FI70180C - Maerkregistreringssystem - Google Patents
Maerkregistreringssystem Download PDFInfo
- Publication number
- FI70180C FI70180C FI791647A FI791647A FI70180C FI 70180 C FI70180 C FI 70180C FI 791647 A FI791647 A FI 791647A FI 791647 A FI791647 A FI 791647A FI 70180 C FI70180 C FI 70180C
- Authority
- FI
- Finland
- Prior art keywords
- aliphatic
- benzyl phthalate
- chromogen
- phthalate
- solvent
- Prior art date
Links
- 239000002904 solvent Substances 0.000 claims abstract description 39
- 125000001931 aliphatic group Chemical group 0.000 claims abstract description 25
- UCVPKAZCQPRWAY-UHFFFAOYSA-N dibenzyl benzene-1,2-dicarboxylate Chemical compound C=1C=CC=C(C(=O)OCC=2C=CC=CC=2)C=1C(=O)OCC1=CC=CC=C1 UCVPKAZCQPRWAY-UHFFFAOYSA-N 0.000 claims abstract description 20
- 239000002253 acid Substances 0.000 claims abstract description 10
- 239000007788 liquid Substances 0.000 claims abstract description 4
- DYFFAVRFJWYYQO-UHFFFAOYSA-N n-methyl-n-phenylaniline Chemical compound C=1C=CC=CC=1N(C)C1=CC=CC=C1 DYFFAVRFJWYYQO-UHFFFAOYSA-N 0.000 claims abstract 2
- -1 cyanogen-diphenylmethanol Chemical compound 0.000 claims description 19
- 239000000463 material Substances 0.000 claims description 12
- 125000000217 alkyl group Chemical group 0.000 claims description 10
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 claims description 8
- 150000002148 esters Chemical class 0.000 claims description 7
- 239000000203 mixture Substances 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 229930195733 hydrocarbon Natural products 0.000 claims description 5
- 150000002430 hydrocarbons Chemical class 0.000 claims description 5
- 125000005907 alkyl ester group Chemical group 0.000 claims description 3
- 239000003085 diluting agent Substances 0.000 claims description 3
- 230000004888 barrier function Effects 0.000 claims description 2
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 claims description 2
- 239000004215 Carbon black (E152) Substances 0.000 claims 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims 1
- 239000004927 clay Substances 0.000 abstract description 15
- QILSFLSDHQAZET-UHFFFAOYSA-N diphenylmethanol Chemical class C=1C=CC=CC=1C(O)C1=CC=CC=C1 QILSFLSDHQAZET-UHFFFAOYSA-N 0.000 abstract description 3
- 239000003795 chemical substances by application Substances 0.000 abstract 2
- 230000001235 sensitizing effect Effects 0.000 abstract 1
- DOIRQSBPFJWKBE-UHFFFAOYSA-N dibutyl phthalate Chemical class CCCCOC(=O)C1=CC=CC=C1C(=O)OCCCC DOIRQSBPFJWKBE-UHFFFAOYSA-N 0.000 description 14
- IRIAEXORFWYRCZ-UHFFFAOYSA-N Butylbenzyl phthalate Chemical compound CCCCOC(=O)C1=CC=CC=C1C(=O)OCC1=CC=CC=C1 IRIAEXORFWYRCZ-UHFFFAOYSA-N 0.000 description 7
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 7
- YLZSIUVOIFJGQZ-UHFFFAOYSA-N bis[4-(dimethylamino)phenyl]methanol Chemical compound C1=CC(N(C)C)=CC=C1C(O)C1=CC=C(N(C)C)C=C1 YLZSIUVOIFJGQZ-UHFFFAOYSA-N 0.000 description 6
- 229940054021 anxiolytics diphenylmethane derivative Drugs 0.000 description 5
- CZZYITDELCSZES-UHFFFAOYSA-N diphenylmethane Chemical class C=1C=CC=CC=1CC1=CC=CC=C1 CZZYITDELCSZES-UHFFFAOYSA-N 0.000 description 5
- WNZQDUSMALZDQF-UHFFFAOYSA-N 2-benzofuran-1(3H)-one Chemical class C1=CC=C2C(=O)OCC2=C1 WNZQDUSMALZDQF-UHFFFAOYSA-N 0.000 description 4
- 239000003350 kerosene Substances 0.000 description 4
- 239000003208 petroleum Substances 0.000 description 4
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- 230000002378 acidificating effect Effects 0.000 description 3
- 238000005538 encapsulation Methods 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 239000003094 microcapsule Substances 0.000 description 3
- LIZLYZVAYZQVPG-UHFFFAOYSA-N (3-bromo-2-fluorophenyl)methanol Chemical compound OCC1=CC=CC(Br)=C1F LIZLYZVAYZQVPG-UHFFFAOYSA-N 0.000 description 2
- ALRHLSYJTWAHJZ-UHFFFAOYSA-N 3-hydroxypropionic acid Chemical compound OCCC(O)=O ALRHLSYJTWAHJZ-UHFFFAOYSA-N 0.000 description 2
- FXJVNINSOKCNJP-UHFFFAOYSA-M 4-methylbenzenesulfinate Chemical compound CC1=CC=C(S([O-])=O)C=C1 FXJVNINSOKCNJP-UHFFFAOYSA-M 0.000 description 2
- MQIUGAXCHLFZKX-UHFFFAOYSA-N Di-n-octyl phthalate Chemical class CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCCC MQIUGAXCHLFZKX-UHFFFAOYSA-N 0.000 description 2
- AEMRFAOFKBGASW-UHFFFAOYSA-N Glycolic acid Chemical compound OCC(O)=O AEMRFAOFKBGASW-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 2
- 125000006177 alkyl benzyl group Chemical group 0.000 description 2
- 229960000892 attapulgite Drugs 0.000 description 2
- 229910000278 bentonite Inorganic materials 0.000 description 2
- 239000000440 bentonite Substances 0.000 description 2
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 2
- 235000010290 biphenyl Nutrition 0.000 description 2
- BJQHLKABXJIVAM-UHFFFAOYSA-N bis(2-ethylhexyl) phthalate Chemical compound CCCCC(CC)COC(=O)C1=CC=CC=C1C(=O)OCC(CC)CCCC BJQHLKABXJIVAM-UHFFFAOYSA-N 0.000 description 2
- 239000002775 capsule Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 230000003287 optical effect Effects 0.000 description 2
- 229910052625 palygorskite Inorganic materials 0.000 description 2
- 229920000642 polymer Polymers 0.000 description 2
- 238000003825 pressing Methods 0.000 description 2
- 230000000717 retained effect Effects 0.000 description 2
- ZXQVXEAZKZFEEP-UHFFFAOYSA-N 2,2-diphenylacetamide Chemical compound C=1C=CC=CC=1C(C(=O)N)C1=CC=CC=C1 ZXQVXEAZKZFEEP-UHFFFAOYSA-N 0.000 description 1
- HHWGOADEDJUWSM-UHFFFAOYSA-N 2-(3-methyl-1-phenylbutoxy)carbonylbenzoic acid Chemical compound C=1C=CC=CC=1C(CC(C)C)OC(=O)C1=CC=CC=C1C(O)=O HHWGOADEDJUWSM-UHFFFAOYSA-N 0.000 description 1
- WHHSHXMIKFVAEK-UHFFFAOYSA-N 2-o-benzyl 1-o-octyl benzene-1,2-dicarboxylate Chemical compound CCCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCC1=CC=CC=C1 WHHSHXMIKFVAEK-UHFFFAOYSA-N 0.000 description 1
- PYSRRFNXTXNWCD-UHFFFAOYSA-N 3-(2-phenylethenyl)furan-2,5-dione Chemical compound O=C1OC(=O)C(C=CC=2C=CC=CC=2)=C1 PYSRRFNXTXNWCD-UHFFFAOYSA-N 0.000 description 1
- SJZRECIVHVDYJC-UHFFFAOYSA-N 4-hydroxybutyric acid Chemical compound OCCCC(O)=O SJZRECIVHVDYJC-UHFFFAOYSA-N 0.000 description 1
- HKCCBTGBFGJZFG-UHFFFAOYSA-N 4-n-[4-(dimethylamino)phenyl]-1-n,1-n,4-n-trimethylbenzene-1,4-diamine Chemical class C1=CC(N(C)C)=CC=C1N(C)C1=CC=C(N(C)C)C=C1 HKCCBTGBFGJZFG-UHFFFAOYSA-N 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- LCGLNKUTAGEVQW-UHFFFAOYSA-N Dimethyl ether Chemical compound COC LCGLNKUTAGEVQW-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 206010024769 Local reaction Diseases 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 241000907663 Siproeta stelenes Species 0.000 description 1
- 229920000147 Styrene maleic anhydride Polymers 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- GZCGUPFRVQAUEE-SLPGGIOYSA-N aldehydo-D-glucose Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C=O GZCGUPFRVQAUEE-SLPGGIOYSA-N 0.000 description 1
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000004305 biphenyl Substances 0.000 description 1
- 125000006267 biphenyl group Chemical group 0.000 description 1
- 150000004074 biphenyls Chemical class 0.000 description 1
- 235000014121 butter Nutrition 0.000 description 1
- 238000001354 calcination Methods 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- MHDVGSVTJDSBDK-UHFFFAOYSA-N dibenzyl ether Chemical compound C=1C=CC=CC=1COCC1=CC=CC=C1 MHDVGSVTJDSBDK-UHFFFAOYSA-N 0.000 description 1
- BXOUVIIITJXIKB-UHFFFAOYSA-N ethene;styrene Chemical compound C=C.C=CC1=CC=CC=C1 BXOUVIIITJXIKB-UHFFFAOYSA-N 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 125000005448 ethoxyethyl group Chemical group [H]C([H])([H])C([H])([H])OC([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 238000005562 fading Methods 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 150000008282 halocarbons Chemical class 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- 125000004491 isohexyl group Chemical group C(CCC(C)C)* 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 150000002596 lactones Chemical class 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- XIKIUQUXDNHBFR-UHFFFAOYSA-N monobenzyl phthalate Chemical class OC(=O)C1=CC=CC=C1C(=O)OCC1=CC=CC=C1 XIKIUQUXDNHBFR-UHFFFAOYSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229920000620 organic polymer Polymers 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- ZUOUZKKEUPVFJK-UHFFFAOYSA-N phenylbenzene Natural products C1=CC=CC=C1C1=CC=CC=C1 ZUOUZKKEUPVFJK-UHFFFAOYSA-N 0.000 description 1
- 125000005498 phthalate group Chemical class 0.000 description 1
- 229920006122 polyamide resin Polymers 0.000 description 1
- 229920005749 polyurethane resin Polymers 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 125000004079 stearyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 230000009885 systemic effect Effects 0.000 description 1
- 150000001911 terphenyls Chemical class 0.000 description 1
- 238000011282 treatment Methods 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/124—Duplicating or marking methods; Sheet materials for use therein using pressure to make a masked colour visible, e.g. to make a coloured support visible, to create an opaque or transparent pattern, or to form colour by uniting colour-forming components
- B41M5/165—Duplicating or marking methods; Sheet materials for use therein using pressure to make a masked colour visible, e.g. to make a coloured support visible, to create an opaque or transparent pattern, or to form colour by uniting colour-forming components characterised by the use of microcapsules; Special solvents for incorporating the ingredients
- B41M5/1655—Solvents
Landscapes
- Color Printing (AREA)
- Holo Graphy (AREA)
- Optical Recording Or Reproduction (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2596078 | 1978-05-31 | ||
| GB2596078 | 1978-05-31 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI791647A7 FI791647A7 (fi) | 1979-12-01 |
| FI70180B FI70180B (fi) | 1986-02-28 |
| FI70180C true FI70180C (fi) | 1986-09-15 |
Family
ID=10236113
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI791647A FI70180C (fi) | 1978-05-31 | 1979-05-24 | Maerkregistreringssystem |
Country Status (7)
| Country | Link |
|---|---|
| EP (1) | EP0005921B1 (de) |
| JP (1) | JPS552090A (de) |
| AT (1) | ATE1699T1 (de) |
| AU (1) | AU528695B2 (de) |
| CA (1) | CA1126026A (de) |
| DE (1) | DE2963924D1 (de) |
| FI (1) | FI70180C (de) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS57116690A (en) * | 1981-01-13 | 1982-07-20 | Ricoh Co Ltd | Thermal recording material |
| US5318940A (en) * | 1992-12-02 | 1994-06-07 | Koch Industries, Inc. | Carbonless paper solvent comprising diisopropylbiphenyl and triisopropylbiphenyl and products utilizing same |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3016308A (en) * | 1957-08-06 | 1962-01-09 | Moore Business Forms Inc | Recording paper coated with microscopic capsules of coloring material, capsules and method of making |
| US3684549A (en) * | 1970-10-12 | 1972-08-15 | Joseph L Shank | Pressure sensitive transfer coating |
| JPS4931414A (de) * | 1972-07-05 | 1974-03-20 | ||
| DE2334227A1 (de) * | 1973-07-05 | 1975-01-23 | Basf Ag | Griffestes, druckempfindliches durchschreibematerial |
| US4093278A (en) * | 1976-12-27 | 1978-06-06 | Monsanto Company | Dye solvents for pressure-sensitive copying systems |
-
1979
- 1979-05-10 DE DE7979300801T patent/DE2963924D1/de not_active Expired
- 1979-05-10 EP EP79300801A patent/EP0005921B1/de not_active Expired
- 1979-05-10 AT AT79300801T patent/ATE1699T1/de active
- 1979-05-24 FI FI791647A patent/FI70180C/fi not_active IP Right Cessation
- 1979-05-28 AU AU47478/79A patent/AU528695B2/en not_active Ceased
- 1979-05-29 JP JP6569279A patent/JPS552090A/ja active Pending
- 1979-05-30 CA CA328,731A patent/CA1126026A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS552090A (en) | 1980-01-09 |
| AU4747879A (en) | 1980-02-07 |
| ATE1699T1 (de) | 1982-11-15 |
| EP0005921A1 (de) | 1979-12-12 |
| DE2963924D1 (en) | 1982-12-02 |
| EP0005921B1 (de) | 1982-10-27 |
| FI70180B (fi) | 1986-02-28 |
| AU528695B2 (en) | 1983-05-12 |
| CA1126026A (en) | 1982-06-22 |
| FI791647A7 (fi) | 1979-12-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4343652A (en) | Chromogen solutions for pressure-sensitive mark-recording systems | |
| FI62548B (fi) | Saosom faergbildare anvaendbara diaminosubstituerade fluoranfoereningar | |
| FI86046C (fi) | Tryckkaensligt uppteckningsark. | |
| FI71694C (fi) | Tryckkaensligt eller vaermekaensligt uppteckningsmaterial. | |
| CS234013B2 (en) | Chromogenic material and method of its making | |
| EP0024898B1 (de) | Lösungsmittel, Lösungen und druckempfindliche Zeichen-Aufzeichnungssysteme | |
| FI70180B (fi) | Maerkregistreringssystem | |
| FI65113C (fi) | Arkmaterial med maerkfigur och foerfarande foer dess framstaellning | |
| US3968320A (en) | Dye solvents for pressure-sensitive record material | |
| EP0102132A1 (de) | Wiederverwendbares, wärmeempfindliches Material | |
| US5476829A (en) | Pressure-sensitive copying material | |
| EP0902745B1 (de) | Sultine farbbildner verbindungen und deren verwendung in kohlefreiem durchschlagpapier | |
| US3900217A (en) | Pressure-sensitive copying paper | |
| US4093278A (en) | Dye solvents for pressure-sensitive copying systems | |
| JPS60260379A (ja) | 記録材料 | |
| FI59220B (fi) | Kopieringsmaterial | |
| US4411452A (en) | Pressure-sensitive recording material | |
| FI72686C (fi) | Tryckkaensligt kopierpapper. | |
| US4447075A (en) | Pressure-sensitive recording material | |
| EP0012579B1 (de) | Druckempfindliche Aufzeichnungssysteme und Lösungen zur Verwendung in diesen Systemen | |
| JPH0325180Y2 (de) | ||
| JPS6333478B2 (de) | ||
| JPS6361194B2 (de) | ||
| JPS58222880A (ja) | 感圧記録用顕色層 | |
| JPS6049119B2 (ja) | 感圧記録紙 |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MM | Patent lapsed |
Owner name: MONSANTO EUROPE S.A. |