FI111255B - Menetelmä terapeuttisesti käyttökelpoisten 3,5-disubstituoitujen indolijohdannaisten valmistamiseksi - Google Patents
Menetelmä terapeuttisesti käyttökelpoisten 3,5-disubstituoitujen indolijohdannaisten valmistamiseksi Download PDFInfo
- Publication number
- FI111255B FI111255B FI944727A FI944727A FI111255B FI 111255 B FI111255 B FI 111255B FI 944727 A FI944727 A FI 944727A FI 944727 A FI944727 A FI 944727A FI 111255 B FI111255 B FI 111255B
- Authority
- FI
- Finland
- Prior art keywords
- formula
- alkylene
- preparation
- aryl
- compound
- Prior art date
Links
- 238000002360 preparation method Methods 0.000 title claims description 69
- -1 3,5-disubstituted indole Chemical class 0.000 title claims description 41
- 238000000034 method Methods 0.000 title claims description 38
- 230000008569 process Effects 0.000 title claims description 17
- 229940054051 antipsychotic indole derivative Drugs 0.000 title claims description 5
- 150000001875 compounds Chemical class 0.000 claims abstract description 116
- 125000002947 alkylene group Chemical group 0.000 claims abstract description 59
- 125000003118 aryl group Chemical group 0.000 claims abstract description 28
- 150000003839 salts Chemical class 0.000 claims abstract description 18
- 238000011282 treatment Methods 0.000 claims abstract description 9
- 125000003342 alkenyl group Chemical group 0.000 claims abstract description 5
- 125000000392 cycloalkenyl group Chemical group 0.000 claims abstract description 4
- 239000000460 chlorine Chemical group 0.000 claims description 76
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 claims description 42
- 229910052739 hydrogen Inorganic materials 0.000 claims description 29
- 238000006243 chemical reaction Methods 0.000 claims description 23
- 125000006272 (C3-C7) cycloalkyl group Chemical group 0.000 claims description 21
- 125000000217 alkyl group Chemical group 0.000 claims description 21
- 229910052736 halogen Inorganic materials 0.000 claims description 14
- 239000002243 precursor Substances 0.000 claims description 13
- 150000002367 halogens Chemical class 0.000 claims description 12
- 125000001424 substituent group Chemical group 0.000 claims description 12
- 229910052799 carbon Inorganic materials 0.000 claims description 11
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical group [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 claims description 10
- 150000001732 carboxylic acid derivatives Chemical class 0.000 claims description 10
- 125000001072 heteroaryl group Chemical group 0.000 claims description 9
- 150000002576 ketones Chemical class 0.000 claims description 9
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 8
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 claims description 7
- 150000001299 aldehydes Chemical class 0.000 claims description 7
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 7
- 229910052794 bromium Inorganic materials 0.000 claims description 7
- 229910052801 chlorine Inorganic materials 0.000 claims description 6
- 239000003638 chemical reducing agent Substances 0.000 claims description 5
- 229910000029 sodium carbonate Inorganic materials 0.000 claims description 5
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical group C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 claims description 4
- 150000002924 oxiranes Chemical class 0.000 claims description 4
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 claims description 4
- 125000004076 pyridyl group Chemical group 0.000 claims description 4
- 239000012279 sodium borohydride Substances 0.000 claims description 4
- 229910000033 sodium borohydride Inorganic materials 0.000 claims description 4
- 235000017550 sodium carbonate Nutrition 0.000 claims description 4
- 150000003512 tertiary amines Chemical class 0.000 claims description 4
- KMTRUDSVKNLOMY-UHFFFAOYSA-N Ethylene carbonate Chemical compound O=C1OCCO1 KMTRUDSVKNLOMY-UHFFFAOYSA-N 0.000 claims description 3
- 238000007126 N-alkylation reaction Methods 0.000 claims description 3
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 125000002541 furyl group Chemical group 0.000 claims description 3
- 125000002971 oxazolyl group Chemical group 0.000 claims description 3
- 125000003373 pyrazinyl group Chemical group 0.000 claims description 3
- 125000000714 pyrimidinyl group Chemical group 0.000 claims description 3
- 125000000168 pyrrolyl group Chemical group 0.000 claims description 3
- 125000000335 thiazolyl group Chemical group 0.000 claims description 3
- 125000001544 thienyl group Chemical group 0.000 claims description 3
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 2
- 125000001153 fluoro group Chemical group F* 0.000 claims description 2
- 125000000623 heterocyclic group Chemical group 0.000 claims description 2
- 235000015497 potassium bicarbonate Nutrition 0.000 claims description 2
- 229910000027 potassium carbonate Inorganic materials 0.000 claims description 2
- 235000011181 potassium carbonates Nutrition 0.000 claims description 2
- BEOOHQFXGBMRKU-UHFFFAOYSA-N sodium cyanoborohydride Chemical group [Na+].[B-]C#N BEOOHQFXGBMRKU-UHFFFAOYSA-N 0.000 claims description 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 claims 2
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims 1
- UIIMBOGNXHQVGW-DEQYMQKBSA-M Sodium bicarbonate-14C Chemical compound [Na+].O[14C]([O-])=O UIIMBOGNXHQVGW-DEQYMQKBSA-M 0.000 claims 1
- 229910000028 potassium bicarbonate Inorganic materials 0.000 claims 1
- 239000011736 potassium bicarbonate Substances 0.000 claims 1
- TYJJADVDDVDEDZ-UHFFFAOYSA-M potassium hydrogencarbonate Chemical compound [K+].OC([O-])=O TYJJADVDDVDEDZ-UHFFFAOYSA-M 0.000 claims 1
- FJWLWIRHZOHPIY-UHFFFAOYSA-N potassium;hydroiodide Chemical compound [K].I FJWLWIRHZOHPIY-UHFFFAOYSA-N 0.000 claims 1
- ZIQRIAYNHAKDDU-UHFFFAOYSA-N sodium;hydroiodide Chemical compound [Na].I ZIQRIAYNHAKDDU-UHFFFAOYSA-N 0.000 claims 1
- 102220315634 rs1196125127 Human genes 0.000 abstract description 6
- 206010019233 Headaches Diseases 0.000 abstract description 5
- 231100000869 headache Toxicity 0.000 abstract description 4
- 208000019695 Migraine disease Diseases 0.000 abstract description 3
- 125000000304 alkynyl group Chemical group 0.000 abstract description 3
- 206010027599 migraine Diseases 0.000 abstract description 3
- 208000019553 vascular disease Diseases 0.000 abstract description 3
- 239000000018 receptor agonist Substances 0.000 abstract description 2
- 229940044601 receptor agonist Drugs 0.000 abstract description 2
- 206010009094 Chronic paroxysmal hemicrania Diseases 0.000 abstract 1
- 208000006561 Cluster Headache Diseases 0.000 abstract 1
- 208000018912 cluster headache syndrome Diseases 0.000 abstract 1
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 1
- 125000001475 halogen functional group Chemical group 0.000 abstract 1
- 208000007777 paroxysmal Hemicrania Diseases 0.000 abstract 1
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 99
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 48
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 45
- 101000713575 Homo sapiens Tubulin beta-3 chain Proteins 0.000 description 43
- 102100036790 Tubulin beta-3 chain Human genes 0.000 description 43
- 239000006260 foam Substances 0.000 description 38
- 239000000243 solution Substances 0.000 description 31
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 30
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 27
- 239000002904 solvent Substances 0.000 description 24
- 230000002829 reductive effect Effects 0.000 description 20
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 18
- 239000000203 mixture Substances 0.000 description 18
- 239000000741 silica gel Substances 0.000 description 17
- 229910002027 silica gel Inorganic materials 0.000 description 17
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 16
- 238000004440 column chromatography Methods 0.000 description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 16
- 229910001868 water Inorganic materials 0.000 description 16
- 239000002253 acid Substances 0.000 description 13
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 12
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 12
- 239000002585 base Substances 0.000 description 12
- QZAYGJVTTNCVMB-UHFFFAOYSA-N serotonin Chemical compound C1=C(O)C=C2C(CCN)=CNC2=C1 QZAYGJVTTNCVMB-UHFFFAOYSA-N 0.000 description 12
- 239000011734 sodium Substances 0.000 description 12
- CYRMSUTZVYGINF-UHFFFAOYSA-N trichlorofluoromethane Chemical compound FC(Cl)(Cl)Cl CYRMSUTZVYGINF-UHFFFAOYSA-N 0.000 description 12
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 11
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- 150000001412 amines Chemical class 0.000 description 9
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 8
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 8
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 8
- 239000003153 chemical reaction reagent Substances 0.000 description 8
- 239000003921 oil Substances 0.000 description 8
- FVAUCKIRQBBSSJ-UHFFFAOYSA-M sodium iodide Chemical compound [Na+].[I-] FVAUCKIRQBBSSJ-UHFFFAOYSA-M 0.000 description 8
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 8
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 7
- 238000010511 deprotection reaction Methods 0.000 description 7
- 239000012299 nitrogen atmosphere Substances 0.000 description 7
- 239000012074 organic phase Substances 0.000 description 7
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- DTQVDTLACAAQTR-UHFFFAOYSA-N Trifluoroacetic acid Chemical compound OC(=O)C(F)(F)F DTQVDTLACAAQTR-UHFFFAOYSA-N 0.000 description 6
- PXBRQCKWGAHEHS-UHFFFAOYSA-N dichlorodifluoromethane Chemical compound FC(F)(Cl)Cl PXBRQCKWGAHEHS-UHFFFAOYSA-N 0.000 description 6
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 6
- 238000001704 evaporation Methods 0.000 description 6
- 230000008020 evaporation Effects 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- NLKNQRATVPKPDG-UHFFFAOYSA-M potassium iodide Chemical compound [K+].[I-] NLKNQRATVPKPDG-UHFFFAOYSA-M 0.000 description 6
- 238000000746 purification Methods 0.000 description 6
- QCQCHGYLTSGIGX-GHXANHINSA-N 4-[[(3ar,5ar,5br,7ar,9s,11ar,11br,13as)-5a,5b,8,8,11a-pentamethyl-3a-[(5-methylpyridine-3-carbonyl)amino]-2-oxo-1-propan-2-yl-4,5,6,7,7a,9,10,11,11b,12,13,13a-dodecahydro-3h-cyclopenta[a]chrysen-9-yl]oxy]-2,2-dimethyl-4-oxobutanoic acid Chemical compound N([C@@]12CC[C@@]3(C)[C@]4(C)CC[C@H]5C(C)(C)[C@@H](OC(=O)CC(C)(C)C(O)=O)CC[C@]5(C)[C@H]4CC[C@@H]3C1=C(C(C2)=O)C(C)C)C(=O)C1=CN=CC(C)=C1 QCQCHGYLTSGIGX-GHXANHINSA-N 0.000 description 5
- XTHFKEDIFFGKHM-UHFFFAOYSA-N Dimethoxyethane Chemical compound COCCOC XTHFKEDIFFGKHM-UHFFFAOYSA-N 0.000 description 5
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 5
- 239000000443 aerosol Substances 0.000 description 5
- 239000000556 agonist Substances 0.000 description 5
- 230000003197 catalytic effect Effects 0.000 description 5
- 230000000694 effects Effects 0.000 description 5
- 239000012458 free base Substances 0.000 description 5
- 239000000543 intermediate Substances 0.000 description 5
- 108020003175 receptors Proteins 0.000 description 5
- 102000005962 receptors Human genes 0.000 description 5
- 238000003756 stirring Methods 0.000 description 5
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 4
- KZMGYPLQYOPHEL-UHFFFAOYSA-N Boron trifluoride etherate Chemical compound FB(F)F.CCOCC KZMGYPLQYOPHEL-UHFFFAOYSA-N 0.000 description 4
- 241000282472 Canis lupus familiaris Species 0.000 description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-N Hydrogen bromide Chemical compound Br CPELXLSAUQHCOX-UHFFFAOYSA-N 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 4
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 150000001336 alkenes Chemical class 0.000 description 4
- 150000001408 amides Chemical class 0.000 description 4
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 4
- 239000012043 crude product Substances 0.000 description 4
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 4
- 238000005984 hydrogenation reaction Methods 0.000 description 4
- 239000011630 iodine Chemical group 0.000 description 4
- 229910052740 iodine Chemical group 0.000 description 4
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- CTSLXHKWHWQRSH-UHFFFAOYSA-N oxalyl chloride Chemical compound ClC(=O)C(Cl)=O CTSLXHKWHWQRSH-UHFFFAOYSA-N 0.000 description 4
- 230000009467 reduction Effects 0.000 description 4
- 238000006722 reduction reaction Methods 0.000 description 4
- 238000010992 reflux Methods 0.000 description 4
- 239000000758 substrate Substances 0.000 description 4
- 239000003826 tablet Substances 0.000 description 4
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 4
- JXGVXCZADZNAMJ-LLVKDONJSA-N (2r)-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid Chemical compound OC(=O)[C@H]1CCCN1C(=O)OCC1=CC=CC=C1 JXGVXCZADZNAMJ-LLVKDONJSA-N 0.000 description 3
- DCJLLXQAOAAWJD-OAHLLOKOSA-N 5-(2-ethylsulfonylethyl)-3-[[(2r)-pyrrolidin-2-yl]methyl]-1h-indole Chemical compound C12=CC(CCS(=O)(=O)CC)=CC=C2NC=C1C[C@H]1CCCN1 DCJLLXQAOAAWJD-OAHLLOKOSA-N 0.000 description 3
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 description 3
- 206010010904 Convulsion Diseases 0.000 description 3
- 101000713585 Homo sapiens Tubulin beta-4A chain Proteins 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 3
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical group C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 102100036788 Tubulin beta-4A chain Human genes 0.000 description 3
- 150000001266 acyl halides Chemical class 0.000 description 3
- 239000002168 alkylating agent Substances 0.000 description 3
- 229940100198 alkylating agent Drugs 0.000 description 3
- 239000012267 brine Substances 0.000 description 3
- 239000002775 capsule Substances 0.000 description 3
- 125000001589 carboacyl group Chemical group 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- 210000001168 carotid artery common Anatomy 0.000 description 3
- 239000003054 catalyst Substances 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000005859 coupling reaction Methods 0.000 description 3
- 239000006071 cream Substances 0.000 description 3
- 150000002148 esters Chemical class 0.000 description 3
- 239000000284 extract Substances 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 125000000524 functional group Chemical group 0.000 description 3
- 238000000338 in vitro Methods 0.000 description 3
- 238000011065 in-situ storage Methods 0.000 description 3
- 239000012948 isocyanate Substances 0.000 description 3
- 150000002513 isocyanates Chemical class 0.000 description 3
- 239000007800 oxidant agent Substances 0.000 description 3
- 229910052763 palladium Inorganic materials 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 125000006239 protecting group Chemical group 0.000 description 3
- 238000005932 reductive alkylation reaction Methods 0.000 description 3
- 235000009518 sodium iodide Nutrition 0.000 description 3
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- ASOKPJOREAFHNY-UHFFFAOYSA-N 1-Hydroxybenzotriazole Chemical compound C1=CC=C2N(O)N=NC2=C1 ASOKPJOREAFHNY-UHFFFAOYSA-N 0.000 description 2
- LOYZVRIHVZEDMW-UHFFFAOYSA-N 1-bromo-3-methylbut-2-ene Chemical compound CC(C)=CCBr LOYZVRIHVZEDMW-UHFFFAOYSA-N 0.000 description 2
- BJEWLOAZFAGNPE-UHFFFAOYSA-N 1-ethenylsulfonylethane Chemical compound CCS(=O)(=O)C=C BJEWLOAZFAGNPE-UHFFFAOYSA-N 0.000 description 2
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 2
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 2
- 125000003341 7 membered heterocyclic group Chemical group 0.000 description 2
- 208000019901 Anxiety disease Diseases 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 241000282465 Canis Species 0.000 description 2
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 2
- 208000020401 Depressive disease Diseases 0.000 description 2
- 206010013654 Drug abuse Diseases 0.000 description 2
- 208000030814 Eating disease Diseases 0.000 description 2
- 208000019454 Feeding and Eating disease Diseases 0.000 description 2
- 238000007341 Heck reaction Methods 0.000 description 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- SIKJAQJRHWYJAI-UHFFFAOYSA-N Indole Chemical compound C1=CC=C2NC=CC2=C1 SIKJAQJRHWYJAI-UHFFFAOYSA-N 0.000 description 2
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 2
- 239000012448 Lithium borohydride Substances 0.000 description 2
- 101710089759 Melanin-concentrating hormone receptor 2 Proteins 0.000 description 2
- 102100027373 Melanin-concentrating hormone receptor 2 Human genes 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- 208000008589 Obesity Diseases 0.000 description 2
- 102100026459 POU domain, class 3, transcription factor 2 Human genes 0.000 description 2
- 229920002472 Starch Polymers 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 230000010933 acylation Effects 0.000 description 2
- 238000005917 acylation reaction Methods 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- VZTDIZULWFCMLS-UHFFFAOYSA-N ammonium formate Chemical compound [NH4+].[O-]C=O VZTDIZULWFCMLS-UHFFFAOYSA-N 0.000 description 2
- 230000036506 anxiety Effects 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 230000017531 blood circulation Effects 0.000 description 2
- WTEOIRVLGSZEPR-UHFFFAOYSA-N boron trifluoride Chemical compound FB(F)F WTEOIRVLGSZEPR-UHFFFAOYSA-N 0.000 description 2
- 125000001246 bromo group Chemical group Br* 0.000 description 2
- AEILLAXRDHDKDY-UHFFFAOYSA-N bromomethylcyclopropane Chemical compound BrCC1CC1 AEILLAXRDHDKDY-UHFFFAOYSA-N 0.000 description 2
- FUSUHKVFWTUUBE-UHFFFAOYSA-N buten-2-one Chemical compound CC(=O)C=C FUSUHKVFWTUUBE-UHFFFAOYSA-N 0.000 description 2
- FZFAMSAMCHXGEF-UHFFFAOYSA-N chloro formate Chemical compound ClOC=O FZFAMSAMCHXGEF-UHFFFAOYSA-N 0.000 description 2
- 230000001684 chronic effect Effects 0.000 description 2
- 125000000490 cinnamyl group Chemical group C(C=CC1=CC=CC=C1)* 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000010168 coupling process Methods 0.000 description 2
- 125000000596 cyclohexenyl group Chemical group C1(=CCCCC1)* 0.000 description 2
- JBDSSBMEKXHSJF-UHFFFAOYSA-N cyclopentanecarboxylic acid Chemical compound OC(=O)C1CCCC1 JBDSSBMEKXHSJF-UHFFFAOYSA-N 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 235000014632 disordered eating Nutrition 0.000 description 2
- JOXWSDNHLSQKCC-UHFFFAOYSA-N ethenesulfonamide Chemical compound NS(=O)(=O)C=C JOXWSDNHLSQKCC-UHFFFAOYSA-N 0.000 description 2
- 238000001914 filtration Methods 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000012362 glacial acetic acid Substances 0.000 description 2
- 150000004820 halides Chemical class 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910000042 hydrogen bromide Inorganic materials 0.000 description 2
- 230000007062 hydrolysis Effects 0.000 description 2
- 238000006460 hydrolysis reaction Methods 0.000 description 2
- 125000002346 iodo group Chemical group I* 0.000 description 2
- PCEBAZIVZVIQEO-UHFFFAOYSA-N iodocyclopentane Chemical compound IC1CCCC1 PCEBAZIVZVIQEO-UHFFFAOYSA-N 0.000 description 2
- 239000008101 lactose Substances 0.000 description 2
- 239000006210 lotion Substances 0.000 description 2
- 239000011777 magnesium Substances 0.000 description 2
- FRIJBUGBVQZNTB-UHFFFAOYSA-M magnesium;ethane;bromide Chemical compound [Mg+2].[Br-].[CH2-]C FRIJBUGBVQZNTB-UHFFFAOYSA-M 0.000 description 2
- 229940088644 n,n-dimethylacrylamide Drugs 0.000 description 2
- YLGYACDQVQQZSW-UHFFFAOYSA-N n,n-dimethylprop-2-enamide Chemical compound CN(C)C(=O)C=C YLGYACDQVQQZSW-UHFFFAOYSA-N 0.000 description 2
- 239000006199 nebulizer Substances 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- 235000020824 obesity Nutrition 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- LXNAVEXFUKBNMK-UHFFFAOYSA-N palladium(II) acetate Substances [Pd].CC(O)=O.CC(O)=O LXNAVEXFUKBNMK-UHFFFAOYSA-N 0.000 description 2
- YJVFFLUZDVXJQI-UHFFFAOYSA-L palladium(ii) acetate Chemical compound [Pd+2].CC([O-])=O.CC([O-])=O YJVFFLUZDVXJQI-UHFFFAOYSA-L 0.000 description 2
- 239000012188 paraffin wax Substances 0.000 description 2
- 239000000546 pharmaceutical excipient Substances 0.000 description 2
- 125000001844 prenyl group Chemical group [H]C([*])([H])C([H])=C(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000002287 radioligand Substances 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 239000007921 spray Substances 0.000 description 2
- 238000010561 standard procedure Methods 0.000 description 2
- 239000008107 starch Substances 0.000 description 2
- 235000019698 starch Nutrition 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 239000000126 substance Substances 0.000 description 2
- 208000011117 substance-related disease Diseases 0.000 description 2
- 229910052717 sulfur Inorganic materials 0.000 description 2
- KQKPFRSPSRPDEB-UHFFFAOYSA-N sumatriptan Chemical compound CNS(=O)(=O)CC1=CC=C2NC=C(CCN(C)C)C2=C1 KQKPFRSPSRPDEB-UHFFFAOYSA-N 0.000 description 2
- 229960003708 sumatriptan Drugs 0.000 description 2
- 108010072897 transcription factor Brn-2 Proteins 0.000 description 2
- 238000009901 transfer hydrogenation reaction Methods 0.000 description 2
- 229910052723 transition metal Inorganic materials 0.000 description 2
- 150000003624 transition metals Chemical class 0.000 description 2
- AQRLNPVMDITEJU-UHFFFAOYSA-N triethylsilane Chemical compound CC[SiH](CC)CC AQRLNPVMDITEJU-UHFFFAOYSA-N 0.000 description 2
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- COIOYMYWGDAQPM-UHFFFAOYSA-N tris(2-methylphenyl)phosphane Chemical compound CC1=CC=CC=C1P(C=1C(=CC=CC=1)C)C1=CC=CC=C1C COIOYMYWGDAQPM-UHFFFAOYSA-N 0.000 description 2
- 229910052727 yttrium Inorganic materials 0.000 description 2
- UTTCRKBLRZASMH-CRAIPNDOSA-N (2r)-1-[(2r)-2-[[5-(2-ethylsulfonylethyl)-1h-indol-3-yl]methyl]pyrrolidin-1-yl]propan-2-ol Chemical compound C12=CC(CCS(=O)(=O)CC)=CC=C2NC=C1C[C@H]1CCCN1C[C@@H](C)O UTTCRKBLRZASMH-CRAIPNDOSA-N 0.000 description 1
- MWHBWGATGGOJFP-RHSMWYFYSA-N (2r)-2-[(2r)-2-[[5-(2-ethylsulfonylethyl)-1h-indol-3-yl]methyl]pyrrolidin-1-yl]propanamide Chemical compound C12=CC(CCS(=O)(=O)CC)=CC=C2NC=C1C[C@H]1CCCN1[C@H](C)C(N)=O MWHBWGATGGOJFP-RHSMWYFYSA-N 0.000 description 1
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 description 1
- 125000006704 (C5-C6) cycloalkyl group Chemical group 0.000 description 1
- NWUYHJFMYQTDRP-UHFFFAOYSA-N 1,2-bis(ethenyl)benzene;1-ethenyl-2-ethylbenzene;styrene Chemical compound C=CC1=CC=CC=C1.CCC1=CC=CC=C1C=C.C=CC1=CC=CC=C1C=C NWUYHJFMYQTDRP-UHFFFAOYSA-N 0.000 description 1
- DDMOUSALMHHKOS-UHFFFAOYSA-N 1,2-dichloro-1,1,2,2-tetrafluoroethane Chemical compound FC(F)(Cl)C(F)(F)Cl DDMOUSALMHHKOS-UHFFFAOYSA-N 0.000 description 1
- XAKWPDYJLGZSFZ-UHFFFAOYSA-N 1-(2-ethylsulfonylethyl)indole Chemical compound C1=CC=C2N(CCS(=O)(=O)CC)C=CC2=C1 XAKWPDYJLGZSFZ-UHFFFAOYSA-N 0.000 description 1
- NZVKCGBZCUDJHL-GOSISDBHSA-N 1-[(2r)-2-[[5-(2-ethylsulfonylethyl)-1h-indol-3-yl]methyl]pyrrolidin-1-yl]propan-2-one Chemical compound C12=CC(CCS(=O)(=O)CC)=CC=C2NC=C1C[C@H]1CCCN1CC(C)=O NZVKCGBZCUDJHL-GOSISDBHSA-N 0.000 description 1
- CEVMYGZHEJSOHZ-UHFFFAOYSA-N 1-bromo-3-methoxypropane Chemical compound COCCCBr CEVMYGZHEJSOHZ-UHFFFAOYSA-N 0.000 description 1
- MPPPKRYCTPRNTB-UHFFFAOYSA-N 1-bromobutane Chemical compound CCCCBr MPPPKRYCTPRNTB-UHFFFAOYSA-N 0.000 description 1
- LMDZBCPBFSXMTL-UHFFFAOYSA-N 1-ethyl-3-(3-dimethylaminopropyl)carbodiimide Chemical compound CCN=C=NCCCN(C)C LMDZBCPBFSXMTL-UHFFFAOYSA-N 0.000 description 1
- WUIJTQZXUURFQU-UHFFFAOYSA-N 1-methylsulfonylethene Chemical compound CS(=O)(=O)C=C WUIJTQZXUURFQU-UHFFFAOYSA-N 0.000 description 1
- JPMRGPPMXHGKRO-UHFFFAOYSA-N 2-(chloromethyl)pyridine hydrochloride Chemical compound Cl.ClCC1=CC=CC=N1 JPMRGPPMXHGKRO-UHFFFAOYSA-N 0.000 description 1
- CNBUJYAZRVQFAT-MRXNPFEDSA-N 2-[(2r)-2-[[5-(2-ethylsulfonylethyl)-1h-indol-3-yl]methyl]pyrrolidin-1-yl]acetamide Chemical compound C12=CC(CCS(=O)(=O)CC)=CC=C2NC=C1C[C@H]1CCCN1CC(N)=O CNBUJYAZRVQFAT-MRXNPFEDSA-N 0.000 description 1
- BGMYBYQEGSZTDY-QGZVFWFLSA-N 2-[(2r)-2-[[5-(2-ethylsulfonylethyl)-1h-indol-3-yl]methyl]pyrrolidin-1-yl]ethanesulfonamide Chemical compound C12=CC(CCS(=O)(=O)CC)=CC=C2NC=C1C[C@H]1CCCN1CCS(N)(=O)=O BGMYBYQEGSZTDY-QGZVFWFLSA-N 0.000 description 1
- FSAZCZBQNLXZNQ-QGZVFWFLSA-N 2-[(2r)-2-[[5-(2-ethylsulfonylethyl)-1h-indol-3-yl]methyl]pyrrolidin-1-yl]ethanol Chemical compound C12=CC(CCS(=O)(=O)CC)=CC=C2NC=C1C[C@H]1CCCN1CCO FSAZCZBQNLXZNQ-QGZVFWFLSA-N 0.000 description 1
- JUIKUQOUMZUFQT-UHFFFAOYSA-N 2-bromoacetamide Chemical compound NC(=O)CBr JUIKUQOUMZUFQT-UHFFFAOYSA-N 0.000 description 1
- AUHYZQCEIVEMFH-UHFFFAOYSA-N 2-bromopropanamide Chemical compound CC(Br)C(N)=O AUHYZQCEIVEMFH-UHFFFAOYSA-N 0.000 description 1
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- KVTHPKXDLVYNCH-UHFFFAOYSA-N 2-iodoethylbenzene Chemical compound ICCC1=CC=CC=C1 KVTHPKXDLVYNCH-UHFFFAOYSA-N 0.000 description 1
- 125000004105 2-pyridyl group Chemical group N1=C([*])C([H])=C([H])C([H])=C1[H] 0.000 description 1
- PVSAZDBTVUYERO-LJQANCHMSA-N 3-[(2r)-2-[[5-(2-ethylsulfonylethyl)-1h-indol-3-yl]methyl]pyrrolidin-1-yl]-n,n-dimethylpropanamide Chemical compound C12=CC(CCS(=O)(=O)CC)=CC=C2NC=C1C[C@H]1CCCN1CCC(=O)N(C)C PVSAZDBTVUYERO-LJQANCHMSA-N 0.000 description 1
- AKLSOHSMUPDBPR-GOSISDBHSA-N 3-[(2r)-2-[[5-(2-ethylsulfonylethyl)-1h-indol-3-yl]methyl]pyrrolidin-1-yl]-n-methylpropanamide Chemical compound C12=CC(CCS(=O)(=O)CC)=CC=C2NC=C1C[C@H]1CCCN1CCC(=O)NC AKLSOHSMUPDBPR-GOSISDBHSA-N 0.000 description 1
- VNAUFJAGDDISEB-OAQYLSRUSA-N 3-[[(2r)-1-(cyclopentylmethyl)pyrrolidin-2-yl]methyl]-5-(2-ethylsulfonylethyl)-1h-indole Chemical compound C([C@@H]1CC2=CNC3=CC=C(C=C32)CCS(=O)(=O)CC)CCN1CC1CCCC1 VNAUFJAGDDISEB-OAQYLSRUSA-N 0.000 description 1
- BHIMZGLDHUWKQK-LJQANCHMSA-N 3-[[(2r)-1-(cyclopropylmethyl)pyrrolidin-2-yl]methyl]-5-(2-ethylsulfonylethyl)-1h-indole Chemical compound C([C@@H]1CC2=CNC3=CC=C(C=C32)CCS(=O)(=O)CC)CCN1CC1CC1 BHIMZGLDHUWKQK-LJQANCHMSA-N 0.000 description 1
- MGENTIQEGXBYEE-BPGUCPLFSA-N 3-[[(2r)-1-cyclohex-3-en-1-ylpyrrolidin-2-yl]methyl]-5-(2-ethylsulfonylethyl)-1h-indole Chemical compound C([C@@H]1CC2=CNC3=CC=C(C=C32)CCS(=O)(=O)CC)CCN1C1CCC=CC1 MGENTIQEGXBYEE-BPGUCPLFSA-N 0.000 description 1
- MVJOSHBBQCIWPL-HXUWFJFHSA-N 3-[[(2r)-1-cyclopentylpyrrolidin-2-yl]methyl]-5-(2-ethylsulfonylethyl)-1h-indole Chemical compound C([C@@H]1CC2=CNC3=CC=C(C=C32)CCS(=O)(=O)CC)CCN1C1CCCC1 MVJOSHBBQCIWPL-HXUWFJFHSA-N 0.000 description 1
- AJKDUJRRWLQXHM-UHFFFAOYSA-N 3-bromocyclohexene Chemical compound BrC1CCCC=C1 AJKDUJRRWLQXHM-UHFFFAOYSA-N 0.000 description 1
- ZDHKVKPZQKYREU-UHFFFAOYSA-N 4-(chloromethyl)pyridine;hydron;chloride Chemical compound Cl.ClCC1=CC=NC=C1 ZDHKVKPZQKYREU-UHFFFAOYSA-N 0.000 description 1
- 125000000339 4-pyridyl group Chemical group N1=C([H])C([H])=C([*])C([H])=C1[H] 0.000 description 1
- KHGZBJJFVUTLLF-LEQGEALCSA-N 5-(2-ethylsulfonylethyl)-3-[[(2r)-1-(1-phenylethyl)pyrrolidin-2-yl]methyl]-1h-indole Chemical compound C([C@@H]1CC2=CNC3=CC=C(C=C32)CCS(=O)(=O)CC)CCN1C(C)C1=CC=CC=C1 KHGZBJJFVUTLLF-LEQGEALCSA-N 0.000 description 1
- BGSNYRNVPBKJOR-GOSISDBHSA-N 5-(2-ethylsulfonylethyl)-3-[[(2r)-1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-1h-indole Chemical compound C12=CC(CCS(=O)(=O)CC)=CC=C2NC=C1C[C@H]1CCCN1CCOC BGSNYRNVPBKJOR-GOSISDBHSA-N 0.000 description 1
- LNYHAUPKKBRXDD-HSZRJFAPSA-N 5-(2-ethylsulfonylethyl)-3-[[(2r)-1-(2-phenylethyl)pyrrolidin-2-yl]methyl]-1h-indole Chemical compound C([C@@H]1CC2=CNC3=CC=C(C=C32)CCS(=O)(=O)CC)CCN1CCC1=CC=CC=C1 LNYHAUPKKBRXDD-HSZRJFAPSA-N 0.000 description 1
- AQPNSFBZUQZJKL-JOCHJYFZSA-N 5-(2-ethylsulfonylethyl)-3-[[(2r)-1-(2-pyridin-2-ylethyl)pyrrolidin-2-yl]methyl]-1h-indole Chemical compound C([C@@H]1CC2=CNC3=CC=C(C=C32)CCS(=O)(=O)CC)CCN1CCC1=CC=CC=N1 AQPNSFBZUQZJKL-JOCHJYFZSA-N 0.000 description 1
- KHGZBJJFVUTLLF-AUSIDOKSSA-N 5-(2-ethylsulfonylethyl)-3-[[(2r)-1-[(1r)-1-phenylethyl]pyrrolidin-2-yl]methyl]-1h-indole Chemical compound C1([C@@H](C)N2CCC[C@@H]2CC2=CNC3=CC=C(C=C32)CCS(=O)(=O)CC)=CC=CC=C1 KHGZBJJFVUTLLF-AUSIDOKSSA-N 0.000 description 1
- KHGZBJJFVUTLLF-WMZHIEFXSA-N 5-(2-ethylsulfonylethyl)-3-[[(2r)-1-[(1s)-1-phenylethyl]pyrrolidin-2-yl]methyl]-1h-indole Chemical compound C1([C@H](C)N2CCC[C@@H]2CC2=CNC3=CC=C(C=C32)CCS(=O)(=O)CC)=CC=CC=C1 KHGZBJJFVUTLLF-WMZHIEFXSA-N 0.000 description 1
- OVLNYQCTYVYQEN-XFULWGLBSA-N 5-(2-ethylsulfonylethyl)-3-[[(2r)-pyrrolidin-2-yl]methyl]-1h-indole;hydrochloride Chemical compound Cl.C12=CC(CCS(=O)(=O)CC)=CC=C2NC=C1C[C@H]1CCCN1 OVLNYQCTYVYQEN-XFULWGLBSA-N 0.000 description 1
- 108091005478 5-HT1 receptors Proteins 0.000 description 1
- 102000035038 5-HT1 receptors Human genes 0.000 description 1
- GGOSEWSYQHYKDT-OAQYLSRUSA-N 5-[2-(benzenesulfonyl)ethyl]-3-[[(2r)-1-(2-methoxyethyl)pyrrolidin-2-yl]methyl]-1h-indole Chemical compound COCCN1CCC[C@@H]1CC(C1=C2)=CNC1=CC=C2CCS(=O)(=O)C1=CC=CC=C1 GGOSEWSYQHYKDT-OAQYLSRUSA-N 0.000 description 1
- RUYUFHUPVLYNBK-HSZRJFAPSA-N 5-[2-(benzenesulfonyl)ethyl]-3-[[(2r)-1-cyclopentylpyrrolidin-2-yl]methyl]-1h-indole Chemical compound C([C@@H]1CC2=CNC3=CC=C(C=C32)CCS(=O)(=O)C=2C=CC=CC=2)CCN1C1CCCC1 RUYUFHUPVLYNBK-HSZRJFAPSA-N 0.000 description 1
- VXWVFZFZYXOBTA-UHFFFAOYSA-N 5-bromo-1h-indole Chemical compound BrC1=CC=C2NC=CC2=C1 VXWVFZFZYXOBTA-UHFFFAOYSA-N 0.000 description 1
- WVHBOMDMDWANEM-LLVKDONJSA-N 5-bromo-3-[[(2r)-pyrrolidin-2-yl]methyl]-1h-indole Chemical compound C12=CC(Br)=CC=C2NC=C1C[C@H]1CCCN1 WVHBOMDMDWANEM-LLVKDONJSA-N 0.000 description 1
- 101710138638 5-hydroxytryptamine receptor 1A Proteins 0.000 description 1
- 102100022738 5-hydroxytryptamine receptor 1A Human genes 0.000 description 1
- 101710138068 5-hydroxytryptamine receptor 1D Proteins 0.000 description 1
- 108091032151 5-hydroxytryptamine receptor family Proteins 0.000 description 1
- 102000040125 5-hydroxytryptamine receptor family Human genes 0.000 description 1
- GJEZBVHHZQAEDB-UHFFFAOYSA-N 6-oxabicyclo[3.1.0]hexane Chemical compound C1CCC2OC21 GJEZBVHHZQAEDB-UHFFFAOYSA-N 0.000 description 1
- ASXGJMSKWNBENU-UHFFFAOYSA-N 8-OH-DPAT Chemical compound C1=CC(O)=C2CC(N(CCC)CCC)CCC2=C1 ASXGJMSKWNBENU-UHFFFAOYSA-N 0.000 description 1
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 1
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 description 1
- HRPVXLWXLXDGHG-UHFFFAOYSA-N Acrylamide Chemical compound NC(=O)C=C HRPVXLWXLXDGHG-UHFFFAOYSA-N 0.000 description 1
- 229910015900 BF3 Inorganic materials 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical compound OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- ZPRNKGFCLDAECD-STZQEDGTSA-N C([C@@H]1CC2=CNC3=CC=C(C=C32)CCS(=O)(=O)CC)CCN1[C@@H]1CCC[C@H]1O Chemical compound C([C@@H]1CC2=CNC3=CC=C(C=C32)CCS(=O)(=O)CC)CCN1[C@@H]1CCC[C@H]1O ZPRNKGFCLDAECD-STZQEDGTSA-N 0.000 description 1
- KXDHJXZQYSOELW-UHFFFAOYSA-M Carbamate Chemical group NC([O-])=O KXDHJXZQYSOELW-UHFFFAOYSA-M 0.000 description 1
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 1
- 239000004338 Dichlorodifluoromethane Substances 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- 238000006546 Horner-Wadsworth-Emmons reaction Methods 0.000 description 1
- HHTDENYTSCXDFO-GOSISDBHSA-N N-Desmethyleletriptan Chemical compound C=1C=CC=CC=1S(=O)(=O)CCC(C=C12)=CC=C1NC=C2C[C@H]1CCCN1 HHTDENYTSCXDFO-GOSISDBHSA-N 0.000 description 1
- GOOHAUXETOMSMM-GSVOUGTGSA-N R-propylene oxide Chemical compound C[C@@H]1CO1 GOOHAUXETOMSMM-GSVOUGTGSA-N 0.000 description 1
- GOOHAUXETOMSMM-VKHMYHEASA-N S-propylene oxide Chemical compound C[C@H]1CO1 GOOHAUXETOMSMM-VKHMYHEASA-N 0.000 description 1
- 241000350393 Sinna Species 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- 206010047139 Vasoconstriction Diseases 0.000 description 1
- 238000007239 Wittig reaction Methods 0.000 description 1
- WETWJCDKMRHUPV-UHFFFAOYSA-N acetyl chloride Chemical compound CC(Cl)=O WETWJCDKMRHUPV-UHFFFAOYSA-N 0.000 description 1
- 239000012346 acetyl chloride Substances 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 150000001262 acyl bromides Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 125000002009 alkene group Chemical group 0.000 description 1
- 150000004791 alkyl magnesium halides Chemical class 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- BHELZAPQIKSEDF-UHFFFAOYSA-N allyl bromide Chemical compound BrCC=C BHELZAPQIKSEDF-UHFFFAOYSA-N 0.000 description 1
- HSFWRNGVRCDJHI-UHFFFAOYSA-N alpha-acetylene Natural products C#C HSFWRNGVRCDJHI-UHFFFAOYSA-N 0.000 description 1
- 150000001370 alpha-amino acid derivatives Chemical class 0.000 description 1
- 235000008206 alpha-amino acids Nutrition 0.000 description 1
- 238000010976 amide bond formation reaction Methods 0.000 description 1
- 238000005576 amination reaction Methods 0.000 description 1
- 235000001014 amino acid Nutrition 0.000 description 1
- 150000001413 amino acids Chemical class 0.000 description 1
- 239000003420 antiserotonin agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000002393 azetidinyl group Chemical group 0.000 description 1
- CWHKVBJSRGJFFN-LJQANCHMSA-N benzyl (2r)-2-(5-bromo-1h-indole-3-carbonyl)pyrrolidine-1-carboxylate Chemical compound C([C@@H]1C(=O)C2=CNC3=CC=C(C=C32)Br)CCN1C(=O)OCC1=CC=CC=C1 CWHKVBJSRGJFFN-LJQANCHMSA-N 0.000 description 1
- QRSUHZUWSHZRFX-QBFDXINUSA-N benzyl (2r)-2-(5-bromo-1h-indole-3-carbonyl)pyrrolidine-1-carboxylate;benzyl (2r)-2-[(5-bromo-1h-indol-3-yl)methyl]pyrrolidine-1-carboxylate Chemical compound C([C@@H]1CC2=CNC3=CC=C(C=C32)Br)CCN1C(=O)OCC1=CC=CC=C1.C([C@@H]1C(=O)C2=CNC3=CC=C(C=C32)Br)CCN1C(=O)OCC1=CC=CC=C1 QRSUHZUWSHZRFX-QBFDXINUSA-N 0.000 description 1
- PJKWGQAVURRHTO-JOCHJYFZSA-N benzyl (2r)-2-[[5-(2-ethylsulfonylethenyl)-1h-indol-3-yl]methyl]pyrrolidine-1-carboxylate Chemical compound C([C@@H]1CC2=CNC3=CC=C(C=C32)C=CS(=O)(=O)CC)CCN1C(=O)OCC1=CC=CC=C1 PJKWGQAVURRHTO-JOCHJYFZSA-N 0.000 description 1
- DRGFTNGETXLVSB-RUZDIDTESA-N benzyl (2r)-2-[[5-[2-(benzenesulfonyl)ethenyl]-1h-indol-3-yl]methyl]pyrrolidine-1-carboxylate Chemical compound N1([C@H](CCC1)CC=1C2=CC(C=CS(=O)(=O)C=3C=CC=CC=3)=CC=C2NC=1)C(=O)OCC1=CC=CC=C1 DRGFTNGETXLVSB-RUZDIDTESA-N 0.000 description 1
- MDOLFRUYDURXTI-HSZRJFAPSA-N benzyl 2-[(2r)-2-[[5-(2-ethylsulfonylethyl)-1h-indol-3-yl]methyl]pyrrolidin-1-yl]acetate Chemical compound C([C@@H]1CC2=CNC3=CC=C(C=C32)CCS(=O)(=O)CC)CCN1CC(=O)OCC1=CC=CC=C1 MDOLFRUYDURXTI-HSZRJFAPSA-N 0.000 description 1
- JHVLLYQQQYIWKX-UHFFFAOYSA-N benzyl 2-bromoacetate Chemical compound BrCC(=O)OCC1=CC=CC=C1 JHVLLYQQQYIWKX-UHFFFAOYSA-N 0.000 description 1
- AGEZXYOZHKGVCM-UHFFFAOYSA-N benzyl bromide Chemical compound BrCC1=CC=CC=C1 AGEZXYOZHKGVCM-UHFFFAOYSA-N 0.000 description 1
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000004071 biological effect Effects 0.000 description 1
- SIPUZPBQZHNSDW-UHFFFAOYSA-N bis(2-methylpropyl)aluminum Chemical compound CC(C)C[Al]CC(C)C SIPUZPBQZHNSDW-UHFFFAOYSA-N 0.000 description 1
- 239000008280 blood Substances 0.000 description 1
- 210000004369 blood Anatomy 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- FLHFTXCMKFVKRP-UHFFFAOYSA-N bromomethylcyclobutane Chemical compound BrCC1CCC1 FLHFTXCMKFVKRP-UHFFFAOYSA-N 0.000 description 1
- VNWKTOKETHGBQD-AKLPVKDBSA-N carbane Chemical compound [15CH4] VNWKTOKETHGBQD-AKLPVKDBSA-N 0.000 description 1
- 150000001718 carbodiimides Chemical class 0.000 description 1
- 239000001569 carbon dioxide Substances 0.000 description 1
- 229910002092 carbon dioxide Inorganic materials 0.000 description 1
- 229960004424 carbon dioxide Drugs 0.000 description 1
- IETKMTGYQIVLRF-UHFFFAOYSA-N carbon monoxide;rhodium;triphenylphosphane Chemical compound [Rh].[O+]#[C-].C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1.C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 IETKMTGYQIVLRF-UHFFFAOYSA-N 0.000 description 1
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 1
- 210000001715 carotid artery Anatomy 0.000 description 1
- 238000009903 catalytic hydrogenation reaction Methods 0.000 description 1
- 210000003169 central nervous system Anatomy 0.000 description 1
- 230000008859 change Effects 0.000 description 1
- SYGWYBOJXOGMRU-UHFFFAOYSA-N chembl233051 Chemical compound C1=CC=C2C3=CC(C(N(CCN(C)C)C4=O)=O)=C5C4=CC=CC5=C3SC2=C1 SYGWYBOJXOGMRU-UHFFFAOYSA-N 0.000 description 1
- 239000007810 chemical reaction solvent Substances 0.000 description 1
- BULLHNJGPPOUOX-UHFFFAOYSA-N chloroacetone Chemical compound CC(=O)CCl BULLHNJGPPOUOX-UHFFFAOYSA-N 0.000 description 1
- WBLIXGSTEMXDSM-UHFFFAOYSA-N chloromethane Chemical compound Cl[CH2] WBLIXGSTEMXDSM-UHFFFAOYSA-N 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 239000012230 colorless oil Substances 0.000 description 1
- 229940125810 compound 20 Drugs 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 239000013058 crude material Substances 0.000 description 1
- TXWOGHSRPAYOML-UHFFFAOYSA-N cyclobutanecarboxylic acid Chemical compound OC(=O)C1CCC1 TXWOGHSRPAYOML-UHFFFAOYSA-N 0.000 description 1
- 239000012351 deprotecting agent Substances 0.000 description 1
- 235000019404 dichlorodifluoromethane Nutrition 0.000 description 1
- 229940042935 dichlorodifluoromethane Drugs 0.000 description 1
- 229940087091 dichlorotetrafluoroethane Drugs 0.000 description 1
- FAMRKDQNMBBFBR-BQYQJAHWSA-N diethyl azodicarboxylate Substances CCOC(=O)\N=N\C(=O)OCC FAMRKDQNMBBFBR-BQYQJAHWSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 238000006073 displacement reaction Methods 0.000 description 1
- 239000003937 drug carrier Substances 0.000 description 1
- 238000010410 dusting Methods 0.000 description 1
- 125000006575 electron-withdrawing group Chemical group 0.000 description 1
- 238000010828 elution Methods 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002081 enamines Chemical class 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- MZMJHXFYLRTLQX-UHFFFAOYSA-N ethenylsulfinylbenzene Chemical compound C=CS(=O)C1=CC=CC=C1 MZMJHXFYLRTLQX-UHFFFAOYSA-N 0.000 description 1
- UJTPZISIAWDGFF-UHFFFAOYSA-N ethenylsulfonylbenzene Chemical compound C=CS(=O)(=O)C1=CC=CC=C1 UJTPZISIAWDGFF-UHFFFAOYSA-N 0.000 description 1
- FAMRKDQNMBBFBR-UHFFFAOYSA-N ethyl n-ethoxycarbonyliminocarbamate Chemical compound CCOC(=O)N=NC(=O)OCC FAMRKDQNMBBFBR-UHFFFAOYSA-N 0.000 description 1
- 238000011156 evaluation Methods 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 210000001035 gastrointestinal tract Anatomy 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 1
- 150000002390 heteroarenes Chemical class 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- PZOUSPYUWWUPPK-UHFFFAOYSA-N indole Natural products CC1=CC=CC2=C1C=CN2 PZOUSPYUWWUPPK-UHFFFAOYSA-N 0.000 description 1
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine Natural products C1=CC=C2CC=NC2=C1 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 1
- 150000002475 indoles Chemical class 0.000 description 1
- 239000003456 ion exchange resin Substances 0.000 description 1
- 229920003303 ion-exchange polymer Polymers 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- FMKOJHQHASLBPH-UHFFFAOYSA-N isopropyl iodide Chemical compound CC(C)I FMKOJHQHASLBPH-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 239000007937 lozenge Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 238000001819 mass spectrum Methods 0.000 description 1
- NQMRYBIKMRVZLB-UHFFFAOYSA-N methylamine hydrochloride Chemical compound [Cl-].[NH3+]C NQMRYBIKMRVZLB-UHFFFAOYSA-N 0.000 description 1
- 230000003278 mimic effect Effects 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- YPHQUSNPXDGUHL-UHFFFAOYSA-N n-methylprop-2-enamide Chemical compound CNC(=O)C=C YPHQUSNPXDGUHL-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- ODUCDPQEXGNKDN-UHFFFAOYSA-N nitroxyl Chemical class O=N ODUCDPQEXGNKDN-UHFFFAOYSA-N 0.000 description 1
- 231100000252 nontoxic Toxicity 0.000 description 1
- 230000003000 nontoxic effect Effects 0.000 description 1
- 230000000269 nucleophilic effect Effects 0.000 description 1
- MUJIDPITZJWBSW-UHFFFAOYSA-N palladium(2+) Chemical class [Pd+2] MUJIDPITZJWBSW-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- UCUUFSAXZMGPGH-UHFFFAOYSA-N penta-1,4-dien-3-one Chemical compound C=CC(=O)C=C UCUUFSAXZMGPGH-UHFFFAOYSA-N 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 239000003444 phase transfer catalyst Substances 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical compound [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- 235000011007 phosphoric acid Nutrition 0.000 description 1
- 150000003016 phosphoric acids Chemical class 0.000 description 1
- 125000003386 piperidinyl group Chemical group 0.000 description 1
- 229920001223 polyethylene glycol Polymers 0.000 description 1
- GKKCIDNWFBPDBW-UHFFFAOYSA-M potassium cyanate Chemical compound [K]OC#N GKKCIDNWFBPDBW-UHFFFAOYSA-M 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 239000003380 propellant Substances 0.000 description 1
- 238000011321 prophylaxis Methods 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000001525 receptor binding assay Methods 0.000 description 1
- 239000013557 residual solvent Substances 0.000 description 1
- 230000004044 response Effects 0.000 description 1
- 238000012552 review Methods 0.000 description 1
- 238000007363 ring formation reaction Methods 0.000 description 1
- 229940076279 serotonin Drugs 0.000 description 1
- 239000003723 serotonin 1A agonist Substances 0.000 description 1
- 231100000098 severe acute toxicity Toxicity 0.000 description 1
- 235000015424 sodium Nutrition 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000003381 stabilizer Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 229940124530 sulfonamide Drugs 0.000 description 1
- 150000003456 sulfonamides Chemical class 0.000 description 1
- 150000003457 sulfones Chemical class 0.000 description 1
- 150000003461 sulfonyl halides Chemical class 0.000 description 1
- 230000006103 sulfonylation Effects 0.000 description 1
- 238000005694 sulfonylation reaction Methods 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 239000000829 suppository Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 238000010189 synthetic method Methods 0.000 description 1
- ISXSCDLOGDJUNJ-UHFFFAOYSA-N tert-butyl prop-2-enoate Chemical compound CC(C)(C)OC(=O)C=C ISXSCDLOGDJUNJ-UHFFFAOYSA-N 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- BSYVTEYKTMYBMK-UHFFFAOYSA-N tetrahydrofurfuryl alcohol Chemical compound OCC1CCCO1 BSYVTEYKTMYBMK-UHFFFAOYSA-N 0.000 description 1
- CZDYPVPMEAXLPK-UHFFFAOYSA-N tetramethylsilane Chemical compound C[Si](C)(C)C CZDYPVPMEAXLPK-UHFFFAOYSA-N 0.000 description 1
- 238000002560 therapeutic procedure Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 229940029284 trichlorofluoromethane Drugs 0.000 description 1
- 230000004865 vascular response Effects 0.000 description 1
- 230000025033 vasoconstriction Effects 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/14—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing three or more hetero rings
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/04—Centrally acting analgesics, e.g. opioids
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/20—Hypnotics; Sedatives
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P25/00—Drugs for disorders of the nervous system
- A61P25/30—Drugs for disorders of the nervous system for treating abuse or dependence
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P3/00—Drugs for disorders of the metabolism
- A61P3/04—Anorexiants; Antiobesity agents
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P43/00—Drugs for specific purposes, not provided for in groups A61P1/00-A61P41/00
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D403/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00
- C07D403/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings
- C07D403/06—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, not provided for by group C07D401/00 containing two hetero rings linked by a carbon chain containing only aliphatic carbon atoms
Landscapes
- Health & Medical Sciences (AREA)
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Neurosurgery (AREA)
- Biomedical Technology (AREA)
- Neurology (AREA)
- Diabetes (AREA)
- Psychiatry (AREA)
- Obesity (AREA)
- Hematology (AREA)
- Child & Adolescent Psychology (AREA)
- Anesthesiology (AREA)
- Addiction (AREA)
- Pain & Pain Management (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Indole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Medicines Containing Antibodies Or Antigens For Use As Internal Diagnostic Agents (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Acyclic And Carbocyclic Compounds In Medicinal Compositions (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB9207930 | 1992-04-10 | ||
| GB929207930A GB9207930D0 (en) | 1992-04-10 | 1992-04-10 | Indoles |
| PCT/EP1993/000738 WO1993021177A1 (en) | 1992-04-10 | 1993-03-25 | Indole derivatives as 5-ht1-like agonists |
| EP9300738 | 1993-03-25 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| FI944727A0 FI944727A0 (fi) | 1994-10-07 |
| FI944727A FI944727A (fi) | 1994-10-07 |
| FI111255B true FI111255B (fi) | 2003-06-30 |
Family
ID=10713831
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| FI944727A FI111255B (fi) | 1992-04-10 | 1994-10-07 | Menetelmä terapeuttisesti käyttökelpoisten 3,5-disubstituoitujen indolijohdannaisten valmistamiseksi |
Country Status (16)
| Country | Link |
|---|---|
| US (1) | US5639779A (de) |
| EP (1) | EP0635014B1 (de) |
| JP (1) | JP2784265B2 (de) |
| CN (1) | CN1082039A (de) |
| AT (1) | ATE133169T1 (de) |
| AU (1) | AU3752593A (de) |
| CA (1) | CA2131000C (de) |
| DE (1) | DE69301357T2 (de) |
| DK (1) | DK0635014T3 (de) |
| ES (1) | ES2082639T3 (de) |
| FI (1) | FI111255B (de) |
| GB (1) | GB9207930D0 (de) |
| GR (1) | GR3019132T3 (de) |
| IL (1) | IL105311A0 (de) |
| WO (1) | WO1993021177A1 (de) |
| ZA (1) | ZA932534B (de) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5559246A (en) * | 1990-10-15 | 1996-09-24 | Pfizer Inc. | Indole derivatives |
| US5578612A (en) * | 1990-10-15 | 1996-11-26 | Pfizer Inc. | Indole derivatives |
| US5607951A (en) * | 1990-10-15 | 1997-03-04 | Pfizer Inc | Indole derivatives |
| US5545644A (en) * | 1990-10-15 | 1996-08-13 | Pfizer Inc. | Indole derivatives |
| US5559129A (en) * | 1990-10-15 | 1996-09-24 | Pfizer Inc | Indole derivatives |
| ATE170836T1 (de) * | 1993-08-31 | 1998-09-15 | Pfizer | 5-arylindolderivate |
| GB9417310D0 (en) * | 1994-08-27 | 1994-10-19 | Pfizer Ltd | Therapeutic agents |
| GB9420503D0 (en) * | 1994-10-11 | 1994-11-23 | Pfizer Ltd | Therapeutic agents |
| GB9420529D0 (en) | 1994-10-12 | 1994-11-30 | Pfizer Ltd | Indoles |
| US5994352A (en) * | 1998-11-13 | 1999-11-30 | Pfizer Inc. | 5-arylindole derivatives |
| GB9923314D0 (en) * | 1999-10-01 | 1999-12-08 | Pfizer Ltd | Acylation process |
| EP1132389A1 (de) * | 2000-03-06 | 2001-09-12 | Vernalis Research Limited | Neue Azaindolyl-Derivate für die Behandlung von Fettleibigheit |
| WO2011089614A1 (en) | 2010-01-19 | 2011-07-28 | Sms Pharmaceuticals Limited | PROCESS FOR PREPARING ELETRIPTAN HYDROBROMIDE HAVING α-FORM |
Family Cites Families (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ZA795239B (en) * | 1978-10-12 | 1980-11-26 | Glaxo Group Ltd | Heterocyclic compounds |
| BE889931A (fr) * | 1980-08-12 | 1982-02-11 | Glaxo Group Ltd | Derives indoliques, leur preparation et leurs applications en tant que medicaments |
| FR2488606A1 (fr) * | 1980-08-12 | 1982-02-19 | Glaxo Group Ltd | Derives indoliques, leur preparation et leurs applications en tant que medicaments |
| GB8600397D0 (en) * | 1986-01-08 | 1986-02-12 | Glaxo Group Ltd | Chemical compounds |
| GB8719167D0 (en) * | 1987-08-13 | 1987-09-23 | Glaxo Group Ltd | Chemical compounds |
| GB8724912D0 (en) * | 1987-10-23 | 1987-11-25 | Wellcome Found | Indole derivatives |
| GB8819024D0 (en) * | 1988-08-10 | 1988-09-14 | Glaxo Group Ltd | Chemical compounds |
| IL96891A0 (en) * | 1990-01-17 | 1992-03-29 | Merck Sharp & Dohme | Indole-substituted five-membered heteroaromatic compounds,their preparation and pharmaceutical compositions containing them |
| IL114690A (en) * | 1990-06-07 | 1997-02-18 | Wellcome Found | Antimigraine oxazolidinone substituted indole derivatives |
| KR0179053B1 (ko) * | 1990-10-15 | 1999-03-20 | 알렌 제이.스피겔 | 인돌 유도체 |
| US5208248A (en) * | 1991-01-11 | 1993-05-04 | Merck Sharpe & Dohme, Ltd. | Indazole-substituted five-membered heteroaromatic compounds |
| CZ283018B6 (cs) * | 1991-02-01 | 1997-12-17 | Merck Sharp And Dohme Limited | Deriváty imidazolu, triazolu a tetrazolu a farmaceutické přípravky na jejich bázi |
| US5409941A (en) * | 1992-02-03 | 1995-04-25 | Pfizer Inc. | 5-heteroyl indole derivatives |
-
1992
- 1992-04-10 GB GB929207930A patent/GB9207930D0/en active Pending
-
1993
- 1993-03-25 AT AT93906620T patent/ATE133169T1/de not_active IP Right Cessation
- 1993-03-25 DK DK93906620.5T patent/DK0635014T3/da active
- 1993-03-25 US US08/313,106 patent/US5639779A/en not_active Expired - Fee Related
- 1993-03-25 EP EP93906620A patent/EP0635014B1/de not_active Expired - Lifetime
- 1993-03-25 DE DE69301357T patent/DE69301357T2/de not_active Expired - Fee Related
- 1993-03-25 CA CA002131000A patent/CA2131000C/en not_active Expired - Fee Related
- 1993-03-25 ES ES93906620T patent/ES2082639T3/es not_active Expired - Lifetime
- 1993-03-25 JP JP5517929A patent/JP2784265B2/ja not_active Expired - Fee Related
- 1993-03-25 WO PCT/EP1993/000738 patent/WO1993021177A1/en active IP Right Grant
- 1993-03-25 AU AU37525/93A patent/AU3752593A/en not_active Abandoned
- 1993-04-05 IL IL105311A patent/IL105311A0/xx unknown
- 1993-04-08 ZA ZA932534A patent/ZA932534B/xx unknown
- 1993-04-10 CN CN93105712A patent/CN1082039A/zh active Pending
-
1994
- 1994-10-07 FI FI944727A patent/FI111255B/fi not_active IP Right Cessation
-
1996
- 1996-02-28 GR GR960400556T patent/GR3019132T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ES2082639T3 (es) | 1996-03-16 |
| EP0635014A1 (de) | 1995-01-25 |
| IL105311A0 (en) | 1993-08-18 |
| GB9207930D0 (en) | 1992-05-27 |
| GR3019132T3 (en) | 1996-05-31 |
| ATE133169T1 (de) | 1996-02-15 |
| CA2131000C (en) | 1998-09-22 |
| WO1993021177A1 (en) | 1993-10-28 |
| ZA932534B (en) | 1994-10-08 |
| FI944727A0 (fi) | 1994-10-07 |
| JP2784265B2 (ja) | 1998-08-06 |
| US5639779A (en) | 1997-06-17 |
| AU3752593A (en) | 1993-11-18 |
| DK0635014T3 (da) | 1996-02-12 |
| DE69301357D1 (de) | 1996-02-29 |
| DE69301357T2 (de) | 1996-06-13 |
| FI944727A (fi) | 1994-10-07 |
| JPH07505402A (ja) | 1995-06-15 |
| CN1082039A (zh) | 1994-02-16 |
| EP0635014B1 (de) | 1996-01-17 |
| CA2131000A1 (en) | 1993-10-28 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI111255B (fi) | Menetelmä terapeuttisesti käyttökelpoisten 3,5-disubstituoitujen indolijohdannaisten valmistamiseksi | |
| DE69400824T2 (de) | Indol-derivate als 5-ht1-ähnliche antagonisten zur behandlung von migräne | |
| US6294555B1 (en) | 1-[(1-Substituted-4-piperidinyl)methyl]-4-piperidine derivative, process for producing the same, medicinal compositions containing the same and intermediates of these compounds | |
| US20070054950A1 (en) | 3-Azabicyclo[3.1.0]hexane derivatives | |
| US7649002B2 (en) | (3,5-dimethylpiperidin-1yl)(4-phenylpyrrolidin-3-yl)methanone derivatives as MCR4 agonists | |
| WO1998056757A1 (fr) | Derives de benzylamine | |
| TW200804297A (en) | 4,4,5,5 tetrasubstituted imidazolines | |
| CN101466709B (zh) | 具有nos抑制活性的1,5和3,6-取代的吲哚化合物 | |
| NZ551292A (en) | 3-Amino-1-arylpropyl indoles as monoamine reuptake inhibitor | |
| AU2002329557A1 (en) | 3-azabicyclo (3.1.0) hexane derivatives as opioid receptor antagonists | |
| CA2567935C (en) | Aminopyridine derivatives as selective dopamine d3 agonists | |
| JPWO2010107115A1 (ja) | グリシントランスポーター阻害物質 | |
| JPH07121943B2 (ja) | ５−ｈｔ１アゴニストとしてのインドール誘導体 | |
| JPH0692365B2 (ja) | ピペリジンおよびピロリジン誘導体 | |
| CZ216996A3 (en) | Indole derivatives, process of their preparation, their use and pharmaceutical compositions containing thereof | |
| US5641779A (en) | Selective ligands of 5-HT1D -5-HT1B receptors derived from indolepiperazine which are useful medicaments | |
| US20050288270A1 (en) | New aminopyridine derivatives and their use as pharmaceuticals | |
| KR20040007672A (ko) | 신규한 페닐알킬디아민 및 아미드 유사체 | |
| KR20110015050A (ko) | 3-치환된 프로판아민 화합물 | |
| AU767132B2 (en) | Substituted 1-(pieridin-4-yl)-3-(aryl) isothioureas their preparation and therapeutic application | |
| FI113863B (fi) | Indolijohdannaiset 5-HT1-tyyppisinä agonisteina | |
| KR20010013750A (ko) | 3-벤질피페리딘 | |
| HRP970451A2 (en) | Quaternary ammonium compounds | |
| SK286671B6 (sk) | Spôsob prípravy derivátov 2-(2-arylmorfolin-2-yl)etanolu a medziprodukty na ich prípravu | |
| FR2773800A1 (fr) | Derives de benzimidazole, leur procede de preparation et leur application en therapeutique |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MA | Patent expired |