ES427316A1 - Procedimiento para preparar amidinas sustituidas. - Google Patents
Procedimiento para preparar amidinas sustituidas.Info
- Publication number
- ES427316A1 ES427316A1 ES427316A ES427316A ES427316A1 ES 427316 A1 ES427316 A1 ES 427316A1 ES 427316 A ES427316 A ES 427316A ES 427316 A ES427316 A ES 427316A ES 427316 A1 ES427316 A1 ES 427316A1
- Authority
- ES
- Spain
- Prior art keywords
- formula
- alcohol
- amidine
- carbamoyloxy
- hydrogen
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- 238000000034 method Methods 0.000 title abstract 6
- 150000001409 amidines Chemical class 0.000 abstract 21
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 abstract 20
- 229910052739 hydrogen Inorganic materials 0.000 abstract 20
- 239000001257 hydrogen Substances 0.000 abstract 20
- 125000003545 alkoxy group Chemical group 0.000 abstract 17
- 150000002431 hydrogen Chemical group 0.000 abstract 14
- -1 nitro, amino Chemical group 0.000 abstract 13
- 150000001875 compounds Chemical class 0.000 abstract 12
- 125000004423 acyloxy group Chemical group 0.000 abstract 8
- 125000002102 aryl alkyloxo group Chemical group 0.000 abstract 8
- 229910052736 halogen Chemical group 0.000 abstract 7
- 150000002367 halogens Chemical group 0.000 abstract 7
- 125000002887 hydroxy group Chemical group [H]O* 0.000 abstract 7
- 125000003118 aryl group Chemical group 0.000 abstract 6
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 abstract 6
- 150000001336 alkenes Chemical class 0.000 abstract 5
- 125000003277 amino group Chemical group 0.000 abstract 5
- 125000004435 hydrogen atom Chemical group [H]* 0.000 abstract 5
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 abstract 5
- 150000003839 salts Chemical class 0.000 abstract 5
- 125000001424 substituent group Chemical group 0.000 abstract 5
- PAYRUJLWNCNPSJ-UHFFFAOYSA-N Aniline Chemical compound NC1=CC=CC=C1 PAYRUJLWNCNPSJ-UHFFFAOYSA-N 0.000 abstract 4
- 150000001412 amines Chemical class 0.000 abstract 4
- 125000004432 carbon atom Chemical group C* 0.000 abstract 4
- 239000002253 acid Substances 0.000 abstract 3
- 230000001476 alcoholic effect Effects 0.000 abstract 3
- 150000001408 amides Chemical class 0.000 abstract 3
- 125000004104 aryloxy group Chemical group 0.000 abstract 3
- 229910052799 carbon Inorganic materials 0.000 abstract 3
- 125000000753 cycloalkyl group Chemical group 0.000 abstract 3
- AEOCXXJPGCBFJA-UHFFFAOYSA-N ethionamide Chemical compound CCC1=CC(C(N)=S)=CC=N1 AEOCXXJPGCBFJA-UHFFFAOYSA-N 0.000 abstract 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 abstract 3
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 abstract 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical group [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 abstract 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 abstract 2
- 150000001335 aliphatic alkanes Chemical class 0.000 abstract 2
- 150000001450 anions Chemical class 0.000 abstract 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical group BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 abstract 2
- 229910052794 bromium Inorganic materials 0.000 abstract 2
- 125000003739 carbamimidoyl group Chemical group C(N)(=N)* 0.000 abstract 2
- 238000006243 chemical reaction Methods 0.000 abstract 2
- 229910052801 chlorine Inorganic materials 0.000 abstract 2
- 239000000460 chlorine Chemical group 0.000 abstract 2
- 230000007062 hydrolysis Effects 0.000 abstract 2
- 238000006460 hydrolysis reaction Methods 0.000 abstract 2
- PNDPGZBMCMUPRI-UHFFFAOYSA-N iodine Chemical group II PNDPGZBMCMUPRI-UHFFFAOYSA-N 0.000 abstract 2
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 abstract 2
- 238000006237 Beckmann rearrangement reaction Methods 0.000 abstract 1
- 230000002378 acidificating effect Effects 0.000 abstract 1
- 230000029936 alkylation Effects 0.000 abstract 1
- 238000005804 alkylation reaction Methods 0.000 abstract 1
- 230000015572 biosynthetic process Effects 0.000 abstract 1
- 238000003776 cleavage reaction Methods 0.000 abstract 1
- 125000000000 cycloalkoxy group Chemical group 0.000 abstract 1
- 238000006193 diazotization reaction Methods 0.000 abstract 1
- 238000006073 displacement reaction Methods 0.000 abstract 1
- 230000032050 esterification Effects 0.000 abstract 1
- 238000005886 esterification reaction Methods 0.000 abstract 1
- 125000001033 ether group Chemical group 0.000 abstract 1
- 238000006266 etherification reaction Methods 0.000 abstract 1
- CEIPQQODRKXDSB-UHFFFAOYSA-N ethyl 3-(6-hydroxynaphthalen-2-yl)-1H-indazole-5-carboximidate dihydrochloride Chemical compound Cl.Cl.C1=C(O)C=CC2=CC(C3=NNC4=CC=C(C=C43)C(=N)OCC)=CC=C21 CEIPQQODRKXDSB-UHFFFAOYSA-N 0.000 abstract 1
- 238000005984 hydrogenation reaction Methods 0.000 abstract 1
- 230000003301 hydrolyzing effect Effects 0.000 abstract 1
- 150000002825 nitriles Chemical class 0.000 abstract 1
- 229910052757 nitrogen Inorganic materials 0.000 abstract 1
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 abstract 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 abstract 1
- 238000002360 preparation method Methods 0.000 abstract 1
- 239000000376 reactant Substances 0.000 abstract 1
- 230000007017 scission Effects 0.000 abstract 1
- 230000009466 transformation Effects 0.000 abstract 1
- 238000011282 treatment Methods 0.000 abstract 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/16—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms
- C07D295/18—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms acylated on ring nitrogen atoms by radicals derived from carboxylic acids, or sulfur or nitrogen analogues thereof
- C07D295/195—Radicals derived from nitrogen analogues of carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C259/00—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups
- C07C259/12—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups with replacement of the other oxygen atom of the carboxyl group by nitrogen atoms, e.g. N-hydroxyamidines
- C07C259/14—Compounds containing carboxyl groups, an oxygen atom of a carboxyl group being replaced by a nitrogen atom, this nitrogen atom being further bound to an oxygen atom and not being part of nitro or nitroso groups with replacement of the other oxygen atom of the carboxyl group by nitrogen atoms, e.g. N-hydroxyamidines having carbon atoms of hydroxamidine groups bound to hydrogen atoms or to acyclic carbon atoms
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US37179073A | 1973-06-20 | 1973-06-20 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| ES427316A1 true ES427316A1 (es) | 1976-07-16 |
Family
ID=23465417
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| ES427316A Expired ES427316A1 (es) | 1973-06-20 | 1974-06-17 | Procedimiento para preparar amidinas sustituidas. |
Country Status (14)
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5264619B1 (en) * | 1993-01-15 | 1996-05-14 | Cosmos Pharm Corp | Anti-androgenic cyclo and bicyclo alkenes |
| US20060148893A1 (en) * | 2003-06-10 | 2006-07-06 | Blanc Jean-Baptiste E | Chemical compounds |
-
1974
- 1974-06-17 NO NO742181A patent/NO742181L/no unknown
- 1974-06-17 BE BE145517A patent/BE816441A/xx unknown
- 1974-06-17 NL NL7408062A patent/NL7408062A/xx unknown
- 1974-06-17 ES ES427316A patent/ES427316A1/es not_active Expired
- 1974-06-17 GB GB26773/74A patent/GB1478671A/en not_active Expired
- 1974-06-17 SE SE7407986A patent/SE7407986L/xx not_active Application Discontinuation
- 1974-06-17 ZA ZA00743845A patent/ZA743845B/xx unknown
- 1974-06-18 FI FI1862/74A patent/FI186274A7/fi unknown
- 1974-06-18 JP JP49068816A patent/JPS5036430A/ja active Pending
- 1974-06-18 PH PH7415958A patent/PH12364A/en unknown
- 1974-06-18 FR FR7421121A patent/FR2233990B1/fr not_active Expired
- 1974-06-18 IL IL45055A patent/IL45055A0/xx unknown
- 1974-06-18 DE DE2429064A patent/DE2429064A1/de active Pending
- 1974-06-18 DK DK325274A patent/DK325274A/da unknown
Also Published As
| Publication number | Publication date |
|---|---|
| PH12364A (en) | 1979-01-29 |
| DE2429064A1 (de) | 1975-01-23 |
| FR2233990B1 (enrdf_load_stackoverflow) | 1978-07-28 |
| SE7407986L (enrdf_load_stackoverflow) | 1974-12-23 |
| JPS5036430A (enrdf_load_stackoverflow) | 1975-04-05 |
| DK325274A (enrdf_load_stackoverflow) | 1975-02-10 |
| NO742181L (enrdf_load_stackoverflow) | 1975-01-13 |
| IL45055A0 (en) | 1974-09-10 |
| BE816441A (fr) | 1974-12-17 |
| NL7408062A (enrdf_load_stackoverflow) | 1974-12-24 |
| ZA743845B (en) | 1975-06-25 |
| GB1478671A (en) | 1977-07-06 |
| AU7016774A (en) | 1975-12-18 |
| FR2233990A1 (enrdf_load_stackoverflow) | 1975-01-17 |
| FI186274A7 (enrdf_load_stackoverflow) | 1974-12-21 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2240665C2 (de) | N,N'disubstituierte cyclische Diamine | |
| DE1220440B (de) | Verfahren zur Herstellung von Derivaten des 1-(o-Bromphenoxy)-2-hydroxy-3-amino-propans und deren Saeureadditionssalzen | |
| DD148051A5 (de) | Verfahren zur herstellung neuer zwischenprodukte zur herstellung pharmazeutisch verwendbarer verbindungen | |
| US4132786A (en) | N-Substituted 2-methoxybenzenesulphonamides and medicaments containing them | |
| DE1668055A1 (de) | Verfahren zur Herstellung von basisch substituierten Cyclopentylphenolaethern | |
| SU826955A3 (ru) | Способ получения производных аминопропанола или их солей 1 | |
| DE1963182A1 (de) | Neue N-Phenylindolin-Derivate und deren Verwendung als Arzneimittel | |
| SU417936A3 (enrdf_load_stackoverflow) | ||
| ES427316A1 (es) | Procedimiento para preparar amidinas sustituidas. | |
| DE2225765A1 (de) | 3- eckige Klammer auf 2-(4-Phenyl-lpiperazinyl)-äthyl eckige Klammer zu -indoline | |
| US2734920A (en) | New chemical compounds and their | |
| GB1479040A (en) | Aromatic amines their preparation and use as hardeners for epoxy resins | |
| DE1926076B2 (de) | 3-(3-Amino-2-hydroxy-propyl)-6,7>8trimethoxy-SH-M^-benzotriazin^-on-Derivate und ihre Herstellung | |
| DE2263527A1 (de) | Verfahren zur herstellung von substituierten aminoalkyl-(oder -alkenyl-)phenylacetonitril-derivaten | |
| ES411826A1 (es) | Procedimiento de obtencion de 1-ariloxi - 2 - propanolami- nas farmacologicamente activos. | |
| US2824872A (en) | Morpholino phenyl carbamates and production thereof | |
| DE69016647D1 (de) | Verfahren zur herstellung von alpha-beta-ungesättigten ketonen. | |
| CH520117A (de) | Verfahren zur Herstellung von basisch substituierten Oximen des 5H-Dibenzo-(a,d)-10,11-dihydro-cyclohepten-5-ons | |
| US2674615A (en) | 1-arylcycloalkane 1-thiocar-boxylates | |
| GB758382A (en) | Improvements in bis-(ú-aminophenoxy) alkane derivatives | |
| DE1018869B (de) | Verfahren zur Herstellung von Aminoalkylpurinderivaten | |
| CA1237128A (en) | Intermediates for preparing substituted 1-piperazine- carboxamides and use thereof | |
| ES423978A1 (es) | Procedimiento para la preparacion de nuevas bencilaminas. | |
| FI61700C (fi) | Nytt foerfarande foer framstaellning av 2-amino-benzylaminer | |
| DE1543359C (enrdf_load_stackoverflow) |