FI64160C - Nytt foerfarande foer framstaellning av antivirala substituerade purinfoereningar - Google Patents
Nytt foerfarande foer framstaellning av antivirala substituerade purinfoereningar Download PDFInfo
- Publication number
- FI64160C FI64160C FI772548A FI772548A FI64160C FI 64160 C FI64160 C FI 64160C FI 772548 A FI772548 A FI 772548A FI 772548 A FI772548 A FI 772548A FI 64160 C FI64160 C FI 64160C
- Authority
- FI
- Finland
- Prior art keywords
- hydroxy
- mixture
- formula
- acid
- process according
- Prior art date
Links
- 238000000034 method Methods 0.000 claims description 19
- 150000001875 compounds Chemical class 0.000 claims description 16
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 15
- -1 2 -oxa-1,4-butanediol diester Chemical class 0.000 claims description 13
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 10
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 10
- JOXIMZWYDAKGHI-UHFFFAOYSA-N p-toluenesulfonic acid Substances CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 claims description 9
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 5
- 239000001257 hydrogen Substances 0.000 claims description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 5
- UYTPUPDQBNUYGX-UHFFFAOYSA-N guanine Chemical compound O=C1NC(N)=NC2=C1N=CN2 UYTPUPDQBNUYGX-UHFFFAOYSA-N 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 230000003197 catalytic effect Effects 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- MSSXOMSJDRHRMC-UHFFFAOYSA-N 9H-purine-2,6-diamine Chemical compound NC1=NC(N)=C2NC=NC2=N1 MSSXOMSJDRHRMC-UHFFFAOYSA-N 0.000 claims description 2
- 239000003377 acid catalyst Substances 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 2
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 claims 1
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 1
- 229910052799 carbon Inorganic materials 0.000 claims 1
- 125000005489 p-toluenesulfonic acid group Chemical group 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 28
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 18
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 12
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 12
- 125000006239 protecting group Chemical group 0.000 description 12
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 10
- FDGQSTZJBFJUBT-UHFFFAOYSA-N hypoxanthine Chemical compound O=C1NC=NC2=C1NC=N2 FDGQSTZJBFJUBT-UHFFFAOYSA-N 0.000 description 10
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 9
- 238000006243 chemical reaction Methods 0.000 description 9
- 239000007787 solid Substances 0.000 description 9
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 7
- MKUXAQIIEYXACX-UHFFFAOYSA-N aciclovir Chemical compound N1C(N)=NC(=O)C2=C1N(COCCO)C=N2 MKUXAQIIEYXACX-UHFFFAOYSA-N 0.000 description 7
- 239000000047 product Substances 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- KDCGOANMDULRCW-UHFFFAOYSA-N 7H-purine Chemical group N1=CNC2=NC=NC2=C1 KDCGOANMDULRCW-UHFFFAOYSA-N 0.000 description 6
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 230000007062 hydrolysis Effects 0.000 description 6
- 238000006460 hydrolysis reaction Methods 0.000 description 6
- 150000003212 purines Chemical class 0.000 description 6
- UGQMRVRMYYASKQ-UHFFFAOYSA-N Hypoxanthine nucleoside Natural products OC1C(O)C(CO)OC1N1C(NC=NC2=O)=C2N=C1 UGQMRVRMYYASKQ-UHFFFAOYSA-N 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- 125000000561 purinyl group Chemical group N1=C(N=C2N=CNC2=C1)* 0.000 description 4
- XFEQOLXBMLXKDE-UHFFFAOYSA-N 2-(acetyloxymethoxy)ethyl acetate Chemical compound CC(=O)OCCOCOC(C)=O XFEQOLXBMLXKDE-UHFFFAOYSA-N 0.000 description 3
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 229960000583 acetic acid Drugs 0.000 description 3
- 125000002252 acyl group Chemical group 0.000 description 3
- 230000001476 alcoholic effect Effects 0.000 description 3
- 230000000840 anti-viral effect Effects 0.000 description 3
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 239000000543 intermediate Substances 0.000 description 3
- QNXFUWFRTWSSOK-UHFFFAOYSA-N n-acetyl-n-(6-oxo-3,7-dihydropurin-2-yl)acetamide Chemical compound O=C1NC(N(C(C)=O)C(=O)C)=NC2=C1NC=N2 QNXFUWFRTWSSOK-UHFFFAOYSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- ONSWVOSXVUHESJ-UHFFFAOYSA-N 2-(hydroxymethoxy)ethanol Chemical compound OCCOCO ONSWVOSXVUHESJ-UHFFFAOYSA-N 0.000 description 2
- CSMCRCLIPQDIKB-UHFFFAOYSA-N 2-[(2,6-diaminopurin-9-yl)methoxy]ethanol Chemical compound NC1=NC(N)=C2N=CN(COCCO)C2=N1 CSMCRCLIPQDIKB-UHFFFAOYSA-N 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 241000700605 Viruses Species 0.000 description 2
- 150000008065 acid anhydrides Chemical class 0.000 description 2
- 150000008064 anhydrides Chemical class 0.000 description 2
- 239000003443 antiviral agent Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 150000005690 diesters Chemical class 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 235000010446 mineral oil Nutrition 0.000 description 2
- 150000003139 primary aliphatic amines Chemical class 0.000 description 2
- 201000005404 rubella Diseases 0.000 description 2
- WNXJIVFYUVYPPR-UHFFFAOYSA-N 1,3-dioxolane Chemical compound C1COCO1 WNXJIVFYUVYPPR-UHFFFAOYSA-N 0.000 description 1
- UPSLZTCOOLWRMD-UHFFFAOYSA-N 1-(1,2,2,3-tetraacetyl-7H-purin-4-yl)ethanone Chemical compound C(C)(=O)C12N(C(N(C=C2NC=N1)C(C)=O)(C(C)=O)C(C)=O)C(C)=O UPSLZTCOOLWRMD-UHFFFAOYSA-N 0.000 description 1
- JXBPYDQBIDJOPX-UHFFFAOYSA-N 2-[(2,6-diacetamidopurin-9-yl)methoxy]ethyl acetate Chemical compound C(C)(=O)NC1=NC(=C2N=CN(C2=N1)COCCOC(C)=O)NC(C)=O JXBPYDQBIDJOPX-UHFFFAOYSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- COVZYZSDYWQREU-UHFFFAOYSA-N Busulfan Chemical compound CS(=O)(=O)OCCCCOS(C)(=O)=O COVZYZSDYWQREU-UHFFFAOYSA-N 0.000 description 1
- 241000450599 DNA viruses Species 0.000 description 1
- 241000709661 Enterovirus Species 0.000 description 1
- 208000007514 Herpes zoster Diseases 0.000 description 1
- 241001135569 Human adenovirus 5 Species 0.000 description 1
- 241000124008 Mammalia Species 0.000 description 1
- 241000699670 Mus sp. Species 0.000 description 1
- KLUTVBXWIFFOPM-UHFFFAOYSA-N N-(6-amino-7H-purin-2-yl)formamide Chemical compound C(=O)NC1=NC(=C2NC=NC2=N1)N KLUTVBXWIFFOPM-UHFFFAOYSA-N 0.000 description 1
- OHLUUHNLEMFGTQ-UHFFFAOYSA-N N-methylacetamide Chemical compound CNC(C)=O OHLUUHNLEMFGTQ-UHFFFAOYSA-N 0.000 description 1
- 241000283973 Oryctolagus cuniculus Species 0.000 description 1
- WGVWLKXZBUVUAM-UHFFFAOYSA-N Pentanochlor Chemical compound CCCC(C)C(=O)NC1=CC=C(C)C(Cl)=C1 WGVWLKXZBUVUAM-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 206010046865 Vaccinia virus infection Diseases 0.000 description 1
- 125000002777 acetyl group Chemical group [H]C([H])([H])C(*)=O 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 238000006136 alcoholysis reaction Methods 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 1
- 125000003236 benzoyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C(*)=O 0.000 description 1
- MHSVUSZEHNVFKW-UHFFFAOYSA-N bis-4-nitrophenyl phosphate Chemical compound C=1C=C([N+]([O-])=O)C=CC=1OP(=O)(O)OC1=CC=C([N+]([O-])=O)C=C1 MHSVUSZEHNVFKW-UHFFFAOYSA-N 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 210000004087 cornea Anatomy 0.000 description 1
- 238000010511 deprotection reaction Methods 0.000 description 1
- 201000010099 disease Diseases 0.000 description 1
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 1
- 241001493065 dsRNA viruses Species 0.000 description 1
- 206010014599 encephalitis Diseases 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000000338 in vitro Methods 0.000 description 1
- 238000001727 in vivo Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 239000000401 methanolic extract Substances 0.000 description 1
- 125000001570 methylene group Chemical group [H]C([H])([*:1])[*:2] 0.000 description 1
- LNOPIUAQISRISI-UHFFFAOYSA-N n'-hydroxy-2-propan-2-ylsulfonylethanimidamide Chemical compound CC(C)S(=O)(=O)CC(N)=NO LNOPIUAQISRISI-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 125000004430 oxygen atom Chemical group O* 0.000 description 1
- 229920000137 polyphosphoric acid Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 150000005619 secondary aliphatic amines Chemical class 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 238000003797 solvolysis reaction Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 150000003460 sulfonic acids Chemical class 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- ITMCEJHCFYSIIV-UHFFFAOYSA-N triflic acid Chemical compound OS(=O)(=O)C(F)(F)F ITMCEJHCFYSIIV-UHFFFAOYSA-N 0.000 description 1
- 241000701161 unidentified adenovirus Species 0.000 description 1
- 241001529453 unidentified herpesvirus Species 0.000 description 1
- 208000007089 vaccinia Diseases 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D473/00—Heterocyclic compounds containing purine ring systems
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US71810576A | 1976-08-27 | 1976-08-27 | |
| US71810576 | 1976-08-27 | ||
| US77313577 | 1977-02-28 | ||
| US05/773,135 US4146715A (en) | 1975-08-27 | 1977-02-28 | 2-amido-9-(2-acyloxyethoxymethyl)hypoxanthines |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI772548A7 FI772548A7 (fi) | 1978-02-28 |
| FI64160B FI64160B (fi) | 1983-06-30 |
| FI64160C true FI64160C (fi) | 1983-10-10 |
Family
ID=27109837
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI772548A FI64160C (fi) | 1976-08-27 | 1977-08-26 | Nytt foerfarande foer framstaellning av antivirala substituerade purinfoereningar |
Country Status (12)
| Country | Link |
|---|---|
| AT (1) | AT357566B (cs) |
| CA (2) | CA1096863A (cs) |
| CH (1) | CH634843A5 (cs) |
| CS (1) | CS196384B2 (cs) |
| DD (1) | DD131856A6 (cs) |
| DK (1) | DK147857C (cs) |
| FI (1) | FI64160C (cs) |
| GB (1) | GB1567671A (cs) |
| NL (1) | NL7709458A (cs) |
| NO (2) | NO147186C (cs) |
| SE (2) | SE432764B (cs) |
| YU (1) | YU41079B (cs) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4880820A (en) * | 1983-06-24 | 1989-11-14 | Merck & Co., Inc. | Guanine derivatives |
| US4918219A (en) * | 1983-10-31 | 1990-04-17 | Warner-Lambert Company | Glycerine derivatives |
| IE842642L (en) * | 1983-10-31 | 1985-04-30 | Harvard College | Purine Derivatives |
| YU45690B (sh) * | 1984-12-22 | 1992-07-20 | Krka Tovarna Zdraviln.Sol.O. | Postopek za pripravo 9-(2-hidroksietoksimetil)-gvanina |
| EP0289992B1 (en) * | 1987-05-04 | 1994-04-27 | Kemijski Institut | Process for preparing purine derivates |
| ES2103575T3 (es) * | 1993-09-10 | 1997-09-16 | Recordati Chem Pharm | Procedimiento para la preparacion de 9-(2-hidroxi)-etoximetil-guanina. |
| DE19536164A1 (de) * | 1995-09-28 | 1997-04-03 | Boehringer Ingelheim Kg | Verbessertes Verfahren zur Herstellung von 9-[(2-Hyroxyethoxy)methyl]guanin (Acyclovir) |
| IT1276126B1 (it) * | 1995-11-14 | 1997-10-27 | Archimica Spa | Procedimento per la preparazine di 9-((2-idrossietossi)metil) guanina |
| WO1997024357A1 (en) * | 1995-12-28 | 1997-07-10 | Mallinckrodt Chemical, Inc. | Process for synthesis and purification of a compound useful in the preparation of acyclovir |
-
1977
- 1977-08-24 YU YU2022/77A patent/YU41079B/xx unknown
- 1977-08-26 DK DK380377A patent/DK147857C/da not_active IP Right Cessation
- 1977-08-26 GB GB35914/77A patent/GB1567671A/en not_active Expired
- 1977-08-26 CS CS775615A patent/CS196384B2/cs unknown
- 1977-08-26 NL NL7709458A patent/NL7709458A/xx active Search and Examination
- 1977-08-26 AT AT620177A patent/AT357566B/de not_active IP Right Cessation
- 1977-08-26 FI FI772548A patent/FI64160C/fi not_active IP Right Cessation
- 1977-08-26 CH CH1046677A patent/CH634843A5/de not_active IP Right Cessation
- 1977-08-26 NO NO772959A patent/NO147186C/no unknown
- 1977-08-26 SE SE7709606A patent/SE432764B/xx not_active IP Right Cessation
- 1977-08-26 DD DD7700200760A patent/DD131856A6/xx not_active IP Right Cessation
- 1977-08-26 CA CA285,592A patent/CA1096863A/en not_active Expired
-
1980
- 1980-06-20 CA CA354,538A patent/CA1096864A/en not_active Expired
-
1982
- 1982-07-20 NO NO822502A patent/NO150119C/no unknown
-
1983
- 1983-08-23 SE SE8304549A patent/SE447113B/sv not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| GB1567671A (en) | 1980-05-21 |
| DK380377A (da) | 1978-02-28 |
| NO150119C (no) | 1984-08-22 |
| SE8304549D0 (sv) | 1983-08-23 |
| SE7709606L (sv) | 1978-02-28 |
| YU202277A (en) | 1983-02-28 |
| SE432764B (sv) | 1984-04-16 |
| NO150119B (no) | 1984-05-14 |
| FI772548A7 (fi) | 1978-02-28 |
| CH634843A5 (en) | 1983-02-28 |
| NL7709458A (nl) | 1978-03-01 |
| FI64160B (fi) | 1983-06-30 |
| NO147186C (no) | 1983-02-16 |
| CA1096864A (en) | 1981-03-03 |
| SE447113B (sv) | 1986-10-27 |
| NO147186B (no) | 1982-11-08 |
| ATA620177A (de) | 1979-12-15 |
| DK147857B (da) | 1984-12-24 |
| NO772959L (no) | 1978-02-28 |
| AT357566B (de) | 1980-07-25 |
| DK147857C (da) | 1985-06-10 |
| NO822502L (no) | 1978-02-28 |
| YU41079B (en) | 1986-12-31 |
| SE8304549L (sv) | 1983-08-23 |
| DD131856A6 (de) | 1978-07-26 |
| CA1096863A (en) | 1981-03-03 |
| CS196384B2 (en) | 1980-03-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US6573378B1 (en) | Antiviral guanine derivatives | |
| Martin et al. | 9-(1, 3-Dihydroxy-2-propoxymethyl) guanine: a new potent and selective antiherpes agent | |
| SU784777A3 (ru) | Способ пролучени производных пурина или их солей | |
| MATSUMOTO et al. | A convenient synthesis of 9-(2-hydroxyethoxymethyl) guanine (acyclovir) and related compounds | |
| FI64160C (fi) | Nytt foerfarande foer framstaellning av antivirala substituerade purinfoereningar | |
| JPH0729979B2 (ja) | 抗ウィルス性化合物 | |
| US5336770A (en) | Transglycosilation process for producing acyclic nucleosides | |
| US20010004668A1 (en) | Process for the preparation of purine derivatives | |
| KR100327147B1 (ko) | 푸린의제조방법 | |
| KR940010033B1 (ko) | 항비루스 활성을 갖는 화합물의 제조방법 | |
| Chamberlain et al. | An enantiospecific synthesis of the human cytomegalovirus antiviral agent [(R)-3-((2-amino-1, 6-dihydro-6-oxo-9H-purin-9-yl) methoxy)-4-hydroxybutyl] phosphonic acid | |
| HU198485B (en) | Process for producing 2-aminopurins substituted in 6 and 9-positions, as well as pharmaceutical compositions comprising same | |
| US5583225A (en) | Syntheses of acyclic guanine nucleosides | |
| SU1454253A3 (ru) | Способ получени 9-(2-оксиэтоксиметил)гуанина | |
| US3585189A (en) | Unsaturated nucleosides and processes for their preparation | |
| SU932991A3 (ru) | Способ получени производных пурина | |
| CA2038589A1 (en) | Substituted purines, processes for their preparation and their use as antiviral agents | |
| Holý | Preparation of 9-(β-D-ribofuranosyl)-2-hydroxypurine | |
| Kuśmierek et al. | A new route to 2′(3′)-O-alkyl purine nucleosides | |
| RU2111967C1 (ru) | Способ получения ацикловира | |
| EP0464769B1 (en) | Purinyl and pyrimidinyl tetrahydrofurans | |
| EP0564006A2 (en) | Process for preparing purine derivatives and novel purine derivatives | |
| KR930010559B1 (ko) | 1-히드록시알킬크산틴류, 그의 제조방법 | |
| Golovchinskaya | New Reactions of N-Methylated Oxopurines | |
| Doak et al. | The reaction between diazonium fluoborates and antimony trichloride in organic solvents |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MA | Patent expired | ||
| MA | Patent expired |
Owner name: THE WELLCOME FOUNDATION LIMITED |