FI59320C - Icke-haeftande tuggummiprodukt - Google Patents
Icke-haeftande tuggummiprodukt Download PDFInfo
- Publication number
- FI59320C FI59320C FI760110A FI760110A FI59320C FI 59320 C FI59320 C FI 59320C FI 760110 A FI760110 A FI 760110A FI 760110 A FI760110 A FI 760110A FI 59320 C FI59320 C FI 59320C
- Authority
- FI
- Finland
- Prior art keywords
- chewing gum
- molecular weight
- polyisobutylene
- chewing
- masterbatch
- Prior art date
Links
- 235000015218 chewing gum Nutrition 0.000 claims description 99
- 229940112822 chewing gum Drugs 0.000 claims description 87
- 229920001971 elastomer Polymers 0.000 claims description 41
- 229920002367 Polyisobutene Polymers 0.000 claims description 32
- 239000000203 mixture Substances 0.000 claims description 28
- 239000004594 Masterbatch (MB) Substances 0.000 claims description 27
- 239000011118 polyvinyl acetate Substances 0.000 claims description 26
- 229920002689 polyvinyl acetate Polymers 0.000 claims description 25
- 239000000806 elastomer Substances 0.000 claims description 24
- 238000002360 preparation method Methods 0.000 claims description 24
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 16
- 239000000194 fatty acid Substances 0.000 claims description 16
- 229930195729 fatty acid Natural products 0.000 claims description 16
- 239000004615 ingredient Substances 0.000 claims description 15
- 150000004665 fatty acids Chemical class 0.000 claims description 12
- 229910052500 inorganic mineral Inorganic materials 0.000 claims description 10
- 239000011707 mineral Substances 0.000 claims description 10
- 229920001577 copolymer Polymers 0.000 claims description 9
- VHOQXEIFYTTXJU-UHFFFAOYSA-N Isobutylene-isoprene copolymer Chemical compound CC(C)=C.CC(=C)C=C VHOQXEIFYTTXJU-UHFFFAOYSA-N 0.000 claims description 8
- 241001465754 Metazoa Species 0.000 claims description 6
- IPCSVZSSVZVIGE-UHFFFAOYSA-N hexadecanoic acid Chemical compound CCCCCCCCCCCCCCCC(O)=O IPCSVZSSVZVIGE-UHFFFAOYSA-N 0.000 claims description 6
- 239000003921 oil Substances 0.000 claims description 6
- 235000021314 Palmitic acid Nutrition 0.000 claims description 3
- 235000021355 Stearic acid Nutrition 0.000 claims description 3
- WQEPLUUGTLDZJY-UHFFFAOYSA-N n-Pentadecanoic acid Natural products CCCCCCCCCCCCCCC(O)=O WQEPLUUGTLDZJY-UHFFFAOYSA-N 0.000 claims description 3
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 claims description 3
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 claims description 3
- 235000013311 vegetables Nutrition 0.000 claims description 3
- 229920005690 natural copolymer Polymers 0.000 claims 1
- 208000011580 syndromic disease Diseases 0.000 claims 1
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 26
- 238000012360 testing method Methods 0.000 description 20
- 229920005989 resin Polymers 0.000 description 19
- 239000011347 resin Substances 0.000 description 18
- 239000005060 rubber Substances 0.000 description 17
- 229920003052 natural elastomer Polymers 0.000 description 16
- 229920001194 natural rubber Polymers 0.000 description 16
- 230000001055 chewing effect Effects 0.000 description 14
- 239000008172 hydrogenated vegetable oil Substances 0.000 description 14
- 229910000019 calcium carbonate Inorganic materials 0.000 description 13
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerol Natural products OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 12
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 10
- 235000010935 mono and diglycerides of fatty acids Nutrition 0.000 description 10
- 229920003051 synthetic elastomer Polymers 0.000 description 10
- 239000005061 synthetic rubber Substances 0.000 description 10
- 244000043261 Hevea brasiliensis Species 0.000 description 9
- 230000001070 adhesive effect Effects 0.000 description 9
- 239000008173 hydrogenated soybean oil Substances 0.000 description 9
- 238000000034 method Methods 0.000 description 9
- 239000010514 hydrogenated cottonseed oil Substances 0.000 description 8
- 239000001993 wax Substances 0.000 description 8
- CERQOIWHTDAKMF-UHFFFAOYSA-M Methacrylate Chemical compound CC(=C)C([O-])=O CERQOIWHTDAKMF-UHFFFAOYSA-M 0.000 description 7
- 240000008042 Zea mays Species 0.000 description 7
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 7
- 229920001195 polyisoprene Polymers 0.000 description 7
- 235000013599 spices Nutrition 0.000 description 7
- 239000001263 FEMA 3042 Substances 0.000 description 6
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 6
- 239000003795 chemical substances by application Substances 0.000 description 6
- 235000005822 corn Nutrition 0.000 description 6
- 239000003925 fat Substances 0.000 description 6
- 235000011187 glycerol Nutrition 0.000 description 6
- 239000000463 material Substances 0.000 description 6
- 239000000126 substance Substances 0.000 description 6
- 229920002258 tannic acid Polymers 0.000 description 6
- 229940033123 tannic acid Drugs 0.000 description 6
- TUSDEZXZIZRFGC-UHFFFAOYSA-N 1-O-galloyl-3,6-(R)-HHDP-beta-D-glucose Natural products OC1C(O2)COC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC1C(O)C2OC(=O)C1=CC(O)=C(O)C(O)=C1 TUSDEZXZIZRFGC-UHFFFAOYSA-N 0.000 description 5
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 5
- LRBQNJMCXXYXIU-PPKXGCFTSA-N Penta-digallate-beta-D-glucose Natural products OC1=C(O)C(O)=CC(C(=O)OC=2C(=C(O)C=C(C=2)C(=O)OC[C@@H]2[C@H]([C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)O2)OC(=O)C=2C=C(OC(=O)C=3C=C(O)C(O)=C(O)C=3)C(O)=C(O)C=2)O)=C1 LRBQNJMCXXYXIU-PPKXGCFTSA-N 0.000 description 5
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 5
- 239000011248 coating agent Substances 0.000 description 5
- 238000000576 coating method Methods 0.000 description 5
- 235000019198 oils Nutrition 0.000 description 5
- 239000000546 pharmaceutical excipient Substances 0.000 description 5
- 235000020357 syrup Nutrition 0.000 description 5
- 239000006188 syrup Substances 0.000 description 5
- LRBQNJMCXXYXIU-NRMVVENXSA-N tannic acid Chemical compound OC1=C(O)C(O)=CC(C(=O)OC=2C(=C(O)C=C(C=2)C(=O)OC[C@@H]2[C@H]([C@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)[C@@H](OC(=O)C=3C=C(OC(=O)C=4C=C(O)C(O)=C(O)C=4)C(O)=C(O)C=3)O2)OC(=O)C=2C=C(OC(=O)C=3C=C(O)C(O)=C(O)C=3)C(O)=C(O)C=2)O)=C1 LRBQNJMCXXYXIU-NRMVVENXSA-N 0.000 description 5
- 235000015523 tannic acid Nutrition 0.000 description 5
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 5
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 4
- RRHGJUQNOFWUDK-UHFFFAOYSA-N Isoprene Chemical compound CC(=C)C=C RRHGJUQNOFWUDK-UHFFFAOYSA-N 0.000 description 4
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 description 4
- 239000000853 adhesive Substances 0.000 description 4
- 239000008121 dextrose Substances 0.000 description 4
- 238000002156 mixing Methods 0.000 description 4
- 239000000025 natural resin Substances 0.000 description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- VQTUBCCKSQIDNK-UHFFFAOYSA-N Isobutene Chemical group CC(C)=C VQTUBCCKSQIDNK-UHFFFAOYSA-N 0.000 description 3
- 239000000654 additive Substances 0.000 description 3
- 230000001464 adherent effect Effects 0.000 description 3
- 235000009508 confectionery Nutrition 0.000 description 3
- 229920001206 natural gum Polymers 0.000 description 3
- 239000012169 petroleum derived wax Substances 0.000 description 3
- -1 synthetic gums Substances 0.000 description 3
- IIZPXYDJLKNOIY-JXPKJXOSSA-N 1-palmitoyl-2-arachidonoyl-sn-glycero-3-phosphocholine Chemical compound CCCCCCCCCCCCCCCC(=O)OC[C@H](COP([O-])(=O)OCC[N+](C)(C)C)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC IIZPXYDJLKNOIY-JXPKJXOSSA-N 0.000 description 2
- 229920000084 Gum arabic Polymers 0.000 description 2
- 239000000817 Petroleum-derived resin Substances 0.000 description 2
- 239000000205 acacia gum Substances 0.000 description 2
- 230000002924 anti-infective effect Effects 0.000 description 2
- 239000001506 calcium phosphate Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 235000012343 cottonseed oil Nutrition 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 230000002458 infectious effect Effects 0.000 description 2
- 235000010445 lecithin Nutrition 0.000 description 2
- 239000000787 lecithin Substances 0.000 description 2
- 229940067606 lecithin Drugs 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 150000003097 polyterpenes Chemical class 0.000 description 2
- 235000020374 simple syrup Nutrition 0.000 description 2
- 239000000454 talc Substances 0.000 description 2
- 229910052623 talc Inorganic materials 0.000 description 2
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 2
- 229940078499 tricalcium phosphate Drugs 0.000 description 2
- 229910000391 tricalcium phosphate Inorganic materials 0.000 description 2
- 235000019731 tricalcium phosphate Nutrition 0.000 description 2
- GFJUOMJGSXRJJY-UHFFFAOYSA-N 2-methylprop-1-ene Chemical group CC(C)=C.CC(C)=C GFJUOMJGSXRJJY-UHFFFAOYSA-N 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- 235000017060 Arachis glabrata Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 235000010777 Arachis hypogaea Nutrition 0.000 description 1
- 235000018262 Arachis monticola Nutrition 0.000 description 1
- 241000282421 Canidae Species 0.000 description 1
- 229920001412 Chicle Polymers 0.000 description 1
- 240000000896 Dyera costulata Species 0.000 description 1
- 229920001875 Ebonite Polymers 0.000 description 1
- 239000001856 Ethyl cellulose Substances 0.000 description 1
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- 244000068988 Glycine max Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 240000001794 Manilkara zapota Species 0.000 description 1
- 235000011339 Manilkara zapota Nutrition 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- 239000000956 alloy Substances 0.000 description 1
- 229910045601 alloy Inorganic materials 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 239000004203 carnauba wax Substances 0.000 description 1
- 235000013869 carnauba wax Nutrition 0.000 description 1
- 235000015111 chews Nutrition 0.000 description 1
- 230000001143 conditioned effect Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 235000019325 ethyl cellulose Nutrition 0.000 description 1
- 229920001249 ethyl cellulose Polymers 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 230000037406 food intake Effects 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 150000002314 glycerols Chemical class 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 238000004898 kneading Methods 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000013521 mastic Substances 0.000 description 1
- 235000012054 meals Nutrition 0.000 description 1
- 239000004200 microcrystalline wax Substances 0.000 description 1
- 235000019808 microcrystalline wax Nutrition 0.000 description 1
- 239000002540 palm oil Substances 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 235000019809 paraffin wax Nutrition 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 235000019381 petroleum wax Nutrition 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229920005672 polyolefin resin Polymers 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 239000000344 soap Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000003760 tallow Substances 0.000 description 1
- 150000001911 terphenyls Chemical class 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- 230000004584 weight gain Effects 0.000 description 1
- 235000019786 weight gain Nutrition 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23G—COCOA; COCOA PRODUCTS, e.g. CHOCOLATE; SUBSTITUTES FOR COCOA OR COCOA PRODUCTS; CONFECTIONERY; CHEWING GUM; ICE-CREAM; PREPARATION THEREOF
- A23G4/00—Chewing gum
- A23G4/06—Chewing gum characterised by the composition containing organic or inorganic compounds
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23G—COCOA; COCOA PRODUCTS, e.g. CHOCOLATE; SUBSTITUTES FOR COCOA OR COCOA PRODUCTS; CONFECTIONERY; CHEWING GUM; ICE-CREAM; PREPARATION THEREOF
- A23G4/00—Chewing gum
- A23G4/06—Chewing gum characterised by the composition containing organic or inorganic compounds
- A23G4/064—Chewing gum characterised by the composition containing organic or inorganic compounds containing inorganic compounds
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23G—COCOA; COCOA PRODUCTS, e.g. CHOCOLATE; SUBSTITUTES FOR COCOA OR COCOA PRODUCTS; CONFECTIONERY; CHEWING GUM; ICE-CREAM; PREPARATION THEREOF
- A23G4/00—Chewing gum
- A23G4/06—Chewing gum characterised by the composition containing organic or inorganic compounds
- A23G4/066—Chewing gum characterised by the composition containing organic or inorganic compounds characterised by the fat used
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23G—COCOA; COCOA PRODUCTS, e.g. CHOCOLATE; SUBSTITUTES FOR COCOA OR COCOA PRODUCTS; CONFECTIONERY; CHEWING GUM; ICE-CREAM; PREPARATION THEREOF
- A23G4/00—Chewing gum
- A23G4/06—Chewing gum characterised by the composition containing organic or inorganic compounds
- A23G4/08—Chewing gum characterised by the composition containing organic or inorganic compounds of the chewing gum base
-
- A—HUMAN NECESSITIES
- A23—FOODS OR FOODSTUFFS; TREATMENT THEREOF, NOT COVERED BY OTHER CLASSES
- A23G—COCOA; COCOA PRODUCTS, e.g. CHOCOLATE; SUBSTITUTES FOR COCOA OR COCOA PRODUCTS; CONFECTIONERY; CHEWING GUM; ICE-CREAM; PREPARATION THEREOF
- A23G4/00—Chewing gum
- A23G4/18—Chewing gum characterised by shape, structure or physical form, e.g. aerated products
- A23G4/20—Composite products, e.g. centre-filled, multi-layer, laminated
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Food Science & Technology (AREA)
- Polymers & Plastics (AREA)
- Inorganic Chemistry (AREA)
- Confectionery (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Dental Preparations (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US05/567,427 US3984574A (en) | 1975-04-11 | 1975-04-11 | Non-tack chewing gum composition |
| US56742775 | 1975-04-11 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI760110A7 FI760110A7 (enExample) | 1976-10-12 |
| FI59320B FI59320B (fi) | 1981-04-30 |
| FI59320C true FI59320C (fi) | 1981-08-10 |
Family
ID=24267107
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI760110A FI59320C (fi) | 1975-04-11 | 1976-01-19 | Icke-haeftande tuggummiprodukt |
Country Status (18)
| Country | Link |
|---|---|
| US (1) | US3984574A (enExample) |
| JP (1) | JPS5853898B2 (enExample) |
| AT (1) | AT344917B (enExample) |
| BE (1) | BE836221A (enExample) |
| CA (1) | CA1050334A (enExample) |
| CH (1) | CH630783A5 (enExample) |
| DE (1) | DE2552834C3 (enExample) |
| ES (1) | ES446900A1 (enExample) |
| FI (1) | FI59320C (enExample) |
| FR (1) | FR2306639A1 (enExample) |
| IT (1) | IT1057479B (enExample) |
| LU (1) | LU74664A1 (enExample) |
| MX (1) | MX3346E (enExample) |
| NL (1) | NL7600482A (enExample) |
| NO (1) | NO142331C (enExample) |
| NZ (1) | NZ180428A (enExample) |
| SE (1) | SE432690B (enExample) |
| ZA (1) | ZA757302B (enExample) |
Families Citing this family (126)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS545063A (en) * | 1977-06-13 | 1979-01-16 | Kanebo Ltd | Powdery mold releasing agent for confectionery |
| DE2830324C2 (de) * | 1977-07-19 | 1984-03-08 | Institut organičeskoj chimii Akademii Nauk Armjanskoj SSR, Erevan | Polymeres Bindemittel für Kaugummi und dessen Verwendung |
| US4160820A (en) * | 1977-11-28 | 1979-07-10 | General Mills, Inc. | Plaque inhibiting composition and method |
| US4148872A (en) * | 1977-11-28 | 1979-04-10 | General Mills, Inc. | Plaque inhibiting composition and method |
| US4187320A (en) * | 1978-05-01 | 1980-02-05 | Warner-Lambert Company | Process for preparing chewing gum base using solid elastomer |
| US4186214A (en) * | 1978-05-30 | 1980-01-29 | The Gillette Company | Molasses chewing gum |
| JPS5561766A (en) * | 1978-10-31 | 1980-05-09 | Lotte Co Ltd | Cold-resistant chewing gum |
| US4352822A (en) * | 1980-12-15 | 1982-10-05 | Nabisco Brands Inc. | Gum base, chewing gum containing same and method |
| US4352823A (en) * | 1981-04-13 | 1982-10-05 | Nabisco Brands, Inc. | Coextruded chewing gum containing a soft non-SBR gum core portion |
| US4514423A (en) * | 1981-05-22 | 1985-04-30 | Lotte Co., Ltd. | Process of preparing an improved bubble chewing gum |
| US4357355A (en) * | 1981-06-03 | 1982-11-02 | Warner-Lambert Company | Non-stick bubble gum base composition |
| US4452820A (en) * | 1981-06-05 | 1984-06-05 | Nabisco Brands, Inc. | Gum base and chewing gum containing same |
| ZA823715B (en) * | 1981-06-05 | 1983-03-30 | Nabisco Brands Inc | Gum base and chewing gum containing same |
| US4387108A (en) * | 1981-06-12 | 1983-06-07 | Warner-Lambert Company | Non-stick chewing gum composition and method of preparation |
| US4379169A (en) * | 1981-11-09 | 1983-04-05 | Nabisco Brands, Inc. | New gum base and chewing gum containing same |
| US4415593A (en) * | 1982-04-28 | 1983-11-15 | Warner Lambert Company | Chewing gum base |
| US4500547A (en) * | 1982-08-30 | 1985-02-19 | Nabisco Brands, Inc. | Reduced-shrink bubble gum |
| US4459311A (en) * | 1983-01-03 | 1984-07-10 | Nabisco Brands, Inc. | Process for preparing gum base |
| US4490395A (en) * | 1983-04-18 | 1984-12-25 | Warner-Lambert Company | Chewing gum with improved stability |
| US4525363A (en) * | 1983-06-29 | 1985-06-25 | Nabisco Brands, Inc. | Single compatibilizing agents for elastomer-resin combination gum base |
| US4518615A (en) * | 1983-08-23 | 1985-05-21 | Warner-Lambert Company | Non-adhesive chewing gum base composition |
| IT1180176B (it) * | 1984-05-29 | 1987-09-23 | Gum Base Co Spa | Composizione di gomma da masticare non calorica e non cariogena |
| US4589223A (en) * | 1984-07-25 | 1986-05-20 | Johnson Fishing, Inc. | Fishing lure composition |
| US4711784A (en) * | 1986-01-07 | 1987-12-08 | Warner-Lambert Company | Encapsulation composition for use with chewing gum and edible products |
| US4721620A (en) * | 1986-04-01 | 1988-01-26 | Warner-Lambert Company | Polyvinylacetate bubble gum base composition |
| US4794003A (en) * | 1986-04-01 | 1988-12-27 | Warner-Lambert Company | Polyvinylacetate bubble gum base composition |
| US5110607A (en) * | 1986-05-20 | 1992-05-05 | Warner-Lambert Company | Chewing gum composition and method of making same |
| US4872884A (en) * | 1986-12-10 | 1989-10-10 | Warner-Lambert Company | Reduced calorie chewing gum base and compositions containing the same |
| US4816265A (en) * | 1986-12-23 | 1989-03-28 | Warner-Lambert Company | Sweetener delivery systems containing polyvinyl acetate |
| US4842870A (en) * | 1987-12-22 | 1989-06-27 | Warner-Lambert Company | Anhydrous, non-staling chewing gum composition |
| US4904482A (en) * | 1988-12-22 | 1990-02-27 | Wm. Wrigley Jr. Company | Chewing gums containing hydrated emulsifier and methods of preparation |
| US5087459A (en) * | 1989-10-04 | 1992-02-11 | Wm. Wrigley Jr. Company | Non-tack chewing gum base |
| US5037924A (en) * | 1990-07-25 | 1991-08-06 | Gaf Chemicals Corporation | Denture adhesive |
| US5085872A (en) * | 1990-08-16 | 1992-02-04 | Wm. Wrigley Jr. Company | Method of manufacturing a chewing gum base |
| US5192562A (en) * | 1990-08-16 | 1993-03-09 | Wm. Wrigley Jr. Company | Method of manufacturing a chewing gum |
| FI96569C (fi) * | 1990-10-05 | 1996-07-25 | Wrigley W M Jun Co | Synteettinen purukumin perusseos ja sen valmistusmenetelmä |
| US5173317A (en) * | 1991-10-29 | 1992-12-22 | Wm. Wrigley Jr. Company | Gum compositions containing vinyl laurate/vinyl acetate copolymer |
| US5266336A (en) * | 1991-11-12 | 1993-11-30 | Wm. Wrigley Jr. Company | High flavor impact non-tack chewing gum with reduced plasticization |
| AU667494B2 (en) * | 1991-11-12 | 1996-03-28 | Wm. Wrigley Jr. Company | High flavor impact non-tack chewing gum with reduced plasticization |
| USH1241H (en) | 1991-11-18 | 1993-10-05 | Universal gum base concentrate | |
| US5286500A (en) * | 1992-03-03 | 1994-02-15 | Wm. Wrigley Jr. Company | Wax-free chewing gum base |
| US5462754A (en) * | 1992-03-03 | 1995-10-31 | Wm. Wrigley Jr. Company | Abhesive chewing gum with improved sweetness profile |
| FI943825L (fi) * | 1992-03-03 | 1994-10-20 | Wrigley W M Jun Co | Parannetut vahattomat purukumit, joissa maketutusaine vapautuu kontrolloidusti |
| US5437877A (en) * | 1992-03-03 | 1995-08-01 | Wm. Wrigley Jr. Company | Wax-free chewing gum with initial soft bite |
| WO1993017570A1 (en) * | 1992-03-03 | 1993-09-16 | Wm. Wrigley Jr. Company | Improved wax-free chewing gum base |
| US5342631A (en) * | 1992-12-29 | 1994-08-30 | Wm. Wrigley Jr. Company | Wax-free chewing gum including special oligosaccharide binders |
| WO1993017572A1 (en) * | 1992-03-03 | 1993-09-16 | Wm. Wrigley Jr. Company | Improved wax-free chewing gum base and chewing gums prepared therefrom |
| MX9206077A (es) * | 1992-03-03 | 1993-09-01 | Wrigley W M Jun Co | Mejorada base para goma de mascar libre de cera |
| US5286501A (en) * | 1992-12-30 | 1994-02-15 | Wm. Wrigley Jr. Company | Petroleum wax-free chewing gums having improved flavor release |
| US5424080A (en) * | 1992-06-30 | 1995-06-13 | Wm. Wrigley Jr. Company | Wax-free chewing gum base |
| US5436013A (en) * | 1993-03-02 | 1995-07-25 | Wm. Wrigley Jr. Company | Process for manufacturing wax-free chewing gums with fast set-up times |
| US5437875A (en) * | 1993-03-02 | 1995-08-01 | Wm. Wrigley, Jr. Company | Wax-free low moisture chewing gum |
| US5437876A (en) * | 1993-03-02 | 1995-08-01 | Wm. Wrigley Jr. Company | Wax-free chewing gums with controlled sweetener release |
| US5397580A (en) * | 1993-10-22 | 1995-03-14 | Wm. Wrigley Jr. Company | Continuous gum base manufacture using sequential mixers |
| US6086925A (en) * | 1993-09-24 | 2000-07-11 | Wm. Wrigley Jr. Company | Chewing gum base manufacturing process using plurality of lubricating agents feed inlets |
| US5419919A (en) * | 1993-10-22 | 1995-05-30 | Wm. Wrigley Jr. Company | Continuous gum base manufacture using paddle mixing |
| US6004589A (en) * | 1993-09-24 | 1999-12-21 | Wm. Wrigley Jr. Company | Chewing gum base manufacturing process using plurality of filler feed inlet locations |
| US5773053A (en) * | 1993-09-24 | 1998-06-30 | Wm. Wrigley Jr. Company | Chewing gum base manufacturing process using plurality of softening agents inlets |
| US5437878A (en) * | 1993-11-10 | 1995-08-01 | Nabisco, Inc. | Chewing gum exhibiting reduced adherence to dental work |
| US5413799A (en) * | 1994-04-12 | 1995-05-09 | Wm. Wrigley Jr. Company | Method of making fruit-flavored chewing with prolonged flavor intensity |
| US5429827A (en) * | 1994-04-12 | 1995-07-04 | Wm. Wrigley Jr. Company | Method of making improved gum base for fruit-flavored chewing gum |
| PH31445A (en) * | 1994-04-12 | 1998-11-03 | Wrigley W M Jun Co | Fruit flavored chewing gum with prolonged flavor intensity. |
| US5545416A (en) * | 1994-09-13 | 1996-08-13 | Wm. Wrigley Jr. Company | Gum base made with reduced antioxidant and method of preparation |
| JPH10502541A (ja) * | 1994-09-13 | 1998-03-10 | ダブリューエム リグリー ジュニア カンパニー | ガムベースの連続製造方法 |
| FI971031L (fi) * | 1994-09-13 | 1997-03-12 | Wrigley W M Jun Co | Purukumin jatkuvatoiminen valmistus kumipohjakonsentraatista |
| AU1086495A (en) * | 1994-11-01 | 1996-05-23 | Wm. Wrigley Jr. Company | Improved chewing gum containing caprenin |
| WO1996018308A1 (en) * | 1994-12-13 | 1996-06-20 | Wm. Wrigley Jr. Company | Improved chewing gum containing salatrim |
| US5538741A (en) * | 1994-12-22 | 1996-07-23 | Wm. Wrigley Jr. Company | Sugarless non-tack chewing gum |
| US5601858A (en) * | 1994-12-29 | 1997-02-11 | Warner-Lambert Company | Non-stick chewing gum |
| US5976581A (en) * | 1995-09-12 | 1999-11-02 | Wm. Wrigley Jr. Company | Continuous chewing gum manufacturing process using rework gum |
| US5827549A (en) * | 1996-02-21 | 1998-10-27 | Wm. Wrigley, Jr. Company | Process control system for automated continuous production of chewing gum |
| US6017565A (en) * | 1996-02-21 | 2000-01-25 | Wm. Wrigley Jr. Company | Method for automated continuous production of chewing gum |
| US6077547A (en) * | 1996-06-20 | 2000-06-20 | Wm. Wrigley Jr. Company | Chewing gum containing cuphea oil |
| WO1997048286A1 (en) * | 1996-06-20 | 1997-12-24 | Wm. Wrigley Jr. Company | Improved chewing gum containing cuphea oil |
| US5792494A (en) * | 1996-08-01 | 1998-08-11 | L. A. Dreyfus Co. | Gum base manufacturing method using elastomer emulsions |
| US6139897A (en) * | 1998-03-24 | 2000-10-31 | Kao Corporation | Oil or fat composition containing phytosterol |
| US6344222B1 (en) | 1998-09-03 | 2002-02-05 | Jsr Llc | Medicated chewing gum delivery system for nicotine |
| US6358060B2 (en) | 1998-09-03 | 2002-03-19 | Jsr Llc | Two-stage transmucosal medicine delivery system for symptom relief |
| US6773716B2 (en) * | 1999-04-06 | 2004-08-10 | Wm. Wrigley Jr. Company | Over-coated chewing gum formulations |
| ES2161141B1 (es) * | 1999-06-02 | 2003-03-16 | Cafosa Gum S A | Chicle moldeable, goma base adecuada para su preparacion y metodo de fabricacion de dicho chicle. |
| US20070286927A1 (en) * | 2000-04-11 | 2007-12-13 | Intergum Gida Sanayi Ve Ticaret A.S. | Low-Density Non-SBR Chewing Gum |
| PL354992A1 (en) * | 2000-08-25 | 2004-03-22 | Wm.Wrigley Jr.Company | Environmentally friendly chewing gums including lecithin |
| US6838098B2 (en) * | 2000-09-07 | 2005-01-04 | Cadbury Adams Usa, Llc | Continuous formation of center filled gum |
| FR2850244A1 (fr) * | 2003-01-24 | 2004-07-30 | Roquette Freres | Chewing-gum respectant l'environnement et son procede de fabrication |
| US20040209082A1 (en) * | 2003-04-17 | 2004-10-21 | Lee Willy W. | Process of Coating Tacky and Soft Polymer Pellets |
| US6986907B2 (en) * | 2003-07-28 | 2006-01-17 | Wm. Wrigley Jr. Company | Chewing gum base and chewing gum compositions |
| US8591972B2 (en) | 2005-05-23 | 2013-11-26 | Kraft Foods Global Brands Llc | Delivery system for coated active components as part of an edible composition |
| US20050112236A1 (en) | 2003-11-21 | 2005-05-26 | Navroz Boghani | Delivery system for active components as part of an edible composition having preselected tensile strength |
| US20060263474A1 (en) * | 2005-05-23 | 2006-11-23 | Cadbury Adams Usa Llc. | Enhanced flavor-release comestible compositions and methods for same |
| US8597703B2 (en) | 2005-05-23 | 2013-12-03 | Kraft Foods Global Brands Llc | Delivery system for active components as part of an edible composition including a ratio of encapsulating material and active component |
| US8591968B2 (en) | 2005-05-23 | 2013-11-26 | Kraft Foods Global Brands Llc | Edible composition including a delivery system for active components |
| US8591973B2 (en) | 2005-05-23 | 2013-11-26 | Kraft Foods Global Brands Llc | Delivery system for active components and a material having preselected hydrophobicity as part of an edible composition |
| US9271904B2 (en) | 2003-11-21 | 2016-03-01 | Intercontinental Great Brands Llc | Controlled release oral delivery systems |
| US8591974B2 (en) * | 2003-11-21 | 2013-11-26 | Kraft Foods Global Brands Llc | Delivery system for two or more active components as part of an edible composition |
| US8389032B2 (en) | 2005-05-23 | 2013-03-05 | Kraft Foods Global Brands Llc | Delivery system for active components as part of an edible composition having selected particle size |
| GB0417938D0 (en) * | 2004-08-12 | 2004-09-15 | Univ Bristol | Elastomeric material exhibiting reduced adhesion and chewing gum composition containing it |
| US7955630B2 (en) | 2004-09-30 | 2011-06-07 | Kraft Foods Global Brands Llc | Thermally stable, high tensile strength encapsulated actives |
| US20080063747A1 (en) * | 2004-08-25 | 2008-03-13 | Cadbury Adams Usa Llc | Dusting compositions for chewing gum products |
| US7727565B2 (en) | 2004-08-25 | 2010-06-01 | Cadbury Adams Usa Llc | Liquid-filled chewing gum composition |
| US9198448B2 (en) * | 2005-02-07 | 2015-12-01 | Intercontinental Great Brands Llc | Stable tooth whitening gum with reactive ingredients |
| WO2006127934A2 (en) * | 2005-05-23 | 2006-11-30 | Cadbury Adams Usa, Llc | Taste potentiator compositions and edible confectionery and chewing gum products containing same |
| US7851006B2 (en) | 2005-05-23 | 2010-12-14 | Cadbury Adams Usa Llc | Taste potentiator compositions and beverages containing same |
| US7851005B2 (en) | 2005-05-23 | 2010-12-14 | Cadbury Adams Usa Llc | Taste potentiator compositions and beverages containing same |
| US8263143B2 (en) * | 2005-08-22 | 2012-09-11 | Kraft Foods Global Brands Llc | Degradable chewing gum |
| US8282971B2 (en) | 2005-08-22 | 2012-10-09 | Kraft Foods Global Brands Llc | Degradable chewing gum |
| US8287928B2 (en) * | 2005-08-22 | 2012-10-16 | Kraft Foods Global Brands Llc | Degradable chewing gum |
| US20070042079A1 (en) * | 2005-08-22 | 2007-02-22 | Cadbury Adams Usa Llc | Environmentally-friendly chewing gum having reduced stickiness |
| US8268371B2 (en) * | 2005-08-22 | 2012-09-18 | Kraft Foods Global Brands Llc | Degradable chewing gum |
| US20070042078A1 (en) * | 2005-08-22 | 2007-02-22 | Cadbury Adams Usa Llc | Biodegradable chewing gum |
| RU2392823C2 (ru) * | 2005-12-29 | 2010-06-27 | Вм. Ригли Дж. Компани | Жевательная резинка, содержащая блоксополимеры стирола и диена |
| ES2284390B1 (es) * | 2006-04-19 | 2008-11-01 | Minera Del Santo Angel, S.L. | Uso del carbonato calcico como coadyuvante tecnologico en los proceso s de extraccion de aceites y grasas. |
| US8642016B2 (en) | 2006-07-21 | 2014-02-04 | Jsrnti, Llc | Medicinal delivery system, and related methods |
| RU2476076C2 (ru) * | 2007-02-26 | 2013-02-27 | Револимер Лимитед | Лечебная жевательная резинка |
| CA2679168A1 (en) * | 2007-02-26 | 2008-09-04 | Revolymer Limited | Medicated chewing gum |
| CA2700818C (en) * | 2007-10-15 | 2015-08-11 | Revolymer Limited | Solvent-free synthesis of amphiphilic polymeric material |
| EP2217266A2 (en) * | 2007-11-06 | 2010-08-18 | Kristian Hellgren | A method for treating ailments of the oral cavity with a krill enzyme composition |
| WO2010053908A1 (en) * | 2008-11-06 | 2010-05-14 | Allison Flynn | Biodegradable chewing gum bases and uses thereof |
| KR101155328B1 (ko) * | 2010-07-20 | 2012-06-19 | 롯데제과주식회사 | 카라멜이 들어있는 츄잉껌 |
| CN103857294A (zh) * | 2011-03-04 | 2014-06-11 | Wm.雷格利Jr.公司 | 可选用的口香糖增量剂 |
| EP2720557B1 (en) * | 2011-06-20 | 2017-02-22 | Okono A/S | Tobacco chewing gum formulation |
| WO2014067933A1 (en) | 2012-10-31 | 2014-05-08 | C-Lecta Gmbh | Bioactive carrier preparation for enhanced safety in care products and food |
| FI4179877T3 (fi) | 2013-12-06 | 2024-12-12 | Perfetti Van Melle Benelux B V | Järjestelmä ja menetelmä purukumin leikkaamiseksi |
| CN109478446B (zh) | 2016-07-29 | 2022-02-18 | 陶氏环球技术有限责任公司 | 包含生物基流体的驱油组合物 |
| ES2969320T3 (es) * | 2017-06-05 | 2024-05-17 | Perfetti Van Melle Benelux B V | Composiciones de goma de mascar y métodos para su fabricación |
| JP6955653B2 (ja) * | 2017-08-21 | 2021-10-27 | 株式会社東京歯材社 | 唾液採取用チューインガム |
| CN115515429A (zh) * | 2020-05-04 | 2022-12-23 | Wm.雷格利 Jr.公司 | 可咀嚼基质及其用于收集唾液样品和感染检测的用途 |
Family Cites Families (15)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1807704A (en) * | 1931-06-02 | Chewing gttm and method of making the xahrb | ||
| US2076112A (en) * | 1930-01-30 | 1937-04-06 | Sweets Lab Inc | Masticable material |
| US2154482A (en) * | 1937-01-30 | 1939-04-18 | Prolamine Products Inc | Chewing gum base |
| US2197719A (en) * | 1938-12-07 | 1940-04-16 | Wrigley W M Jun Co | Chewing gum |
| US2288100A (en) * | 1939-08-03 | 1942-06-30 | Shawinigan Chem Ltd | Chewing gum base |
| US2273425A (en) * | 1940-06-29 | 1942-02-17 | Hercules Powder Co Ltd | Chewing gum |
| US2383145A (en) * | 1944-03-31 | 1945-08-21 | Monsanto Chemicals | Chewing gum base |
| US3262784A (en) * | 1963-12-02 | 1966-07-26 | Frank H Fleer Corp | Chewing gum product and method of making same |
| US3285750A (en) * | 1964-03-09 | 1966-11-15 | Daiwa Chemical Ind Ltd | Chewing gum compositions having low adherence when discarded and methods of preparation thereof |
| GB1179473A (en) * | 1966-02-01 | 1970-01-28 | Takeda Chemical Industries Ltd | Chewing Gum |
| GB1176667A (en) * | 1966-12-22 | 1970-01-07 | Union Carbide Corp | Chewing Gums. |
| US3635735A (en) * | 1970-04-08 | 1972-01-18 | Grace W R & Co | Preparation of confection coated chewing gum |
| DE2115461A1 (en) * | 1970-09-21 | 1972-10-12 | Chewing gum - by stepwise mixing of base material with fat and/or wax components and moulding | |
| US3795744A (en) * | 1970-10-21 | 1974-03-05 | Lotte Co Ltd | Flavor variable chewing gum and methods of preparing the same |
| US3943258A (en) * | 1972-10-05 | 1976-03-09 | General Foods Corporation | Chewing gums of longer lasting sweetness and flavor |
-
1975
- 1975-04-11 US US05/567,427 patent/US3984574A/en not_active Expired - Lifetime
- 1975-05-15 CA CA227,063A patent/CA1050334A/en not_active Expired
- 1975-11-20 ZA ZA757302A patent/ZA757302B/xx unknown
- 1975-11-25 DE DE2552834A patent/DE2552834C3/de not_active Expired
- 1975-12-03 BE BE162399A patent/BE836221A/xx unknown
- 1975-12-08 NO NO754141A patent/NO142331C/no unknown
-
1976
- 1976-01-19 NL NL7600482A patent/NL7600482A/xx not_active Application Discontinuation
- 1976-01-19 FI FI760110A patent/FI59320C/fi not_active IP Right Cessation
- 1976-02-02 FR FR7602745*[A patent/FR2306639A1/fr active Granted
- 1976-02-20 AT AT122476A patent/AT344917B/de not_active IP Right Cessation
- 1976-02-27 JP JP51020187A patent/JPS5853898B2/ja not_active Expired
- 1976-03-09 MX MX000051U patent/MX3346E/es unknown
- 1976-03-25 NZ NZ180428A patent/NZ180428A/xx unknown
- 1976-03-29 LU LU74664A patent/LU74664A1/xx unknown
- 1976-04-07 IT IT48916/76A patent/IT1057479B/it active
- 1976-04-09 CH CH454576A patent/CH630783A5/de not_active IP Right Cessation
- 1976-04-09 SE SE7604236A patent/SE432690B/xx not_active IP Right Cessation
- 1976-04-10 ES ES446900A patent/ES446900A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| JPS51121560A (en) | 1976-10-23 |
| FR2306639A1 (fr) | 1976-11-05 |
| AU1265576A (en) | 1977-10-13 |
| ATA122476A (de) | 1977-12-15 |
| CH630783A5 (de) | 1982-07-15 |
| DE2552834A1 (de) | 1976-10-14 |
| SE432690B (sv) | 1984-04-16 |
| AT344917B (de) | 1978-08-25 |
| FI760110A7 (enExample) | 1976-10-12 |
| JPS5853898B2 (ja) | 1983-12-01 |
| NZ180428A (en) | 1978-06-02 |
| MX3346E (es) | 1980-10-06 |
| ES446900A1 (es) | 1977-09-16 |
| NO142331C (no) | 1980-08-06 |
| SE7604236L (sv) | 1977-01-20 |
| FI59320B (fi) | 1981-04-30 |
| BE836221A (fr) | 1976-04-01 |
| FR2306639B1 (enExample) | 1981-06-12 |
| NO142331B (no) | 1980-04-28 |
| NO754141L (enExample) | 1976-10-12 |
| NL7600482A (nl) | 1976-10-13 |
| IT1057479B (it) | 1982-03-10 |
| ZA757302B (en) | 1976-11-24 |
| DE2552834C3 (de) | 1984-09-27 |
| CA1050334A (en) | 1979-03-13 |
| LU74664A1 (enExample) | 1976-09-01 |
| DE2552834B2 (de) | 1981-07-23 |
| US3984574A (en) | 1976-10-05 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI59320C (fi) | Icke-haeftande tuggummiprodukt | |
| JPH0351382B2 (enExample) | ||
| CA1166889A (en) | Non-stick chewing gum composition and method of preparation | |
| CA1316749C (en) | Reduced calorie chewing gum base and compositions containing the same | |
| EP0134120B1 (en) | A non-adhesive chewing gum base composition, and a non-adhesive chewing gum composition | |
| Wang et al. | Understanding stickiness in sugar‐rich food systems: A review of mechanisms, analyses, and solutions of adhesion | |
| NO330710B1 (no) | Ikke-klebrig gummibaseformulering og tyggegummi inneholdende samme | |
| Harnirattisai et al. | Shear and micro-shear bond strengths of four self-etching adhesives measured immediately and 24 hours after application | |
| CA2183148C (en) | Improved sugarless non-tack chewing gum | |
| EP0702520A1 (en) | CHEWING GUM CONTAINING TRIGLYCERIDES | |
| AU667494B2 (en) | High flavor impact non-tack chewing gum with reduced plasticization | |
| US1052872A (en) | Chewing-gum composition. | |
| JP2025521635A (ja) | チューインガムの調製方法および得られる製品 | |
| GB2225923A (en) | Chewing gum | |
| Goldstein et al. | Effect of age, food deprivation and stress on gastric erosions in the rat | |
| JPH0376901B2 (enExample) | ||
| JP3660099B2 (ja) | 低付着、生分解性チューインガム | |
| Towns et al. | The stimulatory effect of insulin on diacylglycerol generation in adipocyte membranes from ob/ob mice is impaired by growth hormone | |
| CN103125723A (zh) | 不黏口香糖及其制造方法 | |
| WO2016140995A1 (en) | Process of using sorbitol of small and large crystal sizes to achieve gum texture and chewing gum including the sorbitol combination |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MA | Patent expired | ||
| MA | Patent expired |
Owner name: WM. WRIGLEY JR., COMPANY |