FI58506C - Foerfarande foer framstaellning av titandioxidpigment med oekad klimatbestaendighet - Google Patents
Foerfarande foer framstaellning av titandioxidpigment med oekad klimatbestaendighet Download PDFInfo
- Publication number
- FI58506C FI58506C FI3559/72A FI355972A FI58506C FI 58506 C FI58506 C FI 58506C FI 3559/72 A FI3559/72 A FI 3559/72A FI 355972 A FI355972 A FI 355972A FI 58506 C FI58506 C FI 58506C
- Authority
- FI
- Finland
- Prior art keywords
- pigment
- zirconium
- added
- suspension
- post
- Prior art date
Links
- 239000000049 pigment Substances 0.000 title claims description 52
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 34
- 238000000034 method Methods 0.000 claims description 23
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 claims description 20
- 239000000126 substance Substances 0.000 claims description 20
- 239000000725 suspension Substances 0.000 claims description 17
- 150000003754 zirconium Chemical class 0.000 claims description 14
- 239000004408 titanium dioxide Substances 0.000 claims description 13
- 239000003795 chemical substances by application Substances 0.000 claims description 11
- 150000003839 salts Chemical class 0.000 claims description 8
- 229910052782 aluminium Inorganic materials 0.000 claims description 7
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical class [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 7
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical class [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 claims description 6
- 230000002378 acidificating effect Effects 0.000 claims description 6
- 238000006243 chemical reaction Methods 0.000 claims description 6
- 239000000203 mixture Substances 0.000 claims description 6
- 230000007935 neutral effect Effects 0.000 claims description 6
- 229910052726 zirconium Chemical class 0.000 claims description 6
- 230000003472 neutralizing effect Effects 0.000 claims description 5
- 150000001875 compounds Chemical class 0.000 claims description 3
- 229910052751 metal Inorganic materials 0.000 claims description 3
- 239000002184 metal Substances 0.000 claims description 3
- 238000006386 neutralization reaction Methods 0.000 claims description 3
- 238000001556 precipitation Methods 0.000 claims description 3
- 150000003608 titanium Chemical class 0.000 claims description 3
- 238000001914 filtration Methods 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- GGROONUBGIWGGS-UHFFFAOYSA-N oxygen(2-);zirconium(4+);hydrate Chemical compound O.[O-2].[O-2].[Zr+4] GGROONUBGIWGGS-UHFFFAOYSA-N 0.000 claims description 2
- 235000012239 silicon dioxide Nutrition 0.000 claims description 2
- 150000003751 zinc Chemical class 0.000 claims description 2
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 claims 2
- 239000007900 aqueous suspension Substances 0.000 claims 1
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 claims 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 claims 1
- 239000000243 solution Substances 0.000 description 22
- 238000007792 addition Methods 0.000 description 17
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- IPCAPQRVQMIMAN-UHFFFAOYSA-L zirconyl chloride Chemical compound Cl[Zr](Cl)=O IPCAPQRVQMIMAN-UHFFFAOYSA-L 0.000 description 12
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- BUACSMWVFUNQET-UHFFFAOYSA-H dialuminum;trisulfate;hydrate Chemical compound O.[Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O BUACSMWVFUNQET-UHFFFAOYSA-H 0.000 description 10
- 230000014759 maintenance of location Effects 0.000 description 10
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 6
- 229910010413 TiO 2 Inorganic materials 0.000 description 6
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 5
- 229910021529 ammonia Inorganic materials 0.000 description 5
- 229910021653 sulphate ion Inorganic materials 0.000 description 5
- 229910052719 titanium Inorganic materials 0.000 description 5
- 239000010936 titanium Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- 229910004298 SiO 2 Inorganic materials 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- AZDRQVAHHNSJOQ-UHFFFAOYSA-N alumane Chemical class [AlH3] AZDRQVAHHNSJOQ-UHFFFAOYSA-N 0.000 description 4
- 239000000376 reactant Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- 238000010626 work up procedure Methods 0.000 description 4
- 229910018072 Al 2 O 3 Inorganic materials 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 3
- 239000003513 alkali Substances 0.000 description 3
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 3
- 235000019353 potassium silicate Nutrition 0.000 description 3
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 description 3
- NWONKYPBYAMBJT-UHFFFAOYSA-L zinc sulfate Chemical compound [Zn+2].[O-]S([O-])(=O)=O NWONKYPBYAMBJT-UHFFFAOYSA-L 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 229910052910 alkali metal silicate Inorganic materials 0.000 description 2
- 150000004645 aluminates Chemical class 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 235000011114 ammonium hydroxide Nutrition 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000008367 deionised water Substances 0.000 description 2
- 229910021641 deionized water Inorganic materials 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 150000004760 silicates Chemical class 0.000 description 2
- 239000000377 silicon dioxide Substances 0.000 description 2
- 239000002002 slurry Substances 0.000 description 2
- 239000002966 varnish Substances 0.000 description 2
- 239000011686 zinc sulphate Substances 0.000 description 2
- 235000009529 zinc sulphate Nutrition 0.000 description 2
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 1
- HXKKHQJGJAFBHI-UHFFFAOYSA-N 1-aminopropan-2-ol Chemical compound CC(O)CN HXKKHQJGJAFBHI-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- SVONRAPFKPVNKG-UHFFFAOYSA-N 2-ethoxyethyl acetate Chemical compound CCOCCOC(C)=O SVONRAPFKPVNKG-UHFFFAOYSA-N 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 150000000703 Cerium Chemical class 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 150000001342 alkaline earth metals Chemical class 0.000 description 1
- 229920000180 alkyd Polymers 0.000 description 1
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 1
- ANBBXQWFNXMHLD-UHFFFAOYSA-N aluminum;sodium;oxygen(2-) Chemical compound [O-2].[O-2].[Na+].[Al+3] ANBBXQWFNXMHLD-UHFFFAOYSA-N 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 229910052681 coesite Inorganic materials 0.000 description 1
- 229910052593 corundum Inorganic materials 0.000 description 1
- 229910052906 cristobalite Inorganic materials 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000003112 inhibitor Substances 0.000 description 1
- 230000000977 initiatory effect Effects 0.000 description 1
- 230000001050 lubricating effect Effects 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 238000002360 preparation method Methods 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 150000003377 silicon compounds Chemical class 0.000 description 1
- 229920006268 silicone film Polymers 0.000 description 1
- 229920002545 silicone oil Polymers 0.000 description 1
- 229910001388 sodium aluminate Inorganic materials 0.000 description 1
- GCLGEJMYGQKIIW-UHFFFAOYSA-H sodium hexametaphosphate Chemical compound [Na]OP1(=O)OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])OP(=O)(O[Na])O1 GCLGEJMYGQKIIW-UHFFFAOYSA-H 0.000 description 1
- 235000019982 sodium hexametaphosphate Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 229910052682 stishovite Inorganic materials 0.000 description 1
- 150000003467 sulfuric acid derivatives Chemical class 0.000 description 1
- 239000001577 tetrasodium phosphonato phosphate Substances 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- 229910000349 titanium oxysulfate Inorganic materials 0.000 description 1
- 229910052905 tridymite Inorganic materials 0.000 description 1
- 229910001845 yogo sapphire Inorganic materials 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229960001763 zinc sulfate Drugs 0.000 description 1
- 229910000368 zinc sulfate Inorganic materials 0.000 description 1
- -1 zirconia dihydrate Chemical class 0.000 description 1
- ZXAUZSQITFJWPS-UHFFFAOYSA-J zirconium(4+);disulfate Chemical compound [Zr+4].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O ZXAUZSQITFJWPS-UHFFFAOYSA-J 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09C—TREATMENT OF INORGANIC MATERIALS, OTHER THAN FIBROUS FILLERS, TO ENHANCE THEIR PIGMENTING OR FILLING PROPERTIES ; PREPARATION OF CARBON BLACK ; PREPARATION OF INORGANIC MATERIALS WHICH ARE NO SINGLE CHEMICAL COMPOUNDS AND WHICH ARE MAINLY USED AS PIGMENTS OR FILLERS
- C09C1/00—Treatment of specific inorganic materials other than fibrous fillers; Preparation of carbon black
- C09C1/36—Compounds of titanium
- C09C1/3607—Titanium dioxide
- C09C1/3653—Treatment with inorganic compounds
- C09C1/3661—Coating
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pigments, Carbon Blacks, Or Wood Stains (AREA)
- Paints Or Removers (AREA)
- Inorganic Compounds Of Heavy Metals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2223524A DE2223524C2 (de) | 1972-05-13 | 1972-05-13 | Verfahren zur Herstellung eines beschichteten Titandioxid-Pigmentes |
| DE2223524 | 1972-05-13 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI58506B FI58506B (fi) | 1980-10-31 |
| FI58506C true FI58506C (fi) | 1981-02-10 |
Family
ID=5844873
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI3559/72A FI58506C (fi) | 1972-05-13 | 1972-12-15 | Foerfarande foer framstaellning av titandioxidpigment med oekad klimatbestaendighet |
Country Status (12)
| Country | Link |
|---|---|
| JP (1) | JPS565270B2 (enExample) |
| BE (1) | BE799446A (enExample) |
| BR (1) | BR7303426D0 (enExample) |
| DE (1) | DE2223524C2 (enExample) |
| ES (1) | ES414668A1 (enExample) |
| FI (1) | FI58506C (enExample) |
| FR (1) | FR2184694B1 (enExample) |
| GB (1) | GB1435718A (enExample) |
| IT (1) | IT987274B (enExample) |
| NL (1) | NL175637C (enExample) |
| NO (1) | NO133276C (enExample) |
| ZA (1) | ZA733085B (enExample) |
Families Citing this family (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1479988A (en) * | 1975-07-17 | 1977-07-13 | Tioxide Group Ltd | Treatment of pigment |
| GB1481151A (en) * | 1975-08-14 | 1977-07-27 | Tioxide Group Ltd | Treatment of pigment |
| DE2738805A1 (de) * | 1977-08-29 | 1979-03-08 | Basf Ag | Verdunstungsarme, gut ueberlaminierbare, haertbare ungesaettigte polyesterharze |
| DE2835880A1 (de) * | 1978-08-16 | 1980-02-28 | Bayer Ag | Verfahren zur herstellung von titandioxidpigmenten mit hoher wetterbestaendigkeit |
| JPS5937305B2 (ja) * | 1980-11-18 | 1984-09-08 | 石原産業株式会社 | 二酸化チタン顔料 |
| DE3137384A1 (de) * | 1981-09-19 | 1983-04-07 | Bayer Ag, 5090 Leverkusen | Flockungsstabile mischphasenpigmente mit rutilstruktur, verfahren zu ihrer herstellung sowie ihre verwendung |
| GB2108097B (en) * | 1981-10-30 | 1985-01-03 | Tioxide Group Plc | Improved pigments and their preparation |
| GB2108098B (en) * | 1981-10-30 | 1985-03-20 | Tioxide Group Plc | Improved pigments and their preparation |
| DE10205920A1 (de) | 2002-02-12 | 2003-08-21 | Itn Nanovation Gmbh | Nanoskaliger Rutil, sowie Verfahren zu dessen Herstellung |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE637952A (enExample) * | 1962-10-05 | |||
| NL300720A (enExample) * | 1962-11-20 | |||
| FR1426766A (fr) * | 1964-03-20 | 1966-01-28 | American Potash & Chem Corp | Perfectionnements aux pigments de bioxyde de titane |
-
1972
- 1972-05-13 DE DE2223524A patent/DE2223524C2/de not_active Expired
- 1972-12-15 FI FI3559/72A patent/FI58506C/fi active
-
1973
- 1973-04-03 NO NO1348/73A patent/NO133276C/no unknown
- 1973-05-02 GB GB2074473A patent/GB1435718A/en not_active Expired
- 1973-05-07 ZA ZA733085A patent/ZA733085B/xx unknown
- 1973-05-10 IT IT23944/73A patent/IT987274B/it active
- 1973-05-10 FR FR7317010A patent/FR2184694B1/fr not_active Expired
- 1973-05-11 ES ES414668A patent/ES414668A1/es not_active Expired
- 1973-05-11 BE BE131044A patent/BE799446A/xx not_active IP Right Cessation
- 1973-05-11 NL NLAANVRAGE7306622,A patent/NL175637C/xx not_active IP Right Cessation
- 1973-05-11 BR BR3426/73A patent/BR7303426D0/pt unknown
- 1973-05-14 JP JP5346273A patent/JPS565270B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| NO133276B (enExample) | 1975-12-29 |
| FR2184694B1 (enExample) | 1976-11-12 |
| NO133276C (enExample) | 1976-04-07 |
| JPS4941424A (enExample) | 1974-04-18 |
| JPS565270B2 (enExample) | 1981-02-04 |
| FI58506B (fi) | 1980-10-31 |
| NL175637C (nl) | 1984-12-03 |
| BE799446A (fr) | 1973-08-31 |
| GB1435718A (en) | 1976-05-12 |
| DE2223524C2 (de) | 1987-01-02 |
| DE2223524A1 (de) | 1973-11-22 |
| NL175637B (nl) | 1984-07-02 |
| FR2184694A1 (enExample) | 1973-12-28 |
| NL7306622A (enExample) | 1973-11-15 |
| IT987274B (it) | 1975-02-20 |
| ES414668A1 (es) | 1976-01-16 |
| AU5547573A (en) | 1974-11-14 |
| ZA733085B (en) | 1974-04-24 |
| BR7303426D0 (pt) | 1974-07-18 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| RU2023715C1 (ru) | Способ получения пигментов с перламутровым блеском | |
| FI66417C (fi) | Foerfarande foer framstaellning av titandioxidpigment innehaollande zirkonium och anvaendning av dylika pigment vid faergning av lack plaster och spinnfibrer | |
| US4505755A (en) | Method of producing surface-treated barium sulfate | |
| KR960004637B1 (ko) | 세륨 양이온, 선택된 산 음이온과 알루미나로 피복된 이산화 티탄 안료 | |
| US3515566A (en) | Process for producing coated titanium dioxide pigment | |
| US4052223A (en) | Treatment of pigment | |
| GB2108097A (en) | Improved pigments and their preparation | |
| EP0654509B1 (en) | Durable pigmentary titanium dioxide and methods of producing the same | |
| FI58506C (fi) | Foerfarande foer framstaellning av titandioxidpigment med oekad klimatbestaendighet | |
| GB1258129A (enExample) | ||
| US4405376A (en) | Titanium dioxide pigment and process for producing same | |
| US4052224A (en) | Treatment of pigment | |
| US3897261A (en) | Hydrous oxide coated TiO{HD 2 {L | |
| DE2313542A1 (de) | Verfahren zur herstellung eines titandioxydpigmentes | |
| JPS5930749B2 (ja) | 二酸化チタン顔料組成物及びその製法 | |
| US4170485A (en) | Titanium dioxide slurries from recycle material | |
| US5792250A (en) | Process for the production of inorganically coated pigments and fillers | |
| JP3568685B2 (ja) | 有色顔料 | |
| US3330798A (en) | Aluminum phosphate coated titanium dioxide pigments for melamine and urea formaldehyde resins | |
| US4052222A (en) | Treatment of pigment | |
| US3941603A (en) | TiO2 Pigment for industrial paints based on water reducible systems | |
| DE2629954C2 (enExample) | ||
| GB1440543A (en) | Temperature-stable inorganic yellow pigments | |
| US3459575A (en) | Titanium pigment manufacture | |
| JP2002138218A (ja) | 二酸化チタン顔料及びその製造方法 |