FI71303C - Metallsalter av mono- eller dinitrodihydroxidiazobensener vilka aer speciellt anvaendbara som initialspraengaemnen i spraengtaendnings- och flammtaendningssatser - Google Patents
Metallsalter av mono- eller dinitrodihydroxidiazobensener vilka aer speciellt anvaendbara som initialspraengaemnen i spraengtaendnings- och flammtaendningssatser Download PDFInfo
- Publication number
- FI71303C FI71303C FI790497A FI790497A FI71303C FI 71303 C FI71303 C FI 71303C FI 790497 A FI790497 A FI 790497A FI 790497 A FI790497 A FI 790497A FI 71303 C FI71303 C FI 71303C
- Authority
- FI
- Finland
- Prior art keywords
- metal
- mono
- compounds
- salts
- lead
- Prior art date
Links
- 229910052751 metal Inorganic materials 0.000 title claims description 20
- 239000002184 metal Substances 0.000 title claims description 20
- 150000003839 salts Chemical class 0.000 claims description 33
- 239000002360 explosive Substances 0.000 claims description 23
- 150000001875 compounds Chemical class 0.000 claims description 18
- 239000011133 lead Substances 0.000 claims description 17
- 239000002253 acid Substances 0.000 claims description 10
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 10
- 238000000034 method Methods 0.000 claims description 10
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 6
- 238000006193 diazotization reaction Methods 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 5
- 229910052783 alkali metal Inorganic materials 0.000 claims description 4
- 150000001340 alkali metals Chemical class 0.000 claims description 4
- 238000005474 detonation Methods 0.000 claims description 4
- GKDMYNLGGDLGHR-UHFFFAOYSA-N 4-amino-3-nitrobenzene-1,2-diol Chemical compound NC1=CC=C(O)C(O)=C1[N+]([O-])=O GKDMYNLGGDLGHR-UHFFFAOYSA-N 0.000 claims description 3
- NKZVAYHPKMUNNH-UHFFFAOYSA-N 6-diazo-3,4-dinitrocyclohexa-2,4-diene-1,2-diol Chemical class OC1C(O)=C([N+]([O-])=O)C([N+]([O-])=O)=CC1=[N+]=[N-] NKZVAYHPKMUNNH-UHFFFAOYSA-N 0.000 claims description 3
- 150000007513 acids Chemical class 0.000 claims description 3
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 3
- 229910000000 metal hydroxide Inorganic materials 0.000 claims description 2
- 229910044991 metal oxide Inorganic materials 0.000 claims description 2
- 150000004706 metal oxides Chemical class 0.000 claims description 2
- GGCZERPQGJTIQP-UHFFFAOYSA-N sodium;9,10-dioxoanthracene-2-sulfonic acid Chemical compound [Na+].C1=CC=C2C(=O)C3=CC(S(=O)(=O)O)=CC=C3C(=O)C2=C1 GGCZERPQGJTIQP-UHFFFAOYSA-N 0.000 claims description 2
- XMVSFMXFQRXULS-UHFFFAOYSA-N 1-nitrocyclohexa-2,4-dien-1-amine Chemical compound [O-][N+](=O)C1(N)CC=CC=C1 XMVSFMXFQRXULS-UHFFFAOYSA-N 0.000 claims 1
- 239000003929 acidic solution Substances 0.000 claims 1
- 150000004692 metal hydroxides Chemical class 0.000 claims 1
- 150000003606 tin compounds Chemical class 0.000 claims 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 10
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000000203 mixture Substances 0.000 description 9
- 230000035939 shock Effects 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- IUKSYUOJRHDWRR-UHFFFAOYSA-N 2-diazonio-4,6-dinitrophenolate Chemical compound [O-]C1=C([N+]#N)C=C([N+]([O-])=O)C=C1[N+]([O-])=O IUKSYUOJRHDWRR-UHFFFAOYSA-N 0.000 description 7
- 230000035945 sensitivity Effects 0.000 description 7
- HXZVLCYKZVALTE-UHFFFAOYSA-N 4-diazo-2,6-dinitrocyclohexa-1,5-diene-1,3-diol Chemical class OC1C(=[N+]=[N-])C=C([N+]([O-])=O)C(O)=C1[N+]([O-])=O HXZVLCYKZVALTE-UHFFFAOYSA-N 0.000 description 5
- WETZJIOEDGMBMA-UHFFFAOYSA-L lead styphnate Chemical compound [Pb+2].[O-]C1=C([N+]([O-])=O)C=C([N+]([O-])=O)C([O-])=C1[N+]([O-])=O WETZJIOEDGMBMA-UHFFFAOYSA-L 0.000 description 5
- 239000007795 chemical reaction product Substances 0.000 description 4
- 239000003638 chemical reducing agent Substances 0.000 description 4
- 238000004880 explosion Methods 0.000 description 4
- 239000011521 glass Substances 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- XDLSQDCBMSXZBV-UHFFFAOYSA-O 2,3-dihydroxy-4,5-dinitrobenzenediazonium Chemical class [N+](=O)([O-])C=1C(=C(C(=C(C=1)[N+]#N)O)O)[N+](=O)[O-] XDLSQDCBMSXZBV-UHFFFAOYSA-O 0.000 description 3
- CZYANASLDZZAKQ-UHFFFAOYSA-N 4-diazo-2,3-dinitrocyclohexa-1,5-dien-1-ol Chemical class OC1=C([N+]([O-])=O)C([N+]([O-])=O)C(=[N+]=[N-])C=C1 CZYANASLDZZAKQ-UHFFFAOYSA-N 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- -1 alkaline earth metal salts Chemical class 0.000 description 3
- 150000001540 azides Chemical class 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- YILKAGZLOBFNSV-UHFFFAOYSA-O 2,3-dihydroxybenzenediazonium Chemical class OC1=CC=CC([N+]#N)=C1O YILKAGZLOBFNSV-UHFFFAOYSA-O 0.000 description 2
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 2
- 229910052788 barium Inorganic materials 0.000 description 2
- IWOUKMZUPDVPGQ-UHFFFAOYSA-N barium nitrate Chemical compound [Ba+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O IWOUKMZUPDVPGQ-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- YCIMNLLNPGFGHC-UHFFFAOYSA-N catechol Chemical compound OC1=CC=CC=C1O YCIMNLLNPGFGHC-UHFFFAOYSA-N 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- 238000002485 combustion reaction Methods 0.000 description 2
- YADSGOSSYOOKMP-UHFFFAOYSA-N dioxolead Chemical compound O=[Pb]=O YADSGOSSYOOKMP-UHFFFAOYSA-N 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N formic acid Substances OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 229910001385 heavy metal Inorganic materials 0.000 description 2
- 230000000977 initiatory effect Effects 0.000 description 2
- MHWLNQBTOIYJJP-UHFFFAOYSA-N mercury difulminate Chemical compound [O-][N+]#C[Hg]C#[N+][O-] MHWLNQBTOIYJJP-UHFFFAOYSA-N 0.000 description 2
- 238000001556 precipitation Methods 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- GHMLBKRAJCXXBS-UHFFFAOYSA-N resorcinol Chemical compound OC1=CC=CC(O)=C1 GHMLBKRAJCXXBS-UHFFFAOYSA-N 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- IQUPABOKLQSFBK-UHFFFAOYSA-N 2-nitrophenol Chemical compound OC1=CC=CC=C1[N+]([O-])=O IQUPABOKLQSFBK-UHFFFAOYSA-N 0.000 description 1
- YHKWFDPEASWKFQ-UHFFFAOYSA-N 3-nitrobenzene-1,2-diol Chemical compound OC1=CC=CC([N+]([O-])=O)=C1O YHKWFDPEASWKFQ-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- JTVDRNHPFAIHJO-UHFFFAOYSA-N 5-diazo-3,4-dinitrocyclohexa-2,6-diene-1,2-diol Chemical class OC1=CC(=[N+]=[N-])C([N+]([O-])=O)C([N+]([O-])=O)=C1O JTVDRNHPFAIHJO-UHFFFAOYSA-N 0.000 description 1
- OUHREBGMGVQVQJ-UHFFFAOYSA-N 5-diazo-6-nitrocyclohexa-1,3-dien-1-ol Chemical compound OC1=CC=CC(=[N+]=[N-])C1[N+]([O-])=O OUHREBGMGVQVQJ-UHFFFAOYSA-N 0.000 description 1
- XOQBCSLRHRLUKZ-UHFFFAOYSA-N 6-diazo-4,5-dinitrocyclohexa-2,4-diene-1,2-diol Chemical class OC1C(O)=CC([N+]([O-])=O)=C([N+]([O-])=O)C1=[N+]=[N-] XOQBCSLRHRLUKZ-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 208000031968 Cadaver Diseases 0.000 description 1
- IOVCWXUNBOPUCH-UHFFFAOYSA-M Nitrite anion Chemical compound [O-]N=O IOVCWXUNBOPUCH-UHFFFAOYSA-M 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 229910021626 Tin(II) chloride Inorganic materials 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 239000003082 abrasive agent Substances 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- DSAJWYNOEDNPEQ-UHFFFAOYSA-N barium atom Chemical class [Ba] DSAJWYNOEDNPEQ-UHFFFAOYSA-N 0.000 description 1
- 239000011230 binding agent Substances 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- ZCDOYSPFYFSLEW-UHFFFAOYSA-N chromate(2-) Chemical class [O-][Cr]([O-])(=O)=O ZCDOYSPFYFSLEW-UHFFFAOYSA-N 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 230000006835 compression Effects 0.000 description 1
- 238000007906 compression Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 238000004200 deflagration Methods 0.000 description 1
- 150000008049 diazo compounds Chemical class 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000012467 final product Substances 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- XLYOFNOQVPJJNP-ZSJDYOACSA-N heavy water Substances [2H]O[2H] XLYOFNOQVPJJNP-ZSJDYOACSA-N 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- 239000005457 ice water Substances 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 229910000765 intermetallic Inorganic materials 0.000 description 1
- 229910052745 lead Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 1
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 150000002736 metal compounds Chemical class 0.000 description 1
- 229910001960 metal nitrate Inorganic materials 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- FUHCAFVCWOAAIW-UHFFFAOYSA-N n,n-dihydroxy-2,3-dinitroaniline Chemical class ON(O)C1=CC=CC([N+]([O-])=O)=C1[N+]([O-])=O FUHCAFVCWOAAIW-UHFFFAOYSA-N 0.000 description 1
- BCOQERQOUAZDFA-UHFFFAOYSA-N n-(2,3-dihydroxyphenyl)-n-nitronitramide Chemical class OC1=CC=CC(N([N+]([O-])=O)[N+]([O-])=O)=C1O BCOQERQOUAZDFA-UHFFFAOYSA-N 0.000 description 1
- 230000007935 neutral effect Effects 0.000 description 1
- GQPLMRYTRLFLPF-UHFFFAOYSA-N nitrous oxide Inorganic materials [O-][N+]#N GQPLMRYTRLFLPF-UHFFFAOYSA-N 0.000 description 1
- 239000007800 oxidant agent Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 238000009527 percussion Methods 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- 239000000276 potassium ferrocyanide Substances 0.000 description 1
- FGIUAXJPYTZDNR-UHFFFAOYSA-N potassium nitrate Inorganic materials [K+].[O-][N+]([O-])=O FGIUAXJPYTZDNR-UHFFFAOYSA-N 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 239000002243 precursor Substances 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- QBFXQJXHEPIJKW-UHFFFAOYSA-N silver azide Chemical compound [Ag+].[N-]=[N+]=[N-] QBFXQJXHEPIJKW-UHFFFAOYSA-N 0.000 description 1
- 235000011150 stannous chloride Nutrition 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- YPMOSINXXHVZIL-UHFFFAOYSA-N sulfanylideneantimony Chemical compound [Sb]=S YPMOSINXXHVZIL-UHFFFAOYSA-N 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- XOGGUFAVLNCTRS-UHFFFAOYSA-N tetrapotassium;iron(2+);hexacyanide Chemical compound [K+].[K+].[K+].[K+].[Fe+2].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-].N#[C-] XOGGUFAVLNCTRS-UHFFFAOYSA-N 0.000 description 1
- AXZWODMDQAVCJE-UHFFFAOYSA-L tin(II) chloride (anhydrous) Chemical compound [Cl-].[Cl-].[Sn+2] AXZWODMDQAVCJE-UHFFFAOYSA-L 0.000 description 1
- 231100000331 toxic Toxicity 0.000 description 1
- 230000002588 toxic effect Effects 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C06—EXPLOSIVES; MATCHES
- C06B—EXPLOSIVES OR THERMIC COMPOSITIONS; MANUFACTURE THEREOF; USE OF SINGLE SUBSTANCES AS EXPLOSIVES
- C06B25/00—Compositions containing a nitrated organic compound
- C06B25/04—Compositions containing a nitrated organic compound the nitrated compound being an aromatic
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2806599 | 1978-02-16 | ||
| DE2806599A DE2806599C2 (de) | 1978-02-16 | 1978-02-16 | Mono- und Dinitrodihydroxydiazobenzolsalze |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| FI790497A0 FI790497A0 (fi) | 1979-02-15 |
| FI790497A7 FI790497A7 (fi) | 1979-08-17 |
| FI71303B FI71303B (fi) | 1986-09-09 |
| FI71303C true FI71303C (fi) | 1986-12-19 |
Family
ID=6032157
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI790497A FI71303C (fi) | 1978-02-16 | 1979-02-15 | Metallsalter av mono- eller dinitrodihydroxidiazobensener vilka aer speciellt anvaendbara som initialspraengaemnen i spraengtaendnings- och flammtaendningssatser |
Country Status (9)
| Country | Link |
|---|---|
| US (1) | US4246052A (de) |
| AT (1) | AT365563B (de) |
| BE (1) | BE874187A (de) |
| DE (1) | DE2806599C2 (de) |
| ES (1) | ES477727A1 (de) |
| FI (1) | FI71303C (de) |
| FR (1) | FR2417495B1 (de) |
| GB (1) | GB2014569B (de) |
| IT (1) | IT1162446B (de) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3321943A1 (de) * | 1983-06-18 | 1984-12-20 | Dynamit Nobel Ag, 5210 Troisdorf | Blei- und bariumfreie anzuendsaetze |
| US5684268A (en) * | 1995-09-29 | 1997-11-04 | Remington Arms Company, Inc. | Lead-free primer mix |
| US5831208A (en) * | 1996-12-13 | 1998-11-03 | Federal Cartridge Company | Lead-free centerfire primer with DDNP and barium nitrate oxidizer |
| US6027588A (en) * | 1997-08-15 | 2000-02-22 | Orica Explosives Technology Pty Ltd | Method of manufacture of emulsion explosives |
| DE19912622A1 (de) * | 1998-03-20 | 1999-09-23 | Dynamit Nobel Ag | Durch elektrische Auslösung anzündbare Initialexplosivstoffe und Anzündsätze |
| AT410315B (de) * | 2001-11-14 | 2003-03-25 | Josef Koehler | Signaturarmer und schadstoffreduzierter, pyrotechnischer darstellungskörper |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1572715A (en) * | 1926-02-09 | Rhine | ||
| US1840333A (en) * | 1927-07-21 | 1932-01-12 | Kalle & Co Ag | Solid stable diazo compounds and process of preparing them |
-
1978
- 1978-02-16 DE DE2806599A patent/DE2806599C2/de not_active Expired
- 1978-12-08 FR FR7834637A patent/FR2417495B1/fr not_active Expired
-
1979
- 1979-02-12 GB GB7904873A patent/GB2014569B/en not_active Expired
- 1979-02-12 US US06/011,466 patent/US4246052A/en not_active Expired - Lifetime
- 1979-02-14 IT IT47993/79A patent/IT1162446B/it active
- 1979-02-14 AT AT0112979A patent/AT365563B/de not_active IP Right Cessation
- 1979-02-15 ES ES477727A patent/ES477727A1/es not_active Expired
- 1979-02-15 BE BE193478A patent/BE874187A/xx not_active IP Right Cessation
- 1979-02-15 FI FI790497A patent/FI71303C/fi not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| US4246052A (en) | 1981-01-20 |
| FR2417495B1 (fr) | 1985-11-29 |
| ES477727A1 (es) | 1980-01-16 |
| GB2014569B (en) | 1982-09-02 |
| BE874187A (fr) | 1979-05-29 |
| FI790497A0 (fi) | 1979-02-15 |
| ATA112979A (de) | 1981-06-15 |
| GB2014569A (en) | 1979-08-30 |
| FI790497A7 (fi) | 1979-08-17 |
| IT1162446B (it) | 1987-04-01 |
| FR2417495A1 (fr) | 1979-09-14 |
| DE2806599A1 (de) | 1979-08-23 |
| FI71303B (fi) | 1986-09-09 |
| AT365563B (de) | 1982-01-25 |
| DE2806599C2 (de) | 1986-06-26 |
| IT7947993A0 (it) | 1979-02-14 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| Matyáš et al. | Primary explosives | |
| AU782638B2 (en) | Non-toxic primer mix | |
| EP3660019B1 (de) | 7h-pyrazolo[3,4-d]triazine-2-oxide als sprengstoffe | |
| US8273784B2 (en) | Dinitropyrazole derivatives, their preparation, and energetic compositions comprising them | |
| US4733610A (en) | 3-nitro-1,2,4-triazol-5-one, a less sensitive explosive | |
| US5388519A (en) | Low toxicity primer composition | |
| JP2519621B2 (ja) | ジニトラミド塩およびその製法 | |
| Bhosale et al. | Ultrafast igniting, imidazolium based hypergolic ionic liquids with enhanced hydrophobicity | |
| AU2007217337B2 (en) | Ignition composition and applications | |
| US11814332B2 (en) | Bismuth-based energetic materials | |
| FI71303B (fi) | Metallsalter av mono- eller dinitrodihydroxidiazobensener vilka aer speciellt anvaendbara som initialspraengaemnen i spraengtaendnings- och flammtaendningssatser | |
| US9278984B2 (en) | Method for preparation of a lead-free primary explosive | |
| CA2892473A1 (en) | 3,3'-dinitro-5,5'-bis-triazole-1,1'-diol | |
| US4329522A (en) | 1,3,5,7-Tetranitroadamantane and process for preparing same | |
| RU2343150C1 (ru) | 3-(3,5-динитропиразол-4-ил)-4-нитрофуразан, способ его получения и применение его в качестве термостойкого взрывчатого вещества | |
| Taylor et al. | HMTD—A new detonating explosive | |
| US3125606A (en) | Process for the manufacture of | |
| US5274105A (en) | Hydroxylammonium salts of 5-nitro-1,2,4-triazol-3-one | |
| US6602366B2 (en) | Triazolyl-tetrazinyl-aminotriazine compounds useful in pyrotechnic compositions and process thereof | |
| US2090745A (en) | Chemical compound | |
| US7220328B1 (en) | Low-smoke gas generating low order pressure pulse compositions | |
| RU2674964C1 (ru) | Калиевая соль 1,1-динитро-1-(4-нитро-3-(1Н-тетразол-1-ил)-1Н-пиразол-1-ил)метана и способ ее получения | |
| CN111269126A (zh) | 一种熔铸载体1,2-二氟-4,5-二硝基苯的制备方法 | |
| US2350670A (en) | Ammunition priming composition | |
| CN116283805B (zh) | 一种1,2,3-三唑离子盐、其制备方法及其用途 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MA | Patent expired | ||
| MA | Patent expired |
Owner name: DYNAMIT NOBEL AKTIENGESELLSCHAFT |