FI52570C - Menetelmä veren kolesteroli- tai lipoidipitoisuutta alentavien fenoxia lifaattisten karboksyylihappoyhdisteiden ja -esteriyhdisteiden valmist amiseksi. - Google Patents
Menetelmä veren kolesteroli- tai lipoidipitoisuutta alentavien fenoxia lifaattisten karboksyylihappoyhdisteiden ja -esteriyhdisteiden valmist amiseksi.Info
- Publication number
- FI52570C FI52570C FI700963A FI96370A FI52570C FI 52570 C FI52570 C FI 52570C FI 700963 A FI700963 A FI 700963A FI 96370 A FI96370 A FI 96370A FI 52570 C FI52570 C FI 52570C
- Authority
- FI
- Finland
- Prior art keywords
- cholesterol
- blood
- producing
- carboxylic acid
- compounds
- Prior art date
Links
- -1 carboxylic acid compounds Chemical class 0.000 title 2
- HVYWMOMLDIMFJA-DPAQBDIFSA-N cholesterol Chemical compound C1C=C2C[C@@H](O)CC[C@]2(C)[C@@H]2[C@@H]1[C@@H]1CC[C@H]([C@H](C)CCCC(C)C)[C@@]1(C)CC2 HVYWMOMLDIMFJA-DPAQBDIFSA-N 0.000 title 2
- 239000008280 blood Substances 0.000 title 1
- 210000004369 blood Anatomy 0.000 title 1
- 235000012000 cholesterol Nutrition 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/72—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings and other rings
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/347—Preparation of carboxylic acids or their salts, halides or anhydrides by reactions not involving formation of carboxyl groups
- C07C51/367—Preparation of carboxylic acids or their salts, halides or anhydrides by reactions not involving formation of carboxyl groups by introduction of functional groups containing oxygen only in singly bound form
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C51/00—Preparation of carboxylic acids or their salts, halides or anhydrides
- C07C51/41—Preparation of salts of carboxylic acids
- C07C51/412—Preparation of salts of carboxylic acids by conversion of the acids, their salts, esters or anhydrides with the same carboxylic acid part
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C59/00—Compounds having carboxyl groups bound to acyclic carbon atoms and containing any of the groups OH, O—metal, —CHO, keto, ether, groups, groups, or groups
- C07C59/40—Unsaturated compounds
- C07C59/58—Unsaturated compounds containing ether groups, groups, groups, or groups
- C07C59/64—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings
- C07C59/66—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings
- C07C59/68—Unsaturated compounds containing ether groups, groups, groups, or groups containing six-membered aromatic rings the non-carboxylic part of the ether containing six-membered aromatic rings the oxygen atom of the ether group being bound to a non-condensed six-membered aromatic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (10)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP2990569A JPS5010298B1 (enExample) | 1969-04-16 | 1969-04-16 | |
| JP2990769A JPS5010299B1 (enExample) | 1969-04-16 | 1969-04-16 | |
| JP3416769 | 1969-05-02 | ||
| JP3416669 | 1969-05-02 | ||
| JP8004269A JPS5010308B1 (enExample) | 1969-10-03 | 1969-10-03 | |
| JP8004169 | 1969-10-03 | ||
| JP10280969 | 1969-12-19 | ||
| JP10419469A JPS4939995B1 (enExample) | 1969-12-23 | 1969-12-23 | |
| US2641270A | 1970-04-07 | 1970-04-07 | |
| US00206966A US3821404A (en) | 1969-04-16 | 1971-12-10 | Phenoxy carboxylic acid derivatives as anti-atherosclerosis agents |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| FI52570B FI52570B (enExample) | 1977-06-30 |
| FI52570C true FI52570C (fi) | 1977-10-10 |
Family
ID=27579824
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI700963A FI52570C (fi) | 1969-04-16 | 1970-04-07 | Menetelmä veren kolesteroli- tai lipoidipitoisuutta alentavien fenoxia lifaattisten karboksyylihappoyhdisteiden ja -esteriyhdisteiden valmist amiseksi. |
Country Status (9)
| Country | Link |
|---|---|
| US (2) | US3716583A (enExample) |
| AT (2) | AT302278B (enExample) |
| BE (1) | BE748970A (enExample) |
| CA (1) | CA964273A (enExample) |
| CH (2) | CH539012A (enExample) |
| DK (1) | DK128731B (enExample) |
| FI (1) | FI52570C (enExample) |
| FR (1) | FR2042333B1 (enExample) |
| NL (1) | NL139016B (enExample) |
Families Citing this family (43)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4092324A (en) * | 1971-05-22 | 1978-05-30 | Sumitomo Chemical Company, Limited | Diheterocyclic esters of 4-(1,1-bis-(phenoxy-propionic or -butoyric acid)-cyclohexane)α-methyl substituted |
| US4008265A (en) * | 1971-05-22 | 1977-02-15 | Sumitomo Chemical Company, Limited | Novel bisphenoxy carboxylic acid derivatives and their salts |
| JPS575214B2 (enExample) * | 1972-06-01 | 1982-01-29 | ||
| JPS4931651A (enExample) * | 1972-07-20 | 1974-03-22 | ||
| JPS5735171B2 (enExample) * | 1973-07-02 | 1982-07-27 | ||
| CH617417A5 (enExample) * | 1973-12-27 | 1980-05-30 | Siegfried Ag | |
| AT353776B (de) * | 1973-12-27 | 1979-12-10 | Siegfried Ag | Verfahren zur herstellung von neuen alkan- saeuren, deren estern und salzen |
| FR2428629A1 (fr) * | 1978-06-14 | 1980-01-11 | Hexachimie | Nouveaux composes bis(aryloxycarboxyliques), leur preparation et leur utilisation en therapeutique |
| EP0363760A1 (de) * | 1988-10-12 | 1990-04-18 | Bayer Ag | Aromatische Ether |
| US5179097A (en) * | 1991-06-10 | 1993-01-12 | Angres Isaac A | Salts of non-steroidal anti-inflammatory carboxylic acids and anti-lipidemic carboxylic acids |
| US6083497A (en) | 1997-11-05 | 2000-07-04 | Geltex Pharmaceuticals, Inc. | Method for treating hypercholesterolemia with unsubstituted polydiallylamine polymers |
| US6982251B2 (en) * | 2000-12-20 | 2006-01-03 | Schering Corporation | Substituted 2-azetidinones useful as hypocholesterolemic agents |
| EP1911462A3 (en) | 2001-01-26 | 2011-11-30 | Schering Corporation | Compositions comprising a sterol absorption inhibitor |
| KR20070120617A (ko) * | 2001-01-26 | 2007-12-24 | 쉐링 코포레이션 | 치환된 아제티딘온 화합물을 포함하는 약제학적 조성물 |
| MXPA03006727A (es) * | 2001-01-26 | 2003-10-24 | Schering Corp | Combinaciones de acido nicotinico y derivados del mismo con inhibidor(es) de la absorcion de los esteroles, y tratamiento para indicaciones vasculares. |
| EP1413331B1 (en) * | 2001-01-26 | 2007-10-03 | Schering Corporation | Combinations of the peroxisome proliferator-activated receptor (PPAR) activator fenofibrate with sterol absorption inhibitor ezetimibe for vascular indications |
| DK1385548T3 (da) * | 2001-01-26 | 2007-09-10 | Schering Corp | Kombinationer af sterolabsorptionsinhibitor(er) med (et eller flere) kardiovaskulære midler til behandling af vaskulære tilstande |
| KR20040025890A (ko) * | 2001-01-26 | 2004-03-26 | 쉐링 코포레이션 | 혈관성 질환을 치료하기 위한 스테롤 흡수 억제제와 혈액조절제의 조합물 |
| US20060287254A1 (en) * | 2001-01-26 | 2006-12-21 | Schering Corporation | Use of substituted azetidinone compounds for the treatment of sitosterolemia |
| US7071181B2 (en) * | 2001-01-26 | 2006-07-04 | Schering Corporation | Methods and therapeutic combinations for the treatment of diabetes using sterol absorption inhibitors |
| EP1785144A3 (en) * | 2001-01-26 | 2007-05-23 | Shering Corporation | Combinations of bile acid sequestrant(s) and sterol absorption inhibitor(s) and treatments for vascular indications |
| ATE345792T1 (de) * | 2001-05-25 | 2006-12-15 | Schering Corp | Verwendung von mit azetidinon substituierten derivaten bei der behandlung der alzheimer- krankheit |
| US7053080B2 (en) * | 2001-09-21 | 2006-05-30 | Schering Corporation | Methods and therapeutic combinations for the treatment of obesity using sterol absorption inhibitors |
| US7056906B2 (en) * | 2001-09-21 | 2006-06-06 | Schering Corporation | Combinations of hormone replacement therapy composition(s) and sterol absorption inhibitor(s) and treatments for vascular conditions in post-menopausal women |
| DE60216300T2 (de) * | 2001-09-21 | 2007-06-28 | Schering Corp. | Behandlung von xanthom mittels azetidinon-derivate als hemmer der sterol absorption |
| NZ531060A (en) * | 2001-09-21 | 2006-06-30 | Schering Corp | Methods for treating or preventing vascular inflammation using sterol absorption inhibitor(s) |
| US20030119808A1 (en) * | 2001-09-21 | 2003-06-26 | Schering Corporation | Methods of treating or preventing cardiovascular conditions while preventing or minimizing muscular degeneration side effects |
| CA2504916A1 (en) * | 2002-11-06 | 2004-05-27 | Schering Corporation | Cholesterol absorptions inhibitors for the treatment of autoimmune disorders |
| CA2517573C (en) * | 2003-03-07 | 2011-12-06 | Schering Corporation | Substituted azetidinone compounds, formulations and uses thereof for the treatment of hypercholesterolemia |
| MXPA05009503A (es) * | 2003-03-07 | 2005-10-18 | Schering Corp | Compuestos de azetidinona sustituidos, formulaciones y usos de los mismos para el tratamiento de hipercolesterolemia. |
| US7459442B2 (en) * | 2003-03-07 | 2008-12-02 | Schering Corporation | Substituted azetidinone compounds, processes for preparing the same, formulations and uses thereof |
| DE602004018617D1 (de) * | 2003-03-07 | 2009-02-05 | Schering Corp | Substituierte azetidinon-derivate, deren pharmazeutische formulierungen und deren verwendung zur behandlung von hypercholesterolemia |
| MXPA05012900A (es) * | 2003-05-30 | 2006-02-22 | Ranbaxy Lab Ltd | Derivados de pirrol sustituidos. |
| JP2007510659A (ja) * | 2003-11-05 | 2007-04-26 | シェーリング コーポレイション | 脂質調節剤および置換アゼチジノンの組み合わせならびに血管状態の処置 |
| US6998397B2 (en) * | 2004-07-23 | 2006-02-14 | Drebsk Comptech, Inc. | Method for decreasing cholesterol level in blood |
| KR101329112B1 (ko) * | 2005-11-08 | 2013-11-14 | 랜박시 래보러터리스 리미티드 | (3r,5r)-7-〔2-(4-플루오로페닐)-5-이소프로필-3-페닐-4-〔(4-히드록시 메틸 페닐 아미노)카르보닐〕-피롤-1-일〕-3,5-디히드록시 헵탄산 헤미 칼슘염의 제조 방법 |
| AR059838A1 (es) * | 2006-03-14 | 2008-04-30 | Ranbaxy Lab Ltd | Formulaciones para dosis estabilizantes de estatina |
| EP2049102A4 (en) * | 2006-07-14 | 2010-12-22 | Ranbaxy Lab Ltd | POLYMORPHIC FORMS OF AN HMG COA REDUCTASE HEATHER AND USE |
| EP2134169A2 (en) | 2007-03-09 | 2009-12-23 | Indigene Pharmaceuticals Inc. | Combination of metformin r-(+) lipoate and antihyperlipidemic agents for the treatment of diabetic hyperglycemia and diabetic complications |
| WO2012027331A1 (en) | 2010-08-27 | 2012-03-01 | Ironwood Pharmaceuticals, Inc. | Compositions and methods for treating or preventing metabolic syndrome and related diseases and disorders |
| CR20170356A (es) | 2015-02-06 | 2018-02-28 | Intercept Pharmaceuticals Inc | Composiciones farmacéuticas para terapia combinada |
| CN104610051A (zh) * | 2015-03-02 | 2015-05-13 | 北京万全德众医药生物技术有限公司 | 一种制备克利贝特杂质的方法 |
| KR20220016146A (ko) | 2019-05-30 | 2022-02-08 | 인터셉트 파마슈티컬즈, 인크. | 담즙정체성 간 질환의 치료에서 사용하기 위한 fxr 효능제 및 피브레이트를 포함하는 제약 조성물 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2444594A (en) * | 1947-08-07 | 1948-07-06 | American Cyanamid Co | Isopropylidene-p-phenoxy-2-ethanol-p-phenoxyacetic acid |
| US2541003A (en) * | 1948-08-17 | 1951-02-06 | American Cyanamid Co | Process for reacting salts of phenols with halo-alkanoic acid compounds |
| GB860303A (en) * | 1958-06-20 | 1961-02-01 | Ici Ltd | Pharmaceutical compositions comprising ª‡-aryloxy-aliphatic carboxylic acids and/or ª |
| US3169144A (en) * | 1960-08-12 | 1965-02-09 | Massarani Elena | Anticholesterinemic and antilipaemic agents |
| GB970969A (en) * | 1963-08-15 | 1964-09-23 | Shell Int Research | Dicarboxylic acids and their esters and a process for the preparation thereof |
| FR1380816A (fr) * | 1963-11-18 | 1964-12-04 | Ciba Geigy | Procédé de préparation de nouveaux acides isobutyriques, entre autres de l'acide alpha-[p-(2-p'-chlorophényl-propyl-[2])-phénoxy]-isobutyrique |
| US3470234A (en) * | 1965-08-23 | 1969-09-30 | Ciba Geigy Corp | Diaryl substituted benzocycloalkanes |
| US3470235A (en) * | 1965-11-05 | 1969-09-30 | Eastman Kodak Co | Alicyclic bisphenyleneoxydicarboxylic acids,salts and esters |
| GB1121722A (en) * | 1966-03-31 | 1968-07-31 | Ici Ltd | New carboxylic acid derivatives |
| US3630715A (en) * | 1968-12-19 | 1971-12-28 | Weston Chemical Corp | Alkylene bis (phenoxyacetic acid) derivatives as herbicides |
| US3755603A (en) * | 1970-07-01 | 1973-08-28 | Syntex Corp | Biphenylyloxyacetic acids in pharmaceutical compositions |
-
1970
- 1970-04-07 FI FI700963A patent/FI52570C/fi active
- 1970-04-07 US US00026412A patent/US3716583A/en not_active Expired - Lifetime
- 1970-04-10 CA CA079,830A patent/CA964273A/en not_active Expired
- 1970-04-15 DK DK189570AA patent/DK128731B/da unknown
- 1970-04-15 AT AT344070A patent/AT302278B/de active
- 1970-04-15 AT AT784271A patent/AT303015B/de not_active IP Right Cessation
- 1970-04-15 FR FR707013609A patent/FR2042333B1/fr not_active Expired
- 1970-04-15 NL NL707005400A patent/NL139016B/xx not_active IP Right Cessation
- 1970-04-15 BE BE748970D patent/BE748970A/xx not_active IP Right Cessation
- 1970-04-16 CH CH567770A patent/CH539012A/de not_active IP Right Cessation
- 1970-04-16 CH CH748073A patent/CH556807A/xx not_active IP Right Cessation
-
1974
- 1974-04-10 US US05/459,861 patent/US3959484A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US3959484A (en) | 1976-05-25 |
| NL7005400A (enExample) | 1970-10-20 |
| FI52570B (enExample) | 1977-06-30 |
| CH556807A (de) | 1974-12-13 |
| AT303015B (de) | 1972-11-10 |
| CA964273A (en) | 1975-03-11 |
| CH539012A (de) | 1973-08-31 |
| US3716583A (en) | 1973-02-13 |
| NL139016B (nl) | 1973-06-15 |
| FR2042333B1 (enExample) | 1973-04-06 |
| AT302278B (de) | 1972-10-10 |
| FR2042333A1 (enExample) | 1971-02-12 |
| BE748970A (fr) | 1970-09-16 |
| DK128731B (da) | 1974-06-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI52570C (fi) | Menetelmä veren kolesteroli- tai lipoidipitoisuutta alentavien fenoxia lifaattisten karboksyylihappoyhdisteiden ja -esteriyhdisteiden valmist amiseksi. | |
| CH547310A (de) | Verfahren zur herstellung von 7(beta)-acylamido-3-methylceph-3-em-4-carbonsaeureestern. | |
| CH549052A (de) | Verfahren zur herstellung von 7 (beta)-acylamido-3-methylceph-3-em-4-carbonsaeureestern. | |
| CH550825A (de) | Verfahren zur herstellung von alkanphosphonsaeurediestern. | |
| CH556329A (de) | Verfahren zur herstellung von cyanacrylsaeureestern. | |
| CH551388A (de) | Verfahren zur herstellung von benzylidenamino-oxyalkylcarbonsaeuren und -carbonsaeurederivaten. | |
| AT296241B (de) | Verfahren zur Herstellung von Carbonsäureallylestern | |
| FI51472C (fi) | Menetelmä hydroksihappoestereiden valmistamiseksi. | |
| NL180506C (nl) | Werkwijze voor de bereiding van carbonzure esters. | |
| CH498873A (de) | Verfahren zur Herstellung von O-Chlor- bzw. O-Bromalkyl-S-benzyl-S'-alkyl-dithiolphosphorsäureestern | |
| AT305261B (de) | Verfahren zur Herstellung von 3,3-Bis-phenylolbuttersäureestern | |
| AT305260B (de) | Verfahren zur Herstellung von 3,3-Bis-phenylolbuttersäureestern | |
| AT293350B (de) | Verfahren zur Herstellung von α-Oxycarbonsäureestern | |
| CH529139A (de) | Verfahren zur Herstellung von Benzimidazol-2-carbaminsäureestern | |
| AT310134B (de) | Verfahren zur Herstellung von Perflouralkylalkan oder -cycloalkan-monocarbonsäureestern | |
| NL175173C (nl) | Werkwijze ter bereiding van alfa-anilinocarbonzure esters en/of nitrillen. | |
| CH538440A (de) | Verfahren zur Herstellung von Carbonsäureestern | |
| AT297025B (de) | Verfahren zur Herstellung von neuen O,O-Dialkyl-S-(1,2,2-trichloräthyl)-thionothiolphosphor- bzw. O-Alkyl-S-(1,2,2-trichloräthyl)-alkanthionothiolphosphonsäureestern | |
| CH538514A (de) | Verfahren zur Herstellung von 2-Chloräthyl-dithiophosphonsäureestern | |
| CH536299A (de) | Verfahren zur Herstellung von 21-Kohlensäureestern von Steroiden | |
| AT319269B (de) | Verfahren zur Herstellung von O,O-Dialky-O-(2,2-dichlorvinyl)-thionophosphorsäureestern | |
| CH555808A (de) | Verfahren zur herstellung von l-alpha-hydrazino-betaphenylalkansaeuren, deren salzen und estern. | |
| CH551451A (de) | Verfahren zur herstellung von 5-arylphenylphosphorigesaeure- und 5-arylphenylunterphosphorigesaeure-verbindungen. | |
| CH513924A (de) | Verfahren zur Herstellung von (+) und (-) (cis-1,2-Epoxypropylphosphonsäure und ihrer entsprechenden Salze und Ester | |
| CH537896A (de) | Verfahren zur Herstellung von Perfluoralkancarbonsäureestern |