FI58115C - Foerfarande foer framstaellning av nya terapeutiskt aktiva 5-oxodibensocykloheptadienylaettiksyraderivat - Google Patents
Foerfarande foer framstaellning av nya terapeutiskt aktiva 5-oxodibensocykloheptadienylaettiksyraderivat Download PDFInfo
- Publication number
- FI58115C FI58115C FI614/74A FI61474A FI58115C FI 58115 C FI58115 C FI 58115C FI 614/74 A FI614/74 A FI 614/74A FI 61474 A FI61474 A FI 61474A FI 58115 C FI58115 C FI 58115C
- Authority
- FI
- Finland
- Prior art keywords
- formula
- group
- atom
- och
- compound
- Prior art date
Links
- 239000002253 acid Substances 0.000 title claims description 8
- 230000001225 therapeutic effect Effects 0.000 title 1
- 150000001875 compounds Chemical class 0.000 claims description 30
- 238000000034 method Methods 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 150000003839 salts Chemical class 0.000 claims description 6
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- -1 methyl-1-piperazinyl group Chemical group 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 150000004820 halides Chemical class 0.000 claims description 4
- 150000001242 acetic acid derivatives Chemical class 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 229910052757 nitrogen Inorganic materials 0.000 claims description 3
- 125000005843 halogen group Chemical group 0.000 claims description 2
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 claims description 2
- 125000004429 atom Chemical group 0.000 claims 3
- 125000003545 alkoxy group Chemical group 0.000 claims 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 claims 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims 1
- 108090000623 proteins and genes Proteins 0.000 claims 1
- 125000001424 substituent group Chemical group 0.000 claims 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 17
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 15
- 238000002844 melting Methods 0.000 description 10
- 230000008018 melting Effects 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 239000000243 solution Substances 0.000 description 8
- RZWZRACFZGVKFM-UHFFFAOYSA-N propanoyl chloride Chemical compound CCC(Cl)=O RZWZRACFZGVKFM-UHFFFAOYSA-N 0.000 description 7
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- 231100000252 nontoxic Toxicity 0.000 description 6
- 230000003000 nontoxic effect Effects 0.000 description 6
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 125000004093 cyano group Chemical group *C#N 0.000 description 5
- FVSKHRXBFJPNKK-UHFFFAOYSA-N propionitrile Chemical compound CCC#N FVSKHRXBFJPNKK-UHFFFAOYSA-N 0.000 description 5
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 4
- 241000700159 Rattus Species 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 239000000284 extract Substances 0.000 description 4
- 239000000155 melt Substances 0.000 description 4
- LQNUZADURLCDLV-UHFFFAOYSA-N nitrobenzene Chemical compound [O-][N+](=O)C1=CC=CC=C1 LQNUZADURLCDLV-UHFFFAOYSA-N 0.000 description 4
- 229920000137 polyphosphoric acid Polymers 0.000 description 4
- 239000000377 silicon dioxide Substances 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- DLYUQMMRRRQYAE-UHFFFAOYSA-N tetraphosphorus decaoxide Chemical compound O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 4
- USROOJDCPHEUKV-UHFFFAOYSA-N 2-[2-[3-(cyanomethyl)phenyl]ethyl]benzoic acid Chemical compound OC(=O)C1=CC=CC=C1CCC1=CC=CC(CC#N)=C1 USROOJDCPHEUKV-UHFFFAOYSA-N 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229910021529 ammonia Inorganic materials 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 3
- 238000010438 heat treatment Methods 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- ODZPKZBBUMBTMG-UHFFFAOYSA-N sodium amide Chemical compound [NH2-].[Na+] ODZPKZBBUMBTMG-UHFFFAOYSA-N 0.000 description 3
- 239000007858 starting material Substances 0.000 description 3
- IOHPVZBSOKLVMN-UHFFFAOYSA-N 2-(2-phenylethyl)benzoic acid Chemical compound OC(=O)C1=CC=CC=C1CCC1=CC=CC=C1 IOHPVZBSOKLVMN-UHFFFAOYSA-N 0.000 description 2
- ZPJLEIUNYSMCOO-UHFFFAOYSA-N 2-(3-cyano-3-phenylpropyl)benzoic acid Chemical compound C(=O)(O)C1=C(C=CC=C1)CCC(C#N)C1=CC=CC=C1 ZPJLEIUNYSMCOO-UHFFFAOYSA-N 0.000 description 2
- QGJOPFRUJISHPQ-UHFFFAOYSA-N Carbon disulfide Chemical compound S=C=S QGJOPFRUJISHPQ-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- 206010037660 Pyrexia Diseases 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 2
- 230000003110 anti-inflammatory effect Effects 0.000 description 2
- 230000001754 anti-pyretic effect Effects 0.000 description 2
- 239000002221 antipyretic Substances 0.000 description 2
- 239000007864 aqueous solution Substances 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- 235000014121 butter Nutrition 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 2
- SKCNIGRBPJIUBQ-UHFFFAOYSA-N chloroform;ethyl acetate Chemical compound ClC(Cl)Cl.CCOC(C)=O SKCNIGRBPJIUBQ-UHFFFAOYSA-N 0.000 description 2
- 238000007796 conventional method Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000002474 experimental method Methods 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 230000003301 hydrolyzing effect Effects 0.000 description 2
- 150000002825 nitriles Chemical class 0.000 description 2
- 230000000144 pharmacologic effect Effects 0.000 description 2
- 235000011007 phosphoric acid Nutrition 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- 230000000630 rising effect Effects 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- PVOAHINGSUIXLS-UHFFFAOYSA-N 1-Methylpiperazine Chemical compound CN1CCNCC1 PVOAHINGSUIXLS-UHFFFAOYSA-N 0.000 description 1
- NJEBGBWXVVFLEQ-UHFFFAOYSA-N 2-(11-oxo-5,6-dihydrodibenzo[2,1-b:3',1'-f][7]annulen-3-yl)-n-phenylpropanamide Chemical compound C=1C=C(C(C2=CC=CC=C2CC2)=O)C2=CC=1C(C)C(=O)NC1=CC=CC=C1 NJEBGBWXVVFLEQ-UHFFFAOYSA-N 0.000 description 1
- DWXSYDKEWORWBT-UHFFFAOYSA-N 2-(2-bromophenyl)acetic acid Chemical compound OC(=O)CC1=CC=CC=C1Br DWXSYDKEWORWBT-UHFFFAOYSA-N 0.000 description 1
- ALXADGDGMRJAGC-UHFFFAOYSA-N 2-(2-oxo-5-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenyl)propanoic acid Chemical compound O=C1C2=C(CCC3=C1C=C(C=C3)C(C(=O)O)C)C=CC=C2 ALXADGDGMRJAGC-UHFFFAOYSA-N 0.000 description 1
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 1
- QOWSWEBLNVACCL-UHFFFAOYSA-N 4-Bromophenyl acetate Chemical compound OC(=O)CC1=CC=C(Br)C=C1 QOWSWEBLNVACCL-UHFFFAOYSA-N 0.000 description 1
- 229910021630 Antimony pentafluoride Inorganic materials 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 238000005727 Friedel-Crafts reaction Methods 0.000 description 1
- RJUFJBKOKNCXHH-UHFFFAOYSA-N Methyl propionate Chemical compound CCC(=O)OC RJUFJBKOKNCXHH-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-N Propionic acid Substances CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 1
- 240000004808 Saccharomyces cerevisiae Species 0.000 description 1
- 235000014680 Saccharomyces cerevisiae Nutrition 0.000 description 1
- 239000012670 alkaline solution Substances 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 230000000202 analgesic effect Effects 0.000 description 1
- 150000008064 anhydrides Chemical class 0.000 description 1
- 229940124599 anti-inflammatory drug Drugs 0.000 description 1
- VBVBHWZYQGJZLR-UHFFFAOYSA-I antimony pentafluoride Chemical compound F[Sb](F)(F)(F)F VBVBHWZYQGJZLR-UHFFFAOYSA-I 0.000 description 1
- 229940125716 antipyretic agent Drugs 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- HRYZWHHZPQKTII-UHFFFAOYSA-N chloroethane Chemical compound CCCl HRYZWHHZPQKTII-UHFFFAOYSA-N 0.000 description 1
- 238000004587 chromatography analysis Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 150000008508 dibenzocycloheptenes Chemical class 0.000 description 1
- 125000004177 diethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 239000003814 drug Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical group CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 239000010410 layer Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229940017219 methyl propionate Drugs 0.000 description 1
- 125000000325 methylidene group Chemical group [H]C([H])=* 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- LYGJENNIWJXYER-UHFFFAOYSA-N nitromethane Chemical compound C[N+]([O-])=O LYGJENNIWJXYER-UHFFFAOYSA-N 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 239000002574 poison Substances 0.000 description 1
- 231100000614 poison Toxicity 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- QLNJFJADRCOGBJ-UHFFFAOYSA-N propionamide Chemical compound CCC(N)=O QLNJFJADRCOGBJ-UHFFFAOYSA-N 0.000 description 1
- 229940080818 propionamide Drugs 0.000 description 1
- 125000001501 propionyl group Chemical group O=C([*])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910052938 sodium sulfate Inorganic materials 0.000 description 1
- 235000011152 sodium sulphate Nutrition 0.000 description 1
- 238000005507 spraying Methods 0.000 description 1
- 238000007920 subcutaneous administration Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/10—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings
- C07D317/14—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 not condensed with other rings with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D317/18—Radicals substituted by singly bound oxygen or sulfur atoms
- C07D317/22—Radicals substituted by singly bound oxygen or sulfur atoms etherified
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/58—Preparation of carboxylic acid halides
- C07C51/60—Preparation of carboxylic acid halides by conversion of carboxylic acids or their anhydrides or esters, lactones, salts into halides with the same carboxylic acid part
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/76—Unsaturated compounds containing keto groups
- C07C59/86—Unsaturated compounds containing keto groups containing six-membered aromatic rings and other rings
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Coloring (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FI793490A FI793490A7 (fi) | 1973-03-02 | 1979-11-07 | Foerfarande foer framstaellning av nya terapeutiskt aktiva 5-oxodibensocykloheptadienylaettiksyraderivat |
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR7307508 | 1973-03-02 | ||
| FR7307508A FR2219777A1 (en) | 1973-03-02 | 1973-03-02 | 5-oxo dibenzo(a,d)cycloheptene derivs - with analgesic, antipyretic and anti-inflamm- atory activity |
| FR7337404 | 1973-10-19 | ||
| FR7337404A FR2248031A1 (en) | 1973-10-19 | 1973-10-19 | 5-oxo dibenzo(a,d)cycloheptene derivs - with analgesic, antipyretic and anti-inflamm- atory activity |
| FR7402214 | 1974-01-23 | ||
| FR7402214A FR2258174A1 (en) | 1974-01-23 | 1974-01-23 | 5-oxo dibenzo(a,d)cycloheptene derivs - with analgesic, antipyretic and anti-inflamm- atory activity |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI58115B FI58115B (fi) | 1980-08-29 |
| FI58115C true FI58115C (fi) | 1980-12-10 |
Family
ID=27250066
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI614/74A FI58115C (fi) | 1973-03-02 | 1974-03-01 | Foerfarande foer framstaellning av nya terapeutiskt aktiva 5-oxodibensocykloheptadienylaettiksyraderivat |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3933905A (enExample) |
| JP (1) | JPS5024260A (enExample) |
| AR (1) | AR202811A1 (enExample) |
| CA (1) | CA1022929A (enExample) |
| DE (1) | DE2409919A1 (enExample) |
| FI (1) | FI58115C (enExample) |
| GB (1) | GB1412095A (enExample) |
| IE (1) | IE38942B1 (enExample) |
| IL (1) | IL44311A (enExample) |
| LU (1) | LU69524A1 (enExample) |
| NL (1) | NL7402475A (enExample) |
| OA (1) | OA04603A (enExample) |
| SE (1) | SE397972B (enExample) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4020094A (en) * | 1974-04-22 | 1977-04-26 | Syntex (U.S.A.) Inc. | 2-Substituted-5-oxo-5H-dibenzo[a,d]cycloheptenes, the salts and esters thereof, having pharmaceutical activity |
| US4011243A (en) * | 1975-09-08 | 1977-03-08 | Syntex (U.S.A.) Inc. | Intermediate in the oxidative process for the preparation of 2-(5H-dibenzo[a,d]cyclohepten-5-on-2-yl)acetic, propionic and butyric acids |
| US4059611A (en) * | 1975-09-08 | 1977-11-22 | Syntex (U.S.A.) Inc. | Oxidative process for the preparation of 2-(5H-dibenzo[a,d]cyclohepten-5-on-2-yl)acetic, propionic and butyric acid |
| US4054579A (en) * | 1975-09-08 | 1977-10-18 | Syntex (U.S.A.) Inc. | Intermediates in the process for the preparation of 2-(5H-dibenzo[a,d]cyclohepten-5-on-2-yl)acetic, propionic and butyric acids |
| US4041173A (en) * | 1975-10-06 | 1977-08-09 | Syntex (U.S.A.) Inc. | 2-Carboxy-(7-,8- and 9-substituted)-5-oxo-5H-dibenzo (a,d) cycloheptenes and the corresponding 10,11-dihydro compounds |
| US4172949A (en) * | 1978-06-28 | 1979-10-30 | Syntex (U.S.A.) Inc. | 2,4-Disubstituted-5-oxo-5H-dibenzo[a,d]cycloheptenes |
| JPS5649337A (en) * | 1979-09-29 | 1981-05-02 | Toa Eiyou Kagaku Kogyo Kk | Dibenzo a,d cycloheptene derivative and its preparation |
| US4337354A (en) * | 1979-10-19 | 1982-06-29 | Merck & Co., Inc. | [(5,6,9a-Substituted-3-oxo-1,2,9,9a-tetrahydro-3H-fluoren-7-yl)oxy]alkanoic and cycloalkanoic acids, their analogs, esters, salts, and derivatives |
| US4317922A (en) * | 1979-10-19 | 1982-03-02 | Merck & Co., Inc. | [(5,6,9a-Substituted-3-oxo-1,2,9,9a-tetrahydro-3H-fluoren-7-yl)oxy]alkanoic and cycloalkanoic acids and their analogs, esters, salts and derivatives |
| US4356313A (en) * | 1979-10-19 | 1982-10-26 | Merck & Co., Inc. | [(5,6,9a-substituted-3-oxo-1,2,9,9a-tetrahydro-3H-fluoren-7-yl)oxy]alkanoic and cycloalkanoic acid esters and their analogs, the parent acids and their salts |
| US4356314A (en) * | 1980-06-30 | 1982-10-26 | Merck & Co., Inc. | [5,6,9A-Substituted-3-oxo-1,2,9,9a-tetrahydro-3H-fluoren-7-yl)oxy]alkanoic and cycloalkanoic acids, their analogs, esters, salts, and derivatives |
| US4316043A (en) * | 1980-12-19 | 1982-02-16 | Merck & Co., Inc. | [(5,6,9a-Substituted-3-oxo-1,2,9,9a-tetrahydro-3H-fluoren-7-yl)oxy]alkanoic and cycloalkanoic acids and their analogs, esters, salts and derivatives |
| GB8520662D0 (en) * | 1985-08-17 | 1985-09-25 | Wellcome Found | Tricyclic aromatic compounds |
-
1974
- 1974-02-20 OA OA55125A patent/OA04603A/xx unknown
- 1974-02-22 NL NL7402475A patent/NL7402475A/xx not_active Application Discontinuation
- 1974-02-28 JP JP49022905A patent/JPS5024260A/ja active Pending
- 1974-02-28 IE IE00421/74A patent/IE38942B1/xx unknown
- 1974-02-28 GB GB915474A patent/GB1412095A/en not_active Expired
- 1974-02-28 IL IL44311A patent/IL44311A/en unknown
- 1974-02-28 CA CA193,752A patent/CA1022929A/en not_active Expired
- 1974-02-28 US US05/447,059 patent/US3933905A/en not_active Expired - Lifetime
- 1974-03-01 SE SE7402779A patent/SE397972B/xx not_active IP Right Cessation
- 1974-03-01 AR AR252579A patent/AR202811A1/es active
- 1974-03-01 FI FI614/74A patent/FI58115C/fi active
- 1974-03-01 LU LU69524A patent/LU69524A1/xx unknown
- 1974-03-01 DE DE2409919A patent/DE2409919A1/de not_active Withdrawn
Also Published As
| Publication number | Publication date |
|---|---|
| SE397972B (sv) | 1977-11-28 |
| LU69524A1 (enExample) | 1974-10-09 |
| FI58115B (fi) | 1980-08-29 |
| GB1412095A (en) | 1975-10-29 |
| NL7402475A (enExample) | 1974-09-04 |
| IE38942L (en) | 1974-09-02 |
| CA1022929A (en) | 1977-12-20 |
| US3933905A (en) | 1976-01-20 |
| IL44311A0 (en) | 1974-05-16 |
| AU6614274A (en) | 1975-08-28 |
| JPS5024260A (enExample) | 1975-03-15 |
| IL44311A (en) | 1977-12-30 |
| IE38942B1 (en) | 1978-07-05 |
| AR202811A1 (es) | 1975-07-24 |
| DE2409919A1 (de) | 1974-09-05 |
| OA04603A (fr) | 1980-06-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI58115C (fi) | Foerfarande foer framstaellning av nya terapeutiskt aktiva 5-oxodibensocykloheptadienylaettiksyraderivat | |
| EP0253503B1 (en) | Substituted anilides having antiandrogenic properties | |
| KR920005815B1 (ko) | 퀴논 유도체 및 약리학적 이용 | |
| JPS6310784A (ja) | 抗アレルギー剤 | |
| CA1212380A (fr) | Procede de preparation de nouveaux derives de thieno (2,3-b) pyrrole | |
| WO1983003096A1 (fr) | Derives d'immidazole | |
| US4659728A (en) | Hydroxy substituted 4,5-diphenyl-2-oxazole propanoic acid | |
| CH464172A (fr) | Procédé de préparation d'acides carboxyliques -substitués | |
| US4143055A (en) | 2,4,6-trisubstituted-2,3-dihydro-benzofuran derivatives | |
| EP0397031A1 (en) | Novel esters of phenylalkanoic acid | |
| US4952602A (en) | Phenyl benzothiophene hypolipidemic derivatives | |
| US5003090A (en) | Process for the preparation of benzopyrans | |
| US4931574A (en) | Process for the preparation of benzopyrans | |
| US4060550A (en) | Novel n'-acylated phenyl-hydrazine and -hydrazone derivatives | |
| US3975437A (en) | Dibenzo (a,d) cycloheptene derivatives | |
| CA1085412A (fr) | Acides thienothienylcarbonylphenylalcanoiques, leurs derives, leur preparation et les compositions qui les contiennent | |
| US4511577A (en) | Derivatives of benzoic acid | |
| US4218473A (en) | Derivatives of 4-cyclohexyl-1-naphthalene-acetic acid and their use as drugs | |
| CH601228A5 (en) | Antiinflammatory indomethacin esters active topically and orally | |
| US5182404A (en) | Biphenyl derivatives, process for preparing the same and intermediates therefor | |
| Nierenstein et al. | A New Hydrocarbon | |
| US5233057A (en) | Biphenyl derivatives, process for preparing the same and intermediates therefor | |
| RU2357973C1 (ru) | Способ получения дипептидов лупанового ряда | |
| JPS6097963A (ja) | ビス−ジオキソピペラジン誘導体,その製造方法及びそれからなる抗腫瘍剤 | |
| KR790000978B1 (ko) | 아미노 피롤 유도체의 제조방법 |