSA-N 2-decyloxirane Chemical compound CCCCCCCCCCC1CO1 MPGABYXKKCLIRW-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 3
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical class OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000004480 active ingredient Substances 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 208000002925 dental caries Diseases 0.000 description 3
- REZZEXDLIUJMMS-UHFFFAOYSA-M dimethyldioctadecylammonium chloride Chemical compound [Cl-].CCCCCCCCCCCCCCCCCC[N+](C)(C)CCCCCCCCCCCCCCCCCC REZZEXDLIUJMMS-UHFFFAOYSA-M 0.000 description 3
- 239000004664 distearyldimethylammonium chloride (DHTDMAC) Substances 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 210000000214 mouth Anatomy 0.000 description 3
- 244000052769 pathogen Species 0.000 description 3
- 230000001717 pathogenic effect Effects 0.000 description 3
- 230000007505 plaque formation Effects 0.000 description 3
- HWIRBMRZEDSXIZ-UHFFFAOYSA-M 2-hydroxydodecyl-(2-hydroxyethyl)-dimethylazanium;fluoride Chemical compound [F-].CCCCCCCCCCC(O)C[N+](C)(C)CCO HWIRBMRZEDSXIZ-UHFFFAOYSA-M 0.000 description 2
- YKAWQLWSSXLBPD-UHFFFAOYSA-M 2-hydroxydodecyl-bis(2-hydroxyethyl)-methylazanium;fluoride Chemical compound [F-].CCCCCCCCCCC(O)C[N+](C)(CCO)CCO YKAWQLWSSXLBPD-UHFFFAOYSA-M 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- 241000416162 Astragalus gummifer Species 0.000 description 2
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 2
- DBVJJBKOTRCVKF-UHFFFAOYSA-N Etidronic acid Chemical compound OP(=O)(O)C(O)(C)P(O)(O)=O DBVJJBKOTRCVKF-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 208000014151 Stomatognathic disease Diseases 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- 229920001615 Tragacanth Polymers 0.000 description 2
- 239000000654 additive Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 230000000844 anti-bacterial effect Effects 0.000 description 2
- 230000000170 anti-cariogenic effect Effects 0.000 description 2
- 239000004599 antimicrobial Substances 0.000 description 2
- 230000001580 bacterial effect Effects 0.000 description 2
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000006185 dispersion Substances 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 235000003599 food sweetener Nutrition 0.000 description 2
- 239000000416 hydrocolloid Substances 0.000 description 2
- 230000005764 inhibitory process Effects 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- CRVGTESFCCXCTH-UHFFFAOYSA-N methyl diethanolamine Chemical compound OCCN(C)CCO CRVGTESFCCXCTH-UHFFFAOYSA-N 0.000 description 2
- 230000003641 microbiacidal effect Effects 0.000 description 2
- 229940124561 microbicide Drugs 0.000 description 2
- 150000007524 organic acids Chemical class 0.000 description 2
- 235000005985 organic acids Nutrition 0.000 description 2
- 201000001245 periodontitis Diseases 0.000 description 2
- 229940068196 placebo Drugs 0.000 description 2
- 239000000902 placebo Substances 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 125000001453 quaternary ammonium group Chemical group 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 239000000600 sorbitol Substances 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- 239000003765 sweetening agent Substances 0.000 description 2
- 239000000196 tragacanth Substances 0.000 description 2
- 235000010487 tragacanth Nutrition 0.000 description 2
- 229940116362 tragacanth Drugs 0.000 description 2
- 239000000341 volatile oil Substances 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- 239000002888 zwitterionic surfactant Substances 0.000 description 2
- FTLYMKDSHNWQKD-UHFFFAOYSA-N (2,4,5-trichlorophenyl)boronic acid Chemical compound OB(O)C1=CC(Cl)=C(Cl)C=C1Cl FTLYMKDSHNWQKD-UHFFFAOYSA-N 0.000 description 1
- WSWCOQWTEOXDQX-MQQKCMAXSA-M (E,E)-sorbate Chemical compound C\C=C\C=C\C([O-])=O WSWCOQWTEOXDQX-MQQKCMAXSA-M 0.000 description 1
- MLRVZFYXUZQSRU-UHFFFAOYSA-N 1-chlorohexane Chemical compound CCCCCCCl MLRVZFYXUZQSRU-UHFFFAOYSA-N 0.000 description 1
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 1
- COKIOUWMXONTKQ-UHFFFAOYSA-N 1-phosphonopropane-1,2,3-tricarboxylic acid Chemical compound OC(=O)CC(C(O)=O)C(C(O)=O)P(O)(O)=O COKIOUWMXONTKQ-UHFFFAOYSA-N 0.000 description 1
- QTDCGWKKIXYBSL-UHFFFAOYSA-N 2-hydroxydodecyl-(2-hydroxyethyl)-dimethylazanium Chemical class CCCCCCCCCCC(O)C[N+](C)(C)CCO QTDCGWKKIXYBSL-UHFFFAOYSA-N 0.000 description 1
- FDENMUFFUJNUTA-UHFFFAOYSA-M 2-hydroxydodecyl-(2-hydroxyethyl)-dimethylazanium;chloride Chemical compound [Cl-].CCCCCCCCCCC(O)C[N+](C)(C)CCO FDENMUFFUJNUTA-UHFFFAOYSA-M 0.000 description 1
- QCMHUGYTOGXZIW-UHFFFAOYSA-N 3-(dimethylamino)propane-1,2-diol Chemical compound CN(C)CC(O)CO QCMHUGYTOGXZIW-UHFFFAOYSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- 229920001817 Agar Polymers 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 1
- ZVDOUKXPFDQTTH-UHFFFAOYSA-N CCCCCCCCCCC(C[N+](CC)(CCO)CCO)O Chemical class CCCCCCCCCCC(C[N+](CC)(CCO)CCO)O ZVDOUKXPFDQTTH-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 244000303965 Cyamopsis psoralioides Species 0.000 description 1
- UDIPTWFVPPPURJ-UHFFFAOYSA-M Cyclamate Chemical compound [Na+].[O-]S(=O)(=O)NC1CCCCC1 UDIPTWFVPPPURJ-UHFFFAOYSA-M 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- RGHNJXZEOKUKBD-SQOUGZDYSA-M D-gluconate Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C([O-])=O RGHNJXZEOKUKBD-SQOUGZDYSA-M 0.000 description 1
- 208000006558 Dental Calculus Diseases 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- GGLIEWRLXDLBBF-UHFFFAOYSA-N Dulcin Chemical compound CCOC1=CC=C(NC(N)=O)C=C1 GGLIEWRLXDLBBF-UHFFFAOYSA-N 0.000 description 1
- 239000004097 EU approved flavor enhancer Substances 0.000 description 1
- 239000004593 Epoxy Substances 0.000 description 1
- BDAGIHXWWSANSR-UHFFFAOYSA-M Formate Chemical compound [O-]C=O BDAGIHXWWSANSR-UHFFFAOYSA-M 0.000 description 1
- RFSUNEUAIZKAJO-ARQDHWQXSA-N Fructose Chemical compound OC[C@H]1O[C@](O)(CO)[C@@H](O)[C@@H]1O RFSUNEUAIZKAJO-ARQDHWQXSA-N 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- AEMRFAOFKBGASW-UHFFFAOYSA-M Glycolate Chemical compound OCC([O-])=O AEMRFAOFKBGASW-UHFFFAOYSA-M 0.000 description 1
- 239000004705 High-molecular-weight polyethylene Substances 0.000 description 1
- 239000004354 Hydroxyethyl cellulose Substances 0.000 description 1
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 description 1
- 229920001612 Hydroxyethyl starch Polymers 0.000 description 1
- JVTAAEKCZFNVCJ-UHFFFAOYSA-M Lactate Chemical compound CC(O)C([O-])=O JVTAAEKCZFNVCJ-UHFFFAOYSA-M 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-L Malonate Chemical compound [O-]C(=O)CC([O-])=O OFOBLEOULBTSOW-UHFFFAOYSA-L 0.000 description 1
- 244000246386 Mentha pulegium Species 0.000 description 1
- 235000016257 Mentha pulegium Nutrition 0.000 description 1
- 235000004357 Mentha x piperita Nutrition 0.000 description 1
- 244000227633 Ocotea pretiosa Species 0.000 description 1
- 235000004263 Ocotea pretiosa Nutrition 0.000 description 1
- 208000025157 Oral disease Diseases 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical class OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 1
- RVGRUAULSDPKGF-UHFFFAOYSA-N Poloxamer Chemical compound C1CO1.CC1CO1 RVGRUAULSDPKGF-UHFFFAOYSA-N 0.000 description 1
- 229920001213 Polysorbate 20 Polymers 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- 235000016639 Syzygium aromaticum Nutrition 0.000 description 1
- 244000223014 Syzygium aromaticum Species 0.000 description 1
- 208000004509 Tooth Discoloration Diseases 0.000 description 1
- 206010044032 Tooth discolouration Diseases 0.000 description 1
- 229920001938 Vegetable gum Polymers 0.000 description 1
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000008272 agar Substances 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 150000003868 ammonium compounds Chemical class 0.000 description 1
- 239000002280 amphoteric surfactant Substances 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 239000003945 anionic surfactant Substances 0.000 description 1
- 230000000675 anti-caries Effects 0.000 description 1
- 235000019568 aromas Nutrition 0.000 description 1
- 239000010692 aromatic oil Substances 0.000 description 1
- 229940072107 ascorbate Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 238000010533 azeotropic distillation Methods 0.000 description 1
- 229940050390 benzoate Drugs 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- JUNWLZAGQLJVLR-UHFFFAOYSA-J calcium diphosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])(=O)OP([O-])([O-])=O JUNWLZAGQLJVLR-UHFFFAOYSA-J 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229940043256 calcium pyrophosphate Drugs 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical class OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 230000001013 cariogenic effect Effects 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 229940112822 chewing gum Drugs 0.000 description 1
- 235000015218 chewing gum Nutrition 0.000 description 1
- 229940001468 citrate Drugs 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012141 concentrate Substances 0.000 description 1
- 239000006071 cream Substances 0.000 description 1
- 229940109275 cyclamate Drugs 0.000 description 1
- 230000006378 damage Effects 0.000 description 1
- 230000002939 deleterious effect Effects 0.000 description 1
- 210000003298 dental enamel Anatomy 0.000 description 1
- 239000002781 deodorant agent Substances 0.000 description 1
- 239000008121 dextrose Substances 0.000 description 1
- 235000019821 dicalcium diphosphate Nutrition 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000012897 dilution medium Substances 0.000 description 1
- 238000002845 discoloration Methods 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 230000009969 flowable effect Effects 0.000 description 1
- 235000019264 food flavour enhancer Nutrition 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229960002737 fructose Drugs 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 239000000451 gelidium spp. gum Substances 0.000 description 1
- 229940050410 gluconate Drugs 0.000 description 1
- 229930182478 glucoside Natural products 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 239000012676 herbal extract Substances 0.000 description 1
- 235000001050 hortel pimenta Nutrition 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 description 1
- 229940050526 hydroxyethylstarch Drugs 0.000 description 1
- 230000001771 impaired effect Effects 0.000 description 1
- 238000011534 incubation Methods 0.000 description 1
- 230000003993 interaction Effects 0.000 description 1
- 239000002563 ionic surfactant Substances 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- 229940067606 lecithin Drugs 0.000 description 1
- 229940049920 malate Drugs 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- BJEPYKJPYRNKOW-UHFFFAOYSA-N malic acid Chemical compound OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 description 1
- 239000002609 medium Substances 0.000 description 1
- 244000005706 microflora Species 0.000 description 1
- 208000030194 mouth disease Diseases 0.000 description 1
- 231100000017 mucous membrane irritation Toxicity 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 239000006916 nutrient agar Substances 0.000 description 1
- 239000003605 opacifier Substances 0.000 description 1
- 239000008375 oral care agent Substances 0.000 description 1
- 150000002924 oxiranes Chemical class 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000006072 paste Substances 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- 239000003444 phase transfer catalyst Substances 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 229920001522 polyglycol ester Polymers 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000000256 polyoxyethylene sorbitan monolaurate Substances 0.000 description 1
- 235000010486 polyoxyethylene sorbitan monolaurate Nutrition 0.000 description 1
- 229920000136 polysorbate Polymers 0.000 description 1
- 229920000036 polyvinylpyrrolidone Polymers 0.000 description 1
- 239000001267 polyvinylpyrrolidone Substances 0.000 description 1
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 230000002035 prolonged effect Effects 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 238000005956 quaternization reaction Methods 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- 230000000171 quenching effect Effects 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 229940085605 saccharin sodium Drugs 0.000 description 1
- YGSDEFSMJLZEOE-UHFFFAOYSA-M salicylate Chemical compound OC1=CC=CC=C1C([O-])=O YGSDEFSMJLZEOE-UHFFFAOYSA-M 0.000 description 1
- 229960001860 salicylate Drugs 0.000 description 1
- 210000003296 saliva Anatomy 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- AQMNWCRSESPIJM-UHFFFAOYSA-M sodium metaphosphate Chemical compound [Na+].[O-]P(=O)=O AQMNWCRSESPIJM-UHFFFAOYSA-M 0.000 description 1
- 229940075554 sorbate Drugs 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 229940086735 succinate Drugs 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 150000003512 tertiary amines Chemical class 0.000 description 1
- 230000008719 thickening Effects 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- 230000001256 tonic effect Effects 0.000 description 1
- 230000036367 tooth discoloration Effects 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/40—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds containing nitrogen
- A61K8/41—Amines
- A61K8/416—Quaternary ammonium compounds
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K8/00—Cosmetics or similar toiletry preparations
- A61K8/18—Cosmetics or similar toiletry preparations characterised by the composition
- A61K8/30—Cosmetics or similar toiletry preparations characterised by the composition containing organic compounds
- A61K8/55—Phosphorus compounds
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61Q—SPECIFIC USE OF COSMETICS OR SIMILAR TOILETRY PREPARATIONS
- A61Q11/00—Preparations for care of the teeth, of the oral cavity or of dentures; Dentifrices, e.g. toothpastes; Mouth rinses
Landscapes
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Epidemiology (AREA)
- Birds (AREA)
- Oral & Maxillofacial Surgery (AREA)
- Cosmetics (AREA)
- Saccharide Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Dental Preparations (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19833345781 DE3345781A1 (de) | 1983-12-17 | 1983-12-17 | Mund- und zahnpflegemittel |
| DE3345781 | 1983-12-17 |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI844958A0 FI844958A0 (fi) | 1984-12-14 |
| FI844958L FI844958L (fi) | 1985-06-18 |
| FI79022B FI79022B (fi) | 1989-07-31 |
| FI79022C true FI79022C (fi) | 1989-11-10 |
Family
ID=6217296
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI844958A FI79022C (fi) | 1983-12-17 | 1984-12-14 | Mun- och tandvaordsmedel. |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4820507A (enExample) |
| EP (1) | EP0150374B1 (enExample) |
| JP (1) | JPS60146817A (enExample) |
| AT (1) | ATE62398T1 (enExample) |
| CA (1) | CA1244352A (enExample) |
| DE (2) | DE3345781A1 (enExample) |
| DK (1) | DK165480C (enExample) |
| ES (1) | ES538685A0 (enExample) |
| FI (1) | FI79022C (enExample) |
| NO (1) | NO165903C (enExample) |
Families Citing this family (19)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3725248A1 (de) * | 1987-07-30 | 1989-02-09 | Henkel Kgaa | Antimikrobiell wirksame, aromatisierte zubereitungen |
| DE3927982A1 (de) * | 1989-08-24 | 1991-02-28 | Henkel Kgaa | Belaghemmende zahnpaste |
| US5158763A (en) * | 1990-10-09 | 1992-10-27 | Colgate-Palmolive Company | Non-staining anti-bacterial oral composition |
| US6214320B1 (en) * | 1990-10-09 | 2001-04-10 | Colgate-Palmolive Company | Oral compositions containing anticalculus and antiplaque agents |
| US5176901A (en) * | 1991-04-10 | 1993-01-05 | Smithkline Beecham Corporation | Dental composition |
| US5318772A (en) * | 1991-12-10 | 1994-06-07 | The Dow Chemical Company | Oral compositions for inhibiting calculus formation |
| US5320829A (en) * | 1991-12-10 | 1994-06-14 | The Dow Chemical Company | Oral compositions for inhibiting plaque formation |
| ES2040633B1 (es) * | 1991-12-31 | 1994-05-16 | Fitzig Nie Simon | Un procedimiento para la preparacion de una composicion oral antihalitosica. |
| US5374418A (en) * | 1992-02-13 | 1994-12-20 | Kao Corporation | Composition for use in oral cavity |
| US5370865A (en) * | 1992-05-15 | 1994-12-06 | Kao Corporation | Composition for use in oral cavity |
| EP0735856A1 (en) * | 1993-12-22 | 1996-10-09 | The Procter & Gamble Company | Concentrated mouthrinse for efficient delivery of antimicrobials |
| DE19740453A1 (de) * | 1997-09-15 | 1999-03-18 | Henkel Kgaa | Zahnreinigungsmittel |
| DE60127385T2 (de) * | 2000-01-18 | 2007-11-29 | Unilever N.V. | Antimikrobielle schweisshemmende produkte |
| GB0001129D0 (en) * | 2000-01-18 | 2000-03-08 | Unilever Plc | Anti-microbial aerosol compositions |
| GB0117535D0 (en) * | 2001-07-18 | 2001-09-12 | Unilever Plc | Deodorant compositions |
| US6924325B2 (en) * | 2002-06-21 | 2005-08-02 | Kerr Corporation | Silver-containing dental composition |
| DE10311171A1 (de) * | 2003-03-12 | 2004-09-23 | Henkel Kgaa | Mund- und Zahnpflegemittel |
| CN104884038A (zh) * | 2012-12-20 | 2015-09-02 | 高露洁-棕榄公司 | 口腔护理组合物 |
| EP2934463B1 (en) | 2012-12-20 | 2018-02-14 | Colgate-Palmolive Company | Oral care composition containing ionic liquids |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA673101A (en) * | 1963-10-29 | Gaba A.G. | Quaternary ammonium fluorides for use in caries prophylaxis | |
| US3277118A (en) * | 1958-05-29 | 1966-10-04 | Gaba Ag | Quaternary ammonium fluorides |
| US3369046A (en) * | 1965-12-02 | 1968-02-13 | Lever Brothers Ltd | 2-hydroxy-alkyl-benzyl quaternary ammonium compounds |
| NL149701C (nl) * | 1965-12-08 | 1981-05-15 | Procter & Gamble | Werkwijze voor het bereiden van een tegen tandsteen werkzaam tandverzorgingsmiddel, dat als werkzaam bestanddeel een fosfonzuurderivaat bevat, alsmede gevormd tandverzorgingsmiddel. |
| US3703583A (en) * | 1971-06-10 | 1972-11-21 | Lever Brothers Ltd | Anticalculus formulations |
| DE2224430C3 (de) * | 1972-05-19 | 1980-10-09 | Henkel Kgaa, 4000 Duesseldorf | Zahnsteinbildung verhindernde Mund- und Zahnpflegemittel |
| US3988443A (en) * | 1973-08-27 | 1976-10-26 | Henkel & Cie G.M.B.H. | Azacycloalkane-2,2-diphosphonic acids |
| DE3116087A1 (de) * | 1981-04-23 | 1982-11-11 | Degussa Ag, 6000 Frankfurt | "verfahren zur herstellung von quartaeren ammoniumverbindungen" |
-
1983
- 1983-12-17 DE DE19833345781 patent/DE3345781A1/de not_active Withdrawn
-
1984
- 1984-08-15 NO NO843253A patent/NO165903C/no unknown
- 1984-11-22 CA CA000468408A patent/CA1244352A/en not_active Expired
- 1984-12-10 EP EP84115121A patent/EP0150374B1/de not_active Expired - Lifetime
- 1984-12-10 DE DE8484115121T patent/DE3484431D1/de not_active Expired - Fee Related
- 1984-12-10 AT AT84115121T patent/ATE62398T1/de active
- 1984-12-12 DK DK594984A patent/DK165480C/da active
- 1984-12-13 JP JP59261926A patent/JPS60146817A/ja active Granted
- 1984-12-14 FI FI844958A patent/FI79022C/fi not_active IP Right Cessation
- 1984-12-17 ES ES538685A patent/ES538685A0/es active Granted
-
1987
- 1987-03-02 US US07/018,762 patent/US4820507A/en not_active Expired - Fee Related
Also Published As
| Publication number | Publication date |
|---|---|
| EP0150374A2 (de) | 1985-08-07 |
| DK165480B (da) | 1992-12-07 |
| ATE62398T1 (de) | 1991-04-15 |
| CA1244352A (en) | 1988-11-08 |
| NO165903B (no) | 1991-01-21 |
| ES8600926A1 (es) | 1985-11-01 |
| DK594984A (da) | 1985-06-18 |
| DE3484431D1 (de) | 1991-05-16 |
| US4820507A (en) | 1989-04-11 |
| JPS60146817A (ja) | 1985-08-02 |
| NO165903C (no) | 1991-05-02 |
| DE3345781A1 (de) | 1985-06-27 |
| DK594984D0 (da) | 1984-12-12 |
| FI844958L (fi) | 1985-06-18 |
| ES538685A0 (es) | 1985-11-01 |
| DK165480C (da) | 1993-04-19 |
| FI844958A0 (fi) | 1984-12-14 |
| FI79022B (fi) | 1989-07-31 |
| JPH0461846B2 (enExample) | 1992-10-02 |
| NO843253L (no) | 1985-06-18 |
| EP0150374A3 (en) | 1988-07-27 |
| EP0150374B1 (de) | 1991-04-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI79022C (fi) | Mun- och tandvaordsmedel. | |
| US5015466A (en) | Anticalculus compositions using tartrate-succinates | |
| CN104721226B (zh) | 口腔护理组合物 | |
| EP2934463B1 (en) | Oral care composition containing ionic liquids | |
| AU2012397210B2 (en) | Oral care composition containing ionic liquids | |
| US5158763A (en) | Non-staining anti-bacterial oral composition | |
| AU2012397213B2 (en) | Oral care composition | |
| FI81719B (fi) | Vaelsmakande tandkraem som foerhindrar uppkomsten av plack. | |
| JPH11255629A (ja) | 口腔用組成物 | |
| WO2015157241A1 (en) | Oral care compositions | |
| US4582702A (en) | Cleaning product for dental and oral care, containing a non-ionic poly(hydroxypropyl ether) surface-active agent | |
| Ernst et al. | Clinical study on the effectiveness and side effects of hexetidine and chlorhexidine mouthrinses versus a negative control | |
| CA2086620C (en) | Anticalculus/antiplaque compositions using azacycloalkane diphosphonates | |
| EP3383502B1 (en) | Oral care product and methods of use and manufacture thereof | |
| KR100637653B1 (ko) | 구취억제용 구강용 조성물 | |
| US5318772A (en) | Oral compositions for inhibiting calculus formation | |
| JP5665280B2 (ja) | 口腔用組成物 | |
| KR20110128961A (ko) | 녹차 추출물을 함유한 구강용 조성물 | |
| KR100759518B1 (ko) | 구취 억제용 구강 조성물 | |
| JP2024095188A (ja) | 口腔用組成物 | |
| JP2002241253A (ja) | 口腔組成物 | |
| KR20070102184A (ko) | 항균력이 우수한 구강용 조성물 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed | ||
| MM | Patent lapsed |
Owner name: HENKEL KOMMANDITGESELLSCHAFT AUF AKTIEN |