FI58778C - Foerfarande foer framstaellning av aminoacyldipeptidpenicilliner med antibakteriell aktivitet - Google Patents
Foerfarande foer framstaellning av aminoacyldipeptidpenicilliner med antibakteriell aktivitet Download PDFInfo
- Publication number
- FI58778C FI58778C FI1265/74A FI126574A FI58778C FI 58778 C FI58778 C FI 58778C FI 1265/74 A FI1265/74 A FI 1265/74A FI 126574 A FI126574 A FI 126574A FI 58778 C FI58778 C FI 58778C
- Authority
- FI
- Finland
- Prior art keywords
- methyl
- acid
- gem
- formula
- phenyl
- Prior art date
Links
- 230000000694 effects Effects 0.000 title description 5
- 238000000034 method Methods 0.000 claims description 72
- -1 2-hydroxyphenyl Chemical group 0.000 claims description 48
- 239000002253 acid Substances 0.000 claims description 46
- 150000001875 compounds Chemical class 0.000 claims description 26
- 229930182555 Penicillin Natural products 0.000 claims description 19
- 150000003839 salts Chemical class 0.000 claims description 15
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 12
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 claims description 11
- 230000000844 anti-bacterial effect Effects 0.000 claims description 10
- 239000001257 hydrogen Substances 0.000 claims description 10
- 229910052739 hydrogen Inorganic materials 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 10
- 238000002360 preparation method Methods 0.000 claims description 9
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 8
- 229940049954 penicillin Drugs 0.000 claims description 8
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 claims description 7
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 claims description 6
- 125000000217 alkyl group Chemical group 0.000 claims description 6
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 150000002148 esters Chemical class 0.000 claims description 6
- 125000000636 p-nitrophenyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)[N+]([O-])=O 0.000 claims description 6
- 125000001541 3-thienyl group Chemical group S1C([H])=C([*])C([H])=C1[H] 0.000 claims description 5
- 125000004203 4-hydroxyphenyl group Chemical group [H]OC1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 4
- 125000000266 alpha-aminoacyl group Chemical group 0.000 claims description 4
- 238000006243 chemical reaction Methods 0.000 claims description 4
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 claims description 4
- 125000000814 indol-3-yl group Chemical group [H]C1=C([H])C([H])=C2N([H])C([H])=C([*])C2=C1[H] 0.000 claims description 4
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 4
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 125000003808 silyl group Chemical group [H][Si]([H])([H])[*] 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 4
- 125000001424 substituent group Chemical group 0.000 claims description 4
- 108010016626 Dipeptides Proteins 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 3
- 125000002150 cyclohexa-1,4-dienyl group Chemical group [H]C1=C([H])C([H])(*)C([H])=C([H])C1([H])[H] 0.000 claims description 3
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 3
- 125000000896 monocarboxylic acid group Chemical group 0.000 claims description 3
- 230000007062 hydrolysis Effects 0.000 claims description 2
- 238000006460 hydrolysis reaction Methods 0.000 claims description 2
- 125000003118 aryl group Chemical group 0.000 description 29
- 150000003952 β-lactams Chemical class 0.000 description 27
- 125000006297 carbonyl amino group Chemical group [H]N([*:2])C([*:1])=O 0.000 description 19
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 18
- 239000011734 sodium Substances 0.000 description 17
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 14
- DBTDEFJAFBUGPP-UHFFFAOYSA-N Methanethial Chemical compound S=C DBTDEFJAFBUGPP-UHFFFAOYSA-N 0.000 description 13
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 12
- 150000002960 penicillins Chemical class 0.000 description 12
- 229910052708 sodium Inorganic materials 0.000 description 12
- 238000004458 analytical method Methods 0.000 description 10
- LSQZJLSUYDQPKJ-NJBDSQKTSA-N amoxicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=C(O)C=C1 LSQZJLSUYDQPKJ-NJBDSQKTSA-N 0.000 description 8
- 229960003022 amoxicillin Drugs 0.000 description 8
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 8
- 229960000723 ampicillin Drugs 0.000 description 8
- LSQZJLSUYDQPKJ-UHFFFAOYSA-N p-Hydroxyampicillin Natural products O=C1N2C(C(O)=O)C(C)(C)SC2C1NC(=O)C(N)C1=CC=C(O)C=C1 LSQZJLSUYDQPKJ-UHFFFAOYSA-N 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 6
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 6
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- 150000008064 anhydrides Chemical class 0.000 description 6
- 150000004684 trihydrates Chemical class 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 229910052799 carbon Inorganic materials 0.000 description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 4
- 150000002431 hydrogen Chemical group 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 159000000000 sodium salts Chemical class 0.000 description 4
- 125000002653 sulfanylmethyl group Chemical group [H]SC([H])([H])[*] 0.000 description 4
- HUMNYLRZRPPJDN-UHFFFAOYSA-N benzaldehyde Chemical compound O=CC1=CC=CC=C1 HUMNYLRZRPPJDN-UHFFFAOYSA-N 0.000 description 3
- 125000006367 bivalent amino carbonyl group Chemical group [H]N([*:1])C([*:2])=O 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- RBKMMJSQKNKNEV-RITPCOANSA-N penicillanic acid Chemical compound OC(=O)[C@H]1C(C)(C)S[C@@H]2CC(=O)N21 RBKMMJSQKNKNEV-RITPCOANSA-N 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- DEWDMTSMCKXBNP-UHFFFAOYSA-N 2-(carbamoylamino)-4-methylsulfanylbutanoic acid Chemical compound CSCCC(C(O)=O)NC(N)=O DEWDMTSMCKXBNP-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- 229920001817 Agar Polymers 0.000 description 2
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 2
- QOSSAOTZNIDXMA-UHFFFAOYSA-N Dicylcohexylcarbodiimide Chemical compound C1CCCCC1N=C=NC1CCCCC1 QOSSAOTZNIDXMA-UHFFFAOYSA-N 0.000 description 2
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 2
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 2
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 2
- NQTADLQHYWFPDB-UHFFFAOYSA-N N-Hydroxysuccinimide Chemical compound ON1C(=O)CCC1=O NQTADLQHYWFPDB-UHFFFAOYSA-N 0.000 description 2
- 230000006181 N-acylation Effects 0.000 description 2
- 229910017912 NH2OH Inorganic materials 0.000 description 2
- 241000589516 Pseudomonas Species 0.000 description 2
- 239000008272 agar Substances 0.000 description 2
- 238000003556 assay Methods 0.000 description 2
- RPBAFSBGYDKNRG-NJBDSQKTSA-N epicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CCC=CC1 RPBAFSBGYDKNRG-NJBDSQKTSA-N 0.000 description 2
- 229960002457 epicillin Drugs 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 125000001041 indolyl group Chemical group 0.000 description 2
- 208000015181 infectious disease Diseases 0.000 description 2
- 235000013372 meat Nutrition 0.000 description 2
- 229960005190 phenylalanine Drugs 0.000 description 2
- 230000006340 racemization Effects 0.000 description 2
- 210000002966 serum Anatomy 0.000 description 2
- 239000007858 starting material Substances 0.000 description 2
- 125000001544 thienyl group Chemical group 0.000 description 2
- ZMANZCXQSJIPKH-UHFFFAOYSA-O triethylammonium ion Chemical compound CC[NH+](CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-O 0.000 description 2
- NWLXJVDJMARXSP-SNVBAGLBSA-N (2r)-2-(carbamoylamino)-3-(1h-indol-3-yl)propanoic acid Chemical compound C1=CC=C2C(C[C@@H](NC(=O)N)C(O)=O)=CNC2=C1 NWLXJVDJMARXSP-SNVBAGLBSA-N 0.000 description 1
- PNLKYZVGQWCHBH-MRVPVSSYSA-N (2r)-2-(carbamoylamino)-3-(4-hydroxyphenyl)propanoic acid Chemical compound NC(=O)N[C@@H](C(O)=O)CC1=CC=C(O)C=C1 PNLKYZVGQWCHBH-MRVPVSSYSA-N 0.000 description 1
- GRVBUPWWVPDLHN-RXMQYKEDSA-N (2r)-2-(propylcarbamoylamino)propanoic acid Chemical compound CCCNC(=O)N[C@H](C)C(O)=O GRVBUPWWVPDLHN-RXMQYKEDSA-N 0.000 description 1
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 1
- ARCILDYSNOBLLE-UHFFFAOYSA-N 2-(carbamoylamino)-3-(4-fluorophenyl)propanoic acid Chemical compound NC(=O)NC(C(O)=O)CC1=CC=C(F)C=C1 ARCILDYSNOBLLE-UHFFFAOYSA-N 0.000 description 1
- WIYYLBIKONLIEY-UHFFFAOYSA-N 2-(carbamoylamino)-3-(4-nitrophenyl)propanoic acid Chemical compound NC(=O)NC(C(O)=O)CC1=CC=C([N+]([O-])=O)C=C1 WIYYLBIKONLIEY-UHFFFAOYSA-N 0.000 description 1
- QYQIRCQFPYDPPD-UHFFFAOYSA-N 2-(methylcarbamoylamino)-3-phenylpropanoic acid Chemical compound CNC(=O)NC(C(O)=O)CC1=CC=CC=C1 QYQIRCQFPYDPPD-UHFFFAOYSA-N 0.000 description 1
- ROUWPHMRHBMAFE-UHFFFAOYSA-N 2-formamido-3-(4-hydroxyphenyl)propanoic acid Chemical compound O=CNC(C(=O)O)CC1=CC=C(O)C=C1 ROUWPHMRHBMAFE-UHFFFAOYSA-N 0.000 description 1
- NSTPXGARCQOSAU-UHFFFAOYSA-N 2-formamido-3-phenylpropanoic acid Chemical compound O=CNC(C(=O)O)CC1=CC=CC=C1 NSTPXGARCQOSAU-UHFFFAOYSA-N 0.000 description 1
- YOETUEMZNOLGDB-UHFFFAOYSA-N 2-methylpropyl carbonochloridate Chemical compound CC(C)COC(Cl)=O YOETUEMZNOLGDB-UHFFFAOYSA-N 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 description 1
- YAUPUFGQHHALEZ-UHFFFAOYSA-N CC(C(=O)OC1=CC=CS1)NC(=O)N Chemical compound CC(C(=O)OC1=CC=CS1)NC(=O)N YAUPUFGQHHALEZ-UHFFFAOYSA-N 0.000 description 1
- ZPCMBWXPRBRHEB-UHFFFAOYSA-N CC(C1=CC=C(C=C1)Cl)(C(=O)O)NC(=O)N Chemical compound CC(C1=CC=C(C=C1)Cl)(C(=O)O)NC(=O)N ZPCMBWXPRBRHEB-UHFFFAOYSA-N 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- KRKNYBCHXYNGOX-UHFFFAOYSA-K Citrate Chemical compound [O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O KRKNYBCHXYNGOX-UHFFFAOYSA-K 0.000 description 1
- 229940126639 Compound 33 Drugs 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- 102000004190 Enzymes Human genes 0.000 description 1
- 108090000790 Enzymes Proteins 0.000 description 1
- 241000588724 Escherichia coli Species 0.000 description 1
- 241000192125 Firmicutes Species 0.000 description 1
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 1
- 206010061598 Immunodeficiency Diseases 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- AFVFQIVMOAPDHO-UHFFFAOYSA-N Methanesulfonic acid Chemical compound CS(O)(=O)=O AFVFQIVMOAPDHO-UHFFFAOYSA-N 0.000 description 1
- PYUSHNKNPOHWEZ-UHFFFAOYSA-N N-Formyl-DL-methionine Chemical compound CSCCC(C(O)=O)NC=O PYUSHNKNPOHWEZ-UHFFFAOYSA-N 0.000 description 1
- DEWDMTSMCKXBNP-SCSAIBSYSA-N N-carbamoyl-D-methionine Chemical compound CSCC[C@H](C(O)=O)NC(N)=O DEWDMTSMCKXBNP-SCSAIBSYSA-N 0.000 description 1
- JSJWCHRYRHKBBW-UHFFFAOYSA-N N-carbamoyl-beta-alanine Chemical compound NC(=O)NCCC(O)=O JSJWCHRYRHKBBW-UHFFFAOYSA-N 0.000 description 1
- HTLZVHNRZJPSMI-UHFFFAOYSA-N N-ethylpiperidine Chemical compound CCN1CCCCC1 HTLZVHNRZJPSMI-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- PNUZDKCDAWUEGK-CYZMBNFOSA-N Sitafloxacin Chemical compound C([C@H]1N)N(C=2C(=C3C(C(C(C(O)=O)=CN3[C@H]3[C@H](C3)F)=O)=CC=2F)Cl)CC11CC1 PNUZDKCDAWUEGK-CYZMBNFOSA-N 0.000 description 1
- 241000191940 Staphylococcus Species 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-M Thiocyanate anion Chemical compound [S-]C#N ZMZDMBWJUHKJPS-UHFFFAOYSA-M 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 101710117056 Trimethylamine corrinoid protein 2 Proteins 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 229940024606 amino acid Drugs 0.000 description 1
- 150000003863 ammonium salts Chemical class 0.000 description 1
- 239000003242 anti bacterial agent Substances 0.000 description 1
- 230000000845 anti-microbial effect Effects 0.000 description 1
- 229940088710 antibiotic agent Drugs 0.000 description 1
- 229940072107 ascorbate Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 125000000043 benzamido group Chemical group [H]N([*])C(=O)C1=C([H])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 125000001584 benzyloxycarbonyl group Chemical group C(=O)(OCC1=CC=CC=C1)* 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 1
- FPPNZSSZRUTDAP-UWFZAAFLSA-N carbenicillin Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)C(C(O)=O)C1=CC=CC=C1 FPPNZSSZRUTDAP-UWFZAAFLSA-N 0.000 description 1
- 229960003669 carbenicillin Drugs 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229940125773 compound 10 Drugs 0.000 description 1
- 238000010790 dilution Methods 0.000 description 1
- 239000012895 dilution Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 1
- 125000000816 ethylene group Chemical group [H]C([H])([*:1])C([H])([H])[*:2] 0.000 description 1
- 150000004820 halides Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- ZMZDMBWJUHKJPS-UHFFFAOYSA-N hydrogen thiocyanate Natural products SC#N ZMZDMBWJUHKJPS-UHFFFAOYSA-N 0.000 description 1
- 150000002440 hydroxy compounds Chemical class 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- ZLVXBBHTMQJRSX-VMGNSXQWSA-N jdtic Chemical compound C1([C@]2(C)CCN(C[C@@H]2C)C[C@H](C(C)C)NC(=O)[C@@H]2NCC3=CC(O)=CC=C3C2)=CC=CC(O)=C1 ZLVXBBHTMQJRSX-VMGNSXQWSA-N 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 125000004092 methylthiomethyl group Chemical group [H]C([H])([H])SC([H])([H])* 0.000 description 1
- LUSWEUMSEVLFEQ-UWTATZPHSA-N n-carbamoyl-alanine Chemical compound OC(=O)[C@@H](C)NC(N)=O LUSWEUMSEVLFEQ-UWTATZPHSA-N 0.000 description 1
- PYUSHNKNPOHWEZ-RXMQYKEDSA-N n-formyl-l-methionine Chemical compound CSCC[C@H](C(O)=O)NC=O PYUSHNKNPOHWEZ-RXMQYKEDSA-N 0.000 description 1
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 231100000956 nontoxicity Toxicity 0.000 description 1
- 230000020477 pH reduction Effects 0.000 description 1
- 244000052769 pathogen Species 0.000 description 1
- 235000019371 penicillin G benzathine Nutrition 0.000 description 1
- UYWQUFXKFGHYNT-UHFFFAOYSA-N phenylmethyl ester of formic acid Natural products O=COCC1=CC=CC=C1 UYWQUFXKFGHYNT-UHFFFAOYSA-N 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- 244000144977 poultry Species 0.000 description 1
- 238000001556 precipitation Methods 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 230000000069 prophylactic effect Effects 0.000 description 1
- 125000006239 protecting group Chemical group 0.000 description 1
- IFGCUJZIWBUILZ-UHFFFAOYSA-N sodium 2-[[2-[[hydroxy-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxyphosphoryl]amino]-4-methylpentanoyl]amino]-3-(1H-indol-3-yl)propanoic acid Chemical compound [Na+].C=1NC2=CC=CC=C2C=1CC(C(O)=O)NC(=O)C(CC(C)C)NP(O)(=O)OC1OC(C)C(O)C(O)C1O IFGCUJZIWBUILZ-UHFFFAOYSA-N 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-L succinate(2-) Chemical compound [O-]C(=O)CCC([O-])=O KDYFGRWQOYBRFD-UHFFFAOYSA-L 0.000 description 1
- 229940095064 tartrate Drugs 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- ACOOSTZBTYEGER-UHFFFAOYSA-N thiobenzaldehyde Chemical compound S=CC1=CC=CC=C1 ACOOSTZBTYEGER-UHFFFAOYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- 150000003955 ε-lactams Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI790883A FI59252C (fi) | 1973-05-04 | 1979-03-15 | Foerfarande foer framstaellning av alfa-(alfa'-guanidin-beta'-fenylpropionamido)-fenylacetamidopenicillansyra med antibakteriell aktivitet |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2120373 | 1973-05-04 | ||
| GB21203/73A GB1479267A (en) | 1973-05-04 | 1973-05-04 | Penicillins |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI58778B FI58778B (fi) | 1980-12-31 |
| FI58778C true FI58778C (fi) | 1981-04-10 |
Family
ID=10158924
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI1265/74A FI58778C (fi) | 1973-05-04 | 1974-04-24 | Foerfarande foer framstaellning av aminoacyldipeptidpenicilliner med antibakteriell aktivitet |
Country Status (26)
| Country | Link |
|---|---|
| US (1) | US3923788A (Home) |
| JP (1) | JPS5756479B2 (Home) |
| AR (1) | AR201768A1 (Home) |
| AT (1) | AT330957B (Home) |
| BE (1) | BE814559A (Home) |
| BR (1) | BR7403455D0 (Home) |
| CH (1) | CH603663A5 (Home) |
| CS (1) | CS197231B2 (Home) |
| DD (1) | DD111579A5 (Home) |
| DE (1) | DE2421030A1 (Home) |
| ES (1) | ES425945A1 (Home) |
| FI (1) | FI58778C (Home) |
| FR (1) | FR2227858B1 (Home) |
| GB (1) | GB1479267A (Home) |
| HU (1) | HU169830B (Home) |
| IE (1) | IE40013B1 (Home) |
| IL (2) | IL44728A (Home) |
| MW (1) | MW1874A1 (Home) |
| NL (1) | NL7406024A (Home) |
| PH (1) | PH12910A (Home) |
| RO (1) | RO67060A (Home) |
| SE (1) | SE7703567L (Home) |
| SU (1) | SU668606A3 (Home) |
| YU (1) | YU122174A (Home) |
| ZA (1) | ZA742788B (Home) |
| ZM (1) | ZM7274A1 (Home) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1503918A (en) * | 1974-06-18 | 1978-03-15 | Beecham Group Ltd | Penicillins |
| ES448679A1 (es) * | 1975-07-31 | 1977-11-16 | Kim Young Sul | Un procedimiento para la produccion de lisinato de metampi- cilina. |
| US4053609A (en) * | 1975-09-12 | 1977-10-11 | Tanabe Seiyaku Co., Ltd. | Penicillins and processes for preparing the same |
| TR201922977A2 (tr) * | 2019-12-31 | 2021-07-26 | T C Erciyes Ueniversitesi | Penisilin türevleri ve bunların sentezlenmesi için yöntem |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR6705A (Home) * | 1958-02-06 | |||
| US3340252A (en) * | 1964-04-07 | 1967-09-05 | American Home Prod | Amino-acylamino-acylamino-penicillanic acids |
| GB1180745A (en) * | 1966-10-04 | 1970-02-11 | Beecham Group Ltd | Penicillins |
| US3483188A (en) * | 1968-06-13 | 1969-12-09 | Bristol Myers Co | 6-(alpha - 3 - allophanamidophenylacetamido) and 6 - (alpha - 3 - allophanamidothienylacetamido)-penicillanic acids |
-
1973
- 1973-05-04 IL IL44728A patent/IL44728A/en unknown
- 1973-05-04 GB GB21203/73A patent/GB1479267A/en not_active Expired
-
1974
- 1974-04-24 FI FI1265/74A patent/FI58778C/fi active
- 1974-04-26 BR BR3455/74A patent/BR7403455D0/pt unknown
- 1974-04-29 IL IL44728A patent/IL44728A0/xx unknown
- 1974-04-29 IE IE901/74A patent/IE40013B1/xx unknown
- 1974-04-30 SU SU742026174A patent/SU668606A3/ru active
- 1974-04-30 DE DE2421030A patent/DE2421030A1/de not_active Ceased
- 1974-04-30 YU YU01221/74A patent/YU122174A/xx unknown
- 1974-05-02 AT AT364374A patent/AT330957B/de not_active IP Right Cessation
- 1974-05-02 FR FR7415192A patent/FR2227858B1/fr not_active Expired
- 1974-05-02 ZA ZA00742788A patent/ZA742788B/xx unknown
- 1974-05-03 ZM ZM72/74A patent/ZM7274A1/xx unknown
- 1974-05-03 RO RO7478669A patent/RO67060A/ro unknown
- 1974-05-03 BE BE143931A patent/BE814559A/xx unknown
- 1974-05-03 HU HUBE1197A patent/HU169830B/hu unknown
- 1974-05-03 US US466814A patent/US3923788A/en not_active Expired - Lifetime
- 1974-05-03 CS CS743212A patent/CS197231B2/cs unknown
- 1974-05-03 PH PH15807A patent/PH12910A/en unknown
- 1974-05-03 NL NL7406024A patent/NL7406024A/xx not_active Application Discontinuation
- 1974-05-03 ES ES425945A patent/ES425945A1/es not_active Expired
- 1974-05-03 CH CH605774A patent/CH603663A5/xx not_active IP Right Cessation
- 1974-05-03 MW MW18/74*UA patent/MW1874A1/xx unknown
- 1974-05-04 JP JP49050193A patent/JPS5756479B2/ja not_active Expired
- 1974-05-06 DD DD178296A patent/DD111579A5/xx unknown
- 1974-05-06 AR AR253608A patent/AR201768A1/es active
-
1977
- 1977-03-28 SE SE7703567A patent/SE7703567L/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| RO67060A (ro) | 1982-10-26 |
| NL7406024A (Home) | 1974-11-06 |
| YU122174A (en) | 1982-05-31 |
| AR201768A1 (es) | 1975-04-15 |
| MW1874A1 (en) | 1975-05-13 |
| IL44728A (en) | 1977-08-31 |
| IE40013B1 (en) | 1979-02-28 |
| FI58778B (fi) | 1980-12-31 |
| ES425945A1 (es) | 1976-12-16 |
| ZA742788B (en) | 1975-05-28 |
| FR2227858B1 (Home) | 1977-11-04 |
| AT330957B (de) | 1976-07-26 |
| AU6853474A (en) | 1975-11-06 |
| CH603663A5 (Home) | 1978-08-31 |
| JPS5040589A (Home) | 1975-04-14 |
| ATA364374A (de) | 1975-10-15 |
| ZM7274A1 (en) | 1976-11-22 |
| PH12910A (en) | 1979-10-04 |
| US3923788A (en) | 1975-12-02 |
| DE2421030A1 (de) | 1974-11-21 |
| IL44728A0 (en) | 1974-06-30 |
| DD111579A5 (Home) | 1975-02-20 |
| BE814559A (fr) | 1974-11-04 |
| SU668606A3 (ru) | 1979-06-15 |
| FR2227858A1 (Home) | 1974-11-29 |
| CS197231B2 (en) | 1980-04-30 |
| IE40013L (en) | 1974-11-04 |
| BR7403455D0 (pt) | 1974-12-31 |
| HU169830B (Home) | 1977-02-28 |
| JPS5756479B2 (Home) | 1982-11-30 |
| GB1479267A (en) | 1977-07-13 |
| SE7703567L (sv) | 1977-03-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| NZ193713A (en) | Bisesters of methanediol with penicillins, pharmaceutical compositions, and intermediate penicillanic acid 1,1-dioxide esters | |
| DE2331133C2 (de) | O-Substituierte 7β-Amino-2- oder 3-cephem-3-ol-4-carbonsäureverbindungen | |
| EP1221446B1 (en) | Antibacterial cephalosporins | |
| US3759904A (en) | Ds and salts thereof 3 - (s-(1,2,3-triazole-5-yl)thiomethyl)-3 - cephem - 4-carboxylic aci7-(d-(alpha-amino-alpha-phenyl-, 2-thienyl- and 3-thienylacetamido))- | |
| US3870709A (en) | 6-(alpha-(ome ga-guanidinoalkanoylamido)acylamido)penicillanic acids | |
| FI58778C (fi) | Foerfarande foer framstaellning av aminoacyldipeptidpenicilliner med antibakteriell aktivitet | |
| CH625526A5 (Home) | ||
| DE2222434C2 (de) | Cephalosporin-Derivat und Verfahren zu dessen Herstellung | |
| US3933797A (en) | 6-[α-(ω-QUANIDINOALKANOYLAMIDO)ACYLAMIDO]PENICILLANIC ACIDS | |
| US4115385A (en) | Antibacterial 3-(5-tetrazolyl) penam compounds | |
| DE2753182A1 (de) | Neue cephalosporine, verfahren zu deren herstellung und diese enthaltende pharmazeutische zusammensetzungen | |
| US4370327A (en) | Cephalosporins and pharmaceutical compositions | |
| US3935189A (en) | Penicillins | |
| US4179511A (en) | Antibacterial 3-(5-tetrazolyl) penam compounds | |
| US3935192A (en) | Penicillins | |
| US3957759A (en) | Penicillins | |
| US4180658A (en) | 7[-2-Alkoxyamino(acetamido)]cephalosporin derivatives | |
| FI60399B (fi) | Foerfarande foer framstaellning av antibakteriella 6-(2-substituerade-2-(4-hydroxifenyl)-asetamido)-2,2-dimetyl-3-(5-tetrazolyl)penamer | |
| DE2626621A1 (de) | Cephalosporine, verfahren zu ihrer herstellung und diese verbindungen enthaltende arzneipraeparate | |
| PL95747B1 (pl) | Sposob wytwarzania nowych pochodnych penamu | |
| US3962216A (en) | Penicillins | |
| US4401667A (en) | Cephalosporins | |
| DE2818985C2 (de) | Halogenarylmalonamidooxacephalosporine und deren Verwendung bei der Bekämpfung bakterieller Infektionen | |
| US4125715A (en) | 7-[(Substituted-isothioureamethyl)phenyl]-acetamidocephalosporin derivatives | |
| KR830002220B1 (ko) | 페니실린류의 제조방법 |