FI56823C - Foerfarande foer framstaellning av fenylaminoetanolderivat - Google Patents
Foerfarande foer framstaellning av fenylaminoetanolderivat Download PDFInfo
- Publication number
- FI56823C FI56823C FI1389/71A FI138971A FI56823C FI 56823 C FI56823 C FI 56823C FI 1389/71 A FI1389/71 A FI 1389/71A FI 138971 A FI138971 A FI 138971A FI 56823 C FI56823 C FI 56823C
- Authority
- FI
- Finland
- Prior art keywords
- formaldehyde
- benzyl
- process according
- preparation
- borate
- Prior art date
Links
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 32
- 150000001875 compounds Chemical class 0.000 claims description 17
- 238000000034 method Methods 0.000 claims description 16
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims description 15
- -1 alkali metal borate Chemical class 0.000 claims description 14
- 238000002360 preparation method Methods 0.000 claims description 8
- ULZRKSDAMUWQEZ-UHFFFAOYSA-N 1-anilinoethanol Chemical class CC(O)NC1=CC=CC=C1 ULZRKSDAMUWQEZ-UHFFFAOYSA-N 0.000 claims description 6
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 6
- 229910021538 borax Inorganic materials 0.000 claims description 6
- 235000010339 sodium tetraborate Nutrition 0.000 claims description 6
- BSVBQGMMJUBVOD-UHFFFAOYSA-N trisodium borate Chemical group [Na+].[Na+].[Na+].[O-]B([O-])[O-] BSVBQGMMJUBVOD-UHFFFAOYSA-N 0.000 claims description 6
- 229910052783 alkali metal Inorganic materials 0.000 claims description 5
- 239000002585 base Substances 0.000 claims description 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 5
- 239000007864 aqueous solution Substances 0.000 claims description 4
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 2
- 150000008044 alkali metal hydroxides Chemical class 0.000 claims description 2
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- BTBUEUYNUDRHOZ-UHFFFAOYSA-N Borate Chemical compound [O-]B([O-])[O-] BTBUEUYNUDRHOZ-UHFFFAOYSA-N 0.000 claims 1
- 229910052751 metal Inorganic materials 0.000 claims 1
- 239000002184 metal Substances 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 12
- 239000000243 solution Substances 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 239000000203 mixture Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- WSFSSNUMVMOOMR-NJFSPNSNSA-N methanone Chemical compound O=[14CH2] WSFSSNUMVMOOMR-NJFSPNSNSA-N 0.000 description 3
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000000376 reactant Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910052938 sodium sulfate Inorganic materials 0.000 description 2
- 235000011152 sodium sulphate Nutrition 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- VZSRBBMJRBPUNF-UHFFFAOYSA-N 2-(2,3-dihydro-1H-inden-2-ylamino)-N-[3-oxo-3-(2,4,6,7-tetrahydrotriazolo[4,5-c]pyridin-5-yl)propyl]pyrimidine-5-carboxamide Chemical compound C1C(CC2=CC=CC=C12)NC1=NC=C(C=N1)C(=O)NCCC(N1CC2=C(CC1)NN=N2)=O VZSRBBMJRBPUNF-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- 229930040373 Paraformaldehyde Natural products 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- WVDDGKGOMKODPV-UHFFFAOYSA-N benzyl alcohol Substances OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 239000012267 brine Substances 0.000 description 1
- 230000007883 bronchodilation Effects 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 230000008878 coupling Effects 0.000 description 1
- 238000010168 coupling process Methods 0.000 description 1
- 238000005859 coupling reaction Methods 0.000 description 1
- IIEWJVIFRVWJOD-UHFFFAOYSA-N ethyl cyclohexane Natural products CCC1CCCCC1 IIEWJVIFRVWJOD-UHFFFAOYSA-N 0.000 description 1
- 239000000706 filtrate Substances 0.000 description 1
- 238000007327 hydrogenolysis reaction Methods 0.000 description 1
- 125000004029 hydroxymethyl group Chemical group [H]OC([H])([H])* 0.000 description 1
- 238000007031 hydroxymethylation reaction Methods 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229920002866 paraformaldehyde Polymers 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 238000005932 reductive alkylation reaction Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000000021 stimulant Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C213/00—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton
- C07C213/10—Separation; Purification; Stabilisation; Use of additives
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C215/00—Compounds containing amino and hydroxy groups bound to the same carbon skeleton
- C07C215/46—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton
- C07C215/56—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains further substituted by hydroxy groups
- C07C215/58—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains further substituted by hydroxy groups with hydroxy groups and the six-membered aromatic ring, or the condensed ring system containing that ring, bound to the same carbon atom of the carbon chain
- C07C215/60—Compounds containing amino and hydroxy groups bound to the same carbon skeleton having hydroxy groups bound to carbon atoms of at least one six-membered aromatic ring and amino groups bound to acyclic carbon atoms or to carbon atoms of rings other than six-membered aromatic rings of the same carbon skeleton with amino groups linked to the six-membered aromatic ring, or to the condensed ring system containing that ring, by carbon chains further substituted by hydroxy groups with hydroxy groups and the six-membered aromatic ring, or the condensed ring system containing that ring, bound to the same carbon atom of the carbon chain the chain having two carbon atoms between the amino groups and the six-membered aromatic ring or the condensed ring system containing that ring
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C209/00—Preparation of compounds containing amino groups bound to a carbon skeleton
- C07C209/82—Purification; Separation; Stabilisation; Use of additives
- C07C209/84—Purification
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C213/00—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton
- C07C213/08—Preparation of compounds containing amino and hydroxy, amino and etherified hydroxy or amino and esterified hydroxy groups bound to the same carbon skeleton by reactions not involving the formation of amino groups, hydroxy groups or etherified or esterified hydroxy groups
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C2601/00—Systems containing only non-condensed rings
- C07C2601/12—Systems containing only non-condensed rings with a six-membered ring
- C07C2601/14—The ring being saturated
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB2652370 | 1970-06-02 | ||
| GB26523/70A GB1298284A (en) | 1970-06-02 | 1970-06-02 | Preparation of phenylaminoethanols |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI56823B FI56823B (fi) | 1979-12-31 |
| FI56823C true FI56823C (fi) | 1980-04-10 |
Family
ID=10244972
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI1389/71A FI56823C (fi) | 1970-06-02 | 1971-05-21 | Foerfarande foer framstaellning av fenylaminoetanolderivat |
Country Status (14)
| Country | Link |
|---|---|
| JP (1) | JPS5216102B1 (de) |
| AT (1) | AT308724B (de) |
| CA (1) | CA989418A (de) |
| CH (1) | CH558329A (de) |
| DE (1) | DE2127177C3 (de) |
| DK (1) | DK125388B (de) |
| ES (1) | ES391800A1 (de) |
| FI (1) | FI56823C (de) |
| GB (1) | GB1298284A (de) |
| IL (1) | IL36836A (de) |
| NL (1) | NL174040C (de) |
| NO (1) | NO130312B (de) |
| SE (1) | SE376764B (de) |
| YU (1) | YU34979B (de) |
Families Citing this family (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS51118737A (en) * | 1975-04-10 | 1976-10-18 | Shionogi & Co Ltd | Novel process for preparation of monosubstituted aminobenzylalcohols a t o-n position |
| US4952729A (en) * | 1986-09-05 | 1990-08-28 | Schering-Plough Corp. | Intermediates in the preparation of alpha1(((1,1-dimethylethyl) amino) methyl)-4-hydroxy-1,3-benzenedimethanol |
| EP0259159A3 (de) * | 1986-09-05 | 1989-08-09 | Schering Corporation | Verfahren zur Herstellung von alpha 1-[[(1,1-Dimethylethyl(amino]methyl]-4-hydroxy-1,3-benzendimethanol und bei ihrer Herstellung verwendete Zwischenprodukte |
-
1970
- 1970-06-02 GB GB26523/70A patent/GB1298284A/en not_active Expired
-
1971
- 1971-05-11 CA CA112,656A patent/CA989418A/en not_active Expired
- 1971-05-12 IL IL36836A patent/IL36836A/en unknown
- 1971-05-20 YU YU1271/71A patent/YU34979B/xx unknown
- 1971-05-21 FI FI1389/71A patent/FI56823C/fi active
- 1971-05-26 JP JP46035603A patent/JPS5216102B1/ja active Pending
- 1971-05-28 AT AT464071A patent/AT308724B/de not_active IP Right Cessation
- 1971-05-31 ES ES391800A patent/ES391800A1/es not_active Expired
- 1971-06-01 NO NO02049/71*[A patent/NO130312B/no unknown
- 1971-06-01 DE DE2127177A patent/DE2127177C3/de not_active Expired
- 1971-06-01 DK DK264671AA patent/DK125388B/da unknown
- 1971-06-02 CH CH798871A patent/CH558329A/de not_active IP Right Cessation
- 1971-06-02 SE SE7107128A patent/SE376764B/xx unknown
- 1971-06-02 NL NLAANVRAGE7107588,A patent/NL174040C/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| IL36836A (en) | 1973-07-30 |
| NL174040B (nl) | 1983-11-16 |
| ES391800A1 (es) | 1974-11-01 |
| AT308724B (de) | 1973-07-25 |
| DE2127177B2 (de) | 1980-05-22 |
| YU127171A (en) | 1979-12-31 |
| CH558329A (de) | 1975-01-31 |
| DE2127177A1 (de) | 1971-12-09 |
| GB1298284A (en) | 1972-11-29 |
| SE376764B (de) | 1975-06-09 |
| DK125388B (da) | 1973-02-12 |
| NO130312B (de) | 1974-08-12 |
| JPS5216102B1 (de) | 1977-05-06 |
| IL36836A0 (en) | 1971-07-28 |
| NL7107588A (de) | 1971-12-06 |
| FI56823B (fi) | 1979-12-31 |
| CA989418A (en) | 1976-05-18 |
| DE2127177C3 (de) | 1981-01-29 |
| YU34979B (en) | 1980-06-30 |
| NL174040C (nl) | 1984-04-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| KR850001229A (ko) | 4'-탈메틸-4-에피포도필로톡신 유도체의 제조방법 | |
| KR880001583A (ko) | 광학적 활성 벤젠설폰아미드 유도체의 제조방법 | |
| HU186760B (en) | Process for preparing 3,4-dihydro-5h-2,3-aenzodiazepine derivatives | |
| US4420479A (en) | Olefinic benzimidazoles, formulations, and antiviral methods | |
| NZ197041A (en) | Substituted phenyl ethers and pharmaceutical compositions containing them | |
| KR850008166A (ko) | 인돌린 및 2-인돌리논 유도체의 제조방법 | |
| FI56823C (fi) | Foerfarande foer framstaellning av fenylaminoetanolderivat | |
| GB1059256A (en) | Fluorescent, practically colourless, benzimidazole and benzoxazole derivatives | |
| GB1418287A (en) | 1-ethyl-trizoles process for their preparation and their use as fungicides | |
| GB1399235A (en) | N-sulphenylated n-methylcarbamidoximes process for their preparation and their use as insecticides acaricides or fungicides | |
| US2695290A (en) | Derivatives of indole and method for the production thereof | |
| GB1320031A (en) | Process for the manufacture of imidazole derivatives | |
| DE3888029D1 (de) | Verfahren zur Herstellung von N-Phosphonomethylglycin. | |
| US4237131A (en) | Prostaglandin analogues | |
| US3867455A (en) | Preparation of phenylaminoethanols | |
| ES2029830T3 (es) | Un procedimiento para preparar un derivado de 6-cetoprostaglandina e1. | |
| US3290332A (en) | 6, 7-dihydroindoles and derivatives thereof | |
| GB1398066A (en) | Quinoline derivatives | |
| GB1589883A (en) | 7-aminocephalosporin derivatives | |
| US3748326A (en) | 5-hydroxy-1-((5-nitrofurfurylidene)-amino)hydantoin | |
| US1866956A (en) | Phenyl-indol-sulphonic acids | |
| SU466683A3 (ru) | Способ получени производных 5-аминометил-(оксазино-(5,6,-е)индолов) | |
| US2573607A (en) | Hydroxyalkyl fluorenyl amines | |
| SU117044A1 (ru) | Способ получени 1-фенил-2, 3 диметил-4-диметиламинопиразолона-5 (пирамидона) | |
| CA1067497A (en) | 5-PHENYL-1,2,3,4,-TETRAHYDRO-.gamma.-CARBOLINES |