EP2369927A2 - Herbizid-safener-kombination - Google Patents
Herbizid-safener-kombinationInfo
- Publication number
- EP2369927A2 EP2369927A2 EP09756682A EP09756682A EP2369927A2 EP 2369927 A2 EP2369927 A2 EP 2369927A2 EP 09756682 A EP09756682 A EP 09756682A EP 09756682 A EP09756682 A EP 09756682A EP 2369927 A2 EP2369927 A2 EP 2369927A2
- Authority
- EP
- European Patent Office
- Prior art keywords
- alkyl
- hydrogen
- compounds
- haloalkyl
- alkoxy
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 150000001875 compounds Chemical class 0.000 claims abstract description 133
- 239000000203 mixture Substances 0.000 claims abstract description 50
- 150000003839 salts Chemical class 0.000 claims abstract description 27
- 150000001204 N-oxides Chemical class 0.000 claims abstract description 5
- 229910052739 hydrogen Inorganic materials 0.000 claims description 111
- 239000001257 hydrogen Substances 0.000 claims description 104
- 241000196324 Embryophyta Species 0.000 claims description 85
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 57
- -1 Ci-C 3 alkoxy Chemical group 0.000 claims description 51
- 150000002431 hydrogen Chemical class 0.000 claims description 47
- 229910052736 halogen Inorganic materials 0.000 claims description 34
- 150000002367 halogens Chemical class 0.000 claims description 34
- 230000009261 transgenic effect Effects 0.000 claims description 27
- 230000002363 herbicidal effect Effects 0.000 claims description 26
- 125000000217 alkyl group Chemical group 0.000 claims description 24
- 240000007594 Oryza sativa Species 0.000 claims description 20
- 235000007164 Oryza sativa Nutrition 0.000 claims description 20
- 229910052799 carbon Inorganic materials 0.000 claims description 20
- 235000009566 rice Nutrition 0.000 claims description 20
- 239000013543 active substance Substances 0.000 claims description 19
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 18
- 238000000034 method Methods 0.000 claims description 17
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 16
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 15
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 15
- 244000038559 crop plants Species 0.000 claims description 11
- 125000004356 hydroxy functional group Chemical group O* 0.000 claims description 10
- UKSLKNUCVPZQCQ-UHFFFAOYSA-N Fluxofenim Chemical compound C=1C=C(Cl)C=CC=1C(C(F)(F)F)=NOCC1OCCO1 UKSLKNUCVPZQCQ-UHFFFAOYSA-N 0.000 claims description 9
- 125000003545 alkoxy group Chemical group 0.000 claims description 9
- MCNOFYBITGAAGM-UHFFFAOYSA-N 2,2-dichloro-1-[5-(furan-2-yl)-2,2-dimethyl-1,3-oxazolidin-3-yl]ethanone Chemical compound C1N(C(=O)C(Cl)Cl)C(C)(C)OC1C1=CC=CO1 MCNOFYBITGAAGM-UHFFFAOYSA-N 0.000 claims description 8
- MWKVXOJATACCCH-UHFFFAOYSA-N isoxadifen-ethyl Chemical group C1C(C(=O)OCC)=NOC1(C=1C=CC=CC=1)C1=CC=CC=C1 MWKVXOJATACCCH-UHFFFAOYSA-N 0.000 claims description 8
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- PFJJMJDEVDLPNE-UHFFFAOYSA-N Benoxacor Chemical compound C1=CC=C2N(C(=O)C(Cl)Cl)C(C)COC2=C1 PFJJMJDEVDLPNE-UHFFFAOYSA-N 0.000 claims description 7
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- OPGCOAPTHCZZIW-UHFFFAOYSA-N diethyl 1-(2,4-dichlorophenyl)-5-methyl-4h-pyrazole-3,5-dicarboxylate Chemical group CCOC(=O)C1(C)CC(C(=O)OCC)=NN1C1=CC=C(Cl)C=C1Cl OPGCOAPTHCZZIW-UHFFFAOYSA-N 0.000 claims description 7
- BWUPSGJXXPATLU-UHFFFAOYSA-N dimepiperate Chemical compound C=1C=CC=CC=1C(C)(C)SC(=O)N1CCCCC1 BWUPSGJXXPATLU-UHFFFAOYSA-N 0.000 claims description 7
- 125000004438 haloalkoxy group Chemical group 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- 229910052760 oxygen Inorganic materials 0.000 claims description 7
- 125000004178 (C1-C4) alkyl group Chemical group 0.000 claims description 6
- 125000004765 (C1-C4) haloalkyl group Chemical group 0.000 claims description 6
- 125000006650 (C2-C4) alkynyl group Chemical group 0.000 claims description 6
- 125000005913 (C3-C6) cycloalkyl group Chemical group 0.000 claims description 6
- NNYRZQHKCHEXSD-UHFFFAOYSA-N Daimuron Chemical compound C1=CC(C)=CC=C1NC(=O)NC(C)(C)C1=CC=CC=C1 NNYRZQHKCHEXSD-UHFFFAOYSA-N 0.000 claims description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 claims description 6
- GMBRUAIJEFRHFQ-UHFFFAOYSA-N Fenchlorazole-ethyl Chemical group N1=C(C(=O)OCC)N=C(C(Cl)(Cl)Cl)N1C1=CC=C(Cl)C=C1Cl GMBRUAIJEFRHFQ-UHFFFAOYSA-N 0.000 claims description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical group C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 6
- 125000003342 alkenyl group Chemical group 0.000 claims description 6
- 125000004414 alkyl thio group Chemical group 0.000 claims description 6
- 125000003118 aryl group Chemical group 0.000 claims description 6
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 6
- 239000000460 chlorine Substances 0.000 claims description 6
- OAWUUPVZMNKZRY-UHFFFAOYSA-N cyprosulfamide Chemical compound COC1=CC=CC=C1C(=O)NS(=O)(=O)C1=CC=C(C(=O)NC2CC2)C=C1 OAWUUPVZMNKZRY-UHFFFAOYSA-N 0.000 claims description 6
- 125000001188 haloalkyl group Chemical group 0.000 claims description 6
- COYBRKAVBMYYSF-UHFFFAOYSA-N heptan-2-yl [(5-chloroquinolin-8-yl)oxy]acetate Chemical group C1=CN=C2C(OCC(=O)OC(C)CCCCC)=CC=C(Cl)C2=C1 COYBRKAVBMYYSF-UHFFFAOYSA-N 0.000 claims description 6
- 125000004430 oxygen atom Chemical group O* 0.000 claims description 6
- VYNOULHXXDFBLU-UHFFFAOYSA-N Cumyluron Chemical compound C=1C=CC=CC=1C(C)(C)NC(=O)NCC1=CC=CC=C1Cl VYNOULHXXDFBLU-UHFFFAOYSA-N 0.000 claims description 5
- BWPYBAJTDILQPY-UHFFFAOYSA-N Methoxyphenone Chemical compound C1=C(C)C(OC)=CC=C1C(=O)C1=CC=CC(C)=C1 BWPYBAJTDILQPY-UHFFFAOYSA-N 0.000 claims description 5
- 125000000304 alkynyl group Chemical group 0.000 claims description 5
- 125000004995 haloalkylthio group Chemical group 0.000 claims description 5
- 125000001424 substituent group Chemical group 0.000 claims description 5
- 229910052717 sulfur Inorganic materials 0.000 claims description 5
- 235000013311 vegetables Nutrition 0.000 claims description 5
- WMMQJAQJAPXWDO-UHFFFAOYSA-N (4-chlorophenyl) n-methylcarbamate Chemical compound CNC(=O)OC1=CC=C(Cl)C=C1 WMMQJAQJAPXWDO-UHFFFAOYSA-N 0.000 claims description 4
- 125000000229 (C1-C4)alkoxy group Chemical group 0.000 claims description 4
- AHXUVTKVCMOKIX-UHFFFAOYSA-N 1-bromo-4-(chloromethylsulfonyl)benzene Chemical compound ClCS(=O)(=O)C1=CC=C(Br)C=C1 AHXUVTKVCMOKIX-UHFFFAOYSA-N 0.000 claims description 4
- GVNVAWHJIKLAGL-UHFFFAOYSA-N 2-(cyclohexen-1-yl)cyclohexan-1-one Chemical compound O=C1CCCCC1C1=CCCCC1 GVNVAWHJIKLAGL-UHFFFAOYSA-N 0.000 claims description 4
- 101150065749 Churc1 gene Proteins 0.000 claims description 4
- NRFQZTCQAYEXEE-UHFFFAOYSA-N Fenclorim Chemical compound ClC1=CC(Cl)=NC(C=2C=CC=CC=2)=N1 NRFQZTCQAYEXEE-UHFFFAOYSA-N 0.000 claims description 4
- 102100038239 Protein Churchill Human genes 0.000 claims description 4
- 150000007513 acids Chemical class 0.000 claims description 4
- 125000004453 alkoxycarbonyl group Chemical group 0.000 claims description 4
- MKQSWTQPLLCSOB-UHFFFAOYSA-N benzyl 2-chloro-4-(trifluoromethyl)-1,3-thiazole-5-carboxylate Chemical compound N1=C(Cl)SC(C(=O)OCC=2C=CC=CC=2)=C1C(F)(F)F MKQSWTQPLLCSOB-UHFFFAOYSA-N 0.000 claims description 4
- 125000000051 benzyloxy group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])O* 0.000 claims description 4
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- WCGGWVOVFQNRRS-UHFFFAOYSA-N dichloroacetamide Chemical compound NC(=O)C(Cl)Cl WCGGWVOVFQNRRS-UHFFFAOYSA-N 0.000 claims description 4
- ITGSCCPVERXFGN-UHFFFAOYSA-N isoxadifen Chemical compound C1C(C(=O)O)=NOC1(C=1C=CC=CC=1)C1=CC=CC=C1 ITGSCCPVERXFGN-UHFFFAOYSA-N 0.000 claims description 4
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 claims description 4
- LLBYUPOTPHGXIL-UHFFFAOYSA-N prop-2-enyl 1-oxa-4-azaspiro[4.5]decane-4-carbodithioate Chemical compound C=CCSC(=S)N1CCOC11CCCCC1 LLBYUPOTPHGXIL-UHFFFAOYSA-N 0.000 claims description 4
- 125000006677 (C1-C3) haloalkoxy group Chemical group 0.000 claims description 3
- 125000006656 (C2-C4) alkenyl group Chemical group 0.000 claims description 3
- JAXUXISKXAOIDD-UHFFFAOYSA-N 2-(5-chloroquinolin-8-yl)oxypropanedioic acid Chemical compound C1=CN=C2C(OC(C(=O)O)C(O)=O)=CC=C(Cl)C2=C1 JAXUXISKXAOIDD-UHFFFAOYSA-N 0.000 claims description 3
- KWGQOJWITMQEOT-UHFFFAOYSA-N 2-benzhydryloxyacetic acid Chemical class C=1C=CC=CC=1C(OCC(=O)O)C1=CC=CC=C1 KWGQOJWITMQEOT-UHFFFAOYSA-N 0.000 claims description 3
- ILTLVVKUKQEONT-UHFFFAOYSA-N 4-amino-3,5-dichloro-6-cyclopropylpyridine-2-carboxylic acid Chemical compound OC(=O)C1=C(Cl)C(N)=C(Cl)C(C2CC2)=N1 ILTLVVKUKQEONT-UHFFFAOYSA-N 0.000 claims description 3
- GKLDAXALUKMHMQ-UHFFFAOYSA-N 4-amino-3-chloro-6-cyclopropylpyridine-2-carboxylic acid Chemical compound OC(=O)C1=C(Cl)C(N)=CC(C2CC2)=N1 GKLDAXALUKMHMQ-UHFFFAOYSA-N 0.000 claims description 3
- GRSMWKLPSNHDHA-UHFFFAOYSA-N Naphthalic anhydride Chemical compound C1=CC(C(=O)OC2=O)=C3C2=CC=CC3=C1 GRSMWKLPSNHDHA-UHFFFAOYSA-N 0.000 claims description 3
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- PQUDHENXKDQHRE-UHFFFAOYSA-N methyl 4-amino-3,5-dichloro-6-cyclopropylpyridine-2-carboxylate Chemical compound NC1=C(Cl)C(C(=O)OC)=NC(C2CC2)=C1Cl PQUDHENXKDQHRE-UHFFFAOYSA-N 0.000 claims description 3
- RFEQCYNYINNDRQ-UHFFFAOYSA-N methyl 4-amino-3-chloro-6-cyclopropylpyridine-2-carboxylate Chemical compound NC1=C(Cl)C(C(=O)OC)=NC(C2CC2)=C1 RFEQCYNYINNDRQ-UHFFFAOYSA-N 0.000 claims description 3
- 125000006643 (C2-C6) haloalkenyl group Chemical group 0.000 claims description 2
- 125000006552 (C3-C8) cycloalkyl group Chemical group 0.000 claims description 2
- JJMZLVASVSISLC-UHFFFAOYSA-N 1,5-diphenylpyrazole-3-carboxylic acid Chemical class C=1C=CC=CC=1N1N=C(C(=O)O)C=C1C1=CC=CC=C1 JJMZLVASVSISLC-UHFFFAOYSA-N 0.000 claims description 2
- OHXLAOJLJWLEIP-UHFFFAOYSA-N 2-(dichloromethyl)-2-methyl-1,3-dioxolane Chemical compound ClC(Cl)C1(C)OCCO1 OHXLAOJLJWLEIP-UHFFFAOYSA-N 0.000 claims description 2
- PNKYIZBUGAZUHQ-UHFFFAOYSA-N 2-quinolin-8-yloxyacetic acid Chemical compound C1=CN=C2C(OCC(=O)O)=CC=CC2=C1 PNKYIZBUGAZUHQ-UHFFFAOYSA-N 0.000 claims description 2
- BBPCQVYYILTZAN-UHFFFAOYSA-N 3-(2h-tetrazole-5-carbonyl)-1h-quinolin-2-one Chemical class C=1C2=CC=CC=C2NC(=O)C=1C(=O)C1=NN=NN1 BBPCQVYYILTZAN-UHFFFAOYSA-N 0.000 claims description 2
- WVQFVFHYUXCSBD-UHFFFAOYSA-N 4-(2,3-dichlorophenyl)-1h-pyrazole-5-carboxylic acid Chemical class N1N=CC(C=2C(=C(Cl)C=CC=2)Cl)=C1C(=O)O WVQFVFHYUXCSBD-UHFFFAOYSA-N 0.000 claims description 2
- FAOFKIOARCDPBY-UHFFFAOYSA-N 4-(benzoylsulfamoyl)benzamide Chemical compound C1=CC(C(=O)N)=CC=C1S(=O)(=O)NC(=O)C1=CC=CC=C1 FAOFKIOARCDPBY-UHFFFAOYSA-N 0.000 claims description 2
- ZAYKVYVNMLEAMI-UHFFFAOYSA-N 4-(carboxymethyl)-2,3-dihydrochromene-4-carboxylic acid Chemical compound C1=CC=C2C(CC(=O)O)(C(O)=O)CCOC2=C1 ZAYKVYVNMLEAMI-UHFFFAOYSA-N 0.000 claims description 2
- AXEFJPAEQNOTOG-UHFFFAOYSA-N 4-amino-3-chloro-6-cyclopropyl-5-fluoropyridine-2-carboxylic acid Chemical compound OC(=O)C1=C(Cl)C(N)=C(F)C(C2CC2)=N1 AXEFJPAEQNOTOG-UHFFFAOYSA-N 0.000 claims description 2
- 125000004399 C1-C4 alkenyl group Chemical group 0.000 claims description 2
- 125000000882 C2-C6 alkenyl group Chemical group 0.000 claims description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 claims description 2
- LWOLGHMOQLJMIH-UHFFFAOYSA-N ClC1(C=C(NN1C1=CC=CC=C1)C(=O)O)Cl Chemical compound ClC1(C=C(NN1C1=CC=CC=C1)C(=O)O)Cl LWOLGHMOQLJMIH-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 230000009471 action Effects 0.000 claims description 2
- 238000009395 breeding Methods 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000001316 cycloalkyl alkyl group Chemical group 0.000 claims description 2
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 2
- XXWNKVBJDWSYBN-UHFFFAOYSA-N diethoxy-phenoxy-sulfanylidene-$l^{5}-phosphane Chemical compound CCOP(=S)(OCC)OC1=CC=CC=C1 XXWNKVBJDWSYBN-UHFFFAOYSA-N 0.000 claims description 2
- 239000011737 fluorine Substances 0.000 claims description 2
- 125000006277 halobenzyl group Chemical group 0.000 claims description 2
- FFRYUAVNPBUEIC-UHFFFAOYSA-N quinoxalin-2-ol Chemical class C1=CC=CC2=NC(O)=CN=C21 FFRYUAVNPBUEIC-UHFFFAOYSA-N 0.000 claims description 2
- 125000006559 (C1-C3) alkylamino group Chemical group 0.000 claims 1
- 125000004767 (C1-C4) haloalkoxy group Chemical group 0.000 claims 1
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 claims 1
- XCSKMKLNIBUVPP-UHFFFAOYSA-N 3,4-dihydroisothiochromen-1-one Chemical class C1=CC=C2C(=O)SCCC2=C1 XCSKMKLNIBUVPP-UHFFFAOYSA-N 0.000 claims 1
- VRODIKIAQUNGJI-UHFFFAOYSA-N 5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxylic acid Chemical compound C1C(C(=O)O)=NOC1C1=CC=CC=C1 VRODIKIAQUNGJI-UHFFFAOYSA-N 0.000 claims 1
- 230000001488 breeding effect Effects 0.000 claims 1
- 239000007858 starting material Substances 0.000 description 47
- 239000004009 herbicide Substances 0.000 description 41
- 150000003254 radicals Chemical class 0.000 description 36
- 239000004480 active ingredient Substances 0.000 description 21
- 238000009472 formulation Methods 0.000 description 20
- 235000010469 Glycine max Nutrition 0.000 description 14
- 240000008042 Zea mays Species 0.000 description 13
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 13
- 108090000623 proteins and genes Proteins 0.000 description 13
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 11
- 244000062793 Sorghum vulgare Species 0.000 description 10
- 150000002148 esters Chemical class 0.000 description 10
- 239000002689 soil Substances 0.000 description 10
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 9
- 235000005822 corn Nutrition 0.000 description 9
- 235000019713 millet Nutrition 0.000 description 9
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 8
- 235000013339 cereals Nutrition 0.000 description 8
- 244000068988 Glycine max Species 0.000 description 7
- 239000008187 granular material Substances 0.000 description 7
- 230000008569 process Effects 0.000 description 7
- 238000005507 spraying Methods 0.000 description 7
- IAJOBQBIJHVGMQ-UHFFFAOYSA-N 2-amino-4-[hydroxy(methyl)phosphoryl]butanoic acid Chemical compound CP(O)(=O)CCC(N)C(O)=O IAJOBQBIJHVGMQ-UHFFFAOYSA-N 0.000 description 6
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 6
- 244000075850 Avena orientalis Species 0.000 description 6
- 229920000742 Cotton Polymers 0.000 description 6
- 239000005562 Glyphosate Substances 0.000 description 6
- 244000299507 Gossypium hirsutum Species 0.000 description 6
- 240000005979 Hordeum vulgare Species 0.000 description 6
- 235000007340 Hordeum vulgare Nutrition 0.000 description 6
- 235000021307 Triticum Nutrition 0.000 description 6
- 241000209140 Triticum Species 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 6
- 150000007970 thio esters Chemical class 0.000 description 6
- WVQBLGZPHOPPFO-UHFFFAOYSA-N 2-chloro-N-(2-ethyl-6-methylphenyl)-N-(1-methoxypropan-2-yl)acetamide Chemical compound CCC1=CC=CC(C)=C1N(C(C)COC)C(=O)CCl WVQBLGZPHOPPFO-UHFFFAOYSA-N 0.000 description 5
- 235000007319 Avena orientalis Nutrition 0.000 description 5
- 241000219310 Beta vulgaris subsp. vulgaris Species 0.000 description 5
- 240000002791 Brassica napus Species 0.000 description 5
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- 239000005561 Glufosinate Substances 0.000 description 5
- 241000209056 Secale Species 0.000 description 5
- 235000007238 Secale cereale Nutrition 0.000 description 5
- 235000021536 Sugar beet Nutrition 0.000 description 5
- 239000000654 additive Substances 0.000 description 5
- 210000004027 cell Anatomy 0.000 description 5
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 5
- 230000014509 gene expression Effects 0.000 description 5
- XDDAORKBJWWYJS-UHFFFAOYSA-N glyphosate Chemical compound OC(=O)CNCP(O)(O)=O XDDAORKBJWWYJS-UHFFFAOYSA-N 0.000 description 5
- 229940097068 glyphosate Drugs 0.000 description 5
- 239000000843 powder Substances 0.000 description 5
- 150000003222 pyridines Chemical class 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- YRMLFORXOOIJDR-UHFFFAOYSA-N Dichlormid Chemical compound ClC(Cl)C(=O)N(CC=C)CC=C YRMLFORXOOIJDR-UHFFFAOYSA-N 0.000 description 4
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 4
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 4
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 4
- 241000219843 Pisum Species 0.000 description 4
- 240000003768 Solanum lycopersicum Species 0.000 description 4
- 235000002595 Solanum tuberosum Nutrition 0.000 description 4
- 244000061456 Solanum tuberosum Species 0.000 description 4
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 4
- 125000003282 alkyl amino group Chemical group 0.000 description 4
- 150000001721 carbon Chemical group 0.000 description 4
- 239000003795 chemical substances by application Substances 0.000 description 4
- ICJSJAJWTWPSBD-UHFFFAOYSA-N cloquintocet Chemical compound C1=CN=C2C(OCC(=O)O)=CC=C(Cl)C2=C1 ICJSJAJWTWPSBD-UHFFFAOYSA-N 0.000 description 4
- 235000013399 edible fruits Nutrition 0.000 description 4
- 229910052500 inorganic mineral Inorganic materials 0.000 description 4
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 4
- 235000009973 maize Nutrition 0.000 description 4
- 239000000575 pesticide Substances 0.000 description 4
- 230000000885 phytotoxic effect Effects 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 239000000047 product Substances 0.000 description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N silicon dioxide Inorganic materials O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 4
- 239000002904 solvent Substances 0.000 description 4
- 239000000725 suspension Substances 0.000 description 4
- WFVUIONFJOAYPK-SDNWHVSQSA-N (z)-n-(1,3-dioxolan-2-ylmethoxy)benzenecarboximidoyl cyanide Chemical compound C=1C=CC=CC=1C(/C#N)=N/OCC1OCCO1 WFVUIONFJOAYPK-SDNWHVSQSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- CAAMSDWKXXPUJR-UHFFFAOYSA-N 3,5-dihydro-4H-imidazol-4-one Chemical compound O=C1CNC=N1 CAAMSDWKXXPUJR-UHFFFAOYSA-N 0.000 description 3
- HBAQYPYDRFILMT-UHFFFAOYSA-N 8-[3-(1-cyclopropylpyrazol-4-yl)-1H-pyrazolo[4,3-d]pyrimidin-5-yl]-3-methyl-3,8-diazabicyclo[3.2.1]octan-2-one Chemical class C1(CC1)N1N=CC(=C1)C1=NNC2=C1N=C(N=C2)N1C2C(N(CC1CC2)C)=O HBAQYPYDRFILMT-UHFFFAOYSA-N 0.000 description 3
- 108010000700 Acetolactate synthase Proteins 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 3
- 235000006008 Brassica napus var napus Nutrition 0.000 description 3
- 108091026890 Coding region Proteins 0.000 description 3
- 108020004414 DNA Proteins 0.000 description 3
- 102000004190 Enzymes Human genes 0.000 description 3
- 108090000790 Enzymes Proteins 0.000 description 3
- 235000003222 Helianthus annuus Nutrition 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 108091028043 Nucleic acid sequence Proteins 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- 240000000111 Saccharum officinarum Species 0.000 description 3
- 235000007201 Saccharum officinarum Nutrition 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- 239000003905 agrochemical Substances 0.000 description 3
- 125000004183 alkoxy alkyl group Chemical group 0.000 description 3
- 125000005081 alkoxyalkoxyalkyl group Chemical group 0.000 description 3
- 125000005119 alkyl cycloalkyl group Chemical group 0.000 description 3
- 150000003863 ammonium salts Chemical class 0.000 description 3
- MXWJVTOOROXGIU-UHFFFAOYSA-N atrazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)C)=N1 MXWJVTOOROXGIU-UHFFFAOYSA-N 0.000 description 3
- 239000000969 carrier Substances 0.000 description 3
- 235000014113 dietary fatty acids Nutrition 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- 150000002170 ethers Chemical class 0.000 description 3
- 125000004494 ethyl ester group Chemical group 0.000 description 3
- 239000000194 fatty acid Substances 0.000 description 3
- 229930195729 fatty acid Natural products 0.000 description 3
- 230000012010 growth Effects 0.000 description 3
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 3
- 108020004707 nucleic acids Proteins 0.000 description 3
- 150000007523 nucleic acids Chemical class 0.000 description 3
- 102000039446 nucleic acids Human genes 0.000 description 3
- 230000003647 oxidation Effects 0.000 description 3
- 238000007254 oxidation reaction Methods 0.000 description 3
- 230000008635 plant growth Effects 0.000 description 3
- 239000011814 protection agent Substances 0.000 description 3
- 239000011734 sodium Substances 0.000 description 3
- 229910052708 sodium Inorganic materials 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 238000009331 sowing Methods 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 150000003460 sulfonic acids Chemical class 0.000 description 3
- 238000012360 testing method Methods 0.000 description 3
- PYKLUAIDKVVEOS-JLHYYAGUSA-N (z)-n-(cyanomethoxy)benzenecarboximidoyl cyanide Chemical compound N#CCO\N=C(/C#N)C1=CC=CC=C1 PYKLUAIDKVVEOS-JLHYYAGUSA-N 0.000 description 2
- HKELWJONQIFBPO-UHFFFAOYSA-N 1-(2,4-dichlorophenyl)-5-(trichloromethyl)-1,2,4-triazole-3-carboxylic acid Chemical compound N1=C(C(=O)O)N=C(C(Cl)(Cl)Cl)N1C1=CC=C(Cl)C=C1Cl HKELWJONQIFBPO-UHFFFAOYSA-N 0.000 description 2
- LPVPNRSVMLNXGQ-UHFFFAOYSA-N 1-(azepan-1-yl)-2,2-dichloroethanone Chemical compound ClC(Cl)C(=O)N1CCCCCC1 LPVPNRSVMLNXGQ-UHFFFAOYSA-N 0.000 description 2
- OSJDGTBABDLNIN-UHFFFAOYSA-N 1-ethyl-4-hydroxy-3-(2h-tetrazole-5-carbonyl)quinolin-2-one Chemical compound O=C1N(CC)C2=CC=CC=C2C(O)=C1C(=O)C1=NN=NN1 OSJDGTBABDLNIN-UHFFFAOYSA-N 0.000 description 2
- WXGFRIMZEZRKFH-UHFFFAOYSA-N 1h-isothiochromen-4-one Chemical compound C1=CC=C2C(=O)CSCC2=C1 WXGFRIMZEZRKFH-UHFFFAOYSA-N 0.000 description 2
- QWWHRELOCZEQNZ-UHFFFAOYSA-N 2,2-dichloro-1-(1-oxa-4-azaspiro[4.5]decan-4-yl)ethanone Chemical compound ClC(Cl)C(=O)N1CCOC11CCCCC1 QWWHRELOCZEQNZ-UHFFFAOYSA-N 0.000 description 2
- UIAFKZKHHVMJGS-UHFFFAOYSA-N 2,4-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1O UIAFKZKHHVMJGS-UHFFFAOYSA-N 0.000 description 2
- KRQUFUKTQHISJB-YYADALCUSA-N 2-[(E)-N-[2-(4-chlorophenoxy)propoxy]-C-propylcarbonimidoyl]-3-hydroxy-5-(thian-3-yl)cyclohex-2-en-1-one Chemical compound CCC\C(=N/OCC(C)OC1=CC=C(Cl)C=C1)C1=C(O)CC(CC1=O)C1CCCSC1 KRQUFUKTQHISJB-YYADALCUSA-N 0.000 description 2
- YIWUKEYIRIRTPP-UHFFFAOYSA-N 2-ethylhexan-1-ol Chemical compound CCCCC(CC)CO YIWUKEYIRIRTPP-UHFFFAOYSA-N 0.000 description 2
- LOHXCLHVVJGTLU-UHFFFAOYSA-N 2-oxopropyl 2-(5-chloroquinolin-8-yl)oxyacetate Chemical compound C1=CN=C2C(OCC(=O)OCC(=O)C)=CC=C(Cl)C2=C1 LOHXCLHVVJGTLU-UHFFFAOYSA-N 0.000 description 2
- UYEMGAFJOZZIFP-UHFFFAOYSA-N 3,5-dihydroxybenzoic acid Chemical compound OC(=O)C1=CC(O)=CC(O)=C1 UYEMGAFJOZZIFP-UHFFFAOYSA-N 0.000 description 2
- 241001133760 Acoelorraphe Species 0.000 description 2
- 235000005254 Allium ampeloprasum Nutrition 0.000 description 2
- 240000006108 Allium ampeloprasum Species 0.000 description 2
- 244000291564 Allium cepa Species 0.000 description 2
- 235000002732 Allium cepa var. cepa Nutrition 0.000 description 2
- 235000003911 Arachis Nutrition 0.000 description 2
- 244000105624 Arachis hypogaea Species 0.000 description 2
- 240000007124 Brassica oleracea Species 0.000 description 2
- 235000003899 Brassica oleracea var acephala Nutrition 0.000 description 2
- 235000011301 Brassica oleracea var capitata Nutrition 0.000 description 2
- 235000001169 Brassica oleracea var oleracea Nutrition 0.000 description 2
- 235000004977 Brassica sinapistrum Nutrition 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- 241000207199 Citrus Species 0.000 description 2
- 240000007154 Coffea arabica Species 0.000 description 2
- 244000000626 Daucus carota Species 0.000 description 2
- 235000002767 Daucus carota Nutrition 0.000 description 2
- 239000005504 Dicamba Substances 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 239000004606 Fillers/Extenders Substances 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- 239000004471 Glycine Substances 0.000 description 2
- 244000020551 Helianthus annuus Species 0.000 description 2
- 244000043261 Hevea brasiliensis Species 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 239000005567 Imazosulfuron Substances 0.000 description 2
- NAGRVUXEKKZNHT-UHFFFAOYSA-N Imazosulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2N3C=CC=CC3=NC=2Cl)=N1 NAGRVUXEKKZNHT-UHFFFAOYSA-N 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- 240000003183 Manihot esculenta Species 0.000 description 2
- 235000016735 Manihot esculenta subsp esculenta Nutrition 0.000 description 2
- 240000005561 Musa balbisiana Species 0.000 description 2
- 241000219833 Phaseolus Species 0.000 description 2
- 235000010582 Pisum sativum Nutrition 0.000 description 2
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 2
- YLPGTOIOYRQOHV-UHFFFAOYSA-N Pretilachlor Chemical compound CCCOCCN(C(=O)CCl)C1=C(CC)C=CC=C1CC YLPGTOIOYRQOHV-UHFFFAOYSA-N 0.000 description 2
- 229940100389 Sulfonylurea Drugs 0.000 description 2
- 244000269722 Thea sinensis Species 0.000 description 2
- 241000219873 Vicia Species 0.000 description 2
- 241001464837 Viridiplantae Species 0.000 description 2
- CIUQDSCDWFSTQR-UHFFFAOYSA-N [C]1=CC=CC=C1 Chemical compound [C]1=CC=CC=C1 CIUQDSCDWFSTQR-UHFFFAOYSA-N 0.000 description 2
- XCSGPAVHZFQHGE-UHFFFAOYSA-N alachlor Chemical compound CCC1=CC=CC(CC)=C1N(COC)C(=O)CCl XCSGPAVHZFQHGE-UHFFFAOYSA-N 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- 125000002877 alkyl aryl group Chemical group 0.000 description 2
- 239000000729 antidote Substances 0.000 description 2
- 235000021015 bananas Nutrition 0.000 description 2
- LVKBXDHACCFCTA-UHFFFAOYSA-N bencarbazone Chemical compound C1=C(C(N)=S)C(NS(=O)(=O)CC)=CC(N2C(N(C)C(=N2)C(F)(F)F)=O)=C1F LVKBXDHACCFCTA-UHFFFAOYSA-N 0.000 description 2
- 150000001735 carboxylic acids Chemical class 0.000 description 2
- 150000001768 cations Chemical class 0.000 description 2
- PNCNFDRSHBFIDM-WOJGMQOQSA-N chembl111617 Chemical compound C=CCO\N=C(/CCC)C1=C(O)C(C(=O)OC)C(C)(C)CC1=O PNCNFDRSHBFIDM-WOJGMQOQSA-N 0.000 description 2
- 229920003211 cis-1,4-polyisoprene Polymers 0.000 description 2
- 235000020971 citrus fruits Nutrition 0.000 description 2
- 235000016213 coffee Nutrition 0.000 description 2
- 235000013353 coffee beverage Nutrition 0.000 description 2
- MZZBPDKVEFVLFF-UHFFFAOYSA-N cyanazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)(C)C#N)=N1 MZZBPDKVEFVLFF-UHFFFAOYSA-N 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- IWEDIXLBFLAXBO-UHFFFAOYSA-N dicamba Chemical compound COC1=C(Cl)C=CC(Cl)=C1C(O)=O IWEDIXLBFLAXBO-UHFFFAOYSA-N 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 2
- 238000007598 dipping method Methods 0.000 description 2
- 201000010099 disease Diseases 0.000 description 2
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 description 2
- 239000002270 dispersing agent Substances 0.000 description 2
- 239000000975 dye Substances 0.000 description 2
- 239000000839 emulsion Substances 0.000 description 2
- DNJIEGIFACGWOD-UHFFFAOYSA-N ethanethiol Chemical compound CCS DNJIEGIFACGWOD-UHFFFAOYSA-N 0.000 description 2
- ZKDUJUNNBWZZCO-UHFFFAOYSA-N ethyl 5-[(2,4-dichlorophenyl)methyl]-4,5-dihydro-1,2-oxazole-3-carboxylate Chemical compound C1C(C(=O)OCC)=NOC1CC1=CC=C(Cl)C=C1Cl ZKDUJUNNBWZZCO-UHFFFAOYSA-N 0.000 description 2
- YNZGZAJXHXGDBF-UHFFFAOYSA-N ethyl 5-phenyl-4,5-dihydro-1,2-oxazole-3-carboxylate Chemical compound C1C(C(=O)OCC)=NOC1C1=CC=CC=C1 YNZGZAJXHXGDBF-UHFFFAOYSA-N 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 239000006260 foam Substances 0.000 description 2
- 239000012634 fragment Substances 0.000 description 2
- 239000000417 fungicide Substances 0.000 description 2
- 238000010353 genetic engineering Methods 0.000 description 2
- 230000035784 germination Effects 0.000 description 2
- 239000002917 insecticide Substances 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 239000003621 irrigation water Substances 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 235000021374 legumes Nutrition 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 230000004807 localization Effects 0.000 description 2
- 230000007774 longterm Effects 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- LQPRNRFJJUSONA-UHFFFAOYSA-N methyl 2-benzhydryloxyacetate Chemical compound C=1C=CC=CC=1C(OCC(=O)OC)C1=CC=CC=C1 LQPRNRFJJUSONA-UHFFFAOYSA-N 0.000 description 2
- 239000011707 mineral Substances 0.000 description 2
- 239000002480 mineral oil Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 235000015097 nutrients Nutrition 0.000 description 2
- 235000014571 nuts Nutrition 0.000 description 2
- 239000002420 orchard Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 239000003415 peat Substances 0.000 description 2
- 238000005554 pickling Methods 0.000 description 2
- 102000004169 proteins and genes Human genes 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 239000004575 stone Substances 0.000 description 2
- 230000008961 swelling Effects 0.000 description 2
- JMSVCTWVEWCHDZ-UHFFFAOYSA-N syringic acid Chemical compound COC1=CC(C(O)=O)=CC(OC)=C1O JMSVCTWVEWCHDZ-UHFFFAOYSA-N 0.000 description 2
- 235000013616 tea Nutrition 0.000 description 2
- 239000003053 toxin Substances 0.000 description 2
- 231100000765 toxin Toxicity 0.000 description 2
- 108700012359 toxins Proteins 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- IPPAUTOBDWNELX-UHFFFAOYSA-N (2-ethoxy-2-oxoethyl) 5-[2-chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoate Chemical group C1=C([N+]([O-])=O)C(C(=O)OCC(=O)OCC)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 IPPAUTOBDWNELX-UHFFFAOYSA-N 0.000 description 1
- NYHLMHAKWBUZDY-QMMMGPOBSA-N (2s)-2-[2-chloro-5-[2-chloro-4-(trifluoromethyl)phenoxy]benzoyl]oxypropanoic acid Chemical compound C1=C(Cl)C(C(=O)O[C@@H](C)C(O)=O)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 NYHLMHAKWBUZDY-QMMMGPOBSA-N 0.000 description 1
- LNGRZPZKVUBWQV-UHFFFAOYSA-N (4-chloro-2-methylsulfonylphenyl)-(5-cyclopropyl-1,2-oxazol-4-yl)methanone Chemical compound CS(=O)(=O)C1=CC(Cl)=CC=C1C(=O)C1=C(C2CC2)ON=C1 LNGRZPZKVUBWQV-UHFFFAOYSA-N 0.000 description 1
- 125000004641 (C1-C12) haloalkyl group Chemical group 0.000 description 1
- MZHCENGPTKEIGP-RXMQYKEDSA-N (R)-dichlorprop Chemical compound OC(=O)[C@@H](C)OC1=CC=C(Cl)C=C1Cl MZHCENGPTKEIGP-RXMQYKEDSA-N 0.000 description 1
- WNTGYJSOUMFZEP-SSDOTTSWSA-N (R)-mecoprop Chemical compound OC(=O)[C@@H](C)OC1=CC=C(Cl)C=C1C WNTGYJSOUMFZEP-SSDOTTSWSA-N 0.000 description 1
- ADDQHLREJDZPMT-AWEZNQCLSA-N (S)-metamifop Chemical compound O=C([C@@H](OC=1C=CC(OC=2OC3=CC(Cl)=CC=C3N=2)=CC=1)C)N(C)C1=CC=CC=C1F ADDQHLREJDZPMT-AWEZNQCLSA-N 0.000 description 1
- WVQBLGZPHOPPFO-LBPRGKRZSA-N (S)-metolachlor Chemical compound CCC1=CC=CC(C)=C1N([C@@H](C)COC)C(=O)CCl WVQBLGZPHOPPFO-LBPRGKRZSA-N 0.000 description 1
- 108091032973 (ribonucleotides)n+m Proteins 0.000 description 1
- XBYZOHTXPQOOJM-UHFFFAOYSA-N 1,2-oxazol-3-yl(phenyl)methanone Chemical compound C=1C=CC=CC=1C(=O)C=1C=CON=1 XBYZOHTXPQOOJM-UHFFFAOYSA-N 0.000 description 1
- ZJZBVJYILZVGMG-UHFFFAOYSA-N 1-(2,4-dichlorophenyl)-5-ethoxycarbonyl-5-methyl-4h-pyrazole-3-carboxylic acid Chemical compound CCOC(=O)C1(C)CC(C(O)=O)=NN1C1=CC=C(Cl)C=C1Cl ZJZBVJYILZVGMG-UHFFFAOYSA-N 0.000 description 1
- DHYXNIKICPUXJI-UHFFFAOYSA-N 1-(2,4-dichlorophenyl)-n-(2,4-difluorophenyl)-5-oxo-n-propan-2-yl-1,2,4-triazole-4-carboxamide Chemical compound C=1C=C(F)C=C(F)C=1N(C(C)C)C(=O)N(C1=O)C=NN1C1=CC=C(Cl)C=C1Cl DHYXNIKICPUXJI-UHFFFAOYSA-N 0.000 description 1
- CJIUSUMMIWIYMH-UHFFFAOYSA-N 1-(2-aminoethyl)-3-thiophen-2-ylquinoxalin-2-one;hydrochloride Chemical compound Cl.O=C1N(CCN)C2=CC=CC=C2N=C1C1=CC=CS1 CJIUSUMMIWIYMH-UHFFFAOYSA-N 0.000 description 1
- PYCINWWWERDNKE-UHFFFAOYSA-N 1-(2-chloro-6-propylimidazo[1,2-b]pyridazin-3-yl)sulfonyl-3-(4,6-dimethoxypyrimidin-2-yl)urea Chemical compound N12N=C(CCC)C=CC2=NC(Cl)=C1S(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 PYCINWWWERDNKE-UHFFFAOYSA-N 0.000 description 1
- RBSXHDIPCIWOMG-UHFFFAOYSA-N 1-(4,6-dimethoxypyrimidin-2-yl)-3-(2-ethylsulfonylimidazo[1,2-a]pyridin-3-yl)sulfonylurea Chemical compound CCS(=O)(=O)C=1N=C2C=CC=CN2C=1S(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 RBSXHDIPCIWOMG-UHFFFAOYSA-N 0.000 description 1
- KBPLFHHGFOOTCA-UHFFFAOYSA-N 1-Octanol Chemical class CCCCCCCCO KBPLFHHGFOOTCA-UHFFFAOYSA-N 0.000 description 1
- IXWKBUKANTXHJH-UHFFFAOYSA-N 1-[5-chloro-2-methyl-4-(5-methyl-5,6-dihydro-1,4,2-dioxazin-3-yl)pyrazol-3-yl]sulfonyl-3-(4,6-dimethoxypyrimidin-2-yl)urea Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2N(N=C(Cl)C=2C=2OC(C)CON=2)C)=N1 IXWKBUKANTXHJH-UHFFFAOYSA-N 0.000 description 1
- ZKFARSBUEBZZJT-UHFFFAOYSA-N 1-butoxypropan-2-yl 2-(4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxyacetate Chemical group CCCCOCC(C)OC(=O)COC1=NC(F)=C(Cl)C(N)=C1Cl ZKFARSBUEBZZJT-UHFFFAOYSA-N 0.000 description 1
- IPBFEHWNKZHUSY-UHFFFAOYSA-N 1-methyl-3-thiophen-2-ylquinoxalin-2-one Chemical compound O=C1N(C)C2=CC=CC=C2N=C1C1=CC=CS1 IPBFEHWNKZHUSY-UHFFFAOYSA-N 0.000 description 1
- VOWPJWPJWXZTID-UHFFFAOYSA-N 1-methyl-3-thiophen-2-ylquinoxaline-2-thione Chemical compound S=C1N(C)C2=CC=CC=C2N=C1C1=CC=CS1 VOWPJWPJWXZTID-UHFFFAOYSA-N 0.000 description 1
- VCSWZXSTJNUEPD-UHFFFAOYSA-N 1-o-ethyl 3-o-methyl 2-(5-chloroquinolin-8-yl)oxypropanedioate Chemical compound C1=CN=C2C(OC(C(=O)OCC)C(=O)OC)=CC=C(Cl)C2=C1 VCSWZXSTJNUEPD-UHFFFAOYSA-N 0.000 description 1
- KOPFEFZSAMLEHK-UHFFFAOYSA-N 1h-pyrazole-5-carboxylic acid Chemical class OC(=O)C=1C=CNN=1 KOPFEFZSAMLEHK-UHFFFAOYSA-N 0.000 description 1
- QQNIGXQDICUWGT-UHFFFAOYSA-N 2,2-dichloro-1-(1-oxa-3-azaspiro[4.5]decan-3-yl)ethanone Chemical compound C1N(C(=O)C(Cl)Cl)COC21CCCCC2 QQNIGXQDICUWGT-UHFFFAOYSA-N 0.000 description 1
- ZAWPDPLWGKAAHU-UHFFFAOYSA-N 2,2-dichloro-n-[2-oxo-2-(prop-2-enylamino)ethyl]-n-prop-2-enylacetamide Chemical compound ClC(Cl)C(=O)N(CC=C)CC(=O)NCC=C ZAWPDPLWGKAAHU-UHFFFAOYSA-N 0.000 description 1
- KNGWEAQJZJKFLI-UHFFFAOYSA-N 2,2-dimethyl-4h-1,3-benzodioxine-6-carbaldehyde Chemical compound O=CC1=CC=C2OC(C)(C)OCC2=C1 KNGWEAQJZJKFLI-UHFFFAOYSA-N 0.000 description 1
- 239000005631 2,4-Dichlorophenoxyacetic acid Substances 0.000 description 1
- YOYAIZYFCNQIRF-UHFFFAOYSA-N 2,6-dichlorobenzonitrile Chemical compound ClC1=CC=CC(Cl)=C1C#N YOYAIZYFCNQIRF-UHFFFAOYSA-N 0.000 description 1
- BDQWWOHKFDSADC-UHFFFAOYSA-N 2-(2,4-dichloro-3-methylphenoxy)-n-phenylpropanamide Chemical compound C=1C=CC=CC=1NC(=O)C(C)OC1=CC=C(Cl)C(C)=C1Cl BDQWWOHKFDSADC-UHFFFAOYSA-N 0.000 description 1
- MZHCENGPTKEIGP-UHFFFAOYSA-N 2-(2,4-dichlorophenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1Cl MZHCENGPTKEIGP-UHFFFAOYSA-N 0.000 description 1
- WNTGYJSOUMFZEP-UHFFFAOYSA-N 2-(4-chloro-2-methylphenoxy)propanoic acid Chemical compound OC(=O)C(C)OC1=CC=C(Cl)C=C1C WNTGYJSOUMFZEP-UHFFFAOYSA-N 0.000 description 1
- NUPJIGQFXCQJBK-UHFFFAOYSA-N 2-(4-isopropyl-4-methyl-5-oxo-4,5-dihydro-1H-imidazol-2-yl)-5-(methoxymethyl)nicotinic acid Chemical compound OC(=O)C1=CC(COC)=CN=C1C1=NC(C)(C(C)C)C(=O)N1 NUPJIGQFXCQJBK-UHFFFAOYSA-N 0.000 description 1
- CLQMBPJKHLGMQK-UHFFFAOYSA-N 2-(4-isopropyl-4-methyl-5-oxo-4,5-dihydro-1H-imidazol-2-yl)nicotinic acid Chemical compound N1C(=O)C(C(C)C)(C)N=C1C1=NC=CC=C1C(O)=O CLQMBPJKHLGMQK-UHFFFAOYSA-N 0.000 description 1
- GOCUAJYOYBLQRH-UHFFFAOYSA-N 2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=NC=C(C(F)(F)F)C=C1Cl GOCUAJYOYBLQRH-UHFFFAOYSA-N 0.000 description 1
- YUVKUEAFAVKILW-UHFFFAOYSA-N 2-(4-{[5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoic acid Chemical compound C1=CC(OC(C)C(O)=O)=CC=C1OC1=CC=C(C(F)(F)F)C=N1 YUVKUEAFAVKILW-UHFFFAOYSA-N 0.000 description 1
- IRJQWZWMQCVOLA-ZBKNUEDVSA-N 2-[(z)-n-[(3,5-difluorophenyl)carbamoylamino]-c-methylcarbonimidoyl]pyridine-3-carboxylic acid Chemical compound N=1C=CC=C(C(O)=O)C=1C(/C)=N\NC(=O)NC1=CC(F)=CC(F)=C1 IRJQWZWMQCVOLA-ZBKNUEDVSA-N 0.000 description 1
- CABMTIJINOIHOD-UHFFFAOYSA-N 2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]quinoline-3-carboxylic acid Chemical compound N1C(=O)C(C(C)C)(C)N=C1C1=NC2=CC=CC=C2C=C1C(O)=O CABMTIJINOIHOD-UHFFFAOYSA-N 0.000 description 1
- IQWMUTFHGXREBR-UHFFFAOYSA-N 2-[5-(5-tert-butyl-2-oxo-1,3,4-oxadiazol-3-yl)-2,4-dichlorophenoxy]acetonitrile Chemical group O=C1OC(C(C)(C)C)=NN1C1=CC(OCC#N)=C(Cl)C=C1Cl IQWMUTFHGXREBR-UHFFFAOYSA-N 0.000 description 1
- BOBATFKNMFWLFG-UHFFFAOYSA-N 2-amino-2-cyano-n-methylacetamide Chemical compound CNC(=O)C(N)C#N BOBATFKNMFWLFG-UHFFFAOYSA-N 0.000 description 1
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 1
- JLYFCTQDENRSOL-UHFFFAOYSA-N 2-chloro-N-(2,4-dimethylthiophen-3-yl)-N-(1-methoxypropan-2-yl)acetamide Chemical compound COCC(C)N(C(=O)CCl)C=1C(C)=CSC=1C JLYFCTQDENRSOL-UHFFFAOYSA-N 0.000 description 1
- KZNDFYDURHAESM-UHFFFAOYSA-N 2-chloro-n-(2-ethyl-6-methylphenyl)-n-(propan-2-yloxymethyl)acetamide Chemical compound CCC1=CC=CC(C)=C1N(COC(C)C)C(=O)CCl KZNDFYDURHAESM-UHFFFAOYSA-N 0.000 description 1
- IRCMYGHHKLLGHV-UHFFFAOYSA-N 2-ethoxy-3,3-dimethyl-2,3-dihydro-1-benzofuran-5-yl methanesulfonate Chemical compound C1=C(OS(C)(=O)=O)C=C2C(C)(C)C(OCC)OC2=C1 IRCMYGHHKLLGHV-UHFFFAOYSA-N 0.000 description 1
- MIJLZGZLQLAQCM-UHFFFAOYSA-N 2-ethoxyethyl 2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate Chemical group C1=CC(OC(C)C(=O)OCCOCC)=CC=C1OC1=NC=C(C(F)(F)F)C=C1Cl MIJLZGZLQLAQCM-UHFFFAOYSA-N 0.000 description 1
- 125000000175 2-thienyl group Chemical group S1C([*])=C([H])C([H])=C1[H] 0.000 description 1
- UFAPVJDEYHLLBG-UHFFFAOYSA-N 2-{2-chloro-4-(methylsulfonyl)-3-[(tetrahydrofuran-2-ylmethoxy)methyl]benzoyl}cyclohexane-1,3-dione Chemical compound ClC1=C(COCC2OCCC2)C(S(=O)(=O)C)=CC=C1C(=O)C1C(=O)CCCC1=O UFAPVJDEYHLLBG-UHFFFAOYSA-N 0.000 description 1
- UPMXNNIRAGDFEH-UHFFFAOYSA-N 3,5-dibromo-4-hydroxybenzonitrile Chemical compound OC1=C(Br)C=C(C#N)C=C1Br UPMXNNIRAGDFEH-UHFFFAOYSA-N 0.000 description 1
- MEBWABJHRAYGFW-UHFFFAOYSA-N 3-(2,4-dichlorophenyl)prop-2-enoic acid Chemical compound OC(=O)C=CC1=CC=C(Cl)C=C1Cl MEBWABJHRAYGFW-UHFFFAOYSA-N 0.000 description 1
- XMTQQYYKAHVGBJ-UHFFFAOYSA-N 3-(3,4-DICHLOROPHENYL)-1,1-DIMETHYLUREA Chemical compound CN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XMTQQYYKAHVGBJ-UHFFFAOYSA-N 0.000 description 1
- 108010020183 3-phosphoshikimate 1-carboxyvinyltransferase Proteins 0.000 description 1
- TTZOLDXHOCCNMF-UHFFFAOYSA-N 4-fluoro-2-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(F)C=C1O TTZOLDXHOCCNMF-UHFFFAOYSA-N 0.000 description 1
- 125000001255 4-fluorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1F 0.000 description 1
- ZOQWKQZKRNTDHF-UHFFFAOYSA-N 4-hydroxy-1-methyl-3-(2h-tetrazole-5-carbonyl)quinolin-2-one Chemical compound O=C1N(C)C2=CC=CC=C2C(O)=C1C(=O)C1=NN=NN1 ZOQWKQZKRNTDHF-UHFFFAOYSA-N 0.000 description 1
- QMNWXSUXINMZIM-UHFFFAOYSA-N 4-methylpentan-2-yl 2-(5-chloroquinolin-8-yl)oxyacetate Chemical compound C1=CN=C2C(OCC(=O)OC(C)CC(C)C)=CC=C(Cl)C2=C1 QMNWXSUXINMZIM-UHFFFAOYSA-N 0.000 description 1
- NYRMIJKDBAQCHC-UHFFFAOYSA-N 5-(methylamino)-2-phenyl-4-[3-(trifluoromethyl)phenyl]furan-3(2H)-one Chemical compound O1C(NC)=C(C=2C=C(C=CC=2)C(F)(F)F)C(=O)C1C1=CC=CC=C1 NYRMIJKDBAQCHC-UHFFFAOYSA-N 0.000 description 1
- CTSLUCNDVMMDHG-UHFFFAOYSA-N 5-bromo-3-(butan-2-yl)-6-methylpyrimidine-2,4(1H,3H)-dione Chemical compound CCC(C)N1C(=O)NC(C)=C(Br)C1=O CTSLUCNDVMMDHG-UHFFFAOYSA-N 0.000 description 1
- PVSGXWMWNRGTKE-UHFFFAOYSA-N 5-methyl-2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid Chemical compound N1C(=O)C(C(C)C)(C)N=C1C1=NC=C(C)C=C1C(O)=O PVSGXWMWNRGTKE-UHFFFAOYSA-N 0.000 description 1
- ZUSHSDOEVHPTCU-UHFFFAOYSA-N 6-chloro-3-phenyl-1h-pyridazin-4-one Chemical compound N1C(Cl)=CC(=O)C(C=2C=CC=CC=2)=N1 ZUSHSDOEVHPTCU-UHFFFAOYSA-N 0.000 description 1
- 241000219144 Abutilon Species 0.000 description 1
- 244000215068 Acacia senegal Species 0.000 description 1
- VTNQPKFIQCLBDU-UHFFFAOYSA-N Acetochlor Chemical compound CCOCN(C(=O)CCl)C1=C(C)C=CC=C1CC VTNQPKFIQCLBDU-UHFFFAOYSA-N 0.000 description 1
- 102000000452 Acetyl-CoA carboxylase Human genes 0.000 description 1
- 108010016219 Acetyl-CoA carboxylase Proteins 0.000 description 1
- 239000002890 Aclonifen Substances 0.000 description 1
- 241000209136 Agropyron Species 0.000 description 1
- 241000743339 Agrostis Species 0.000 description 1
- XKJMBINCVNINCA-UHFFFAOYSA-N Alfalone Chemical compound CON(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 XKJMBINCVNINCA-UHFFFAOYSA-N 0.000 description 1
- RGCKGOZRHPZPFP-UHFFFAOYSA-N Alizarin Natural products C1=CC=C2C(=O)C3=C(O)C(O)=CC=C3C(=O)C2=C1 RGCKGOZRHPZPFP-UHFFFAOYSA-N 0.000 description 1
- 241000743985 Alopecurus Species 0.000 description 1
- 241000219318 Amaranthus Species 0.000 description 1
- 239000003666 Amidosulfuron Substances 0.000 description 1
- CTTHWASMBLQOFR-UHFFFAOYSA-N Amidosulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)N(C)S(C)(=O)=O)=N1 CTTHWASMBLQOFR-UHFFFAOYSA-N 0.000 description 1
- 239000005468 Aminopyralid Substances 0.000 description 1
- KLSJWNVTNUYHDU-UHFFFAOYSA-N Amitrole Chemical compound NC1=NC=NN1 KLSJWNVTNUYHDU-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- NXQDBZGWYSEGFL-UHFFFAOYSA-N Anilofos Chemical compound COP(=S)(OC)SCC(=O)N(C(C)C)C1=CC=C(Cl)C=C1 NXQDBZGWYSEGFL-UHFFFAOYSA-N 0.000 description 1
- 241000404028 Anthemis Species 0.000 description 1
- 108020005544 Antisense RNA Proteins 0.000 description 1
- 241001666377 Apera Species 0.000 description 1
- 235000005781 Avena Nutrition 0.000 description 1
- 239000005469 Azimsulfuron Substances 0.000 description 1
- 241000193388 Bacillus thuringiensis Species 0.000 description 1
- 241000894006 Bacteria Species 0.000 description 1
- 239000005472 Bensulfuron methyl Substances 0.000 description 1
- 239000005476 Bentazone Substances 0.000 description 1
- JDWQITFHZOBBFE-UHFFFAOYSA-N Benzofenap Chemical compound C=1C=C(Cl)C(C)=C(Cl)C=1C(=O)C=1C(C)=NN(C)C=1OCC(=O)C1=CC=C(C)C=C1 JDWQITFHZOBBFE-UHFFFAOYSA-N 0.000 description 1
- 239000005484 Bifenox Substances 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 241000611157 Brachiaria Species 0.000 description 1
- 241000339490 Brachyachne Species 0.000 description 1
- XTFNPKDYCLFGPV-OMCISZLKSA-N Bromofenoxim Chemical compound C1=C(Br)C(O)=C(Br)C=C1\C=N\OC1=CC=C([N+]([O-])=O)C=C1[N+]([O-])=O XTFNPKDYCLFGPV-OMCISZLKSA-N 0.000 description 1
- 239000005489 Bromoxynil Substances 0.000 description 1
- 241000209200 Bromus Species 0.000 description 1
- SPNQRCTZKIBOAX-UHFFFAOYSA-N Butralin Chemical compound CCC(C)NC1=C([N+]([O-])=O)C=C(C(C)(C)C)C=C1[N+]([O-])=O SPNQRCTZKIBOAX-UHFFFAOYSA-N 0.000 description 1
- ZOGDSYNXUXQGHF-XIEYBQDHSA-N Butroxydim Chemical compound CCCC(=O)C1=C(C)C=C(C)C(C2CC(=O)C(\C(CC)=N\OCC)=C(O)C2)=C1C ZOGDSYNXUXQGHF-XIEYBQDHSA-N 0.000 description 1
- PLFRFSFRYSBJQH-UHFFFAOYSA-N C(C)(=O)OOC(=C1C(SCC2=C1C=CC=C2)=O)C Chemical compound C(C)(=O)OOC(=C1C(SCC2=C1C=CC=C2)=O)C PLFRFSFRYSBJQH-UHFFFAOYSA-N 0.000 description 1
- GUCONUWDJJQBDT-UHFFFAOYSA-N C1(CC1)OC(=O)C1=NC=C(C=C1)F Chemical compound C1(CC1)OC(=O)C1=NC=C(C=C1)F GUCONUWDJJQBDT-UHFFFAOYSA-N 0.000 description 1
- 229910021532 Calcite Inorganic materials 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- 241000320316 Carduus Species 0.000 description 1
- 239000005492 Carfentrazone-ethyl Substances 0.000 description 1
- 108090000994 Catalytic RNA Proteins 0.000 description 1
- 102000053642 Catalytic RNA Human genes 0.000 description 1
- 241000132570 Centaurea Species 0.000 description 1
- 241000219312 Chenopodium Species 0.000 description 1
- 235000000509 Chenopodium ambrosioides Nutrition 0.000 description 1
- 244000098897 Chenopodium botrys Species 0.000 description 1
- 235000005490 Chenopodium botrys Nutrition 0.000 description 1
- DXXVCXKMSWHGTF-UHFFFAOYSA-N Chlomethoxyfen Chemical compound C1=C([N+]([O-])=O)C(OC)=CC(OC=2C(=CC(Cl)=CC=2)Cl)=C1 DXXVCXKMSWHGTF-UHFFFAOYSA-N 0.000 description 1
- 239000005493 Chloridazon (aka pyrazone) Substances 0.000 description 1
- 239000005494 Chlorotoluron Substances 0.000 description 1
- 239000005496 Chlorsulfuron Substances 0.000 description 1
- 244000192528 Chrysanthemum parthenium Species 0.000 description 1
- WMLPCIHUFDKWJU-UHFFFAOYSA-N Cinosulfuron Chemical compound COCCOC1=CC=CC=C1S(=O)(=O)NC(=O)NC1=NC(OC)=NC(OC)=N1 WMLPCIHUFDKWJU-UHFFFAOYSA-N 0.000 description 1
- 241000132536 Cirsium Species 0.000 description 1
- 239000005497 Clethodim Substances 0.000 description 1
- 239000005499 Clomazone Substances 0.000 description 1
- 239000005500 Clopyralid Substances 0.000 description 1
- 244000060011 Cocos nucifera Species 0.000 description 1
- 235000013162 Cocos nucifera Nutrition 0.000 description 1
- 241000207892 Convolvulus Species 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- OFSLKOLYLQSJPB-UHFFFAOYSA-N Cyclosulfamuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)NC=2C(=CC=CC=2)C(=O)C2CC2)=N1 OFSLKOLYLQSJPB-UHFFFAOYSA-N 0.000 description 1
- 239000005501 Cycloxydim Substances 0.000 description 1
- 239000005502 Cyhalofop-butyl Substances 0.000 description 1
- TYIYMOAHACZAMQ-CQSZACIVSA-N Cyhalofop-butyl Chemical group C1=CC(O[C@H](C)C(=O)OCCCC)=CC=C1OC1=CC=C(C#N)C=C1F TYIYMOAHACZAMQ-CQSZACIVSA-N 0.000 description 1
- PYKLUAIDKVVEOS-UHFFFAOYSA-N Cyometrinil Chemical compound N#CCON=C(C#N)C1=CC=CC=C1 PYKLUAIDKVVEOS-UHFFFAOYSA-N 0.000 description 1
- 241000234653 Cyperus Species 0.000 description 1
- 241000320605 Dactyloctenium Species 0.000 description 1
- 241000208296 Datura Species 0.000 description 1
- 239000005503 Desmedipham Substances 0.000 description 1
- FEWJPZIEWOKRBE-JCYAYHJZSA-N Dextrotartaric acid Chemical compound OC(=O)[C@H](O)[C@@H](O)C(O)=O FEWJPZIEWOKRBE-JCYAYHJZSA-N 0.000 description 1
- 239000005505 Dichlorprop-P Substances 0.000 description 1
- QNXAVFXEJCPCJO-UHFFFAOYSA-N Diclosulam Chemical compound N=1N2C(OCC)=NC(F)=CC2=NC=1S(=O)(=O)NC1=C(Cl)C=CC=C1Cl QNXAVFXEJCPCJO-UHFFFAOYSA-N 0.000 description 1
- LBGPXIPGGRQBJW-UHFFFAOYSA-N Difenzoquat Chemical compound C[N+]=1N(C)C(C=2C=CC=CC=2)=CC=1C1=CC=CC=C1 LBGPXIPGGRQBJW-UHFFFAOYSA-N 0.000 description 1
- 239000005507 Diflufenican Substances 0.000 description 1
- 235000017896 Digitaria Nutrition 0.000 description 1
- 241001303487 Digitaria <clam> Species 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-N Dihydrogen sulfide Chemical class S RWSOTUBLDIXVET-UHFFFAOYSA-N 0.000 description 1
- DHWRNDJOGMTCPB-UHFFFAOYSA-N Dimefuron Chemical compound ClC1=CC(NC(=O)N(C)C)=CC=C1N1C(=O)OC(C(C)(C)C)=N1 DHWRNDJOGMTCPB-UHFFFAOYSA-N 0.000 description 1
- 239000005508 Dimethachlor Substances 0.000 description 1
- IKYICRRUVNIHPP-UHFFFAOYSA-N Dimethametryn Chemical compound CCNC1=NC(NC(C)C(C)C)=NC(SC)=N1 IKYICRRUVNIHPP-UHFFFAOYSA-N 0.000 description 1
- 102000016680 Dioxygenases Human genes 0.000 description 1
- 108010028143 Dioxygenases Proteins 0.000 description 1
- 239000005630 Diquat Substances 0.000 description 1
- 208000035240 Disease Resistance Diseases 0.000 description 1
- YUBJPYNSGLJZPQ-UHFFFAOYSA-N Dithiopyr Chemical compound CSC(=O)C1=C(C(F)F)N=C(C(F)(F)F)C(C(=O)SC)=C1CC(C)C YUBJPYNSGLJZPQ-UHFFFAOYSA-N 0.000 description 1
- 239000005510 Diuron Substances 0.000 description 1
- GUVLYNGULCJVDO-UHFFFAOYSA-N EPTC Chemical compound CCCN(CCC)C(=O)SCC GUVLYNGULCJVDO-UHFFFAOYSA-N 0.000 description 1
- 241000192043 Echinochloa Species 0.000 description 1
- 241000202829 Eleocharis Species 0.000 description 1
- 241000209215 Eleusine Species 0.000 description 1
- 235000007351 Eleusine Nutrition 0.000 description 1
- 244000294661 Emex spinosa Species 0.000 description 1
- 235000006369 Emex spinosa Nutrition 0.000 description 1
- BXEHUCNTIZGSOJ-UHFFFAOYSA-N Esprocarb Chemical compound CC(C)C(C)N(CC)C(=O)SCC1=CC=CC=C1 BXEHUCNTIZGSOJ-UHFFFAOYSA-N 0.000 description 1
- PTFJIKYUEPWBMS-UHFFFAOYSA-N Ethalfluralin Chemical compound CC(=C)CN(CC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O PTFJIKYUEPWBMS-UHFFFAOYSA-N 0.000 description 1
- 239000005512 Ethofumesate Substances 0.000 description 1
- UWVKRNOCDUPIDM-UHFFFAOYSA-N Ethoxysulfuron Chemical compound CCOC1=CC=CC=C1OS(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 UWVKRNOCDUPIDM-UHFFFAOYSA-N 0.000 description 1
- ICWUMLXQKFTJMH-UHFFFAOYSA-N Etobenzanid Chemical compound C1=CC(OCOCC)=CC=C1C(=O)NC1=CC=CC(Cl)=C1Cl ICWUMLXQKFTJMH-UHFFFAOYSA-N 0.000 description 1
- 241000221079 Euphorbia <genus> Species 0.000 description 1
- PQKBPHSEKWERTG-UHFFFAOYSA-N Fenoxaprop ethyl Chemical group C1=CC(OC(C)C(=O)OCC)=CC=C1OC1=NC2=CC=C(Cl)C=C2O1 PQKBPHSEKWERTG-UHFFFAOYSA-N 0.000 description 1
- LLQPHQFNMLZJMP-UHFFFAOYSA-N Fentrazamide Chemical compound N1=NN(C=2C(=CC=CC=2)Cl)C(=O)N1C(=O)N(CC)C1CCCCC1 LLQPHQFNMLZJMP-UHFFFAOYSA-N 0.000 description 1
- 241000234642 Festuca Species 0.000 description 1
- 241001290564 Fimbristylis Species 0.000 description 1
- 239000005514 Flazasulfuron Substances 0.000 description 1
- HWATZEJQIXKWQS-UHFFFAOYSA-N Flazasulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CN=2)C(F)(F)F)=N1 HWATZEJQIXKWQS-UHFFFAOYSA-N 0.000 description 1
- 239000005529 Florasulam Substances 0.000 description 1
- QZXATCCPQKOEIH-UHFFFAOYSA-N Florasulam Chemical compound N=1N2C(OC)=NC=C(F)C2=NC=1S(=O)(=O)NC1=C(F)C=CC=C1F QZXATCCPQKOEIH-UHFFFAOYSA-N 0.000 description 1
- FICWGWVVIRLNRB-UHFFFAOYSA-N Flucetosulfuron Chemical compound COCC(=O)OC(C(C)F)C1=NC=CC=C1S(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 FICWGWVVIRLNRB-UHFFFAOYSA-N 0.000 description 1
- MNFMIVVPXOGUMX-UHFFFAOYSA-N Fluchloralin Chemical compound CCCN(CCCl)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O MNFMIVVPXOGUMX-UHFFFAOYSA-N 0.000 description 1
- 239000005531 Flufenacet Substances 0.000 description 1
- RXCPQSJAVKGONC-UHFFFAOYSA-N Flumetsulam Chemical compound N1=C2N=C(C)C=CN2N=C1S(=O)(=O)NC1=C(F)C=CC=C1F RXCPQSJAVKGONC-UHFFFAOYSA-N 0.000 description 1
- IRECWLYBCAZIJM-UHFFFAOYSA-N Flumiclorac pentyl Chemical group C1=C(Cl)C(OCC(=O)OCCCCC)=CC(N2C(C3=C(CCCC3)C2=O)=O)=C1F IRECWLYBCAZIJM-UHFFFAOYSA-N 0.000 description 1
- 239000005533 Fluometuron Substances 0.000 description 1
- AOQMRUTZEYVDIL-UHFFFAOYSA-N Flupoxam Chemical compound C=1C=C(Cl)C(COCC(F)(F)C(F)(F)F)=CC=1N1N=C(C(=O)N)N=C1C1=CC=CC=C1 AOQMRUTZEYVDIL-UHFFFAOYSA-N 0.000 description 1
- YWBVHLJPRPCRSD-UHFFFAOYSA-N Fluridone Chemical compound O=C1C(C=2C=C(C=CC=2)C(F)(F)F)=CN(C)C=C1C1=CC=CC=C1 YWBVHLJPRPCRSD-UHFFFAOYSA-N 0.000 description 1
- 239000005558 Fluroxypyr Substances 0.000 description 1
- VEVZCONIUDBCDC-UHFFFAOYSA-N Flurprimidol Chemical compound C=1N=CN=CC=1C(O)(C(C)C)C1=CC=C(OC(F)(F)F)C=C1 VEVZCONIUDBCDC-UHFFFAOYSA-N 0.000 description 1
- 239000005559 Flurtamone Substances 0.000 description 1
- 239000005560 Foramsulfuron Substances 0.000 description 1
- 241000233866 Fungi Species 0.000 description 1
- 241000816457 Galeopsis Species 0.000 description 1
- 241000748465 Galinsoga Species 0.000 description 1
- 241001101998 Galium Species 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 239000005564 Halosulfuron methyl Substances 0.000 description 1
- FMGZEUWROYGLAY-UHFFFAOYSA-N Halosulfuron-methyl Chemical group ClC1=NN(C)C(S(=O)(=O)NC(=O)NC=2N=C(OC)C=C(OC)N=2)=C1C(=O)OC FMGZEUWROYGLAY-UHFFFAOYSA-N 0.000 description 1
- 241000208818 Helianthus Species 0.000 description 1
- 241000238631 Hexapoda Species 0.000 description 1
- CAWXEEYDBZRFPE-UHFFFAOYSA-N Hexazinone Chemical compound O=C1N(C)C(N(C)C)=NC(=O)N1C1CCCCC1 CAWXEEYDBZRFPE-UHFFFAOYSA-N 0.000 description 1
- 239000005566 Imazamox Substances 0.000 description 1
- 239000005981 Imazaquin Substances 0.000 description 1
- XVOKUMIPKHGGTN-UHFFFAOYSA-N Imazethapyr Chemical compound OC(=O)C1=CC(CC)=CN=C1C1=NC(C)(C(C)C)C(=O)N1 XVOKUMIPKHGGTN-UHFFFAOYSA-N 0.000 description 1
- PMAAYIYCDXGUAP-UHFFFAOYSA-N Indanofan Chemical compound O=C1C2=CC=CC=C2C(=O)C1(CC)CC1(C=2C=C(Cl)C=CC=2)CO1 PMAAYIYCDXGUAP-UHFFFAOYSA-N 0.000 description 1
- 235000021506 Ipomoea Nutrition 0.000 description 1
- 241000207783 Ipomoea Species 0.000 description 1
- 239000005570 Isoxaben Substances 0.000 description 1
- 239000005571 Isoxaflutole Substances 0.000 description 1
- 239000005909 Kieselgur Substances 0.000 description 1
- 241000520028 Lamium Species 0.000 description 1
- 239000005572 Lenacil Substances 0.000 description 1
- 241000801118 Lepidium Species 0.000 description 1
- 102000003960 Ligases Human genes 0.000 description 1
- 108090000364 Ligases Proteins 0.000 description 1
- 241000064140 Lindernia Species 0.000 description 1
- 239000005573 Linuron Substances 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- SUSRORUBZHMPCO-UHFFFAOYSA-N MC-4379 Chemical compound C1=C([N+]([O-])=O)C(C(=O)OC)=CC(OC=2C(=CC(Cl)=CC=2)Cl)=C1 SUSRORUBZHMPCO-UHFFFAOYSA-N 0.000 description 1
- 239000005574 MCPA Substances 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 235000017945 Matricaria Nutrition 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- 239000005576 Mecoprop-P Substances 0.000 description 1
- 239000005578 Mesotrione Substances 0.000 description 1
- 239000005579 Metamitron Substances 0.000 description 1
- 239000005580 Metazachlor Substances 0.000 description 1
- RRVIAQKBTUQODI-UHFFFAOYSA-N Methabenzthiazuron Chemical compound C1=CC=C2SC(N(C)C(=O)NC)=NC2=C1 RRVIAQKBTUQODI-UHFFFAOYSA-N 0.000 description 1
- LSDPWZHWYPCBBB-UHFFFAOYSA-N Methanethiol Chemical compound SC LSDPWZHWYPCBBB-UHFFFAOYSA-N 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- 239000005581 Metobromuron Substances 0.000 description 1
- WLFDQEVORAMCIM-UHFFFAOYSA-N Metobromuron Chemical compound CON(C)C(=O)NC1=CC=C(Br)C=C1 WLFDQEVORAMCIM-UHFFFAOYSA-N 0.000 description 1
- 239000005582 Metosulam Substances 0.000 description 1
- VGHPMIFEKOFHHQ-UHFFFAOYSA-N Metosulam Chemical compound N1=C2N=C(OC)C=C(OC)N2N=C1S(=O)(=O)NC1=C(Cl)C=CC(C)=C1Cl VGHPMIFEKOFHHQ-UHFFFAOYSA-N 0.000 description 1
- 239000005583 Metribuzin Substances 0.000 description 1
- 239000005584 Metsulfuron-methyl Substances 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 235000003990 Monochoria hastata Nutrition 0.000 description 1
- 240000000178 Monochoria vaginalis Species 0.000 description 1
- LKJPSUCKSLORMF-UHFFFAOYSA-N Monolinuron Chemical compound CON(C)C(=O)NC1=CC=C(Cl)C=C1 LKJPSUCKSLORMF-UHFFFAOYSA-N 0.000 description 1
- WXZVAROIGSFCFJ-UHFFFAOYSA-N N,N-diethyl-2-(naphthalen-1-yloxy)propanamide Chemical compound C1=CC=C2C(OC(C)C(=O)N(CC)CC)=CC=CC2=C1 WXZVAROIGSFCFJ-UHFFFAOYSA-N 0.000 description 1
- IUFUITYPUYMIHI-UHFFFAOYSA-N N-[1-(3,5-dimethylphenoxy)propan-2-yl]-6-(2-fluoropropan-2-yl)-1,3,5-triazine-2,4-diamine Chemical compound N=1C(N)=NC(C(C)(C)F)=NC=1NC(C)COC1=CC(C)=CC(C)=C1 IUFUITYPUYMIHI-UHFFFAOYSA-N 0.000 description 1
- NTBVTCXMRYKRTB-UHFFFAOYSA-N N-{2-[(4,6-dimethoxypyrimidin-2-yl)(hydroxy)methyl]-6-(methoxymethyl)phenyl}-1,1-difluoromethanesulfonamide Chemical compound COCC1=CC=CC(C(O)C=2N=C(OC)C=C(OC)N=2)=C1NS(=O)(=O)C(F)F NTBVTCXMRYKRTB-UHFFFAOYSA-N 0.000 description 1
- 239000005585 Napropamide Substances 0.000 description 1
- CCGPUGMWYLICGL-UHFFFAOYSA-N Neburon Chemical compound CCCCN(C)C(=O)NC1=CC=C(Cl)C(Cl)=C1 CCGPUGMWYLICGL-UHFFFAOYSA-N 0.000 description 1
- 239000005586 Nicosulfuron Substances 0.000 description 1
- 244000061176 Nicotiana tabacum Species 0.000 description 1
- 235000002637 Nicotiana tabacum Nutrition 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 239000005587 Oryzalin Substances 0.000 description 1
- CHNUNORXWHYHNE-UHFFFAOYSA-N Oxadiazon Chemical compound C1=C(Cl)C(OC(C)C)=CC(N2C(OC(=N2)C(C)(C)C)=O)=C1Cl CHNUNORXWHYHNE-UHFFFAOYSA-N 0.000 description 1
- 239000005589 Oxasulfuron Substances 0.000 description 1
- 239000005590 Oxyfluorfen Substances 0.000 description 1
- OQMBBFQZGJFLBU-UHFFFAOYSA-N Oxyfluorfen Chemical compound C1=C([N+]([O-])=O)C(OCC)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 OQMBBFQZGJFLBU-UHFFFAOYSA-N 0.000 description 1
- 241000209117 Panicum Species 0.000 description 1
- 235000006443 Panicum miliaceum subsp. miliaceum Nutrition 0.000 description 1
- 235000009037 Panicum miliaceum subsp. ruderale Nutrition 0.000 description 1
- 235000011096 Papaver Nutrition 0.000 description 1
- 240000001090 Papaver somniferum Species 0.000 description 1
- 241001268782 Paspalum dilatatum Species 0.000 description 1
- 241000208181 Pelargonium Species 0.000 description 1
- 239000005591 Pendimethalin Substances 0.000 description 1
- 239000005592 Penoxsulam Substances 0.000 description 1
- SYJGKVOENHZYMQ-UHFFFAOYSA-N Penoxsulam Chemical compound N1=C2C(OC)=CN=C(OC)N2N=C1NS(=O)(=O)C1=C(OCC(F)F)C=CC=C1C(F)(F)F SYJGKVOENHZYMQ-UHFFFAOYSA-N 0.000 description 1
- 239000005594 Phenmedipham Substances 0.000 description 1
- 241000746981 Phleum Species 0.000 description 1
- IHPVFYLOGNNZLA-UHFFFAOYSA-N Phytoalexin Natural products COC1=CC=CC=C1C1OC(C=C2C(OCO2)=C2OC)=C2C(=O)C1 IHPVFYLOGNNZLA-UHFFFAOYSA-N 0.000 description 1
- 239000005595 Picloram Substances 0.000 description 1
- 239000005596 Picolinafen Substances 0.000 description 1
- 239000005597 Pinoxaden Substances 0.000 description 1
- UNLYSVIDNRIVFJ-UHFFFAOYSA-N Piperophos Chemical compound CCCOP(=S)(OCCC)SCC(=O)N1CCCCC1C UNLYSVIDNRIVFJ-UHFFFAOYSA-N 0.000 description 1
- 241000209048 Poa Species 0.000 description 1
- 241000205407 Polygonum Species 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 241000219295 Portulaca Species 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000005599 Profoxydim Substances 0.000 description 1
- 239000005600 Propaquizafop Substances 0.000 description 1
- 239000005602 Propyzamide Substances 0.000 description 1
- 239000005603 Prosulfocarb Substances 0.000 description 1
- 239000005604 Prosulfuron Substances 0.000 description 1
- LTUNNEGNEKBSEH-UHFFFAOYSA-N Prosulfuron Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)CCC(F)(F)F)=N1 LTUNNEGNEKBSEH-UHFFFAOYSA-N 0.000 description 1
- 108010009736 Protein Hydrolysates Proteins 0.000 description 1
- 108020001991 Protoporphyrinogen Oxidase Proteins 0.000 description 1
- 102000005135 Protoporphyrinogen oxidase Human genes 0.000 description 1
- IHHMUBRVTJMLQO-UHFFFAOYSA-N Pyraclonil Chemical compound C#CCN(C)C1=C(C#N)C=NN1C1=NN(CCCC2)C2=C1Cl IHHMUBRVTJMLQO-UHFFFAOYSA-N 0.000 description 1
- 239000005605 Pyraflufen-ethyl Substances 0.000 description 1
- BGNQYGRXEXDAIQ-UHFFFAOYSA-N Pyrazosulfuron-ethyl Chemical group C1=NN(C)C(S(=O)(=O)NC(=O)NC=2N=C(OC)C=C(OC)N=2)=C1C(=O)OCC BGNQYGRXEXDAIQ-UHFFFAOYSA-N 0.000 description 1
- CNILNQMBAHKMFS-UHFFFAOYSA-M Pyrithiobac-sodium Chemical compound [Na+].COC1=CC(OC)=NC(SC=2C(=C(Cl)C=CC=2)C([O-])=O)=N1 CNILNQMBAHKMFS-UHFFFAOYSA-M 0.000 description 1
- 239000005607 Pyroxsulam Substances 0.000 description 1
- 239000005608 Quinmerac Substances 0.000 description 1
- 239000005614 Quizalofop-P-ethyl Substances 0.000 description 1
- 239000005615 Quizalofop-P-tefuryl Substances 0.000 description 1
- 241000218206 Ranunculus Species 0.000 description 1
- 239000005616 Rimsulfuron Substances 0.000 description 1
- 241000490453 Rorippa Species 0.000 description 1
- 241000341978 Rotala Species 0.000 description 1
- 239000005617 S-Metolachlor Substances 0.000 description 1
- 240000009132 Sagittaria sagittifolia Species 0.000 description 1
- 241000202758 Scirpus Species 0.000 description 1
- 241000780602 Senecio Species 0.000 description 1
- 239000004113 Sepiolite Substances 0.000 description 1
- 244000275012 Sesbania cannabina Species 0.000 description 1
- 235000005775 Setaria Nutrition 0.000 description 1
- 241000232088 Setaria <nematode> Species 0.000 description 1
- CSPPKDPQLUUTND-NBVRZTHBSA-N Sethoxydim Chemical compound CCO\N=C(/CCC)C1=C(O)CC(CC(C)SCC)CC1=O CSPPKDPQLUUTND-NBVRZTHBSA-N 0.000 description 1
- 241000220261 Sinapis Species 0.000 description 1
- 241000207763 Solanum Species 0.000 description 1
- 235000002634 Solanum Nutrition 0.000 description 1
- 241000488874 Sonchus Species 0.000 description 1
- 235000011684 Sorghum saccharatum Nutrition 0.000 description 1
- 244000273618 Sphenoclea zeylanica Species 0.000 description 1
- 235000017967 Sphenoclea zeylanica Nutrition 0.000 description 1
- 240000006694 Stellaria media Species 0.000 description 1
- 239000005618 Sulcotrione Substances 0.000 description 1
- 239000005619 Sulfosulfuron Substances 0.000 description 1
- 241000245665 Taraxacum Species 0.000 description 1
- FEWJPZIEWOKRBE-UHFFFAOYSA-N Tartaric acid Natural products [H+].[H+].[O-]C(=O)C(O)C(O)C([O-])=O FEWJPZIEWOKRBE-UHFFFAOYSA-N 0.000 description 1
- HBPDKDSFLXWOAE-UHFFFAOYSA-N Tebuthiuron Chemical compound CNC(=O)N(C)C1=NN=C(C(C)(C)C)S1 HBPDKDSFLXWOAE-UHFFFAOYSA-N 0.000 description 1
- 239000005620 Tembotrione Substances 0.000 description 1
- IOYNQIMAUDJVEI-BMVIKAAMSA-N Tepraloxydim Chemical compound C1C(=O)C(C(=N/OC\C=C\Cl)/CC)=C(O)CC1C1CCOCC1 IOYNQIMAUDJVEI-BMVIKAAMSA-N 0.000 description 1
- 239000005621 Terbuthylazine Substances 0.000 description 1
- YIJZJEYQBAAWRJ-UHFFFAOYSA-N Thiazopyr Chemical compound N1=C(C(F)F)C(C(=O)OC)=C(CC(C)C)C(C=2SCCN=2)=C1C(F)(F)F YIJZJEYQBAAWRJ-UHFFFAOYSA-N 0.000 description 1
- 239000005623 Thifensulfuron-methyl Substances 0.000 description 1
- QHTQREMOGMZHJV-UHFFFAOYSA-N Thiobencarb Chemical compound CCN(CC)C(=O)SCC1=CC=C(Cl)C=C1 QHTQREMOGMZHJV-UHFFFAOYSA-N 0.000 description 1
- GNVMUORYQLCPJZ-UHFFFAOYSA-M Thiocarbamate Chemical compound NC([S-])=O GNVMUORYQLCPJZ-UHFFFAOYSA-M 0.000 description 1
- PHSUVQBHRAWOQD-UHFFFAOYSA-N Tiocarbazil Chemical compound CCC(C)N(C(C)CC)C(=O)SCC1=CC=CC=C1 PHSUVQBHRAWOQD-UHFFFAOYSA-N 0.000 description 1
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 1
- 239000005624 Tralkoxydim Substances 0.000 description 1
- WHKUVVPPKQRRBV-UHFFFAOYSA-N Trasan Chemical compound CC1=CC(Cl)=CC=C1OCC(O)=O WHKUVVPPKQRRBV-UHFFFAOYSA-N 0.000 description 1
- 239000005625 Tri-allate Substances 0.000 description 1
- MWBPRDONLNQCFV-UHFFFAOYSA-N Tri-allate Chemical compound CC(C)N(C(C)C)C(=O)SCC(Cl)=C(Cl)Cl MWBPRDONLNQCFV-UHFFFAOYSA-N 0.000 description 1
- 239000005627 Triclopyr Substances 0.000 description 1
- IBZHOAONZVJLOB-UHFFFAOYSA-N Tridiphane Chemical compound ClC1=CC(Cl)=CC(C2(CC(Cl)(Cl)Cl)OC2)=C1 IBZHOAONZVJLOB-UHFFFAOYSA-N 0.000 description 1
- GSEJCLTVZPLZKY-UHFFFAOYSA-N Triethanolamine Chemical compound OCCN(CCO)CCO GSEJCLTVZPLZKY-UHFFFAOYSA-N 0.000 description 1
- 241000219793 Trifolium Species 0.000 description 1
- 241000013033 Triso Species 0.000 description 1
- 239000005629 Tritosulfuron Substances 0.000 description 1
- 241000219422 Urtica Species 0.000 description 1
- 240000005592 Veronica officinalis Species 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical class ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- 241000405217 Viola <butterfly> Species 0.000 description 1
- 241000700605 Viruses Species 0.000 description 1
- 241001506766 Xanthium Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- ABRVLXLNVJHDRQ-UHFFFAOYSA-N [2-pyridin-3-yl-6-(trifluoromethyl)pyridin-4-yl]methanamine Chemical compound FC(C1=CC(=CC(=N1)C=1C=NC=CC=1)CN)(F)F ABRVLXLNVJHDRQ-UHFFFAOYSA-N 0.000 description 1
- YQYBUJYBXOVWQW-UHFFFAOYSA-N [3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxyphenyl]-(3,4-dihydro-1H-isoquinolin-2-yl)methanone Chemical compound NCC1=CC(=NC(=C1)C(F)(F)F)OC=1C=C(C=CC=1)C(=O)N1CC2=CC=CC=C2CC1 YQYBUJYBXOVWQW-UHFFFAOYSA-N 0.000 description 1
- YKKPYMXANSSQCA-UHFFFAOYSA-N [3-[4-(aminomethyl)-6-(trifluoromethyl)pyridin-2-yl]oxyphenyl]-(3-pyrazol-1-ylazetidin-1-yl)methanone Chemical compound N1(N=CC=C1)C1CN(C1)C(=O)C1=CC(=CC=C1)OC1=NC(=CC(=C1)CN)C(F)(F)F YKKPYMXANSSQCA-UHFFFAOYSA-N 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 230000000895 acaricidal effect Effects 0.000 description 1
- 239000000642 acaricide Substances 0.000 description 1
- 150000001241 acetals Chemical class 0.000 description 1
- 150000008065 acid anhydrides Chemical class 0.000 description 1
- NUFNQYOELLVIPL-UHFFFAOYSA-N acifluorfen Chemical compound C1=C([N+]([O-])=O)C(C(=O)O)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 NUFNQYOELLVIPL-UHFFFAOYSA-N 0.000 description 1
- DDBMQDADIHOWIC-UHFFFAOYSA-N aclonifen Chemical compound C1=C([N+]([O-])=O)C(N)=C(Cl)C(OC=2C=CC=CC=2)=C1 DDBMQDADIHOWIC-UHFFFAOYSA-N 0.000 description 1
- 239000012868 active agrochemical ingredient Substances 0.000 description 1
- 150000001264 acyl cyanides Chemical class 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000002671 adjuvant Substances 0.000 description 1
- 239000000443 aerosol Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- HFVAFDPGUJEFBQ-UHFFFAOYSA-M alizarin red S Chemical compound [Na+].O=C1C2=CC=CC=C2C(=O)C2=C1C=C(S([O-])(=O)=O)C(O)=C2O HFVAFDPGUJEFBQ-UHFFFAOYSA-M 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 1
- 125000005083 alkoxyalkoxy group Chemical group 0.000 description 1
- 150000008051 alkyl sulfates Chemical class 0.000 description 1
- 229940045714 alkyl sulfonate alkylating agent Drugs 0.000 description 1
- 150000008052 alkyl sulfonates Chemical class 0.000 description 1
- 230000004075 alteration Effects 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- RQVYBGPQFYCBGX-UHFFFAOYSA-N ametryn Chemical compound CCNC1=NC(NC(C)C)=NC(SC)=N1 RQVYBGPQFYCBGX-UHFFFAOYSA-N 0.000 description 1
- ORFPWVRKFLOQHK-UHFFFAOYSA-N amicarbazone Chemical compound CC(C)C1=NN(C(=O)NC(C)(C)C)C(=O)N1N ORFPWVRKFLOQHK-UHFFFAOYSA-N 0.000 description 1
- 150000001409 amidines Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- KWAIHLIXESXTJL-UHFFFAOYSA-N aminocyclopyrachlor Chemical compound OC(=O)C1=C(Cl)C(N)=NC(C2CC2)=N1 KWAIHLIXESXTJL-UHFFFAOYSA-N 0.000 description 1
- NIXXQNOQHKNPEJ-UHFFFAOYSA-N aminopyralid Chemical compound NC1=CC(Cl)=NC(C(O)=O)=C1Cl NIXXQNOQHKNPEJ-UHFFFAOYSA-N 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 238000000137 annealing Methods 0.000 description 1
- 230000000692 anti-sense effect Effects 0.000 description 1
- 125000003710 aryl alkyl group Chemical group 0.000 description 1
- 125000005228 aryl sulfonate group Chemical group 0.000 description 1
- VGPYEHKOIGNJKV-UHFFFAOYSA-N asulam Chemical compound COC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 VGPYEHKOIGNJKV-UHFFFAOYSA-N 0.000 description 1
- 229960000892 attapulgite Drugs 0.000 description 1
- XOEMATDHVZOBSG-UHFFFAOYSA-N azafenidin Chemical compound C1=C(OCC#C)C(Cl)=CC(Cl)=C1N1C(=O)N2CCCCC2=N1 XOEMATDHVZOBSG-UHFFFAOYSA-N 0.000 description 1
- MAHPNPYYQAIOJN-UHFFFAOYSA-N azimsulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2N(N=CC=2C2=NN(C)N=N2)C)=N1 MAHPNPYYQAIOJN-UHFFFAOYSA-N 0.000 description 1
- 229940097012 bacillus thuringiensis Drugs 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 230000037429 base substitution Effects 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- XMQFTWRPUQYINF-UHFFFAOYSA-N bensulfuron-methyl Chemical group COC(=O)C1=CC=CC=C1CS(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 XMQFTWRPUQYINF-UHFFFAOYSA-N 0.000 description 1
- ZOMSMJKLGFBRBS-UHFFFAOYSA-N bentazone Chemical compound C1=CC=C2NS(=O)(=O)N(C(C)C)C(=O)C2=C1 ZOMSMJKLGFBRBS-UHFFFAOYSA-N 0.000 description 1
- CNBGNNVCVSKAQZ-UHFFFAOYSA-N benzidamine Natural products C12=CC=CC=C2C(OCCCN(C)C)=NN1CC1=CC=CC=C1 CNBGNNVCVSKAQZ-UHFFFAOYSA-N 0.000 description 1
- 235000021028 berry Nutrition 0.000 description 1
- HUYBEDCQLAEVPD-MNOVXSKESA-N bicyclopyrone Chemical compound COCCOCc1nc(ccc1C(=O)C1=C(O)[C@@H]2CC[C@@H](C2)C1=O)C(F)(F)F HUYBEDCQLAEVPD-MNOVXSKESA-N 0.000 description 1
- GINJFDRNADDBIN-FXQIFTODSA-N bilanafos Chemical compound OC(=O)[C@H](C)NC(=O)[C@H](C)NC(=O)[C@@H](N)CCP(C)(O)=O GINJFDRNADDBIN-FXQIFTODSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- FUHMZYWBSHTEDZ-UHFFFAOYSA-M bispyribac-sodium Chemical compound [Na+].COC1=CC(OC)=NC(OC=2C(=C(OC=3N=C(OC)C=C(OC)N=3)C=CC=2)C([O-])=O)=N1 FUHMZYWBSHTEDZ-UHFFFAOYSA-M 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- 229910052794 bromium Inorganic materials 0.000 description 1
- WZDDLAZXUYIVMU-UHFFFAOYSA-N bromobutide Chemical compound CC(C)(C)C(Br)C(=O)NC(C)(C)C1=CC=CC=C1 WZDDLAZXUYIVMU-UHFFFAOYSA-N 0.000 description 1
- HKPHPIREJKHECO-UHFFFAOYSA-N butachlor Chemical compound CCCCOCN(C(=O)CCl)C1=C(CC)C=CC=C1CC HKPHPIREJKHECO-UHFFFAOYSA-N 0.000 description 1
- JEDYYFXHPAIBGR-UHFFFAOYSA-N butafenacil Chemical compound O=C1N(C)C(C(F)(F)F)=CC(=O)N1C1=CC=C(Cl)C(C(=O)OC(C)(C)C(=O)OCC=C)=C1 JEDYYFXHPAIBGR-UHFFFAOYSA-N 0.000 description 1
- VAIZTNZGPYBOGF-UHFFFAOYSA-N butyl 2-(4-{[5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate Chemical group C1=CC(OC(C)C(=O)OCCCC)=CC=C1OC1=CC=C(C(F)(F)F)C=N1 VAIZTNZGPYBOGF-UHFFFAOYSA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- HFEJHAAIJZXXRE-UHFFFAOYSA-N cafenstrole Chemical compound CCN(CC)C(=O)N1C=NC(S(=O)(=O)C=2C(=CC(C)=CC=2C)C)=N1 HFEJHAAIJZXXRE-UHFFFAOYSA-N 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- NLKUPINTOLSSLD-UHFFFAOYSA-L calcium;4-(1-oxidopropylidene)-3,5-dioxocyclohexane-1-carboxylate Chemical compound [Ca+2].CCC([O-])=C1C(=O)CC(C([O-])=O)CC1=O NLKUPINTOLSSLD-UHFFFAOYSA-L 0.000 description 1
- 150000003857 carboxamides Chemical class 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000008166 cellulose biosynthesis Effects 0.000 description 1
- SILSDTWXNBZOGF-KUZBFYBWSA-N chembl111058 Chemical compound CCSC(C)CC1CC(O)=C(\C(CC)=N\OC\C=C\Cl)C(=O)C1 SILSDTWXNBZOGF-KUZBFYBWSA-N 0.000 description 1
- GGWHBJGBERXSLL-NBVRZTHBSA-N chembl113137 Chemical compound C1C(=O)C(C(=N/OCC)/CCC)=C(O)CC1C1CSCCC1 GGWHBJGBERXSLL-NBVRZTHBSA-N 0.000 description 1
- MXZACTZQSGYANA-UHFFFAOYSA-N chembl545463 Chemical compound Cl.C1=CC(OC)=CC=C1C(N=C1)=CN2C1=NC(C)=C2O MXZACTZQSGYANA-UHFFFAOYSA-N 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- WYKYKTKDBLFHCY-UHFFFAOYSA-N chloridazon Chemical compound O=C1C(Cl)=C(N)C=NN1C1=CC=CC=C1 WYKYKTKDBLFHCY-UHFFFAOYSA-N 0.000 description 1
- NSWAMPCUPHPTTC-UHFFFAOYSA-N chlorimuron-ethyl Chemical group CCOC(=O)C1=CC=CC=C1S(=O)(=O)NC(=O)NC1=NC(Cl)=CC(OC)=N1 NSWAMPCUPHPTTC-UHFFFAOYSA-N 0.000 description 1
- XQNAUQUKWRBODG-UHFFFAOYSA-N chlornitrofen Chemical compound C1=CC([N+](=O)[O-])=CC=C1OC1=C(Cl)C=C(Cl)C=C1Cl XQNAUQUKWRBODG-UHFFFAOYSA-N 0.000 description 1
- 150000008422 chlorobenzenes Chemical class 0.000 description 1
- JXCGFZXSOMJFOA-UHFFFAOYSA-N chlorotoluron Chemical compound CN(C)C(=O)NC1=CC=C(C)C(Cl)=C1 JXCGFZXSOMJFOA-UHFFFAOYSA-N 0.000 description 1
- VJYIFXVZLXQVHO-UHFFFAOYSA-N chlorsulfuron Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)Cl)=N1 VJYIFXVZLXQVHO-UHFFFAOYSA-N 0.000 description 1
- NNKKTZOEKDFTBU-YBEGLDIGSA-N cinidon ethyl Chemical compound C1=C(Cl)C(/C=C(\Cl)C(=O)OCC)=CC(N2C(C3=C(CCCC3)C2=O)=O)=C1 NNKKTZOEKDFTBU-YBEGLDIGSA-N 0.000 description 1
- JBDHZKLJNAIJNC-LLVKDONJSA-N clodinafop-propargyl Chemical group C1=CC(O[C@H](C)C(=O)OCC#C)=CC=C1OC1=NC=C(Cl)C=C1F JBDHZKLJNAIJNC-LLVKDONJSA-N 0.000 description 1
- KIEDNEWSYUYDSN-UHFFFAOYSA-N clomazone Chemical compound O=C1C(C)(C)CON1CC1=CC=CC=C1Cl KIEDNEWSYUYDSN-UHFFFAOYSA-N 0.000 description 1
- HUBANNPOLNYSAD-UHFFFAOYSA-N clopyralid Chemical compound OC(=O)C1=NC(Cl)=CC=C1Cl HUBANNPOLNYSAD-UHFFFAOYSA-N 0.000 description 1
- BIKACRYIQSLICJ-UHFFFAOYSA-N cloransulam-methyl Chemical group N=1N2C(OCC)=NC(F)=CC2=NC=1S(=O)(=O)NC1=C(Cl)C=CC=C1C(=O)OC BIKACRYIQSLICJ-UHFFFAOYSA-N 0.000 description 1
- 239000010941 cobalt Substances 0.000 description 1
- 229910017052 cobalt Inorganic materials 0.000 description 1
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 1
- 239000003184 complementary RNA Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- WZJZMXBKUWKXTQ-UHFFFAOYSA-N desmedipham Chemical compound CCOC(=O)NC1=CC=CC(OC(=O)NC=2C=CC=CC=2)=C1 WZJZMXBKUWKXTQ-UHFFFAOYSA-N 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 230000018109 developmental process Effects 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 1
- LPVVTHQFIVXMEZ-UHFFFAOYSA-N diethyl 2-(5-chloroquinolin-8-yl)oxypropanedioate Chemical compound C1=CN=C2C(OC(C(=O)OCC)C(=O)OCC)=CC=C(Cl)C2=C1 LPVVTHQFIVXMEZ-UHFFFAOYSA-N 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- WYEHFWKAOXOVJD-UHFFFAOYSA-N diflufenican Chemical compound FC1=CC(F)=CC=C1NC(=O)C1=CC=CN=C1OC1=CC=CC(C(F)(F)F)=C1 WYEHFWKAOXOVJD-UHFFFAOYSA-N 0.000 description 1
- HRKQOINLCJTGBK-UHFFFAOYSA-N dihydroxidosulfur Chemical compound OSO HRKQOINLCJTGBK-UHFFFAOYSA-N 0.000 description 1
- SCCDDNKJYDZXMM-UHFFFAOYSA-N dimethachlor Chemical compound COCCN(C(=O)CCl)C1=C(C)C=CC=C1C SCCDDNKJYDZXMM-UHFFFAOYSA-N 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- 239000010459 dolomite Substances 0.000 description 1
- 229910000514 dolomite Inorganic materials 0.000 description 1
- 239000004495 emulsifiable concentrate Substances 0.000 description 1
- XPEVJXBWHXAUDR-UHFFFAOYSA-N epyrifenacil Chemical compound CCOC(=O)COC1=NC=CC=C1OC1=CC(N2C(N(C)C(=CC2=O)C(F)(F)F)=O)=C(F)C=C1Cl XPEVJXBWHXAUDR-UHFFFAOYSA-N 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- ZINJLDJMHCUBIP-UHFFFAOYSA-N ethametsulfuron-methyl Chemical group CCOC1=NC(NC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)C(=O)OC)=N1 ZINJLDJMHCUBIP-UHFFFAOYSA-N 0.000 description 1
- PQKBPHSEKWERTG-LLVKDONJSA-N ethyl (2r)-2-[4-[(6-chloro-1,3-benzoxazol-2-yl)oxy]phenoxy]propanoate Chemical group C1=CC(O[C@H](C)C(=O)OCC)=CC=C1OC1=NC2=CC=C(Cl)C=C2O1 PQKBPHSEKWERTG-LLVKDONJSA-N 0.000 description 1
- MBQBFYBOFKZPAY-UHFFFAOYSA-N ethyl 1-(2,4-dichlorophenyl)-4-ethyl-5-phenylpyrazole-3-carboxylate Chemical compound C(C)OC(=O)C1=NN(C(=C1CC)C1=CC=CC=C1)C1=C(C=C(C=C1)Cl)Cl MBQBFYBOFKZPAY-UHFFFAOYSA-N 0.000 description 1
- IVEMKPKJNOWXSK-UHFFFAOYSA-N ethyl 1-(2,4-dichlorophenyl)-5-methylpyrazole-3-carboxylate Chemical compound N1=C(C(=O)OCC)C=C(C)N1C1=CC=C(Cl)C=C1Cl IVEMKPKJNOWXSK-UHFFFAOYSA-N 0.000 description 1
- JEMXUSHXYOXNFL-UHFFFAOYSA-N ethyl 2-(5-chloroquinolin-8-yl)oxyacetate Chemical compound C1=CN=C2C(OCC(=O)OCC)=CC=C(Cl)C2=C1 JEMXUSHXYOXNFL-UHFFFAOYSA-N 0.000 description 1
- VZZVOKHLRXJIEP-UHFFFAOYSA-N ethyl 2-benzhydryloxyacetate Chemical compound C=1C=CC=CC=1C(OCC(=O)OCC)C1=CC=CC=C1 VZZVOKHLRXJIEP-UHFFFAOYSA-N 0.000 description 1
- MLKCGVHIFJBRCD-UHFFFAOYSA-N ethyl 2-chloro-3-{2-chloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-4,5-dihydro-1H-1,2,4-triazol-1-yl]-4-fluorophenyl}propanoate Chemical group C1=C(Cl)C(CC(Cl)C(=O)OCC)=CC(N2C(N(C(F)F)C(C)=N2)=O)=C1F MLKCGVHIFJBRCD-UHFFFAOYSA-N 0.000 description 1
- OSUHJPCHFDQAIT-UHFFFAOYSA-N ethyl 2-{4-[(6-chloroquinoxalin-2-yl)oxy]phenoxy}propanoate Chemical group C1=CC(OC(C)C(=O)OCC)=CC=C1OC1=CN=C(C=C(Cl)C=C2)C2=N1 OSUHJPCHFDQAIT-UHFFFAOYSA-N 0.000 description 1
- APEOYHMMWLHUAL-UHFFFAOYSA-N ethyl 3,4,5-triacetyloxybenzoate Chemical compound CCOC(=O)C1=CC(OC(C)=O)=C(OC(C)=O)C(OC(C)=O)=C1 APEOYHMMWLHUAL-UHFFFAOYSA-N 0.000 description 1
- 230000001747 exhibiting effect Effects 0.000 description 1
- QMTNOLKHSWIQBE-FGTMMUONSA-N exo-(+)-cinmethylin Chemical compound O([C@H]1[C@]2(C)CC[C@@](O2)(C1)C(C)C)CC1=CC=CC=C1C QMTNOLKHSWIQBE-FGTMMUONSA-N 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- ACDZDIIWZVQMIX-UHFFFAOYSA-N fenoxasulfone Chemical compound C1=C(Cl)C(OCC)=CC(Cl)=C1CS(=O)(=O)C1=NOC(C)(C)C1 ACDZDIIWZVQMIX-UHFFFAOYSA-N 0.000 description 1
- 239000003337 fertilizer Substances 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- VAIZTNZGPYBOGF-CYBMUJFWSA-N fluazifop-P-butyl Chemical group C1=CC(O[C@H](C)C(=O)OCCCC)=CC=C1OC1=CC=C(C(F)(F)F)C=N1 VAIZTNZGPYBOGF-CYBMUJFWSA-N 0.000 description 1
- UOUXAYAIONPXDH-UHFFFAOYSA-M flucarbazone-sodium Chemical compound [Na+].O=C1N(C)C(OC)=NN1C(=O)[N-]S(=O)(=O)C1=CC=CC=C1OC(F)(F)F UOUXAYAIONPXDH-UHFFFAOYSA-M 0.000 description 1
- IANUJLZYFUDJIH-UHFFFAOYSA-N flufenacet Chemical compound C=1C=C(F)C=CC=1N(C(C)C)C(=O)COC1=NN=C(C(F)(F)F)S1 IANUJLZYFUDJIH-UHFFFAOYSA-N 0.000 description 1
- WFZSZAXUALBVNX-UHFFFAOYSA-N flufenpyr Chemical compound O=C1C(C)=C(C(F)(F)F)C=NN1C1=CC(OCC(O)=O)=C(Cl)C=C1F WFZSZAXUALBVNX-UHFFFAOYSA-N 0.000 description 1
- FOUWCSDKDDHKQP-UHFFFAOYSA-N flumioxazin Chemical compound FC1=CC=2OCC(=O)N(CC#C)C=2C=C1N(C1=O)C(=O)C2=C1CCCC2 FOUWCSDKDDHKQP-UHFFFAOYSA-N 0.000 description 1
- RZILCCPWPBTYDO-UHFFFAOYSA-N fluometuron Chemical compound CN(C)C(=O)NC1=CC=CC(C(F)(F)F)=C1 RZILCCPWPBTYDO-UHFFFAOYSA-N 0.000 description 1
- OQZCSNDVOWYALR-UHFFFAOYSA-N flurochloridone Chemical compound FC(F)(F)C1=CC=CC(N2C(C(Cl)C(CCl)C2)=O)=C1 OQZCSNDVOWYALR-UHFFFAOYSA-N 0.000 description 1
- MEFQWPUMEMWTJP-UHFFFAOYSA-N fluroxypyr Chemical compound NC1=C(Cl)C(F)=NC(OCC(O)=O)=C1Cl MEFQWPUMEMWTJP-UHFFFAOYSA-N 0.000 description 1
- ZCNQYNHDVRPZIH-UHFFFAOYSA-N fluthiacet-methyl Chemical group C1=C(Cl)C(SCC(=O)OC)=CC(N=C2N3CCCCN3C(=O)S2)=C1F ZCNQYNHDVRPZIH-UHFFFAOYSA-N 0.000 description 1
- BGZZWXTVIYUUEY-UHFFFAOYSA-N fomesafen Chemical compound C1=C([N+]([O-])=O)C(C(=O)NS(=O)(=O)C)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 BGZZWXTVIYUUEY-UHFFFAOYSA-N 0.000 description 1
- PXDNXJSDGQBLKS-UHFFFAOYSA-N foramsulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=C(NC=O)C=2)C(=O)N(C)C)=N1 PXDNXJSDGQBLKS-UHFFFAOYSA-N 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 238000012239 gene modification Methods 0.000 description 1
- 230000005017 genetic modification Effects 0.000 description 1
- 244000037671 genetically modified crops Species 0.000 description 1
- 235000013617 genetically modified food Nutrition 0.000 description 1
- IAJOBQBIJHVGMQ-BYPYZUCNSA-N glufosinate-P Chemical compound CP(O)(=O)CC[C@H](N)C(O)=O IAJOBQBIJHVGMQ-BYPYZUCNSA-N 0.000 description 1
- ZBMRKNMTMPPMMK-WCCKRBBISA-N glufosinate-P-ammonium Chemical compound N.CP(O)(=O)CC[C@H](N)C(O)=O ZBMRKNMTMPPMMK-WCCKRBBISA-N 0.000 description 1
- ZDXPYRJPNDTMRX-UHFFFAOYSA-N glutamine Natural products OC(=O)C(N)CCC(N)=O ZDXPYRJPNDTMRX-UHFFFAOYSA-N 0.000 description 1
- 102000005396 glutamine synthetase Human genes 0.000 description 1
- 108020002326 glutamine synthetase Proteins 0.000 description 1
- 239000003630 growth substance Substances 0.000 description 1
- KKLBEFSLWYDQFI-UHFFFAOYSA-N halauxifen Chemical compound COC1=C(Cl)C=CC(C=2N=C(C(Cl)=C(N)C=2)C(O)=O)=C1F KKLBEFSLWYDQFI-UHFFFAOYSA-N 0.000 description 1
- KDHKOPYYWOHESS-UHFFFAOYSA-N halauxifen-methyl Chemical compound NC1=C(Cl)C(C(=O)OC)=NC(C=2C(=C(OC)C(Cl)=CC=2)F)=C1 KDHKOPYYWOHESS-UHFFFAOYSA-N 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- MFSWTRQUCLNFOM-SECBINFHSA-N haloxyfop-P-methyl Chemical group C1=CC(O[C@H](C)C(=O)OC)=CC=C1OC1=NC=C(C(F)(F)F)C=C1Cl MFSWTRQUCLNFOM-SECBINFHSA-N 0.000 description 1
- 125000004051 hexyl group Chemical class [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 150000004677 hydrates Chemical class 0.000 description 1
- 150000007857 hydrazones Chemical class 0.000 description 1
- 230000007062 hydrolysis Effects 0.000 description 1
- 238000006460 hydrolysis reaction Methods 0.000 description 1
- RUCAXVJJQQJZGU-UHFFFAOYSA-M hydron;2-(phosphonatomethylamino)acetate;trimethylsulfanium Chemical compound C[S+](C)C.OP(O)(=O)CNCC([O-])=O RUCAXVJJQQJZGU-UHFFFAOYSA-M 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 150000002463 imidates Chemical class 0.000 description 1
- YFONKFDEZLYQDH-BOURZNODSA-N indaziflam Chemical compound CC(F)C1=NC(N)=NC(N[C@H]2C3=CC(C)=CC=C3C[C@@H]2C)=N1 YFONKFDEZLYQDH-BOURZNODSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- 238000005342 ion exchange Methods 0.000 description 1
- NRXQIUSYPAHGNM-UHFFFAOYSA-N ioxynil Chemical compound OC1=C(I)C=C(C#N)C=C1I NRXQIUSYPAHGNM-UHFFFAOYSA-N 0.000 description 1
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 1
- PUIYMUZLKQOUOZ-UHFFFAOYSA-N isoproturon Chemical compound CC(C)C1=CC=C(NC(=O)N(C)C)C=C1 PUIYMUZLKQOUOZ-UHFFFAOYSA-N 0.000 description 1
- PMHURSZHKKJGBM-UHFFFAOYSA-N isoxaben Chemical compound O1N=C(C(C)(CC)CC)C=C1NC(=O)C1=C(OC)C=CC=C1OC PMHURSZHKKJGBM-UHFFFAOYSA-N 0.000 description 1
- OYIKARCXOQLFHF-UHFFFAOYSA-N isoxaflutole Chemical compound CS(=O)(=O)C1=CC(C(F)(F)F)=CC=C1C(=O)C1=C(C2CC2)ON=C1 OYIKARCXOQLFHF-UHFFFAOYSA-N 0.000 description 1
- 229940088649 isoxaflutole Drugs 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- CONWAEURSVPLRM-UHFFFAOYSA-N lactofen Chemical compound C1=C([N+]([O-])=O)C(C(=O)OC(C)C(=O)OCC)=CC(OC=2C(=CC(=CC=2)C(F)(F)F)Cl)=C1 CONWAEURSVPLRM-UHFFFAOYSA-N 0.000 description 1
- 239000004816 latex Substances 0.000 description 1
- 229920000126 latex Polymers 0.000 description 1
- 239000000787 lecithin Substances 0.000 description 1
- 235000010445 lecithin Nutrition 0.000 description 1
- ZTMKADLOSYKWCA-UHFFFAOYSA-N lenacil Chemical compound O=C1NC=2CCCC=2C(=O)N1C1CCCCC1 ZTMKADLOSYKWCA-UHFFFAOYSA-N 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical class [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 239000004579 marble Substances 0.000 description 1
- 230000010534 mechanism of action Effects 0.000 description 1
- XIGAUIHYSDTJHW-UHFFFAOYSA-N mefenacet Chemical compound N=1C2=CC=CC=C2SC=1OCC(=O)N(C)C1=CC=CC=C1 XIGAUIHYSDTJHW-UHFFFAOYSA-N 0.000 description 1
- KPUREKXXPHOJQT-UHFFFAOYSA-N mesotrione Chemical compound [O-][N+](=O)C1=CC(S(=O)(=O)C)=CC=C1C(=O)C1C(=O)CCCC1=O KPUREKXXPHOJQT-UHFFFAOYSA-N 0.000 description 1
- VHCNQEUWZYOAEV-UHFFFAOYSA-N metamitron Chemical compound O=C1N(N)C(C)=NN=C1C1=CC=CC=C1 VHCNQEUWZYOAEV-UHFFFAOYSA-N 0.000 description 1
- STEPQTYSZVCJPV-UHFFFAOYSA-N metazachlor Chemical compound CC1=CC=CC(C)=C1N(C(=O)CCl)CN1N=CC=C1 STEPQTYSZVCJPV-UHFFFAOYSA-N 0.000 description 1
- JCHMGYRXQDASJE-UHFFFAOYSA-N metcamifen Chemical compound C1=CC(NC(=O)NC)=CC=C1S(=O)(=O)NC(=O)C1=CC=CC=C1OC JCHMGYRXQDASJE-UHFFFAOYSA-N 0.000 description 1
- 125000001160 methoxycarbonyl group Chemical group [H]C([H])([H])OC(*)=O 0.000 description 1
- RBNIGDFIUWJJEV-LLVKDONJSA-N methyl (2r)-2-(n-benzoyl-3-chloro-4-fluoroanilino)propanoate Chemical group C=1C=C(F)C(Cl)=CC=1N([C@H](C)C(=O)OC)C(=O)C1=CC=CC=C1 RBNIGDFIUWJJEV-LLVKDONJSA-N 0.000 description 1
- DLCGDGOEOISSHF-UHFFFAOYSA-N methyl 1-(2-chlorophenyl)-5-phenylpyrazole-3-carboxylate Chemical compound C=1C=CC=C(Cl)C=1N1N=C(C(=O)OC)C=C1C1=CC=CC=C1 DLCGDGOEOISSHF-UHFFFAOYSA-N 0.000 description 1
- MFSWTRQUCLNFOM-UHFFFAOYSA-N methyl 2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate Chemical group C1=CC(OC(C)C(=O)OC)=CC=C1OC1=NC=C(C(F)(F)F)C=C1Cl MFSWTRQUCLNFOM-UHFFFAOYSA-N 0.000 description 1
- NDQZMBNEHYSVPL-UHFFFAOYSA-N methyl 2-(5-chloroquinolin-8-yl)oxyacetate Chemical compound C1=CN=C2C(OCC(=O)OC)=CC=C(Cl)C2=C1 NDQZMBNEHYSVPL-UHFFFAOYSA-N 0.000 description 1
- NIFKBBMCXCMCAO-UHFFFAOYSA-N methyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]-4-(methanesulfonamidomethyl)benzoate Chemical group COC(=O)C1=CC=C(CNS(C)(=O)=O)C=C1S(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 NIFKBBMCXCMCAO-UHFFFAOYSA-N 0.000 description 1
- BACHBFVBHLGWSL-UHFFFAOYSA-N methyl 2-[4-(2,4-dichlorophenoxy)phenoxy]propanoate Chemical group C1=CC(OC(C)C(=O)OC)=CC=C1OC1=CC=C(Cl)C=C1Cl BACHBFVBHLGWSL-UHFFFAOYSA-N 0.000 description 1
- ZTYVMAQSHCZXLF-UHFFFAOYSA-N methyl 2-[[4,6-bis(difluoromethoxy)pyrimidin-2-yl]carbamoylsulfamoyl]benzoate Chemical group COC(=O)C1=CC=CC=C1S(=O)(=O)NC(=O)NC1=NC(OC(F)F)=CC(OC(F)F)=N1 ZTYVMAQSHCZXLF-UHFFFAOYSA-N 0.000 description 1
- IXCYSZWTYVEVEF-UHFFFAOYSA-N methyl 4-amino-3-chloro-6-cyclopropyl-5-fluoropyridine-2-carboxylate Chemical compound NC1=C(Cl)C(C(=O)OC)=NC(C2CC2)=C1F IXCYSZWTYVEVEF-UHFFFAOYSA-N 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- NDNKHWUXXOFHTD-UHFFFAOYSA-N metizoline Chemical compound CC=1SC2=CC=CC=C2C=1CC1=NCCN1 NDNKHWUXXOFHTD-UHFFFAOYSA-N 0.000 description 1
- 229960002939 metizoline Drugs 0.000 description 1
- VOEYXMAFNDNNED-UHFFFAOYSA-N metolcarb Chemical compound CNC(=O)OC1=CC=CC(C)=C1 VOEYXMAFNDNNED-UHFFFAOYSA-N 0.000 description 1
- DSRNRYQBBJQVCW-UHFFFAOYSA-N metoxuron Chemical compound COC1=CC=C(NC(=O)N(C)C)C=C1Cl DSRNRYQBBJQVCW-UHFFFAOYSA-N 0.000 description 1
- FOXFZRUHNHCZPX-UHFFFAOYSA-N metribuzin Chemical compound CSC1=NN=C(C(C)(C)C)C(=O)N1N FOXFZRUHNHCZPX-UHFFFAOYSA-N 0.000 description 1
- RSMUVYRMZCOLBH-UHFFFAOYSA-N metsulfuron methyl Chemical group COC(=O)C1=CC=CC=C1S(=O)(=O)NC(=O)NC1=NC(C)=NC(OC)=N1 RSMUVYRMZCOLBH-UHFFFAOYSA-N 0.000 description 1
- 244000005700 microbiome Species 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 238000001823 molecular biology technique Methods 0.000 description 1
- 238000010369 molecular cloning Methods 0.000 description 1
- DEDOPGXGGQYYMW-UHFFFAOYSA-N molinate Chemical compound CCSC(=O)N1CCCCCC1 DEDOPGXGGQYYMW-UHFFFAOYSA-N 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 238000002703 mutagenesis Methods 0.000 description 1
- 231100000350 mutagenesis Toxicity 0.000 description 1
- AIMMSOZBPYFASU-UHFFFAOYSA-N n-(4,6-dimethoxypyrimidin-2-yl)-n'-[3-(2,2,2-trifluoroethoxy)pyridin-1-ium-2-yl]sulfonylcarbamimidate Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CN=2)OCC(F)(F)F)=N1 AIMMSOZBPYFASU-UHFFFAOYSA-N 0.000 description 1
- GLBLPMUBLHYFCW-UHFFFAOYSA-N n-(5,7-dimethoxy-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2-methoxy-4-(trifluoromethyl)pyridine-3-sulfonamide Chemical compound N1=C2N=C(OC)C=C(OC)N2N=C1NS(=O)(=O)C1=C(OC)N=CC=C1C(F)(F)F GLBLPMUBLHYFCW-UHFFFAOYSA-N 0.000 description 1
- NYDKNJDNBUFWRJ-UHFFFAOYSA-N n-[4-(dimethylcarbamoylamino)phenyl]sulfonyl-2-methoxybenzamide Chemical compound COC1=CC=CC=C1C(=O)NS(=O)(=O)C1=CC=C(NC(=O)N(C)C)C=C1 NYDKNJDNBUFWRJ-UHFFFAOYSA-N 0.000 description 1
- HZDIJTXDRLNTIS-DAXSKMNVSA-N n-[[(z)-but-2-enoxy]methyl]-2-chloro-n-(2,6-diethylphenyl)acetamide Chemical compound CCC1=CC=CC(CC)=C1N(COC\C=C/C)C(=O)CCl HZDIJTXDRLNTIS-DAXSKMNVSA-N 0.000 description 1
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- UFWIBTONFRDIAS-UHFFFAOYSA-N naphthalene-acid Natural products C1=CC=CC2=CC=CC=C21 UFWIBTONFRDIAS-UHFFFAOYSA-N 0.000 description 1
- 229940042880 natural phospholipid Drugs 0.000 description 1
- 239000005645 nematicide Substances 0.000 description 1
- RTCOGUMHFFWOJV-UHFFFAOYSA-N nicosulfuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CN=2)C(=O)N(C)C)=N1 RTCOGUMHFFWOJV-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- NVGOPFQZYCNLDU-UHFFFAOYSA-N norflurazon Chemical compound O=C1C(Cl)=C(NC)C=NN1C1=CC=CC(C(F)(F)F)=C1 NVGOPFQZYCNLDU-UHFFFAOYSA-N 0.000 description 1
- 230000000050 nutritive effect Effects 0.000 description 1
- PMOWTIHVNWZYFI-UHFFFAOYSA-N o-Coumaric acid Natural products OC(=O)C=CC1=CC=CC=C1O PMOWTIHVNWZYFI-UHFFFAOYSA-N 0.000 description 1
- OLZQTUCTGLHFTQ-UHFFFAOYSA-N octan-2-yl 2-(4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxyacetate Chemical group CCCCCCC(C)OC(=O)COC1=NC(F)=C(Cl)C(N)=C1Cl OLZQTUCTGLHFTQ-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 235000019198 oils Nutrition 0.000 description 1
- 230000003287 optical effect Effects 0.000 description 1
- LLLFASISUZUJEQ-UHFFFAOYSA-N orbencarb Chemical compound CCN(CC)C(=O)SCC1=CC=CC=C1Cl LLLFASISUZUJEQ-UHFFFAOYSA-N 0.000 description 1
- 210000003463 organelle Anatomy 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- 230000008520 organization Effects 0.000 description 1
- 150000002905 orthoesters Chemical class 0.000 description 1
- UCDPMNSCCRBWIC-UHFFFAOYSA-N orthosulfamuron Chemical compound COC1=CC(OC)=NC(NC(=O)NS(=O)(=O)NC=2C(=CC=CC=2)C(=O)N(C)C)=N1 UCDPMNSCCRBWIC-UHFFFAOYSA-N 0.000 description 1
- UNAHYJYOSSSJHH-UHFFFAOYSA-N oryzalin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(S(N)(=O)=O)C=C1[N+]([O-])=O UNAHYJYOSSSJHH-UHFFFAOYSA-N 0.000 description 1
- 230000002018 overexpression Effects 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- IOXAXYHXMLCCJJ-UHFFFAOYSA-N oxetan-3-yl 2-[(4,6-dimethylpyrimidin-2-yl)carbamoylsulfamoyl]benzoate Chemical compound CC1=CC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)C(=O)OC2COC2)=N1 IOXAXYHXMLCCJJ-UHFFFAOYSA-N 0.000 description 1
- 150000002923 oximes Chemical class 0.000 description 1
- 239000005022 packaging material Substances 0.000 description 1
- 229910052625 palygorskite Inorganic materials 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- FIKAKWIAUPDISJ-UHFFFAOYSA-L paraquat dichloride Chemical compound [Cl-].[Cl-].C1=C[N+](C)=CC=C1C1=CC=[N+](C)C=C1 FIKAKWIAUPDISJ-UHFFFAOYSA-L 0.000 description 1
- 244000052769 pathogen Species 0.000 description 1
- CHIFOSRWCNZCFN-UHFFFAOYSA-N pendimethalin Chemical compound CCC(CC)NC1=C([N+]([O-])=O)C=C(C)C(C)=C1[N+]([O-])=O CHIFOSRWCNZCFN-UHFFFAOYSA-N 0.000 description 1
- HVAMZGADVCBITI-UHFFFAOYSA-M pent-4-enoate Chemical compound [O-]C(=O)CCC=C HVAMZGADVCBITI-UHFFFAOYSA-M 0.000 description 1
- 150000005603 pentanoic acids Chemical class 0.000 description 1
- JZPKLLLUDLHCEL-UHFFFAOYSA-N pentoxazone Chemical compound O=C1C(=C(C)C)OC(=O)N1C1=CC(OC2CCCC2)=C(Cl)C=C1F JZPKLLLUDLHCEL-UHFFFAOYSA-N 0.000 description 1
- 125000001147 pentyl group Chemical class C(CCCC)* 0.000 description 1
- CSWIKHNSBZVWNQ-UHFFFAOYSA-N pethoxamide Chemical compound CCOCCN(C(=O)CCl)C(=C(C)C)C1=CC=CC=C1 CSWIKHNSBZVWNQ-UHFFFAOYSA-N 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- IDOWTHOLJBTAFI-UHFFFAOYSA-N phenmedipham Chemical compound COC(=O)NC1=CC=CC(OC(=O)NC=2C=C(C)C=CC=2)=C1 IDOWTHOLJBTAFI-UHFFFAOYSA-N 0.000 description 1
- 150000003904 phospholipids Chemical class 0.000 description 1
- 150000004714 phosphonium salts Chemical class 0.000 description 1
- 230000005097 photorespiration Effects 0.000 description 1
- 239000001007 phthalocyanine dye Substances 0.000 description 1
- 239000000280 phytoalexin Substances 0.000 description 1
- 150000001857 phytoalexin derivatives Chemical class 0.000 description 1
- 108010001545 phytoene dehydrogenase Proteins 0.000 description 1
- NQQVFXUMIDALNH-UHFFFAOYSA-N picloram Chemical compound NC1=C(Cl)C(Cl)=NC(C(O)=O)=C1Cl NQQVFXUMIDALNH-UHFFFAOYSA-N 0.000 description 1
- CWKFPEBMTGKLKX-UHFFFAOYSA-N picolinafen Chemical compound C1=CC(F)=CC=C1NC(=O)C1=CC=CC(OC=2C=C(C=CC=2)C(F)(F)F)=N1 CWKFPEBMTGKLKX-UHFFFAOYSA-N 0.000 description 1
- MGOHCFMYLBAPRN-UHFFFAOYSA-N pinoxaden Chemical compound CCC1=CC(C)=CC(CC)=C1C(C1=O)=C(OC(=O)C(C)(C)C)N2N1CCOCC2 MGOHCFMYLBAPRN-UHFFFAOYSA-N 0.000 description 1
- 239000013612 plasmid Substances 0.000 description 1
- 239000002798 polar solvent Substances 0.000 description 1
- 229920000151 polyglycol Polymers 0.000 description 1
- 239000010695 polyglycol Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000011118 polyvinyl acetate Substances 0.000 description 1
- 229920002689 polyvinyl acetate Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 230000032361 posttranscriptional gene silencing Effects 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 159000000001 potassium salts Chemical class 0.000 description 1
- AAEVYOVXGOFMJO-UHFFFAOYSA-N prometryn Chemical compound CSC1=NC(NC(C)C)=NC(NC(C)C)=N1 AAEVYOVXGOFMJO-UHFFFAOYSA-N 0.000 description 1
- MFOUDYKPLGXPGO-UHFFFAOYSA-N propachlor Chemical compound ClCC(=O)N(C(C)C)C1=CC=CC=C1 MFOUDYKPLGXPGO-UHFFFAOYSA-N 0.000 description 1
- IKVXBIIHQGXQRQ-CYBMUJFWSA-N propan-2-yl (2r)-2-(n-benzoyl-3-chloro-4-fluoroanilino)propanoate Chemical group C=1C=C(F)C(Cl)=CC=1N([C@H](C)C(=O)OC(C)C)C(=O)C1=CC=CC=C1 IKVXBIIHQGXQRQ-CYBMUJFWSA-N 0.000 description 1
- REJMLNWDJIPPSE-UHFFFAOYSA-N propan-2-yl 4-[[2-(4,6-dimethoxypyrimidin-2-yl)oxyphenyl]methylamino]benzoate Chemical group COC1=CC(OC)=NC(OC=2C(=CC=CC=2)CNC=2C=CC(=CC=2)C(=O)OC(C)C)=N1 REJMLNWDJIPPSE-UHFFFAOYSA-N 0.000 description 1
- FKLQIONHGSFYJY-UHFFFAOYSA-N propan-2-yl 5-[4-bromo-1-methyl-5-(trifluoromethyl)pyrazol-3-yl]-2-chloro-4-fluorobenzoate Chemical compound C1=C(Cl)C(C(=O)OC(C)C)=CC(C=2C(=C(N(C)N=2)C(F)(F)F)Br)=C1F FKLQIONHGSFYJY-UHFFFAOYSA-N 0.000 description 1
- LFULEKSKNZEWOE-UHFFFAOYSA-N propanil Chemical compound CCC(=O)NC1=CC=C(Cl)C(Cl)=C1 LFULEKSKNZEWOE-UHFFFAOYSA-N 0.000 description 1
- FROBCXTULYFHEJ-OAHLLOKOSA-N propaquizafop Chemical compound C1=CC(O[C@H](C)C(=O)OCCON=C(C)C)=CC=C1OC1=CN=C(C=C(Cl)C=C2)C2=N1 FROBCXTULYFHEJ-OAHLLOKOSA-N 0.000 description 1
- 235000019260 propionic acid Nutrition 0.000 description 1
- PHNUZKMIPFFYSO-UHFFFAOYSA-N propyzamide Chemical compound C#CC(C)(C)NC(=O)C1=CC(Cl)=CC(Cl)=C1 PHNUZKMIPFFYSO-UHFFFAOYSA-N 0.000 description 1
- NQLVQOSNDJXLKG-UHFFFAOYSA-N prosulfocarb Chemical compound CCCN(CCC)C(=O)SCC1=CC=CC=C1 NQLVQOSNDJXLKG-UHFFFAOYSA-N 0.000 description 1
- 239000003531 protein hydrolysate Substances 0.000 description 1
- 239000008262 pumice Substances 0.000 description 1
- APTZNLHMIGJTEW-UHFFFAOYSA-N pyraflufen-ethyl Chemical group C1=C(Cl)C(OCC(=O)OCC)=CC(C=2C(=C(OC(F)F)N(C)N=2)Cl)=C1F APTZNLHMIGJTEW-UHFFFAOYSA-N 0.000 description 1
- DWSPRBSLSXQIEJ-UHFFFAOYSA-N pyrasulfotole Chemical compound CC1=NN(C)C(O)=C1C(=O)C1=CC=C(C(F)(F)F)C=C1S(C)(=O)=O DWSPRBSLSXQIEJ-UHFFFAOYSA-N 0.000 description 1
- FKERUJTUOYLBKB-UHFFFAOYSA-N pyrazoxyfen Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(=O)C=1C(C)=NN(C)C=1OCC(=O)C1=CC=CC=C1 FKERUJTUOYLBKB-UHFFFAOYSA-N 0.000 description 1
- VTRWMTJQBQJKQH-UHFFFAOYSA-N pyributicarb Chemical compound COC1=CC=CC(N(C)C(=S)OC=2C=C(C=CC=2)C(C)(C)C)=N1 VTRWMTJQBQJKQH-UHFFFAOYSA-N 0.000 description 1
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 1
- ILVXOBCQQYKLDS-UHFFFAOYSA-N pyridine N-oxide Chemical class [O-][N+]1=CC=CC=C1 ILVXOBCQQYKLDS-UHFFFAOYSA-N 0.000 description 1
- USSIUIGPBLPCDF-KEBDBYFISA-N pyriminobac-methyl Chemical group CO\N=C(/C)C1=CC=CC(OC=2N=C(OC)C=C(OC)N=2)=C1C(=O)OC USSIUIGPBLPCDF-KEBDBYFISA-N 0.000 description 1
- 239000010453 quartz Substances 0.000 description 1
- 125000001453 quaternary ammonium group Chemical group 0.000 description 1
- 238000010791 quenching Methods 0.000 description 1
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 1
- FFSSWMQPCJRCRV-UHFFFAOYSA-N quinclorac Chemical compound ClC1=CN=C2C(C(=O)O)=C(Cl)C=CC2=C1 FFSSWMQPCJRCRV-UHFFFAOYSA-N 0.000 description 1
- ALZOLUNSQWINIR-UHFFFAOYSA-N quinmerac Chemical compound OC(=O)C1=C(Cl)C=CC2=CC(C)=CN=C21 ALZOLUNSQWINIR-UHFFFAOYSA-N 0.000 description 1
- OSUHJPCHFDQAIT-GFCCVEGCSA-N quizalofop-P-ethyl Chemical group C1=CC(O[C@H](C)C(=O)OCC)=CC=C1OC1=CN=C(C=C(Cl)C=C2)C2=N1 OSUHJPCHFDQAIT-GFCCVEGCSA-N 0.000 description 1
- BBKDWPHJZANJGB-IKJXHCRLSA-N quizalofop-P-tefuryl Chemical group O=C([C@H](OC=1C=CC(OC=2N=C3C=CC(Cl)=CC3=NC=2)=CC=1)C)OCC1CCCO1 BBKDWPHJZANJGB-IKJXHCRLSA-N 0.000 description 1
- BACHBFVBHLGWSL-JTQLQIEISA-N rac-diclofop methyl Natural products C1=CC(O[C@@H](C)C(=O)OC)=CC=C1OC1=CC=C(Cl)C=C1Cl BACHBFVBHLGWSL-JTQLQIEISA-N 0.000 description 1
- 230000005855 radiation Effects 0.000 description 1
- 230000006798 recombination Effects 0.000 description 1
- 238000005215 recombination Methods 0.000 description 1
- 230000009467 reduction Effects 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 239000005871 repellent Substances 0.000 description 1
- 230000002940 repellent Effects 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 108091092562 ribozyme Proteins 0.000 description 1
- MEFOUWRMVYJCQC-UHFFFAOYSA-N rimsulfuron Chemical compound CCS(=O)(=O)C1=CC=CN=C1S(=O)(=O)NC(=O)NC1=NC(OC)=CC(OC)=N1 MEFOUWRMVYJCQC-UHFFFAOYSA-N 0.000 description 1
- 239000011435 rock Substances 0.000 description 1
- GNHDVXLWBQYPJE-UHFFFAOYSA-N saflufenacil Chemical compound C1=C(Cl)C(C(=O)NS(=O)(=O)N(C)C(C)C)=CC(N2C(N(C)C(=CC2=O)C(F)(F)F)=O)=C1F GNHDVXLWBQYPJE-UHFFFAOYSA-N 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- 238000009394 selective breeding Methods 0.000 description 1
- 229910052624 sepiolite Inorganic materials 0.000 description 1
- 235000019355 sepiolite Nutrition 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- ODCWYMIRDDJXKW-UHFFFAOYSA-N simazine Chemical compound CCNC1=NC(Cl)=NC(NCC)=N1 ODCWYMIRDDJXKW-UHFFFAOYSA-N 0.000 description 1
- MGLWZSOBALDPEK-UHFFFAOYSA-N simetryn Chemical compound CCNC1=NC(NCC)=NC(SC)=N1 MGLWZSOBALDPEK-UHFFFAOYSA-N 0.000 description 1
- JKPSVOHVUGMYGH-UHFFFAOYSA-M sodium;(4,6-dimethoxypyrimidin-2-yl)-[[3-methoxycarbonyl-6-(trifluoromethyl)pyridin-2-yl]sulfonylcarbamoyl]azanide Chemical compound [Na+].COC(=O)C1=CC=C(C(F)(F)F)N=C1S(=O)(=O)NC(=O)[N-]C1=NC(OC)=CC(OC)=N1 JKPSVOHVUGMYGH-UHFFFAOYSA-M 0.000 description 1
- YPMAQKXGDCKXPE-WCCKRBBISA-M sodium;[(3s)-3-amino-3-carboxypropyl]-methylphosphinate Chemical compound [Na+].CP([O-])(=O)CC[C@H](N)C(O)=O YPMAQKXGDCKXPE-WCCKRBBISA-M 0.000 description 1
- JRQGDDUXDKCWRF-UHFFFAOYSA-M sodium;n-(2-methoxycarbonylphenyl)sulfonyl-4-methyl-5-oxo-3-propoxy-1,2,4-triazole-1-carboximidate Chemical compound [Na+].O=C1N(C)C(OCCC)=NN1C(=O)[N-]S(=O)(=O)C1=CC=CC=C1C(=O)OC JRQGDDUXDKCWRF-UHFFFAOYSA-M 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000010561 standard procedure Methods 0.000 description 1
- 230000000707 stereoselective effect Effects 0.000 description 1
- 238000005728 strengthening Methods 0.000 description 1
- PQTBTIFWAXVEPB-UHFFFAOYSA-N sulcotrione Chemical compound ClC1=CC(S(=O)(=O)C)=CC=C1C(=O)C1C(=O)CCCC1=O PQTBTIFWAXVEPB-UHFFFAOYSA-N 0.000 description 1
- OORLZFUTLGXMEF-UHFFFAOYSA-N sulfentrazone Chemical compound O=C1N(C(F)F)C(C)=NN1C1=CC(NS(C)(=O)=O)=C(Cl)C=C1Cl OORLZFUTLGXMEF-UHFFFAOYSA-N 0.000 description 1
- ZDXMLEQEMNLCQG-UHFFFAOYSA-N sulfometuron methyl Chemical group COC(=O)C1=CC=CC=C1S(=O)(=O)NC(=O)NC1=NC(C)=CC(C)=N1 ZDXMLEQEMNLCQG-UHFFFAOYSA-N 0.000 description 1
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical compound [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 description 1
- 150000003462 sulfoxides Chemical class 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 235000002906 tartaric acid Nutrition 0.000 description 1
- 239000011975 tartaric acid Substances 0.000 description 1
- IUQAXCIUEPFPSF-UHFFFAOYSA-N tembotrione Chemical compound ClC1=C(COCC(F)(F)F)C(S(=O)(=O)C)=CC=C1C(=O)C1C(=O)CCCC1=O IUQAXCIUEPFPSF-UHFFFAOYSA-N 0.000 description 1
- IROINLKCQGIITA-UHFFFAOYSA-N terbutryn Chemical compound CCNC1=NC(NC(C)(C)C)=NC(SC)=N1 IROINLKCQGIITA-UHFFFAOYSA-N 0.000 description 1
- FZXISNSWEXTPMF-UHFFFAOYSA-N terbutylazine Chemical compound CCNC1=NC(Cl)=NC(NC(C)(C)C)=N1 FZXISNSWEXTPMF-UHFFFAOYSA-N 0.000 description 1
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 1
- ZFXYFBGIUFBOJW-UHFFFAOYSA-N theophylline Chemical compound O=C1N(C)C(=O)N(C)C2=C1NC=N2 ZFXYFBGIUFBOJW-UHFFFAOYSA-N 0.000 description 1
- 229960000278 theophylline Drugs 0.000 description 1
- XSKZXGDFSCCXQX-UHFFFAOYSA-N thiencarbazone-methyl Chemical compound COC(=O)C1=CSC(C)=C1S(=O)(=O)NC(=O)N1C(=O)N(C)C(OC)=N1 XSKZXGDFSCCXQX-UHFFFAOYSA-N 0.000 description 1
- AHTPATJNIAFOLR-UHFFFAOYSA-N thifensulfuron-methyl Chemical group S1C=CC(S(=O)(=O)NC(=O)NC=2N=C(OC)N=C(C)N=2)=C1C(=O)OC AHTPATJNIAFOLR-UHFFFAOYSA-N 0.000 description 1
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 description 1
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 1
- DQFPEYARZIQXRM-LTGZKZEYSA-N tralkoxydim Chemical compound C1C(=O)C(C(/CC)=N/OCC)=C(O)CC1C1=C(C)C=C(C)C=C1C DQFPEYARZIQXRM-LTGZKZEYSA-N 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- 238000012546 transfer Methods 0.000 description 1
- XOPFESVZMSQIKC-UHFFFAOYSA-N triasulfuron Chemical compound COC1=NC(C)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)OCCCl)=N1 XOPFESVZMSQIKC-UHFFFAOYSA-N 0.000 description 1
- YMXOXAPKZDWXLY-QWRGUYRKSA-N tribenuron methyl Chemical group COC(=O)[C@H]1CCCC[C@@H]1S(=O)(=O)NC(=O)N(C)C1=NC(C)=NC(OC)=N1 YMXOXAPKZDWXLY-QWRGUYRKSA-N 0.000 description 1
- REEQLXCGVXDJSQ-UHFFFAOYSA-N trichlopyr Chemical compound OC(=O)COC1=NC(Cl)=C(Cl)C=C1Cl REEQLXCGVXDJSQ-UHFFFAOYSA-N 0.000 description 1
- ZSDSQXJSNMTJDA-UHFFFAOYSA-N trifluralin Chemical compound CCCN(CCC)C1=C([N+]([O-])=O)C=C(C(F)(F)F)C=C1[N+]([O-])=O ZSDSQXJSNMTJDA-UHFFFAOYSA-N 0.000 description 1
- IMEVJVISCHQJRM-UHFFFAOYSA-N triflusulfuron-methyl Chemical group COC(=O)C1=CC=CC(C)=C1S(=O)(=O)NC(=O)NC1=NC(OCC(F)(F)F)=NC(N(C)C)=N1 IMEVJVISCHQJRM-UHFFFAOYSA-N 0.000 description 1
- NRZWQKGABZFFKE-UHFFFAOYSA-N trimethylsulfonium Chemical class C[S+](C)C NRZWQKGABZFFKE-UHFFFAOYSA-N 0.000 description 1
- KVEQCVKVIFQSGC-UHFFFAOYSA-N tritosulfuron Chemical compound FC(F)(F)C1=NC(OC)=NC(NC(=O)NS(=O)(=O)C=2C(=CC=CC=2)C(F)(F)F)=N1 KVEQCVKVIFQSGC-UHFFFAOYSA-N 0.000 description 1
- 239000004562 water dispersible granule Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/34—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom
- A01N43/40—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with one nitrogen atom as the only ring hetero atom six-membered rings
Definitions
- the present invention relates to agrochemically active herbicide-safener combinations, to processes for their preparation and to their use for controlling harmful plants.
- WO 2003/011853 are structurally different from those described in the compositions according to the invention, namely they have an aryl or heteroaryl substituent in the 6-position of pyridine.
- WO 2007/082098 also discloses structurally different pyridine derivatives, namely also 6-aryl-substituted compounds.
- WO 2006/062979 discloses the pyridine derivatives used in the composition according to the invention, the use of safeners in combination with these is only described generically. It is not described which safeners are suitable for the compounds, also no biological data are shown that demonstrate an actual safener effect.
- the active ingredients in the compositions according to the invention are - if applied without safener - sometimes not fully compatible with some important crops such as various cereals, corn or rice. Therefore, they can not be used in some crops to ensure the desired broad herbicidal activity against harmful plants.
- the object of the present invention is therefore to find herbicidal agents in which the selectivity of the abovementioned herbicides is increased in relation to important crop plants. This object is surprisingly achieved by the herbicide-safener combination according to the invention.
- R 1 is hydrogen, fluorine or chlorine
- R 2 is hydrogen, C 1 -C 4 alkyl optionally substituted with one to two R 7 , C 2 -C 4 alkenyl optionally substituted with one to two radicals
- R 4 is halogen
- R 5 is COOH or a herbicidally active derivative of COOH
- R 6 is independently halogen, Ci-C 6 alkyl, Ci-C 6 haloalkyl, C 2 - Ce alkenyl, C 2 -C 6 haloalkenyl, C r C 3 alkoxy, dC 2 haloalkoxy, Ci- C 3 -
- R 7 , R 8 and R 9 are each independently halogen, dC 3 -
- R 10 independently of one another represent hydrogen, C 1 -C 4 -alkyl, C 1 -C 3 -haloalkyl,
- R 11 is hydrogen, C 1 -C 4 alkyl, C 3 haloalkyl or CHR 24 C (O) OR 25 ;
- R 12 is C 1 -C 4 alkyl or C 3 haloalkyl
- R 14 is hydrogen or C 1 -C 4 alkyl
- R 15 is hydrogen, C 1 -C 4 alkyl or phenyl optionally substituted with one to three R 27 radicals;
- R 16 is hydrogen or C 1 -C 4 alkyl; or
- R 15 and R 16 together represent - (CH 2 ) 4 - or - (CH 2 ) S -;
- R 17 independently of one another are halogen, C 1 -C 3 -alkoxy, C 1 -C 3 -haloalkoxy,
- R 18 independently represents halogen, Ci-C 3 alkyl, C- ⁇ -C 3 alkoxy, Ci- C3 haloalkoxy, Ci-C3 alkylthio, dC 3 haloalkylthio, amino, Ci-C 3 -
- R 19 is hydrogen or C 1 -C 4 -alkyl
- R 20 and R 21 independently of one another are hydrogen or C 1 -C 4 -alkyl; or
- R 22 is hydrogen or C 1 -C 4 -alkyl
- R 23 is C 1 -C 4 alkyl
- R 24 is hydrogen, C 1 -C 4 -alkyl or C 1 -C 4 -alkoxy
- R 25 is hydrogen, C 1 -C 4 alkyl or benzyl
- R 26 is hydrogen, C 1 -C 6 -alkyl, C 1 -C 3 -haloalkyl, C 1 -C 4 -alkoxy, phenyl, phenoxy or benzyloxy;
- R 27 is independently methyl, chloro or methoxy;
- O 1 represents 1, 2, 3, 4 or 5;
- the herbicide-safener combinations according to the invention may contain additional other components, for example crop protection agents of another type and / or additives customary in plant protection and / or formulation auxiliaries, or be used together with them.
- the herbicides (A) and safeners (B) can be applied in a known manner, for example jointly (for example as a co-formulation or as a tank mixture) or also as a splitting, e.g. on the plants, plant parts, plant seeds or the area on which the plants grow. It is possible, e.g. the application of the individual active substances or the herbicide-safener combination in several portions (sequence application), for. After pre-emergence applications, followed by post-emergence applications or early post-emergence applications, followed by mid-late applications
- the abovementioned formula (I) comprises all stereoisomers and mixtures thereof, in particular also racemic mixtures, and - as far as enantiomers are possible - both enantiomers and in particular the respective biologically active enantiomer.
- a herbicidally active derivative is salts, esters, carboxamides, acylhydrazides, imidates,
- the salts of the compounds of the general formula (I) which are suitable in the field of crop protection are salts which are obtained by contacting with acids or bases or by ion exchange, so that the derived salts have sufficient water solubility for the bioavailability and thus the herbicidal activity.
- the compounds of formula (I) can be further prepared by addition of a suitable inorganic or organic acid such as HCl, HBr, H 2 SO 4 , H 3 PO 4 , or HNO 3 , but also oxalic acid, acetic acid, butyric acid, fumaric acid, lactic acid, Malonic acid, propionic acid, salicylic acid, tartaric acid, pentanoic acids or sulfonic acids, such as para-toluenesulfonic acid, to form a basic group, such as amino or alkylamino salts.
- a suitable inorganic or organic acid such as HCl, HBr, H 2 SO 4 , H 3 PO 4 , or HNO 3
- oxalic acid acetic acid, butyric acid, fumaric acid, lactic acid, Malonic acid, propionic acid, salicylic acid, tartaric acid, pentanoic acids or sulfonic acids, such as para-toluenesul
- Suitable substituents which are present in deprotonated form such as, for example, sulfonic acids or carboxylic acids, may be internal salts in turn protonatable groups, such as amino groups form. Salts can also be formed by replacing the hydrogen with a suitable cation for agriculture with suitable substituents, such as, for example, sulfonic acids or carboxylic acids.
- salts are, for example, metal salts, in particular alkali metal salts or alkaline earth metal salts, in particular sodium and potassium salts, salts with organic amines, for example of dimethylamine, diethanolamine or triethanolamine, ammonium salts, in particular quaternary (quaternary) ammonium salts with cations of the formula [NRR'R "R '" ] + , wherein R to R 1 "each independently represent an organic radical, in particular alkyl, aryl, aralkyl or alkylaryl, or sulfonium salts, for example trimethylsulfonium salts.
- ester and thioester derivatives of the carboxylic acid function of R 5 are also particularly suitable.
- Ester groups result from the condensation of a carboxylic acid (CO 2 H) function with an alcohol (ie R AL OH) where R AL is a radical derived from the alcohol; a variety of methods are known for producing such esters.
- Analogous thioester groups of the formula C (O) SR AL can be obtained as the condensation product of a carboxylic acid function with a thioalcohol (mercaptan) of the formula R AL SH; a variety of methods are also known to prepare such thioesters.
- the corresponding ester or thioester compounds of the general formula (I) are easily hydrolyzed, for example by the presence of hydrolytically active enzymes, whereby the corresponding carboxylic acid function is again obtained.
- the radical R AL has more than one OH or SH function
- the radical may be condensed with more than one pyridine ring system of the general formula (I).
- ester and thioester compounds of the general formula (I) are based in particular on ester or thioester formation with methanol, ethanol, butanol, 2-butoxyethanol, 2-ethylhexanol, isopropanol, 2-methylpropanol (isobutanol), octanol isomers (isoctanol) and Ethanethiol to give each methyl, ethyl, butyl, 2- Butoxyethyl, 2-ethylhexyl, isopropyl, 2-methylpropyl, isoctyl and Ethylthioester to form. Particularly preferred are the methyl and ethyl esters.
- the present invention encompasses compounds of the general formula (I) in which
- R 29 is a divalent radical linking the carboxyl ester function CO 2 R 29 of each two pyridine ring systems of general formula (I), and the divalent radical is selected from the group consisting of -CH 2 -, - (CH 2 ) 2 -, - (CH 2 ) 3 - and -CH (CH 3 ) CH 2 -;
- R 30 is hydrogen, C 1 -C 10 -alkyl, which may optionally be substituted by 1 to 3 radicals R 46 , or benzyl;
- R 31 and R 32 are independently dC 4 alkyl or CrC 3 haloalkyl; or
- R 31 and R 32 together are -CH 2 CH 2 -, -CH 2 CH (CH 3 ) - or - (CH 2 ) 3 -;
- R 33 is hydrogen, Ci-C 4 alkyl, C 1 -C 4 -HaIOaIKyI or benzyl;
- Alkoxycarbonyl or benzyl, - R 34 is hydrogen, dC 4 alkyl, C r C 4 haloalkyl, C 2 -C 4 alkylcarbonyl, C 2 -C 4;
- R 35 is hydrogen, C r C 4 alkyl or dC 4 haloalkyl
- R 36 is hydrogen, C r C 4 alkyl, hydroxy, C r C 4 alkoxy or S (O) 2 R 47 ;
- R 37 is hydrogen or C 1 -C 4 alkyl
- R 38, R 39 and R 40 is hydrogen or a radical which is selected from the group consisting of Ci-Cw-alkyl, C 3 -C 12 cycloalkyl, C 4 -C 12 alkylcycloalkyl, C 4 -C 12 -cycloalkylalkyl, C 2 -C 14 -alkenyl and C 2 -C 14 -alkynyl, where each radical may optionally be substituted by 1 to 3 radicals R 45 ;
- Y is O, S or NR 48
- R 41 is hydrogen, Ci-C 3 alkyl, -C 3 haloalkyl, C 2 -C 4 alkoxyalkyl, OH or C 1 -C 3 -alkoxy;
- R 42 is C r C 3 alkyl, C 1 -C 12 haloalkyl or C 2 -C 4 alkoxyalkyl; or
- R 41 and R 42 together form - (CH 2 J 2 -, -CH 2 CH (CH 3 ) - or - (CH 2 ) 3 -;
- R 43 and R 44 are independently of each other C 1 -C 4 alkyl
- each R 45 is independently selected from the group consisting of halogen, cyano, hydroxycarbonyl, C 2 -C 4 -alkoxycarbonyl, hydroxy, C 1 -C 4 -alkoxy, C 1 -C 4 -HaIOalkoxy, C 1 -C 4 - Alkylthio, C 1 -C 4 - Haloalkylthio, amino, C 1 -C 4 -alkylamino, C 2 -C 4 -dialkylamino, -CH [O (CH 2 ) n ] and phenyl which may optionally be substituted by 1 to 3 radicals R 49 ; or
- R 45 together form -OC (O) O- or -O (C (R 50 ) (R 50 )) i -2 O-; or
- R 45's are taken together as an oxygen atom to form a carbonyl with the carbon atom to which they are attached;
- each R 46 is independently selected from the group consisting of halogen, Ci-C 4 alkoxy, -C 4 -haloalkoxy, C 1 -C 4 -AIKyKhJo, C 1 -C 4 - haloalkylthio, amino, Ci-C 4 - Alkylamino or C 2 -C 4 dialkylamino; or
- R 46 are taken together as an oxygen atom to form a carbonyl radical with the carbon atom to which they are attached;
- R 47 is C 1 -C 4 alkyl, C 1 -C 3 haloalkyl or NR 51 R 52 ;
- R 48 is H, C r C 3 alkyl, C 1 -C 3 haloalkyl or C 2 -C 4 alkoxyalkyl;
- each R 49 is independently selected from the group consisting of halogen, C 1 -C 4 -alkyl, C 1 -C 3 -HaIOaIKyI, hydroxy, C 1 -C 4 -alkoxy, C 1 - C 3 haloalkoxy, C -Al 1 -C 3 alkylthio, C 1 -C 3 -HaIOaIKyItIIiO, amino, C 1 -C 3 -
- each R 50 is independently selected from the group consisting of hydrogen and C 1 -C 4 alkyl
- R 51 and R 52 are independently selected from the group consisting of hydrogen or C 1 -C 4 alkyl; m is an integer of 2 to 3; and
- n is an integer from 1 to 4.
- the present invention encompasses compounds of the general formula (I) in which
- R 5 is CO 2 R 29 , CH 2 OR 30 or CHO.
- the present invention encompasses compounds of the general formula (I) in which
- R 5 is CO 2 R 29 or CHO.
- the present invention encompasses compounds of the general formula (I) in which
- R 5 is CO 2 R 29 .
- the present invention encompasses compounds of the general formula (I) in which
- R 29 is selected from the group consisting of hydrogen, C 1 -C 8 -AIRyI or d-alkyl which is substituted by phenyl, where the phenyl radical may optionally be substituted by 1 to 3 radicals R 45 .
- the present invention encompasses compounds of the general formula (I) in which
- R 29 is selected from the group consisting of hydrogen, C 1 -C 4 -alkyl or C 1 -C 4 -alkyl which is substituted by phenyl, where the phenyl radical optionally substituted with 1 to 3 radicals R 45 may be substituted.
- the present invention encompasses compounds of the general formula (I) in which
- R 29 is selected from the group consisting of hydrogen, C 1 -C 4 alkyl or benzyl.
- the present invention encompasses compounds of the general formula (I) in which
- R 36 is selected from the group consisting of hydrogen, C 1 -C 4 -alkyl, hydroxy or C 1 -C 4 -alkoxy.
- the present invention relates to compounds of the general formula (I) in which
- R 41 is selected from the group consisting of hydrogen, C 1 -C 3 alkyl, C 1 -C 3 haloalkyl or C 2 -C 4 alkoxyalkyl.
- the present invention covers compounds of the general formula (I) in which
- R 5 is selected from the group consisting of COOH, an agrochemically acceptable salt, an ester and a thioester derivative thereof.
- the present invention encompasses compounds of the general formula (I) in which
- R 5 is selected from the group consisting of COOH, an agrochemically acceptable salt, and an ester derivative thereof.
- the present invention relates to compounds of the general formula (I) in which
- p is an integer from 0 to 2.
- the present invention covers compounds of the general formula (I) in which
- p is an integer from 0 to 1.
- the present invention encompasses compounds of the general formula (I) in which
- the present invention covers compounds of the general formula (I) in which
- R 1 is hydrogen or F.
- the present invention encompasses compounds of the general formula (I) in which
- R 1 is F or Cl.
- the present invention covers compounds of the general formula (I) in which
- R 1 is H.
- the present invention encompasses compounds of the general formula (I) in which R 1 is F.
- the present invention covers compounds of the general formula (I) in which
- R 1 is Cl.
- the present invention encompasses compounds of the general formula (I) in which
- R 2 is H, C (O) R 10 or C 1 -C 4 alkyl which may optionally be substituted with R 7 ;
- the present invention encompasses compounds of the general formula (I) in which
- R 2 is H, CH 3 or C (O) R 10 ;
- R 3 is H or CH 3 ; or
- the present invention covers compounds of the general formula (I) in which
- R 2 is H, C (O) CH 3 or C 1 -C 4 alkyl which may optionally be substituted with R 7 ; and R 3 is H or C 1-4 alkyl.
- the present invention encompasses compounds of the general formula (I) in which R 2 and R 3 are independently hydrogen or methyl.
- the present invention encompasses compounds of the general formula (I) in which
- R 2 and R 3 are hydrogen.
- the present invention includes compounds of the general formula (I) in which
- R 4 is Br or Cl.
- the present invention encompasses compounds of the general formula (I) in which
- R 4 is Cl.
- the present invention encompasses compounds of the general formula (I) in which
- each R 6 is independently halogen, C 1 -C 2 -alkyl or C 1 -C 2 -haloalkyl.
- the present invention covers compounds of the general formula (I) in which
- R 7 is halo, methoxy, fluoromethoxy, methylthio, fluoromethylthio, amino, methylamino, dimethylamino or methoxycarbonyl.
- the present invention covers compounds of the general formula (I) in which R 10 is hydrogen or C 1 -C 3 alkyl.
- the present invention encompasses compounds of the general formula (I) in which
- R 10 is hydrogen or CH 3 .
- the present invention encompasses compounds of the general formula (I) in which
- R 10 is CH 3 .
- the present invention encompasses compounds of the general formula (I) in which
- R 19 is hydrogen or C 1 -C 2 alkyl.
- the present invention encompasses compounds of the general formula (I) in which
- R 32 is hydrogen or CH 3 .
- the present invention encompasses compounds of the general formula (I) in which
- R 20 and R 21 are independently hydrogen or C 1 -C 2 alkyl.
- the present invention covers compounds of the general formula (I) in which
- R 20 and R 21 are independently hydrogen or CH 3 . Included in the compositions of the described embodiments are N-oxides and agrochemically acceptable salts thereof. Combinations of the embodiments 1 to 35 are shown by
- R 29 represents a divalent radical linking the carboxyl ester function CO 2 R 29 of two pyridine ring systems of general formula (I), and the divalent radical is selected from the group consisting of -CH 2 -, - (CH 2 ) 2 -, - (CH 2 ) 3 - and -CH (CH 3 ) CH 2 -;
- R 30 is hydrogen; Ci-Cio-alkyl, which optionally with 1 to 3
- R 46 radicals may be substituted; or benzyl
- R 31 and R 32 are independently C 1 -C 4 alkyl or C 1 -C 3 haloalkyl; or
- R 31 and R 32 together represent -CH 2 CH 2 -, -CH 2 CH (CH 3 ) - or - (CH 2 J 3 -;
- R 33 is hydrogen, C 1 -C 4 alkyl, C 1 -C 4 haloalkyl or benzyl;
- R 34 is hydrogen, dC 4 alkyl, Ci-C 4 haloalkyl, C 2 -C 4 alkylcarbonyl, C 2 -C 4 ⁇ lkoxycarbonyl or benzyl;
- R 35 is hydrogen, C 1 -C 4 alkyl or C 1 -C 4 haloalkyl
- R 36 is hydrogen, C r C 4 alkyl, hydroxy, C r C 4 alkoxy or S (O) 2 R 47 ;
- R 37 is hydrogen or C 1 -C 4 alkyl
- R 38 , R 39 and R 40 are hydrogen or a radical selected from the group consisting of C 1 -C 14 -
- Y is O, S or NR 48 ;
- R 41 is hydrogen, Ci-C 3 alkyl, -C 3 haloalkyl, C 2 -C 4 alkoxyalkyl, OH or C 1 -C 3 -alkoxy;
- R 42 is C 1 -C 3 alkyl, C r C 3 haloalkyl or C 2 -C 4 alkoxyalkyl; or R 41 and R 42 together form - (CH 2 ) 2 -, -CH 2 CH (CH 3 ) - or - (CH 2 J 3 -, R 43 and R 44 independently of one another are C 1 -C 4 -alkyl each R 45 is independently selected from the group, consisting of halogen, cyano, hydroxycarbonyl, C 2 -C 4 - alkoxycarbonyl, hydroxy, -C 4 alkoxy, C 4 haloalkoxy, C 1 - C 4 alkylthio, -C 4 haloalkylthio, amino, Ci-C 4 - Alkylamino, C 2 -C 4 -dialkylamino, -CH [-O (CH 2 ) n -] and phenyl, which may be optionally substituted with 1 to 3 R 49 radicals;
- two R 45 form an oxygen atom to form a carbonyl with the carbon atom to which they are attached;
- each R 46 is independently selected from the group consisting of halogen, C 4 alkoxy, C 1 -C 4 -HaIOaIkOXy, C 1 - C 4 alkylthio, -C 4 haloalkylthio, amino, Ci-C 4 alkylamino and C 2 -C 4 dialkylamino; or
- R 46 form an oxygen atom to form a carbonyl radical with the carbon atom to which they are attached;
- R 4 4 7 ' is C 1 -C 4 -alkyl 1 -C 3 haloalkyl or NR 5 0 1 1; is;
- R 3 4 4 8 0 is hydrogen, C 1 -C 3 -alkyl, C 1 -C 3 haloalkyl or C 2 -C 4 alkoxyalkyl;
- each R 49 is independently selected from the group consisting of halogen, C 1 -C 4 -alkyl, C 1 -C 3 -haloalkyl, hydroxy,
- each R 50 is independently selected from the group consisting of hydrogen and C 1 -C 4 alkyl;
- R 51 and R 52 are independently hydrogen or C 1 -C 4 alkyl;
- n is an integer of 2 to 3;
- n is an integer from 1 to 4.
- R 2 is hydrogen, CH 3 or C (O) R 10 ;
- R 3 is hydrogen or CH 3 ;
- R 2 and R 3 together form C (R 19 ) N (R 20 ) R 21 ;
- R 10 , R 19 , R 20 and R 21 are each independently hydrogen or CH 3 ;
- R 5 is CO 2 R 29 ;
- R 2 and R 3 are hydrogen
- R 29 is hydrogen, C 1 -C 4 alkyl or benzyl.
- Specific embodiments include compounds of the general formula (I) selected from the group consisting of methyl 4-amino-3,5-dichloro-6-cyclopropyl-2-pyridinecarboxylate (Compound I-22 in Table A.1); 4-Amino-3,5-dichloro-6-cyclopropyl-2-pyridinecarboxylic acid (Compound 1-21 in Table A.1);
- the compounds of the general formula (I) may also comprise N-oxides.
- Corresponding pyridine-N-oxides are accessible via oxidation of the corresponding pyridines. Suitable oxidation methods are, for example, in Houben-Weyl, Methods of Organic Chemistry, Extension and follow-up volumes to the 4th edition, Volume E 7b, p 565 f. described.
- radicals alkyl, alkoxyalkyl, hydroxyalkyl and alkoxyalkoxyalkyl can each be straight-chain or branched.
- alkyl is understood to mean in particular the radicals methyl, ethyl, n-propyl, isopropyl, n-butyl, sec-butyl, tert-butyl, or the various isomers of pentyl or hexyl ,
- alkoxyalkyl is understood to mean alkyl having an alkoxy substituent.
- examples of the radical “alkoxyalkyl” include CH 3 OCH 2 , CH 3 OCH 2 CH 2 , CH 3 CH 2 OCH 2 , CH 3 CH 2 CH 2 CH 2 OCH 2 , CH 3 CH 2 OCH 2 CH 2 , CH 3 CH 2 CH 2 CH 2 OCH 2 CH 2 or CH 3 CH 2 CH 2 CH 2 OCH 2 CHMe.
- alkoxyalkoxy is understood as meaning alkoxy provided with an alkoxy substituent.
- alkoxyalkoxyalkyl is understood as meaning a radical in which an alkoxyalkoxy substituent is bonded to an alkyl radical.
- alkoxyalkoxyalkyl include CH 3 OCH 2 OCH 2 , CH 3 OCH 2 OCH 2 CH 2 , CH 3 CH 2 OCH 3 OCH 2 and CH 3 OCH 3 CH 2 OCH 2 CH 2 .
- hydroxyalkyl is understood to mean alkyl having a hydroxy substituent.
- examples of “hydroxyalkyl” include HOCH 2 CH 2 , HOCH 2 CH 2 CH 2 and HOCH 2 CH 2 CH 2 CH 2 .
- radicals with carbon atoms those having 1 to 6 carbon atoms, preferably 1 to 4 carbon atoms, in particular 1 or 2 carbon atoms, are generally preferred.
- the present invention also provides mixtures comprising stereoisomers which are encompassed by formula (I) or by the formulas of component B (safener).
- Such compounds of the formula (I) or of the formulas of the component B (safener) contain, for example, one or more asymmetrically substituted carbon atoms or sulfoxides.
- the possible stereoisomers defined by their specific spatial form, such as enantiomers and diastereomers, are all encompassed by the formula (I) or by the formulas of component B (safener) and can be obtained by conventional methods from mixtures of stereoisomers or also by stereoselective reactions in combination be prepared with the use of stereochemically pure starting or auxiliary materials.
- the application rates are generally lower, z.
- 0.1 g to 800 g a.i./ha preferably 1 g to 500 g a.i./ha, more preferably 10 g to 400 g a.i./ha.
- the herbicides of the general formula (I) are suitable for controlling harmful plants, for example in plant nutritives, for example in economically important arable crops, for example monocotyledonous crops such as cereals (for example wheat, Barley, rye, oats), rice, maize, millet, or dicotyledonous crops such as sugarbeet, oilseed rape, cotton, sunflower and legumes, for example of the genera Glycine (eg Glycine max. (Soya) as non-transgenic Glycine max.
- Glycine eg Glycine max. (Soya) as non-transgenic Glycine max.
- Phaseolus Phaseolus, Pisum, Vicia and Arachis, or vegetable crops from various botanical groups such as potato, leek, cabbage, carrot, tomato, onion , as well as permanent and plantation crops such as pome and stone fruit, soft fruit, wine, Hevea, bananas, sugarcane, coffee, tea, citrus, nut orchards, turf, palm tree and forest crops.
- botanical groups such as potato, leek, cabbage, carrot, tomato, onion , as well as permanent and plantation crops such as pome and stone fruit, soft fruit, wine, Hevea, bananas, sugarcane, coffee, tea, citrus, nut orchards, turf, palm tree and forest crops.
- the herbicide-safener combinations (A) + (B) are also preferred, the use in cereals (eg wheat, barley, rye, oats), rice, corn, millet, sugar beet, sugar cane is particularly preferred , Sunflower, rapeseed and cotton.
- the herbicide-safener combinations (A) + (B) are also useful in tolerant and non-tolerant mutant cultures and tolerant and intolerant transgenic cultures, preferably of corn, rice, corn, oilseed rape and soy, for example, those directed against imidazolinone herbicides. Atrazine, glufosinate or glyphosate are resistant.
- the safeners contained as component (B) are understood to be compounds which are suitable for the phytotoxic effects of
- Crop protection agents such as herbicides to reduce crops.
- S1 a compounds from the group of heterocyclic carboxylic acid derivatives: S1 a ) compounds of the type of dichlorophenylpyrazoline-3-carboxylic acid (S1 a ), preferably compounds such as
- S1 C derivatives of 1, 5-diphenylpyrazole-3-carboxylic acid (S1 C), preferably compounds such as ethyl 1- (2,4-dichlorophenyl) -5-phenylpyrazole-3-carboxylic acid ethyl ester (S1-5),
- S1 d compounds of the type of the triazolecarboxylic acids (S1 d ), preferably
- S1 e Compounds of the 5-benzyl- or carboxylic acid-5-phenyl-2-isoxazoline-3, or the 5,5-diphenyl-2-isoxazoline-3-carboxylic acid (S1 e), preferably compounds such as 5- ( 2,4-dichlorobenzyl) -2-isoxazoline-3-carboxylic acid ethyl ester (S1-8) or 5-phenyl-2-isoxazoline-3-carboxylic acid ethyl ester (S1-9) and related compounds as described in WO-A-91/08202 or 5,5-diphenyl-2-isoxazoline-carboxylic acid (S1-10) or 5,5-diphenyl-2- isoxazoline-carboxylic acid ethyl ester (S1-11) ("isoxadifen-ethyl") or n-propyl ester (S 1-12) or of 5- (4-fluorophenyl) -5
- S2 a) Compounds of the 8-quinolinoxyacetic acid (S2 a), preferably (5-chloro-8-quinolinoxy) acetic acid, ethyl (1-methylhexyl) ester ( " Cloquintocetmexyl ") (S2-1), (5-chloro-8-quinolinoxy) acetic acid (1,3-dimethyl-but-1-yl) ester (S2-2), (5-chloro-8- quinolinoxy) acetic acid 4-allyl oxy-butyl ester (S2-3),
- S2 b compounds of the (5-chloro-8-quinolinoxy) malonic acid type (S2 b ), preferably compounds such as (5-chloro-8-quinolinoxy) malonic acid diethyl ester, (5-chloro-8-quinolinoxy) malonic acid diallyl ester, ( 5-chloro-8-quinolinoxy) malonic acid methyl ethyl ester and related compounds as described in EP-A-0 582 198.
- S3 Active substances of the dichloroacetamide type (S3), which are often used as pre-emergence safener (soil-active safener), such as. "Dichloromid” (N, N-diallyl-2,2-dichloroacetamide) (S3-1), "R-29148” (a-dichloroacetyl- ⁇ ⁇ . ⁇ -trimethyl-I .S-oxazolidine) from Stauffer
- PPG-1292 N-allyl-N - [(1,3-dioxolan-2-yl) -methyl] -dichloroacetamide
- AD-67 or "MON 4660” (3-dichloroacetyl-1-oxa-3-aza-spiro [4,5] decane) of
- TI-35 (1-dichloroacetyl-azepane) from TRI-Chemical RT (S3-8),
- Diaclonone (dicyclonone) (synonym: “BAS145138” or “LAB145138”) (RS) -I-dichloroacetyl-3,3,8a-trimethyl-perhydropyrrolo [1,2-a] -pyhmidin-6-one from the company
- R A 1 is (Ci-C 6 ) alkyl, (C 3 -C 6 ) cycloalkyl, where the 2 latter radicals by v A substituents selected from the group consisting of halogen, (Ci-C 4 ) alkoxy, (Ci-C 6 ) Halo - Alkoxy and (Ci-C 4 ) alkylthio and in the case of cyclic radicals by (Ci-C 4 ) alkyl and (Ci-C 4 ) haloalkyl are substituted;
- R A 2 is halogen, (dC 4) alkyl, (C 1 -C 4) -alkoxy, CF 3; m A 1 or 2; v A is 0, 1, 2 or 3;
- RB 1 , RB 2 independently of one another hydrogen, (C 1 -C 6 ) AIKyI,
- RB 1 cyclopropyl
- RB 1 cyclopropyl
- Rc 1, Rc 2 are independently hydrogen, (Ci-C ⁇ ) alkyl, (C 3 -C 8) cycloalkyl, (C 3 -C 6) alkenyl, (C 3 -C 6) alkynyl,
- Rc 3 is halogen, (C 1 -C 4 ) alkyl, (C 1 -C 4 ) Al koxy, CF 3 mc is 1 or 2;
- Active ingredients from the class of hydroxyaromatics and aromatic-aliphatic carboxylic acid derivatives e.g. 3,4,5-triacetoxybenzoic acid ethyl ester, 3,5-dimethoxy-4-hydroxybenzoic acid, 3,5-dihydroxybenzoic acid, 4-hydroxysalicylic acid, 4-fluorosalicyclic acid, 2-hydroxycinnamic acid, 2,4-dichlorocinnamic acid, as described in US Pat WO-A-2004/084631, WO-A-2005/015994, WO-A-2005/016001.
- S5 Active ingredients from the class of hydroxyaromatics and aromatic-aliphatic carboxylic acid derivatives (S5), e.g. 3,4,5-triacetoxybenzoic acid ethyl ester, 3,5-dimethoxy-4-hydroxybenzoic acid, 3,5-dihydroxybenzoic acid, 4-hydroxysalicylic acid, 4-fluorosalicyclic acid, 2-hydroxycinnamic acid
- S6 active compounds from the class of 1, 2-dihydroquinoxaline-2-ones (S6), e.g.
- R D 1 is halogen, (C 1 -C 4) -alkyl, (Ci-C 4) haloalkyl, (C 1 -C 4) -alkoxy, (C 1 -C 4) HaIOaIkOXy,
- R D 2 is hydrogen or (C 1 -C 4 ) alkyl
- R D 3 is hydrogen, (C r C 8 ) alkyl, (C 2 -C 4 ) alkenyl, (C 2 -C 4 ) alkynyl, or aryl, where each of the aforementioned C-containing radicals is unsubstituted or substituted by one or more preferably up to three identical or different radicals from the
- a group consisting of halogen and alkoxy is substituted; or their salts no is an integer from 0 to 2.
- RE 2 (C 1 -C 16 ) alkyl, (C 2 -C 6 ) alkenyl, (C 3 -C 6 ) cycloalkyl, aryl; Benzyl, halobenzyl, RE 3 is hydrogen or (C 1 -C 6 ) AlkYl.
- S11) oxyimino compound type compounds (S11) known as seed dressings such as those described in US Pat. B.
- Oxabetrinil ((Z) -1,3-dioxolan-2-ylmethoxyimino (phenyl) acetonitrile) (S11-1), which is known as a seedling safener for millet against damage from metolachlor,
- Fluorofenim (1- (4-chlorophenyl) -2,2,2-trifluoro-1-ethanone O- (1,3-dioxolan-2-ylmethyl) -oxime) (S1 1-2), which was used as seed dressing -Safener for millet is known against damage from metolachlor, and
- Cyometrinil or “CGA-43089” ((Z) -cyanomethoxyimino (phenyl) acetonitrile) (S1 1-3), which is known as a seed dressing safener for millet against damage by metolachlor.
- S12 Isothiochromanone (S12) class agents, e.g. Methyl - [(3-oxo-1H-2-benzothiopyran-4 (3H) -ylidene) methoxy] acetate (CAS No. 205121-04-6) (S12-1) and related compounds of WO-A -1998 / 13361.
- S12 Isothiochromanone (S12) class agents, e.g. Methyl - [(3-oxo-1H-2-benzothiopyran-4 (3H) -ylidene) methoxy] acetate (CAS No. 205121-04-6) (S12-1) and related compounds of WO-A -1998 / 13361.
- Seed pickling safener for maize known for damage from thiocarbamate herbicides
- Pretilachlor is known in seeded rice, "flurazole” (benzyl-2-chloro-4-trifluoromethyl-1, 3-thiazole-5-carboxylate) (S13-3), which is used as a seed dressing safener for millet against damage by alachlor and
- S 14 active substances which, in addition to a herbicidal activity against harmful plants, also have safener action on crops such as rice, such as, for example, rice.
- crops such as rice, such as, for example, rice.
- "Dimepiperate” or "MY-93" S-1-methyl-1-phenylethyl-piperidine-1-carbothioate) known as safener for rice against damages of the herbicide Molinate
- NK 049 3,3'-dimethyl-4-methoxy-benzophenone
- COD (1-bromo-4- (chloromethylsulfonyl) benzene) by Kumiai, (CAS No. 54091-06-4), which is known as a safener against damage of some herbicides in rice.
- component (A) is a compound of formula (I) selected from methyl 4-amino-3,5-dichloro-6-cyclopropyl-2-pyridinecarboxylate, 4-amino-3,5-dichloro-6-cyclopropyl 2-pyridinecarboxylic acid, methyl 4-amino-3-chloro-6-cyclopropyl-2-pyridinecarboxylate, 4-amino-3-chloro-6-cyclopropyl-2-pyridinecarboxylic acid, methyl-4-amino-3-chloro-6-yl cyclopropyl-5-fluoro-2-pyridinecarboxylate and 4-amino-3-chloro-6-cyclopropyl- ⁇ -fluoro-pyridinecarboxylic acid and as component (B) a safener selected from mefenpyr-diethyl (S1-1), isoxadifen- ethyl (S1-11), cy
- herbicide-safener combinations comprising (A) a herbicidally effective amount of one or more compounds of the formula (I) or salts thereof, and (B) an antidote-effective amount of one or more safeners.
- herbicidally effective amount means an amount of one or more herbicides which is suitable for negatively influencing plant growth.
- Antidote effective amount in the sense of the invention means an amount of one or more safeners which is suitable for reducing the phytotoxic effect of crop protection active ingredients (for example of herbicides) on crop plants.
- the safeners (B) are suitable for reducing the phytotoxic effects that can occur when using herbicides of the general formula (I) in crops without significantly impairing the effectiveness of these herbicidal active compounds against harmful plants.
- the field of application of conventional crop protection agents can be considerably extended, e.g. on crops in which the use of herbicides was previously not possible or only possible to a limited extent.
- the required application rates of the safeners can vary within wide limits depending on the indication and the herbicidal active ingredient used and are in usually in the range of 0.001 to 5 kg, preferably 0.005 to 2.5 kg of active ingredient per hectare.
- the herbicidal active compounds (A) of the general formula (I) and the safeners (B) may be applied together (for example as a ready-to-use formulation or in the tank-mix process) or in any desired order, e.g. by spraying, pouring and spraying or by granule scattering.
- the weight ratio herbicide of the general formula (I) (A): safener (B) can vary within wide limits and is preferably in the range from 1: 10,000 to 10,000: 1, in particular from 1: 1000 to 1000: 1.
- safener (B) depend on the type of herbicide used and the safener used, as well as on the species and stage of development of the crop to be treated, and can be determined on a case-by-case basis by simple, routine preliminary tests.
- (B) may, depending on their properties, be used to pre-treat the seed of the crop (e.g., seed dressing) or seeded into the seed furrows prior to sowing, or applied together with the herbicide before or after emergence of the plants.
- Pre-emergence treatment includes both the treatment of the area under cultivation (including possibly on the acreage, for example in rice applications) before sowing and the treatment of the sown, but not overgrown cultivated areas.
- the seed eg grains, seeds or vegetative propagules such as tubers or sprouts with buds
- seedlings with the safeners (B) optionally in combination with other agrochemical active ingredients pretreated.
- the active ingredients can be brought to the seed, for example by pickling, or the active ingredients and the seed can be added to water or other solvents, and the active substances are absorbed, for example, by addition or diffusion in the dipping process or by swelling or pre-germination.
- the young plants can be brought into contact, for example by spraying, dipping or pouring, with the safeners, optionally in combination with other agrochemical active substances, and subsequently transplanted and optionally treated with the herbicides (A).
- Seedling or seedling treatment may be carried out with the safeners (B) alone or in conjunction with other agrochemical active substances - such as fungicides, insecticides or plant-strengthening agents, fertilizers or to speed up the swelling and germination processes.
- the safeners after the pretreatment application can then be applied again before, after or together with one or more herbicides of the formula (I), possibly also in combination with other known herbicides. By pre-treating the seed or seedlings, an improved long-term effect of the safeners can be achieved.
- the present invention thus further provides a method for controlling unwanted plants in plant crops, which is characterized in that the components (A) and (B) of the inventive
- Herbicide-safener combination on the plants eg harmful plants such as monocotyledonous or dicotyledonous weeds or unwanted crops
- the seed eg grains, seeds or vegetative propagules such as tubers or sprouts with buds
- the area on which the plants grow eg the acreage
- one or more safeners (B) preferably one or more, in particular one, compound of groups (S1) to (S14) before, after or simultaneously with the herbicide (s) of general formula (I) (A) on the plants, the seed or the area on which the plants grow (eg the acreage) are applied.
- the safeners (B) are used for seed treatment.
- Undesirable plants are understood to mean all plants that grow in places where they are undesirable. These may be, for example, harmful plants (for example monocotyledonous or dicotyledonous weeds or undesired crop plants), for example those which are resistant to certain herbicidal active substances such as glyphosate, atrazine, glufosinate or imidazolinone herbicides.
- harmful plants for example monocotyledonous or dicotyledonous weeds or undesired crop plants
- herbicidal active substances such as glyphosate, atrazine, glufosinate or imidazolinone herbicides.
- Monocotyledonous weeds are derived e.g. the genera Echinochloa, Setaria, Panicum, Digitaria, Phleum, Poa, Festuca, Eleusine, Brachiaria, Lolium, Bromus, Avena, Cyperus, Sorghum, Agropyron, Cynodon, Monochoria, Fimbristylis, Sagittaria, Eleocharis, Scirpus, Paspalum, Ishaemum, Sphenoclea, Dactyloctenium, Agrostis, Alopecurus, Apera. Dicotyledonous weeds are derived e.g.
- an effective amount of components (A) and (B) for controlling harmful plants in crops for example in economically important arable crops, for example monocotyledonous crops such as cereals (eg wheat, barley, rye, oats), rice, maize , Millet, or dicotyledonous crops such as sugarbeet, oilseed rape, cotton, sunflowers and legumes, for example of the genera Glycine (eg Glycine max., Such as non-transgenic glycine max. (Eg conventional strains such as STS strains) or transgenic glycine max.
- Glycine eg Glycine max.
- non-transgenic glycine max. Eg conventional strains such as STS strains
- transgenic glycine max transgenic glycine max.
- Soy or LL soy) and their crosses Phaseolus, Pisum, Vicia and Arachis, or vegetable crops from various botanical groups such as potato, leek, cabbage, carrot, tomato, onion, as well as long-term and plantation crops such as pome and stone fruit, berry fruit , Wine, hevea, bananas, sugar cane, coffee, tea, citrus, nut orchards, turf, palm tree and forest crops.
- the invention also relates to the use of the herbicide-safener combinations according to the invention for controlling undesired plant growth, preferably in plant crops.
- the herbicide-safener combinations of the invention may be prepared by known methods, e.g. be prepared as mixed formulations of the individual components, optionally with other active ingredients, additives and / or customary formulation auxiliaries, which are then diluted with water used in the usual way, or as so-called tank mixes by common dilution of the separately formulated or partially formulated separately
- the herbicide-safener combination according to the invention can also be used for controlling harmful plants in crops of known or yet to be developed genetically modified plants.
- the transgenic plants are usually characterized by particular advantageous properties, for example by resistance to certain pesticides, especially certain herbicides, resistance to plant diseases or pathogens of plant diseases such as certain insects or microorganisms such as fungi, bacteria or viruses.
- Other special properties relate to z. B. the crop in terms of quantity, quality,
- transgenic plants with increased starch content or altered quality of starch or those known with other fatty acid composition of the crop may be in a tolerance or resistance to abiotic stressors z. As heat, cold, drought, salt and ultraviolet radiation.
- the application of the herbicide-safener combinations according to the invention or their salts in economically important transgenic crops of useful and ornamental plants eg.
- cereals such as wheat, barley, rye, oats, millet, rice, cassava and corn or cultures of sugar beet, cotton, soy, rape, potato, tomato, pea and other vegetables.
- Crop plants are used, which are resistant to the phytotoxic effects of herbicides or have been made genetically resistant.
- Glufosinate see, for example, EP-A-0242236, EP-A-242246) or glyphosate (WO
- Transgenic crop plants with modified fatty acid composition (WO 91/13972). genetically modified crops with new content or secondary substances z.
- Transgenic crop plants which produce pharmaceutically or diagnostically important proteins (molecular pharming") - transgenic crops which are characterized by higher yields or better quality transgenic crop plants which are characterized by a combination of, for example, the above-mentioned new properties (“gene stacking").
- nucleic acid molecules can be introduced into plasmids that allow mutagenesis or sequence alteration by recombination of DNA sequences. With the help of standard methods z. For example, base substitutions are made, partial sequences are removed, or natural or synthetic sequences are added.
- adapters or linkers can be attached to the fragments, see, for example, US Pat. Sambrook et al., 1989, Molecular Cloning, A Laboratory Manual, 2nd ed. CoId Spring Harbor Laboratory Press, ColD Spring Harbor, NY; or Winnacker "Genes and Clones", VCH Weinheim 2nd edition 1996
- the production of plant cells having a reduced activity of a gene product can be achieved, for example, by the expression at least a corresponding antisense RNA, a sense RNA to obtain a cosuppression effect or the expression of at least one appropriately engineered ribozyme which specifically cleaves transcripts of the above gene product.
- DNA molecules may be used which comprise the entire coding sequence of a gene product, including any flanking sequences that may be present, as well as DNA molecules which comprise only parts of the coding sequence, which parts must be long enough to be present in the cells to cause an antisense effect. It is also possible to use DNA sequences which have a high degree of homology to the coding sequences of a gene product but are not completely identical.
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Pest Control & Pesticides (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- General Health & Medical Sciences (AREA)
- Wood Science & Technology (AREA)
- Zoology (AREA)
- Environmental Sciences (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Abstract
Beschrieben wird eine Zusammensetzung, enthaltend (A) eine oder mehrere Verbindungen der Formel (I), deren N-Oxide oder deren Salze, worin die einzelnen Indizes bzw. Definitionen die in der Beschreibung definierte Bedeutung aufweisen sowie (B) einen oder mehrere Safener.
Description
Herbizid-Safener-Kombination
Beschreibung
Die vorliegende Erfindung betrifft agrochemisch wirksame Herbizid-Safener- Kombinationen, Verfahren zu deren Herstellung sowie deren Verwendung zur Bekämpfung von Schadpflanzen.
Aus verschiedenen Schriften ist bekannt, dass bestimmte Pyridin-Derivate herbizide Eigenschaften besitzen. So sind in WO 2003/011853, WO 2006/062979 und WO 2007/082098 Pyridin-Derivate beschrieben, die ein breites Spektrum von Unkräutern bekämpfen.
Die in WO 2003/011853 beschriebenen Wirkstoffe sind allerdings strukturell unterschiedlich von den in den erfindungsgemäßen Zusammensetzungen beschriebenen, sie besitzen nämlich einen Aryl- oder Heteroaryl-Substituenten in der 6-Position des Pyridins. Auch WO 2007/082098 offenbart strukturell unterschiedliche Pyridin-Derivate, nämlich ebenfalls 6-Aryl-substituierte Verbindungen. WO 2006/062979 offenbart zwar die in den erfindungsgemäßen Zusammensetzung verwendeten Pyridin-Derivate, allerdings wird die Verwendung von Safenern in Kombination mit diesen nur generisch beschrieben. Es wird nicht beschrieben, welche Safener sich für die Verbindungen eignen, auch werden keine biologischen Daten gezeigt, die eine tatsächliche Safener-Wirkung belegen.
Die Wirkstoffe in den erfindungsgemäßen Zusammensetzungen sind - wenn ohne Safener ausgebracht - zum Teil nicht voll verträglich mit einigen wichtigen Kulturpflanzen wie z.B. verschiedenen Getreidearten, Mais oder Reis. Sie können deshalb in manchen Kulturen nicht so eingesetzt werden, dass die erwünschte breite herbizide Wirksamkeit gegenüber Schadpflanzen gewährleistet ist.
Aufgabe der vorliegenden Erfindung ist es daher, herbizide Mittel zu finden, in welchen die Selektivität der oben genannten Herbizide gegenüber wichtigen Kulturpflanzen erhöht ist. Diese Aufgabe wird überraschend durch die erfindungsgemäße Herbizid-Safener-Kombination gelöst.
Gegenstand der vorliegenden Erfindung ist daher eine Zusammensetzung, enthaltend
(A) eine oder mehrere Verbindungen der Formel (I), deren N-Oxide oder deren Salze,
(I)
in welchen
R1 für Wasserstoff, Fluor oder Chlor steht;
R2 für Wasserstoff, C1-C4-AIkYl optional substituiert mit ein bis zwei Resten R7, C2-C4-Alkenyl optional substituiert mit ein bis zwei Resten
R8, C2-C4-Alkinyl optional substituiert mit ein bis zwei Resten R9, C(=O)R10, Nitro, OR11, SO2R12, NR13R14 oder N=CR15R16 steht;
R3 für Wasserstoff, Ci-C4-Alkyl optional substituiert mit ein bis zwei Resten R17 oder C(=O)R10 steht; oder
R2 und R3 zusammen für -(CH2)4-, -(CH2)5-, -CH2CH=CHCH2- oder -
(CH2)2O(CH2)2-, wobei jeder dieser vier letztgenannten Reste
optional mit ein bis zwei Resten R18 substituiert ist, stehen; oder
R2 und R3 zusammen für =C(R19)NR20R21 oder =C(R22)OR23 stehen;
R4 für Halogen steht;
R5 für COOH oder ein herbizid-aktives Derivat von COOH steht;
R6 unabhängig voneinander für Halogen, Ci-C6-Alkyl, Ci-C6-Haloalkyl, C2- Ce-Alkenyl, C2-C6-Haloalkenyl, CrC3-Alkoxy, d-C2-Haloalkoxy, Ci-C3-
Alkylthio oder Ci-C2-Haloalkylthio steht;
R7, R8 und R9 jeweils unabhängig voneinander für Halogen, d-C3-
Alkoxy, C1-C3-HaIOaIkOXy, d-C3-Alkylthio, Ci-C3-Haloalkylthio, Amino, Ci-C3-Alkylamino, C2-C4-Dialkylamino oder C2-C4-
Alkoxycarbonyl stehen;
R10 unabhängig voneinander für Wasserstoff, Ci-Ci4-Alkyl, Ci-C3-Haloalkyl,
Ci-C4-Alkoxy, Phenyl, Phenoxy oder Benzyloxy steht;
R11 für Wasserstoff, Ci-C4-Alkyl, d-C3-Haloalkyl oder CHR24C(O)OR25 steht;
R12 für Ci-C4-Alkyl oder d-C3-Haloalkyl steht;
R13 für Wasserstoff, Ci-C4-Alkyl oder C(=O)R26 steht;
R14 für Wasserstoff oder d-C4-Alkyl steht;
R15 für Wasserstoff, d-C4-Alkyl oder Phenyl optional substituiert mit ein bis drei Resten R27 steht;
R16 für Wasserstoff oder d-C4-Alkyl steht; oder
R15 und R16 zusammen für -(CH2)4- oder -(CH2)S- stehen;
R17 unabhängig voneinander für Halogen, Ci-C3-Alkoxy, Ci-C3-Haloalkoxy,
Ci-C3-Alkylthio, CrC3-Haloalkylthio, Amino, Ci-C3-Alkylamino, C2-C4- Dialkylamino oder C2-C4-Alkoxycarbonyl stehen;
R18 unabhängig voneinander für Halogen, Ci-C3-Alkyl, C-ι-C3-Alkoxy, Ci- C3-Haloalkoxy, Ci-C3-Alkylthio, d-C3-Haloalkylthio, Amino, Ci-C3-
Alkylamino, C2-C4-Dialkylamino oder C2-C4-Alkoxycarbonyl stehen;
R19 für Wasserstoff oder Ci-C4-Alkyl steht;
R20 und R21 unabhängig voneinander für Wasserstoff oder Ci-C4-Alkyl stehen; oder
R20 und R21 zusammen für -(CH2)4-, -(CH2)5-, -CH2CH=CHCH2- oder -(CH2)2O(CH2)2- stehen;
R22 für Wasserstoff oder Ci-C4-Alkyl steht;
R23 für d-C4-Alkyl steht;
R24 für Wasserstoff, Ci-C4-Alkyl oder Ci-C4-Alkoxy steht;
R25 für Wasserstoff, Ci-C4-Alkyl oder Benzyl steht;
R26 für Wasserstoff, d-Cu-Alkyl, Ci-C3-Haloalkyl, C1-C4-AIkOXy, Phenyl, Phenoxy oder Benzyloxy steht;
R27 unabhängig voneinander für Methyl, Chlor oder Methoxy steht;
für O1 1 , 2, 3, 4 oder 5 steht;
sowie
(B) einen oder mehrere Safener.
Die erfindungsgemäßen Herbizid-Safener-Kombinationen können zusätzliche weitere Komponenten, beispielsweise Pflanzenschutzmittelwirkstoffe anderer Art und/oder im Pflanzenschutz übliche Zusatzstoffe und/oder Formulierungshilfsmittel, enthalten oder zusammen mit diesen eingesetzt werden.
Die Herbizide (A) und die Safener (B) können auf bekannte Weise angewendet werden, beispielsweise gemeinsam (beispielsweise als Co-Formulierung oder als Tank-Mischung) oder auch zeitlich versetzt (Splitting), z.B. auf die Pflanzen, Pflanzenteile, Pflanzensamen oder die Fläche, auf der die Pflanzen wachsen. Möglich ist z.B. die Anwendung der Einzelwirkstoffe oder der Herbizid-Safener- Kombination in mehreren Portionen (Sequenzanwendung), z. B. nach Anwendungen im Vorauflauf, gefolgt von Nachauflauf-Applikationen oder nach frühen Nachauflaufanwendungen, gefolgt von Applikationen im mittleren oder späten
Nachauflauf. Bevorzugt ist dabei die gemeinsame oder die zeitnahe Anwendung der Wirkstoffe der jeweiligen Kombination. Möglich ist auch die Anwendung der Einzelwirkstoffe oder der Herbizid-Safener-Kombination zur Saatgutbehandlung.
Verbindung der allgemeinen Formel (I)
Die genannte Formel (I) umfasst alle Stereoisomeren und deren Gemische, insbesondere auch racemische Gemische, und - soweit Enantiomere möglich sind - beide Enantiomere und insbesondere das jeweils biologisch wirksame Enantiomer.
Man nimmt an, dass die Verbindungen der allgemeinen Formel (I), in welchen R5
gleich CO2H ist, die Verbindungen sind, die an einer aktiven Stelle eines Pflanzenenzyms oder Rezeptors binden, um einen herbiziden Effekt zu erzielen. Andere Verbindungen der allgemeinen Formel (I), in welchen der Substituent R5 eine Gruppe ist, die innerhalb der Pflanzen oder der Umwelt in eine Carbonsäure- Funktion (d.h. CO2H) umgewandelt werden kann, ermöglichen ähnliche herbizide Effekte und sind im Rahmen der vorliegenden Erfindung als herbizid-aktive Derivate ebenfalls umfasst.
Somit werden im Rahmen der vorliegenden Erfindung unter einem herbizid-aktiven Derivat insbesondere Salze, Ester, Carboxamide, Acylhydrazide, Imidate,
Thioimidate, Amidine, Acylhalogenide, Acylcyanide, Säureanhydride, Ether, Acetale, Orthoester, Carboxaldehyde, Oxime, Hydrazone, Thiosäuren, Thioester, Dithiolester, Nitrile und jedes andere beliebige Carbonsäurederivat, welches die herbizide Wirkung der Verbindung der allgemeinen Formel (I) nicht auslöscht und in Pflanzen und/oder im Boden beispielsweise durch Hydrolyse, Oxidation, Reduktion bzw. andersartige Metabolisierung die Carbonsäurefunktion bereitstellt, verstanden. Die Carbonsäurefunktion kann dabei in Abhängigkeit von dem pH-Wert in dissoziierter oder nicht-dissoziierter Form vorliegen.
Die im Bereich des Pflanzenschutzes geeigneten Salze der Verbindungen der allgemeinen Formel (I) sind Salze, die durch Inkontaktbringen mit Säuren oder Basen oder durch lonenaustausch erhalten werden, so dass die abgeleiteten Salze eine ausreichende Wasserlösbarkeit für die Bioverfügbarkeit und somit die herbizide Wirksamkeit aufweisen.
Die Verbindungen der Formel (I) können ferner durch Anlagerung einer geeigneten anorganischen oder organischen Säure, wie beispielsweise HCl, HBr, H2SO4, H3PO4, oder HNO3, aber auch Oxalsäure, Essigsäure, Buttersäure, Fumarsäure, Milchsäure, Malonsäure, Propionsäure, Salicylsäure, Weinsäure, Pentansäuren oder Sulfonsäuren, wie para-Toluolsulfonsäure, an eine basische Gruppe, wie z.B. Amino oder Alkylamino, Salze bilden. Geeignete Substituenten, die in deprotonierter Form, wie z.B. Sulfonsäuren oder Carbonsäuren, vorliegen, können innere Salze mit
ihrerseits protonierbaren Gruppen, wie Aminogruppen bilden. Salze können ebenfalls dadurch gebildet werden, dass bei geeigneten Substituenten, wie z.B. Sulfonsäuren oder Carbonsäuren, der Wasserstoff durch ein für die Landwirtschaft geeignetes Kation ersetzt wird. Diese Salze sind beispielsweise Metallsalze, insbesondere Alkalimetallsalze oder Erdalkalimetallsalze, insbesondere Natrium- und Kaliumsalze, Salze mit organischen Aminen, beispielsweise von Dimethylamin, Diethanolamin oder Triethanolamin, Amoniumsalze, insbesondere quartäre (quaternäre) Ammoniumsalze mit Kationen der Formel [NRR'R"R'"]+, worin R bis R1" jeweils unabhängig voneinander einen organischen Rest, insbesondere Alkyl, Aryl, Aralkyl oder Alkylaryl darstellen, oder Sulfoniumsalze, beispielsweise Trimethylsulfoniumsalze.
Besonders geeignet sind auch Ester- und Thioesterderivate der Carbonsäurefunktion von R5. Estergruppen resultieren aus der Kondensation einer Carbonsäure-Funktion (CO2H) mit einem Alkohol (d.h. RALOH), worin RAL ein von dem Alkohol abgeleiteter Rest ist; eine Vielzahl an Verfahren ist bekannt, um solche Estern herzustellen. Analoge Thioesterguppen der Formel C(O)SRAL können als das Kondensationsprodukt einer Carbonsäure-Funktion mit einem Thioalkohol (Mercaptan) der Formel RALSH erhalten werden; eine Vielzahl von Verfahren sind ebenfalls bekannt, um solche Thioester herzustellen. In der herbiziden Anwendung werden die entsprechenden Ester- bzw. Thioesterverbindungen der allgemeinen Formel (I) leicht hydrolysiert, beispielsweise durch die Gegenwart von hydrolytischwirkenden Enzymen, wodurch die entsprechende Carbonsäurefunktion wieder erhalten wird.
Wenn der Rest RAL mehr als eine OH- bzw. SH-Funktion aufweist, kann der Rest mit mehr als einem Pyridinringsystem der allgemeinen Formel (I) kondensiert sein.
Beispiele von Ester- und Thioesterverbindungen der allgemeinen Formel (I) basieren insbesondere auf der Ester- bzw. Thioesterbildung mit Methanol, Ethanol, Butanol, 2-Butoxyethanol, 2-Ethylhexanol, Isopropanol, 2-Methylpropanol (Isobutanol), Octanolisomeren (Isoctanol) und Ethanthiol, um jeweils Methyl-, Ethyl-, Butyl-, 2-
Butoxyethyl-, 2-Ethylhexyl-, Isopropyl-, 2-Methypropyl-, Isoctyl- und Ethylthioester zu bilden. Besonders bevorzugt sind die Methyl- und Ethylester.
Im Folgenden werden bevorzugte Ausführungsformen der vorliegenden Erfindung beschrieben:
In einer ersten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R5 gleich CO2R29, CH2OR30, CH(OR31)(OR32), CHO, C(=NOR33)H,
C(=NNR34R35)H, C(=O)N(R36)R37, C(=S)OR38, C(=O)SR39, C(=S)SR40 ist oder C(=NR41)YR42 ist;
R29 gleich H, -CH[-C(O)O(CH2)m-], -N=C(R43)R44; oder ein Radikal ausgewählt aus der Gruppe, bestehend aus Ci-Cu-Alkyl, C3-Ci2-Cycloalkyl, C4-C12-
Alkylcycloalkyl, C4-Ci2- Cycloalkylalkyl, C2-C14-Alkenyl, C2-C14-Alkinyl und Phenyl, wobei jeder Rest gegebenenfalls mit 1 bis 3 Resten R45 substiuiert sein kann; ist; oder
R29 gleich einem zweiwertigen Rest ist, welcher die Carboxylester-Funktion CO2R29 von jeweils zwei Pyridinringsysteme der allgemeinen Formel (I) verbindet, und der zweiwertige Rest ausgewählt ist aus der Gruppe, bestehend aus -CH2-, -(CH2)2-, -(CH2)3- und -CH(CH3)CH2-;
R30 gleich Wasserstoff, Ci-Cio-Alkyl, welches gegebenenfalls mit 1 bis 3 Resten R46 substituiert sein kann, oder Benzyl ist;
R31 und R32 unabhängig voneinander gleich d-C4-Alkyl oder CrC3-Haloalkyl sind; oder
R31 und R32 zusammen -CH2CH2-, -CH2CH(CH3)- oder -(CH2)3- sind;
R33 gleich Wasserstoff, Ci-C4-Alkyl, C1-C4-HaIOaIKyI oder Benzyl sind;
R34 gleich Wasserstoff, d-C4-Alkyl, CrC4-Haloalkyl, C2-C4-Alkylcarbonyl, C2-C4- Alkoxycarbonyl oder Benzyl ist;
R35 gleich Wasserstoff, CrC4-Alkyl oder d-C4-Haloalkyl ist;
R36 gleich Wasserstoff, CrC4-Alkyl, Hydroxy, CrC4-Alkoxy oder S(O)2R47 ist;
R37 gleich Wasserstoff oder C1-C4-AIKyI ist;
R38, R39 und R40 gleich Wasserstoff oder ein Rest sind, welcher ausgewählt wird aus der Gruppe, bestehend aus Ci-C-w-Alkyl, C3-C12-Cycloalkyl, C4-C12-Alkylcycloalkyl, C4-C12-Cycloalkylalkyl, C2-C14-Alkenyl und C2-C14-Alkinyl, wobei jeder Rest gegebenenfalls 1 bis 3 Resten R45 substituiert sein kann;
Y gleich O, S oder NR48 ist
R41 gleich Wasserstoff, Ci-C3-Alkyl, CrC3-Haloalkyl, C2-C4-Alkoxyalkyl, OH oder C1-C3-AIkOXy ist;
R42 gleich CrC3-Alkyl, d-Cs-Haloalkyl oder C2-C4 Alkoxyalkyl ist; oder
R41und R42 zusammen -(CH2J2-, -CH2CH(CH3)- oder -(CH2)3- bilden;
R43 und R44 unabhängig voneinander CrC4-Alkyl sind;
jedes R45 unabhängig voneinander ausgewählt wird aus der Gruppe, bestehend aus Halogen, Cyano, Hydroxycarbonyl, C2-C4-Alkoxycarbonyl, Hydroxy, C1-C4-AIkOXy, C1-C4-HaIOaIkOXy, Ci-C4-Alkylthio, C1-C4-
Haloalkylthio, Amino, Ci-C4-Alkylamino, C2-C4-Dialkylamino, - CH[O(CH2)n] und Phenyl, welches gegebenenfalls mit 1 bis 3 Resten R49 substituiert sein kann; oder
zwei Reste R45 zusammen -OC(O)O- oder -O(C(R50)(R50))i-2O- bilden; oder
zwei Reste R45 als ein Sauerstoffatom zusammen genommen werden, um mit dem Kohlenstoffatom, an welches sie gebunden sind, einen Carbonylrest zu bilden;
jedes R46 unabhängig voneinander ausgewählt ist aus der Gruppe, bestehend aus Halogen, Ci-C4-Alkoxy, CrC4-Haloalkoxy, C1-C4-AIKyKhJo, C1-C4- Haloalkylthio, Amino, Ci-C4-Alkylamino oder C2-C4-Dialkylamino; oder
zwei Reste R46 als ein Sauerstoffatom zusammen genommen werden, um mit dem Kohlenstoffatom, an welches sie gebunden sind, einen Carbonylrest zu bilden;
R47 gleich C1-C4-AIKyI, C1-C3-HaIOaIKyI oder NR51R52 ist;
R48 gleich H, CrC3-Alkyl, C1-C3-HaIOaIKyI oder C2-C4 Alkoxyalkyl ist;
jedes R49 unabhängig voneinander ausgewählt ist aus der Gruppe, bestehend aus Halogen, C1-C4-AIKyI, C1-C3-HaIOaIKyI, Hydroxy, C1-C4-AIkOXy, C1- C3-Haloalkoxy, C1 -C3-Al kylthio, C1-C3-HaIOaIKyItIIiO, Amino, C1-C3-
Alkylamino, C2-C4-Dialkylamino und Nitro;
jedes R50 unabhängig voneinander ausgewählt ist aus der Gruppe, bestehend aus Wasserstoff und C1-C4-AIKyI;
R51 und R52 unabhängig voneinander ausgewählt ist aus der Gruppe, bestehend aus Wasserstoff oder C1-C4-AIKyI;
m eine ganze Zahl von 2 bis 3 ist; und
n eine ganze Zahl von 1 bis 4 ist.
In einer zweiten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R5 gleich CO2R29, CH2OR30 oder CHO ist.
In einer dritten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R5 gleich CO2R29 oder CHO ist.
In einer vierten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R5 gleich CO2R29 ist.
In einer fünften Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R29 ausgewählt ist aus der Gruppe, bestehend aus Wassersoff, C1-C8-AIRyI oder d-Alkyl, welches mit Phenyl substituiert ist, wobei der Phenylrest gegebenenfalls mit 1 bis 3 Resten R45 substituiert sein kann.
In einer sechsten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R29 ausgewählt ist aus der Gruppe, bestehend aus Wasserstoff, Ci-C4-Alkyl oder Ci-Alkyl, welches mit Phenyl substituiert ist, wobei der Phenylrest
gegebenenfalls mit 1 bis 3 Resten R45 substituiert sein kann.
In einer siebten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R29 ausgewählt ist aus der Gruppe, bestehend aus Wasserstoff, C1-C4-AIKyI oder Benzyl.
In einer achten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R36 ausgewählt ist aus der Gruppe, bestehend aus Wasserstoff, CrC4-Alkyl, Hydroxy oder Ci-C4-Alkoxy.
In einer neunten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R41 ausgewählt ist aus der Gruppe, bestehend aus Wasserstoff, C1-C3-AIKyI, C1- C3-Haloalkyl oder C2-C4-Alkoxyalkyl.
In einer zehnten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R5 ausgewählt ist aus der Gruppe, bestehend aus COOH, einem agrochemisch verträglichen Salz, ein Ester- und ein Thioesterderivat davon.
In einer elften Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R5 ausgewählt ist aus der Gruppe, bestehend aus COOH, einem agrochemisch verträglichen Salz und ein Esterderivat davon.
In einer zwölften Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
p eine ganze Zahl von 0 bis 2 ist.
In einer dreizehnten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
p eine ganze Zahl von 0 bis 1 ist.
In einer vierzehnten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
p 0 ist.
In einer fünfzehnten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R1 gleich Wasserstoff oder F ist.
In einer sechzehnten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R1 F oder Cl ist.
In einer siebzehnten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R1 H ist.
In einer achtzehnten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R1 F ist.
In einer neunzehnten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R1 Cl ist.
In einer zwanzigsten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R2 H, C(O)R10 oder Ci-C4 Alkyl, welches gegebenenfalls mit R7 substituiert sein kann, ist;
R3 H oder d-C2-Alkyl ist; oder R2 und R3 zusammen =C(R19)N(R20)R21 bilden.
In einer einundzwanzigsten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R2 H, CH3 oder C(O)R10 ist; R3 H oder CH3 ist; oder R2 und R3 zusammen =C(R19)N(R20)R21 bilden.
In einer zweiundzwanzigsten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R2 H, C(O)CH3 oder C1-C4 Alkyl, welches gegebenenfalls mit R7 substituiert sein kann, ist; und R3 H oder C^-Alkyl ist.
In einer dreiundzwanzigsten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R2 und R3 unabhängig voneinander Wasserstoff oder Methyl sind.
In einer vierundzwanzigsten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R2 und R3 gleich Wasserstoff sind.
In einer fünfundzwanzigsten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R4 Br oder Cl ist.
In einer sechsundzwanzigsten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R4 Cl ist.
In einer siebenundzwanzigsten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
jedes R6 unabhängig voneinander Halogen, Ci-C2-Alkyl oder Ci-C2-Haloalkyl ist.
In einer achtundzwanzigsten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R7 gleich Halogen, Methoxy, Fluoromethoxy, Methylthio, Fluoromethylthio, Amino, Methylamino, Dimethylamino oder Methoxycarbonyl ist.
In einer neunundzwanzigsten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R10 gleich Wasserstoff oder C1-C3 Alkyl ist.
In einer dreißigsten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R10 Wasserstoff oder CH3 ist.
In einer einunddreißigsten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R10 CH3 ist.
In einer zweiunddreißigsten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R19 Wasserstoff oder C1-C2 Alkyl ist.
In einer dreiunddreißigsten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R32 Wasserstoff oder CH3 ist.
In einer vierunddreißigsten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R20 und R21 unabhängig voneinander Wasserstoff oder CrC2-Alkyl sind.
In einer fünfunddreißigsten Ausführungsform sind von der vorliegenden Erfindung Verbindungen der allgemeinen Formel (I) erfasst, in welchen
R20 und R21 unabhängig voneinander Wasserstoff oder CH3 sind.
Einbezogen in den Zusammensetzungen der beschriebenen Ausführungsformen sind N-Oxide und agrochemisch verträgliche Salze davon. Kombinationen der Ausführungsformen 1 bis 35 werden dargestellt durch
(A) die Ausführungsform A, in welcher Verbindungen der allgemeinen Formel (I) umfasst sind, in welchen
R5 gleich CO2R29, CH2OR30, CH(OR31)(OR32), CHO, C(=NOR33)H,
C(=NNR34R35)H, C(=O)N(R36)R37, C(=S)OR38, C(=O)SR39, C(=S)SR40 oder
C(=NR41)YR42 ist;
R29 gleich Wasserstoff, -CH[C(O)O(CH2)m], -N=C(R43)R44 oder ein Rest, welcher ausgewählt ist aus der Gruppe, bestehend aus C-i-Cu-Alkyl, C3-C12-Cycloalkyl, C4-C12-Alkylcycloalkyl, C4-Ci2-Cycloalkylalkyl, C2-
Ci4-Alkenyl, C2-Ci4-Alkynyl und Phenyl, wobei jeder Rest gegebenenfalls mit 1 bis 3 Resten R45 substituiert sein kann; ist oder
R29 einen zweiwertigen Rest darstellt, welcher die Carboxylester-Funktion CO2R29 von zwei Pyridinringsysteme der allgemeinen Formel (I) verbindet, und der zweiwertige Rest ausgewählt ist aus der Gruppe, bestehend aus -CH2-, -(CH2)2-, -(CH2)3- und -CH(CH3)CH2-;
R30 gleich Wasserstoff; Ci-Cio-Alkyl, welches gegebenenfalls mit 1 bis 3
Resten R46 substituiert sein kann; oder Benzyl ist;
R31 und R32 unabhängig voneinander CrC4-Alkyl oder Ci-C3-Haloalkyl sind; oder
R31 und R32 zusammen als -CH2CH2-, -CH2CH(CH3)- oder -(CH2J3- darstellen;
R33 gleich Wasserstoff, Ci-C4-Alkyl, Ci-C4-Haloalkyl oder Benzyl ist;
R34 gleich Wasserstoff, d-C4-Alkyl, Ci-C4-Haloalkyl, C2-C4-Alkylcarbonyl, C2-C4Λlkoxycarbonyl oder Benzyl ist;
R35 gleich Wasserstoff, d-C4-Alkyl oder Ci-C4-Haloalkyl ist;
R36 gleich Wasserstoff, CrC4-Alkyl, Hydroxy, CrC4-Alkoxy oder S(O)2R47 ist;
R37 gleich Wasserstoff oder C1-C4 Alkyl ist;
R38, R39 und R40 gleich Wasserstoff oder ein Rest sind, welcher ausgewählt ist aus der Gruppe, bestehend aus C1-C14-
Alkyl, C3-C12-Cycloalkyl, C4-C12-Alkylcycloalkyl, C4-C12- Cycloalkylalkyl, C2-C14-Alkenyl und C2-C14-Alkinyl, wobei jeder Rest gegebenenfalls mit 1 bis 3 Resten R45 substituiert sein kann;
Y gleich O, S oder NR48 ist;
R41 gleich Wasserstoff, Ci-C3-Alkyl, CrC3-Haloalkyl, C2-C4-Alkoxyalkyl, OH oder C1-C3-AIkOXy ist;
R42 gleich Ci-C3-Alkyl, CrC3-Haloalkyl oder C2-C4-Alkoxyalkyl ist; oder R41 und R42 zusammen -(CH2)2-, -CH2CH(CH3)- oder -(CH2J3- bilden; R43 und R44 unabhängig voneinander C-ι-C4-Alkyl sind; jedes R45 unabhängig voneinander ausgewählt wird aus der Gruppe,
bestehend aus Halogen, Cyano, Hydroxycarbonyl, C2-C4- Alkoxycarbonyl, Hydroxy, CrC4-Alkoxy, Ci-C4-Haloalkoxy, C1- C4-Alkylthio, CrC4-Haloalkylthio, Amino, Ci-C4-Alkylamino, C2- C4-Dialkylamino, -CH[-O(CH2)n-] und Phenyl, welches gegebenenfalls mit 1 bis 3 Resten R49 substituiert sein kann; oder
zwei R45 zusammen -OC(O)O- bilden oder -O(C(R50)(R50))1-2O-; oder
zwei R45 ein Sauerstoffatom bilden, um mit dem Kohlenstoffatom, an welches sie gebunden sind, einen Carbonylrest bilden;
jedes R 46 unabhängig voneinander ausgewählt wird aus der Gruppe, bestehend aus Halogen, d-C4-Alkoxy, C1-C4-HaIOaIkOXy, C1- C4-Alkylthio, CrC4-Haloalkylthio, Amino, Ci-C4-Alkylamino und C2-C4-Dialkylamino; oder
zwei R46 ein Sauerstoffatom bilden, um mit dem Kohlenstoffatom, an welches sie gebunden sind, einen Carbonylrest bilden;
R ,447' gleich C1-C4-AIKyI1 CrC3-Haloalkyl oder NR 5011 ;
ist;
R 34480 gleich Wasserstoff, CrC3-AIKyI, CrC3-Haloalkyl oder C2-C4 Alkoxyalkyl ist;
jedes R 49 unabhängig voneinander ausgewählt wird aus der Gruppe, bestehend aus Halogen, CrC4-AIKyI, CrC3-Haloalkyl, Hydroxy,
C1-C4-AIkOXy, CrC3-Haloalkoxy, CrC3-Alkylthio, C1-C3-
Haloalkylthio, Amino, CrC3-Alkylamino, C2-C4-Dialkylamino und
Nitro; jedes R 50 unabhängig voneinander ausgewählt wird aus der Gruppe, bestehend aus Wasserstoff und CrC4-Alkyl;
R51 und R52 unabhängig voneinander Wasserstoff oder C1-C4 Alkyl sind;
m eine ganze Zahl von 2 bis 3 ist; und
n eine ganze Zahl von 1 bis 4 ist;
(B) die Ausführungsform B, in welcher Verbindungen der allgemeinen Formel (I) umfasst sind, in welchen
R2 gleich Wasserstoff, CH3 oder C(O)R10 ist;
R3 gleich Wasserstoff oder CH3 ist; oder
R2 und R3 zusammen =C(R19)N(R20)R21 bilden; und
R10, R19, R20 und R21 jeweils unabhängig voneinander Wasserstoff oder CH3 sind;
(C) die Ausführungsform C, in welcher Verbindungen der allgemeinen Formel (I) umfasst sind, in welchen
R5 gleich CO2R29 ist; und
R2 und R3 gleich Wasserstoff sind;
(D) die Ausführungsform D, in welcher Verbindungen der allgemeinen Formel (I) umfasst sind, in welchen
R29 gleich Wasserstoff, CrC4-Alkyl oder Benzyl ist.
Spezifische Ausführungsformen schließen Verbindungen der allgemeinen Formel (I) ein, ausgewählt aus der Gruppe, bestehend aus Methyl-4-amino-3,5-dichlor-6-cyclopropyl-2-pyridincarboxylat (Verbindung I-22 in Tabelle A.1); 4-Amino-3,5-dichlor-6-cyclopropyl-2-pyridincarbonsäure (Verbindung 1-21 in Tabelle
A.1);
Methyl 4-amino-3-chlor-6-cyclopropyl-2-pyridincarboxylat (Verbindung I-2 in Tabelle A.1);
4-Amino-3-chlor-6-cyclopropyl-2-pyridincarbonsäure (Verbindung 1-1 in Tabelle A.1); Methyl-4-amino-3-chlor-6-cyclopropyl-5-fluor-2-pyridincarboxylat (Verbindung 1-12 in Tabelle A.1); und
4-Amino-3-chlor-6-cyclopropyl-5-fluor-2-pyridincarbonsäure (Verbindung 1-11 in Tabelle A.1).
Insbesondere können die Verbindungen der allgemeinen Formel (I) auch N-Oxide umfassen. Entsprechende Pyridin-N-Oxide sind über eine Oxidation der entsprechenden Pyridine zugänglich. Geeignete Oxidationsmethoden sind beispielsweise in Houben-Weyl, Methoden der organischen Chemie, Erweiterungsund Folgebände zur 4. Auflage, Band E 7b, S. 565 f. beschrieben.
Sofern es im Einzelnen nicht anders definiert wird, gelten für die Reste der Formel (I) im Allgemeinen die folgenden Definitionen.
In Formel (I) können die Reste Alkyl, Alkoxyalkyl, Hydroxyalkyl und Alkoxyalkoxyalkyl jeweils geradkettig oder verzweigt sein.
Im Rahmen der vorliegenden Erfindung versteht man unter dem Begriff „Alkyl" insbesondere die Reste Methyl; Ethyl; n-Propyl; iso-Propyl; n-Butyl; sec.-Butyl; tert.- Butyl; oder die verschiedenen Isomere von Pentyl oder Hexyl.
Im Rahmen der vorliegenden Erfindung versteht man unter dem Begriff „Alkoxyalkyl" mit einem Alkoxysubstituenten versehenes Alkyl. Beispiele für den Rest "Alkoxyalkyl" umfassen CH3OCH2, CH3OCH2CH2, CH3CH2OCH2, CH3CH2CH2CH2OCH2, CH3CH2OCH2CH2, CH3CH2CH2CH2OCH2CH2 oder CH3CH2CH2CH2OCH2CHMe.
Im Rahmen der vorliegenden Erfindung versteht man unter dem Begriff „Alkoxyalkoxy" mit einem Alkoxysubstituenten versehenes Alkoxy.
Im Rahmen der vorliegenden Erfindung versteht man unter dem Begriff „Alkoxyalkoxyalkyl" einen Rest, bei welchem ein Alkoxyalkoxysubstituent an einem Alkylrest gebunden ist. Beispiele für .Alkoxyalkoxyalkyl" umfassen CH3OCH2OCH2, CH3OCH2OCH2CH2, CH3CH2OCH3OCH2 und CH3OCH3CH2OCH2CH2.
Im Rahmen der vorliegenden Erfindung versteht man unter dem Begriff „Hydroxyalkyl" mit einem Hydroxysubstituenten versehenes Alkyl. Beispiele für „Hydroxyalkyl" umfassen HOCH2CH2, HOCH2CH2CH2 und HOCH2CH2CH2CH2.
Bei Resten mit Kohlenstoff-Atomen sind grundsätzlich solche mit 1 bis 6 Kohlenstoff- Atomen, vorzugsweise 1 bis 4 Kohlenstoff-Atomen, insbesondere 1 oder 2 Kohlenstoff-Atomen, bevorzugt.
Gegenstand der vorliegenden Erfindung sind auch Mischungen, umfassend Stereoisomere, die von Formel (I) oder von den Formeln der Komponente B (Safener) umfasst sind. Solche Verbindungen der Formel (I) oder der Formeln der Komponente B (Safener) enthalten beispielsweise ein oder mehrere asymmetrisch substituierte Kohlenstoff-Atome oder Sulfoxide. Die durch ihre spezifische Raumform definierten möglichen Stereoisomeren, wie Enantiomere und Diastereomere, sind alle von der Formel (I) oder von den Formeln der Komponente B (Safener) umfasst und können nach üblichen Methoden aus Gemischen der Stereoisomeren erhalten oder auch durch stereoselektive Reaktionen in Kombination mit dem Einsatz von stereochemisch reinen Ausgangs- oder Hilfsstoffen hergestellt werden.
Beispiele für als Herbizid (A) verwendete Verbindungen sind in den nachfolgenden Tabellen A genannt, worin folgende Abkürzungen verwendet werden:
Me für Methyl, Et für Ethyl und
i-Pr für Isopropyl.
Tabelle A.1 - Spezifische Beispiele der Verbindungen der allgemeinen Formel (I)
Tabelle A.2 - Spezifische Beispiele der Verbindungen der allgemeinen Formel (I)
Tabelle A.3 - Spezifische Beispiele der Verbindungen der allgemeinen Formel (I)
Die Aufwandmenge der Herbizide der allgemeinen Formel (I) kann mit den äußeren Bedingungen wie Temperatur, Feuchtigkeit, der Art des verwendeten Herbizids in einem weiten Bereich variieren, beispielsweise zwischen 0,001 g und 2000 g a.i./ha (ai/ha bedeutet dabei im folgenden „Aktivsubstanz pro Hektar" = bezogen auf 100%igen Wirkstoff).
Bei Anwendungen mit Aufwandmengen von 0,01 g bis 1000 g a.i./ha der Herbizide (A) der allgemeinen Formel (I) wird im Vor- und Nachauflaufverfahren ein relativ breites Spektrum an Schadpflanzen bekämpft, z.B. annuellen und perennierenden mono- oder dikotylen Unkräutern sowie an unerwünschten Kulturpflanzen. Bei den erfindungsgemäßen Kombinationen liegen die Aufwandmengen in der Regel niedriger, z. B. im Bereich von 0,1 g bis 800 g a.i./ha, vorzugsweise 1 g bis 500 g a.i./ha, besonders bevorzugt 10 g bis 400 g a.i./ha.
Die Herbizide der allgemeinen Formel (I) sind zur Bekämpfung von Schadpflanzen, z.B. in PfIa nzenku Itu ren geeignet, beispielsweise in wirtschaftlich bedeutenden Ackerbaukulturen z.B. monokotylen Ackerbaukulturen wie Getreide (z.B. Weizen,
Gerste, Roggen, Hafer), Reis, Mais, Hirse, oder dikotylen Ackerbaukulturen wie Zuckerrübe, Raps, Baumwolle, Sonnenblume und Leguminosen z.B. der Gattungen Glycine (z.B. Glycine max. (Soja) wie nicht-transgene Glycine max. (z.B. konventionelle Sorten wie STS-Sorten) oder transgene Glycine max. (z.B. RR-Soja oder LL-Soja) und deren Kreuzungen), Phaseolus, Pisum, Vicia und Arachis, oder Gemüsekulturen aus verschiedenen botanischen Gruppen wie Kartoffel, Lauch, Kohl, Karotte, Tomate, Zwiebel, sowie Dauer- und Plantagenkulturen wie Kern- und Steinobst, Beerenobst, Wein, Hevea, Bananen, Zuckerrohr, Kaffee, Tee, Citrus, Nussplantagen, Rasen, Palmenkulturen und Forstkulturen. Für die Anwendung der erfindungsgemäßen Herbizid-Safener-Kombinationen (A)+(B) sind diese Kulturen ebenfalls bevorzugt, besonders bevorzugt ist der Einsatz in Getreide (z.B. Weizen, Gerste, Roggen, Hafer), Reis, Mais, Hirse, Zuckerrübe, Zuckerrohr, Sonnenblume, Raps und Baumwolle. Die Herbizid-Safener-Kombinationen (A)+(B) sind auch einsetzbar in toleranten und nicht toleranten Mutantenkulturen und toleranten und nicht toleranten transgenen Kulturen, vorzugsweise von Mais, Reis, Getreide, Raps und Soja, z.B. solche die gegen Imidazolinon-Herbizide, Atrazin, Glufosinate oder Glyphosate resistent sind.
Die Verbindungen der allgemeinen Formel (I) sind aus der WO 2006/062979 A bekannt und können nach den dort beschriebenen Verfahren erhalten werden.
Safener (B):
Unter den als Komponente (B) enthaltenen Safenern werden Verbindungen verstanden, die geeignet sind, phytotoxische Wirkungen von
Pflanzenschutzmittelwirkstoffen wie Herbiziden an Kulturpflanzen zu reduzieren.
Im Rahmen der vorliegenden Erfindung werden die Verbindungen der allgemeinen Formel (I) mit folgenden Safener-Verbindungen kombiniert:
S1) Verbindungen aus der Gruppe heterocyclischer Carbonsäurederivate: S1a) Verbindungen vom Typ der Dichlorphenylpyrazolin-3-carbonsäure (S1a),
vorzugsweise Verbindungen wie
1-(2,4-Dichlorphenyl)-5-(ethoxycarbonyl)-5-methyl-2-pyrazolin-3-carbonsäure, 1-(2,4-Dichlorphenyl)-5-(ethoxycarbonyl)-5-methyl-2-pyrazolin-3-carbonsäure- ethylester (S1-1) ("Mefenpyr-diethyl"), und verwandte Verbindungen, wie sie in der WO-A-91/07874 beschrieben sind;
S1b) Derivate der Dichlorphenylpyrazolcarbonsäure (S1b), vorzugsweise Verbindungen wie 1-(2,4-Dichlorphenyl)-5-methylpyrazol-3-carbonsäureethylester (S1-2), 1-(2,4-Dichlorphenyl)-5-isopropylpyrazol-3-carbonsäureethylester (S1-3), i^^-DichlorphenyO-δ^i .i-dimethyl-ethyOpyrazol-S-carbonsäure- ethylester (S1-4) und verwandte Verbindungen, wie sie in EP-A-333 131 und EP-A-269 806 beschrieben sind;
S1C) Derivate der 1 ,5-Diphenylpyrazol-3-carbonsäure (S1C), vorzugsweise Verbindungen wie 1-(2,4-Dichlorphenyl)-5-phenylpyrazol-3-carbonsäure- ethylester (S1-5),
1-(2-Chlorphenyl)-5-phenylpyrazol-3-carbonsäuremethylester (S 1-6) und verwandte Verbindungen wie sie beispielsweise in der EP-A-268554 beschrieben sind;
S1d) Verbindungen vom Typ der Triazolcarbonsäuren (S1d), vorzugsweise
Verbindungen wie Fenchlorazol(-ethylester), d.h.
1 -(2,4-Dichlorphenyl)-5-trichlormethyl-(1 H)-1 ,2,4-triazol-3-carbonsäure- ethylester (S1-7), und verwandte Verbindungen, wie sie in EP-A-174 562 und EP-A-346 620 beschrieben sind;
S1e) Verbindungen vom Typ der 5-Benzyl- oder 5-Phenyl-2-isoxazolin-3- carbonsäure, oder der 5,5-Diphenyl-2-isoxazolin-3-carbonsäure(S1e), vorzugsweise Verbindungen wie 5-(2,4-Dichlorbenzyl)-2-isoxazolin-3-carbonsäureethylester (S1-8) oder 5-Phenyl-2-isoxazolin-3-carbonsäureethylester (S1-9) und verwandte Verbindungen, wie sie in WO-A-91/08202 beschrieben sind, bzw. 5,5-Diphenyl-2-isoxazolin-carbonsäure (S1-10) oder 5,5-Diphenyl-2-
isoxazolin-carbonsäureethylester (S1-11) ("Isoxadifen-ethyl") oder -n-propyl- ester (S 1-12) oder der 5-(4-Fluorphenyl)-5-phenyl-2-isoxazolin-3-carbon- säureethylester (S1-13), wie sie in der Patentanmeldung WO-A-95/07897 beschrieben sind.
S2) Verbindungen aus der Gruppe der 8-Chinolinyloxyderivate (S2): S2a) Verbindungen vom Typ der 8-Chinolinoxyessigsäure (S2a), vorzugsweise (5-Chlor-8-chinolinoxy)essigsäure-(1-methylhexyl)-ester ("Cloquintocet- mexyl") (S2-1), (5-Chlor-8-chinolinoxy)essigsäure-(1 ,3-dimethyl-but-1-yl)-ester (S2-2), (5-Chlor-8-chinolinoxy)essigsäure-4-allyl-oxy-butylester (S2-3),
(5-Chlor-8-chinolinoxy)essigsäure-1-allyloxy-prop-2-ylester (S2-4), (5-Chlor-8-chinolinoxy)essigsäureethylester (S2-5), (5-Chlor-8-chinolinoxy)essigsäuremethylester (S2-6), (5-Chlor-8-chinolinoxy)essigsäureallylester (S2-7), (δ-Chlor-δ-chinolinoxyJessigsäure^-^-propyliden-irninoxyH-ethylester
(S2-8), (5-Chlor-8-chinolinoxy)essigsäure-2-oxo-prop-1-ylester (S2-9) und verwandte Verbindungen, wie sie in EP-A-86 750, EP-A-94 349 und EP-A-191 736 oder EP-A-O 492 366 beschrieben sind, sowie (5-Chlor-8- chinolinoxy)essigsäure (S2-10), deren Hydrate und Salze, beispielsweise deren Lithium-, Natrium- Kalium-, Kalzium-, Magnesium-, Aluminium-, Eisen-,
Ammonium-, quartäre Ammonium-, Sulfonium-, oder Phosphoniumsalze wie sie in der WO-A-2002/34048 beschrieben sind;
S2b) Verbindungen vom Typ der (5-Chlor-8-chinolinoxy)malonsäure (S2b), vorzugsweise Verbindungen wie (5-Chlor-8-chinolinoxy)malonsäure- diethylester, (5-Chlor-8-chinolinoxy)malonsäurediallylester, (5-Chlor-8-chinolinoxy)malonsäure-methyl-ethylester und verwandte Verbindungen, wie sie in EP-A-O 582 198 beschrieben sind.
S3) Wirkstoffe vom Typ der Dichloracetamide (S3), die häufig als Vorauflauf- safener (bodenwirksame Safener) angewendet werden, wie z. B. "Dichlormid" (N,N-Diallyl-2,2-dichloracetamid) (S3-1 ),
"R-29148" (a-Dichloracetyl-Σ^.δ-trimethyl-I .S-oxazolidin) der Firma Stauffer
(S3-2),
"R-28725" (3-Dichloracetyl-2,2,-dimethyl-1 ,3-oxazolidin) der Firma Stauffer
(S3-3), "Benoxacor" (4-Dichloracetyl-3,4-dihydro-3-methyl-2H-1 ,4-benzoxazin)
(S3-4),
"PPG-1292" (N-Allyl-N-[(1 ,3-dioxolan-2-yl)-methyl]-dichloracetamid) der Firma
PPG Industries (S3-5),
"DKA-24" (N-Allyl-N-[(allylaminocarbonyl)methyl]-dichloracetamid) der Firma Sagro-Chem (S3-6),
"AD-67" oder "MON 4660" (3-Dichloracetyl-1-oxa-3-aza-spiro[4,5]decan) der
Firma Nitrokemia bzw. Monsanto (S3-7),
"TI-35" (1-Dichloracetyl-azepan) der Firma TRI-Chemical RT (S3-8),
"Diclonon" (Dicyclonon) (synonym: "BAS145138" oder "LAB145138") (RS)-I- Dichloracetyl-3,3,8a-trimethylperhydropyrrolo[1 ,2-a]pyhmidin-6-on der Firma
BASF (S3-9),
"Furilazol" oder "MON 13900" ((RS)-3-Dichloracetyl-5-(2-furyl)-2,2- dimethyloxazolidin) (S3-10), sowie dessen (R)-Isomer (S3-11).
S4) Verbindungen aus der Klasse der Acylsulfonamide (S4):
S4a) N-Acylsulfonamide der Formel (S4a) und deren Salze wie sie in der WO-A-97/45016 beschrieben sind,
worin RA 1 (Ci-C6)Alkyl, (C3-C6)Cycloalkyl, wobei die 2 letztgenannten Reste durch vA Substituenten aus der Gruppe Halogen, (Ci-C4)Alkoxy, (Ci-C6)HaIo- alkoxy und (Ci-C4)Alkylthio und im Falle cyclischer Reste auch durch (Ci-C4)Alkyl und (Ci-C4)Haloalkyl substituiert sind; RA 2 Halogen, (d-C4)Alkyl, (C1-C4)AIkOXy, CF3; mA 1 oder 2;
vA ist 0, 1 , 2 oder 3 bedeuten;
S4b) Verbindungen vom Typ der 4-(Benzoylsulfamoyl)benzamide der Formel (S4b) und deren Salze, wie sie in der WO-A-99/16744 beschrieben sind,
worin
RB1 , RB2 unabhängig voneinander Wasserstoff, (C1-C6)AIKyI,
(C3-C6)Cycloalkyl, (C3-C6)Alkenyl, (C3-C6)Alkinyl, RB3 Halogen, (C1-C4)AIRyI, (CrC4)Haloalkyl oder (C1-C4)AIkOXy und mB 1 oder 2 bedeuten,
z.B. solche worin
RB1 = Cyclopropyl, RB 2 = Wasserstoff und (R6 3) = 2-OMe ist (S4-1 , "Cyprosulfamide"), RB1 = Cyclopropyl, RB 2 = Wasserstoff und (RB 3) = 5-CI-2-OMe ist (S4-2),
RB1 = Ethyl, RB 2 = Wasserstoff und (R8 3) = 2-OMe ist (S4-3), R8 1 = Isopropyl, R8 2 = Wasserstoff und (RB 3) = 5-CI-2-OMe ist (S4-4) und R8 1 = Isopropyl, R8 2 = Wasserstoff und (R8 3) = 2-OMe ist (S4-5).
S4C) Verbindungen aus der Klasse der Benzoylsulfamoylphenylharnstoffe der Formel (S4C), wie sie in der EP-A-365484 beschrieben sind
worin
Rc1, Rc2 unabhängig voneinander Wasserstoff, (Ci-Cβ)Alkyl, (C3-C8)Cycloalkyl, (C3-C6)Alkenyl, (C3-C6)Alkinyl,
Rc3 Halogen, (C1-C4)Alkyl, (C1 -C4)AI koxy, CF3
mc 1 oder 2 bedeuten;
beispielsweise
1-[4-(N-2-Methoxybenzoylsulfamoyl)phenyl]-3-methylharnstoff, 1-[4-(N-2-Methoxybenzoylsulfamoyl)phenyl]-3,3-dimethylharnstoff,
1-[4-(N-4,5-Dimethylbenzoylsulfamoyl)phenyl]-3-methylhamstoff.
S5) Wirkstoffe aus der Klasse der Hydroxyaromaten und der aromatisch- aliphatischen Carbonsäurederivate (S5), z.B. 3,4,5-Triacetoxybenzoesäureethylester, 3,5-Dimethoxy-4-hydroxybenzoe- säure, 3,5-Dihydroxybenzoesäure, 4-Hydroxysalicylsäure, 4-Fluorsalicycl- säure, 2-Hydroxyzimtsäure, 2,4-Dichlorzimtsäure, wie sie in der WO-A- 2004/084631 , WO-A-2005/015994, WO-A-2005/016001 beschrieben sind.
S6) Wirkstoffe aus der Klasse der 1 ,2-Dihydrochinoxalin-2-one (S6), z.B.
1 -Methyl-3-(2-thienyl)-1 ,2-dihydrochinoxalin-2-on, 1 -Methyl-3-(2-thienyl)-1 ,2- dihydrochinoxalin-2-thion, 1-(2-Aminoethyl)-3-(2-thienyl)-1 ,2-dihydro- chinoxalin-2-on-hydrochlorid, 1-(2-Methylsulfonylaminoethyl)-3-(2-thienyl)-1 ,2- dihydro-chinoxalin-2-on, wie sie in der WO-A-2005/112630 beschrieben sind.
57) Verbindungen aus der Klasse der Diphenylmethoxyessigsäurederivate (S7), z.B. Diphenylmethoxyessigsäuremethylester (CAS-Reg.Nr. 41858-19-9) (S7-1), Diphenylmethoxyessigsäureethylester oder Diphenylmethoxy- essigsäure wie sie in der WO-A-98/38856 beschrieben sind.
58) Verbindungen der Formel (S8),wie sie in der WO-A-98/27049 beschrieben sind
worin die Symbole und Indizes folgende Bedeutungen haben:
RD 1 ist Halogen, (C1-C4)AIkYl, (Ci-C4)Haloalkyl, (C1-C4)AIkOXy, (C1-C4)HaIOaIkOXy,
RD 2 ist Wasserstoff oder (CrC4)Alkyl
RD 3 ist Wasserstoff, (CrC8)Alkyl, (C2-C4)Alkenyl, (C2-C4)Alkinyl, oder Aryl, wobei jeder der vorgenannten C-haltigen Reste unsubstituiert oder durch einen oder mehrere, vorzugsweise bis zu drei gleiche oder verschiedene Reste aus der
Gruppe, bestehend aus Halogen und Alkoxy substituiert ist; oder deren Salze no ist eine ganze Zahl von 0 bis 2.
S9) Wirkstoffe aus der Klasse der 3-(5-Tetrazolylcarbonyl)-2-chinolone (S9), z.B. 1 ,2-Dihydro-4-hydroxy-1-ethyl-3-(5-tetrazolylcarbonyl)-2-chinolon (CAS-
Regno: 219479-18-2), 1 ,2-Dihydro-4-hydroxy-1-methyl-3-(5-tetrazolyl- carbonyl)-2-chinolon (CAS-Reg.Nr. 95855-00-8), wie sie in der WO-A- 1999/000020 beschrieben sind.
S10) Verbindungen der Formeln (S10a) oder (S10b) wie sie in der WO-A-2007/023719 und WO-A-2007/023764 beschrieben sind
(S10a) (S10b) worin
RE1 Halogen, (C1-C4)AIkYl, Methoxy, Nitro, Cyano, CF3, OCF3 YE, ZE unabhängig voneinander O oder S, nε eine ganze Zahl von 0 bis 4,
RE2 (C1-C16)AIkYl, (C2-C6)Alkenyl, (C3-C6)Cycloalkyl, Aryl; Benzyl, Halogenbenzyl, RE3 Wasserstoff oder (C1-C6)AIkYl bedeuten.
S11) Wirkstoffe vom Typ der Oxyimino-Verbindungen (S11), die als Saatbeizmittel bekannt sind, wie z. B.
"Oxabetrinil" ((Z)-1 , 3-Dioxolan-2-ylmethoxyimino(phenyl)acetonitril) (S11-1),
das als Saatbeiz-Safener für Hirse gegen Schäden von Metolachlor bekannt ist,
"Fluxofenim" (1 -(4-Chlorphenyl)-2,2,2-trifluor-1 -ethanon-O-(1 ,3-dioxolan-2- ylmethyl)-oxim) (S1 1-2), das als Saatbeiz-Safener für Hirse gegen Schäden von Metolachlor bekannt ist, und
"Cyometrinil" oder "CGA-43089" ((Z)-Cyanomethoxyimino(phenyl)acetonitril) (S1 1-3), das als Saatbeiz-Safener für Hirse gegen Schäden von Metolachlor bekannt ist.
S12) Wirkstoffe aus der Klasse der Isothiochromanone (S12), wie z.B. Methyl-[(3- oxo-1 H-2-benzothiopyran-4(3H)-yliden)methoxy]acetate (CAS-Reg.Nr. 205121-04-6) (S12-1) und verwandte Verbindungen aus WO-A-1998/13361.
S13) Eine oder mehrere Verbindungen aus Gruppe (S13): "Naphthalic anhydrid" (1 ,8-Naphthalindicarbonsäureanhydrid) (S13-1), das als
Saatbeiz-Safener für Mais gegen Schäden von Thiocarbamatherbiziden bekannt ist,
"Fenclorim" (4,6-Dichlor-2-phenylpyrimidin) (S13-2), das als Safener für
Pretilachlor in gesätem Reis bekannt ist, "Flurazole" (Benzyl-2-chlor-4-trifluormethyl-1 ,3-thiazol-5-carboxylat) (S13-3), das als Saatbeiz-Safener für Hirse gegen Schäden von Alachlor und
Metolachlor bekannt ist,
11CL 304415" (CAS-Reg.Nr. 31541-57-8)
(4-Carboxy-3,4-dihydro-2H-1-benzopyran-4-essigsäure) (S13-4) der Firma American Cyanamid, das als Safener für Mais gegen Schäden von
Imidazolinonen bekannt ist,
"MG 191 " (CAS-Reg.Nr. 96420-72-3) (2-Dichlormethyl-2-methyl-1 ,3-dioxolan)
(S13-5) der Firma Nitrokemia, das als Safener für Mais bekannt ist,
"MG-838" (CAS-Reg.Nr. 133993-74-5) (2-propenyl 1-oxa-4-azaspiro[4.5]decane-4-carbodithioate) (S13-6) der Firma
Nitrokemia
"Disulfoton" (0,0-Diethyl S-2-ethylthioethyl phosphordithioat) (S13-7),
"Dietholate" (0,O-Diethyl-O-phenylphosphorotioat) (S13-8), "Mephenate" (4-Chlorphenyl-methylcarbamat) (S13-9).
S 14) Wirkstoffe, die neben einer herbiziden Wirkung gegen Schadpflanzen auch Safenerwirkung an Kulturpflanzen wie Reis aufweisen, wie z. B. "Dimepiperate" oder "MY-93" (S-1-Methyl-1-phenylethyl-piperidin-1 - carbothioat), das als Safener für Reis gegen Schäden des Herbizids Molinate bekannt ist, "Daimuron" oder "SK 23" (1-(1-Methyl-1-phenylethyl)-3-p-tolyl-harnstoff), das als Safener für Reis gegen Schäden des Herbizids Imazosulfuron bekannt ist (S14-1),
"Cumyluron" = "JC-940" (3-(2-Chlorphenylmethyl)-1-(1-methyl-1-phenyl- ethyl)harnstoff, siehe JP-A-60087254), das als Safener für Reis gegen Schäden einiger Herbizide bekannt ist,
"Methoxyphenon" oder "NK 049" (3,3'-Dimethyl-4-methoxy-benzophenon), das als Safener für Reis gegen Schäden einiger Herbizide bekannt ist, "CSB" (1-Brom-4-(chlormethylsulfonyl)benzol) von Kumiai, (CAS-Reg.Nr. 54091-06-4), das als Safener gegen Schäden einiger Herbizide in Reis be- kannt ist.
Die zitierten Schriften enthalten ausführliche Angaben zu Herstellungsverfahren und Ausgangsmaterialien und nennen bevorzugte Verbindungen. Auf diese Schriften wird ausdrücklich Bezug genommen, sie gelten durch Zitat als Bestandteil dieser Beschreibung.
Beispiele für bevorzugte Kombinationen von herbiziden Wirkstoffen (A) und Safenern (B) sind in der folgenden Tabelle dargestellt:
(1-1) + (SM ); (1-1) + (S1-2); (1-1) + (S1-3); (1-1) + (S1-4); (1-1) + (S1-5); (1-1 ) + (S1- 6); (1-1 ) + (S1-7); (1-1) + (S1-8); (1-1) + (S1-9); (1-1 ) + (SM O); (1-1 ) + (SM 1); (1-1) + (SM 2); (1-1 ) + (S1-13); (1-1 ) + (S2-1 ); (1-1) + (S2-2); (1-1) + (S2-3); (1-1) + (S2-4);
(1-1 ) + (S2-5); (1-1) + (S2-6); (1-1) + (S2-7); (1-1) + (S2-8); (1-1) + (S2-9); (1-1) + (S2- 10); (M) + (S3-1 ); (1-1) + (S3-2); (1-1 ) + (S3-3); (1-1 ) + (S3-4); (1-1 ) + (S3-5); (1-1) + (S3-6); (1-1) + (S3-7); (1-1 ) + (S3-8); (M ) + (S3-9); (M ) + (S3-10); (M ) + (S3-11 ); (M) + (S4-1 ); (M) + (S4-2); (1-1) + (S4-3); (M) + (S4-4); (M ) + (S4-5); (M) + (S7- 1); (M) + (S11-1); (M) + (S11-2); (M) + (S11-3); (M ) + (S12-1); (1-1) + (S13-1 ); (M) + (S13-2); (M) + (S13-3); (M) + (S13-4): (M) + (S13-5); (M) + (S13-6); (M) + (S13-7); (M) + (S13-8); (M ) + (S13-9); (M) + (S14-1)
(I-2) + (S1-1); (I-2) + (S1-2); (I-2) + (S1-3); (I-2) + (S1-4); (I-2) + (S1-5); (I-2) + (S1- 6); (I-2) + (S1 -7); (I-2) + (S1-8); (I-2) + (S1-9); (I-2) + (S1-10); (I-2) + (S1-11 ); (I-2) + (S1-12); (I-2) + (S1-13); (I-2) + (S2-1 ); (I-2) + (S2-2); (I-2) + (S2-3); (I-2) + (S2-4); (I-2) + (S2-5); (I-2) + (S2-6); (I-2) + (S2-7); (I-2) + (S2-8); (I-2) + (S2-9); (I-2) + (S2- 10); (I-2) + (S3-1); (I-2) + (S3-2); (I-2) + (S3-3); (I-2) + (S3-4); (I-2) + (S3-5); (I-2) + (S3-6); (I-2) + (S3-7); (I-2) + (S3-8); (I-2) + (S3-9); (I-2) + (S3-10); (I-2) + (S3-11); (I-2) + (S4-1); (I-2) + (S4-2); (I-2) + (S4-3); (I-2) + (S4-4); (I-2) + (S4-5); (I-2) + (S7- 1); (I-2) + (S1 1-1); (I-2) + (S11-2); (I-2) + (S11-3); (I-2) + (S12-1); (I-2) + (S13-1); (I-2) + (S13-2); (I-2) + (S13-3); (I-2) + (S13-4): (I-2) + (S13-5); (I-2) + (S13-6); (I-2) + (S13-7); (I-2) + (S13-8); (I-2) + (S13-9); (I-2) + (S14-1)
(I-3) + (S1-1); (I-3) + (S1-2); (I-3) + (S1-3); (I-3) + (S1-4); (I-3) + (S1-5); (I-3) + (S1- 6); (I-3) + (S1-7); (I-3) + (S1-8); (I-3) + (S1-9); (I-3) + (S1-10); (I-3) + (S1-11 ); (I-3) + (S1-12); (I-3) + (S1-13); (I-3) + (S2-1); (I-3) + (S2-2); (I-3) + (S2-3); (I-3) + (S2-4); (I-3) + (S2-5); (I-3) + (S2-6); (I-3) + (S2-7); (I-3) + (S2-8); (I-3) + (S2-9); (I-3) + (S2- 10); (I-3) + (S3-1); (I-3) + (S3-2); (I-3) + (S3-3); (I-3) + (S3-4); (I-3) + (S3-5); (I-3) + (S3-6); (I-3) + (S3-7); (I-3) + (S3-8); (I-3) + (S3-9); (I-3) + (S3-10); (I-3) + (S3-11); (I-3) + (S4-1); (I-3) + (S4-2); (I-3) + (S4-3); (I-3) + (S4-4); (I-3) + (S4-5); (I-3) + (S7- 1 ); (I-3) + (S11-1 ); (I-3) + (S11-2); (I-3) + (S11-3); (I-3) + (S12-1 ); (I-3) + (S13-1 ); (I-3) + (S13-2); (I-3) + (S13-3); (I-3) + (S13-4): (I-3) + (S13-5); (I-3) + (S13-6); (I-3) + (S13-7); (I-3) + (S13-8); (I-3) + (S13-9); (I-3) + (S14-1)
(I-4) + (S1-1 ); (I-4) + (S1-2); (I-4) + (S1-3); (I-4) + (S1-4); (I-4) + (S1-5); (I-4) + (S1- 6); (I-4) + (S1-7); (I-4) + (S1-8); (I-4) + (S1-9); (I-4) + (S1-10); (I-4) + (S1-11); (I-4) + (S1-12); (I-4) + (S1-13); (I-4) + (S2-1 ); (I-4) + (S2-2); (I-4) + (S2-3); (I-4) + (S2-4); (I-4) + (S2-5); (I-4) + (S2-6); (I-4) + (S2-7); (I-4) + (S2-8); (I-4) + (S2-9); (I-4) + (S2- 10); (I-4) + (S3-1); (I-4) + (S3-2); (I-4) + (S3-3); (I-4) + (S3-4); (I-4) + (S3-5); (I-4) +
(S3-6); (1-4) + (S3-7); (1-4) + (S3-8); (1-4) + (S3-9); (1-4) + (S3-10); (I-4) + (S3-11); (I-4) + (S4-1 ); (I-4) + (S4-2); (I-4) + (S4-3); (I-4) + (S4-4); (I-4) + (S4-5); (I-4) + (S7- 1); (I-4) + (S11-1 ); (I-4) + (S11-2); (I-4) + (S11-3); (I-4) + (S12-1 ); (I-4) + (S13-1 ); (I-4) + (S13-2); (I-4) + (S13-3); (I-4) + (S13-4): (I-4) + (S13-5); (I-4) + (S13-6); (I-4) + (S13-7); (I-4) + (S13-8); (I-4) + (S13-9); (I-4) + (S14-1)
(I-5) + (S1-1 ); (I-5) + (S1-2); (I-5) + (S1-3); (I-5) + (S1-4); (I-5) + (S1-5); (I-5) + (S1- 6); (I-5) + (S1-7); (I-5) + (S1-8); (I-5) + (S1-9); (I-5) + (S1-10); (I-5) + (S1-11); (I-5) + (S1-12); (I-5) + (S1-13); (I-5) + (S2-1); (I-5) + (S2-2); (I-5) + (S2-3); (I-5) + (S2-4); (I-5) + (S2-5); (I-5) + (S2-6); (I-5) + (S2-7); (I-5) + (S2-8); (I-5) + (S2-9); (I-5) + (S2- 10); (I-5) + (S3-1); (I-5) + (S3-2); (I-5) + (S3-3); (I-5) + (S3-4); (I-5) + (S3-5); (I-5) + (S3-6); (I-5) + (S3-7); (I-5) + (S3-8); (I-5) + (S3-9); (I-5) + (S3-10); (I-5) + (S3-11 ); (I-5) + (S4-1); (I-5) + (S4-2); (I-5) + (S4-3); (I-5) + (S4-4); (I-5) + (S4-5); (I-5) + (S7- 1); (I-5) + (S11-1 ); (I-5) + (S11-2); (I-5) + (S11-3); (I-5) + (S12-1 ); (I-5) + (S13-1); (I-5) + (S13-2); (I-5) + (S13-3); (I-5) + (S13-4): (I-5) + (S13-5); (I-5) + (S13-6); (I-5) + (S13-7); (I-5) + (S13-8); (I-5) + (S13-9); (I-5) + (S14-1)
(I-6) + (S1-1); (I-6) + (S1-2); (I-6) + (S1-3); (I-6) + (S1-4); (I-6) + (S1-5); (I-6) + (S1- 6); (I-6) + (S1-7); (I-6) + (S1-8); (I-6) + (S1-9); (I-6) + (S1-10); (I-6) + (S1-11 ); (I-6) + (S1-12); (I-6) + (S1-13); (I-6) + (S2-1); (I-6) + (S2-2); (I-6) + (S2-3); (I-6) + (S2-4); (I-6) + (S2-5); (I-6) + (S2-6); (I-6) + (S2-7); (I-6) + (S2-8); (I-6) + (S2-9); (I-6) + (S2- 10); (I-6) + (S3-1 ); (I-6) + (S3-2); (I-6) + (S3-3); (I-6) + (S3-4); (I-6) + (S3-5); (I-6) + (S3-6); (I-6) + (S3-7); (I-6) + (S3-8); (I-6) + (S3-9); (I-6) + (S3-10); (I-6) + (S3-11); (I-6) + (S4-1); (I-6) + (S4-2); (I-6) + (S4-3); (I-6) + (S4-4); (I-6) + (S4-5); (I-6) + (S7- 1); (I-6) + (S11-1); (I-6) + (S11-2); (I-6) + (S11-3); (I-6) + (S12-1); (I-6) + (S13-1); (I-6) + (S13-2); (I-6) + (S13-3); (I-6) + (S13-4): (I-6) + (S13-5); (I-6) + (S13-6); (I-6) + (S13-7); (I-6) + (S13-8); (I-6) + (S13-9); (I-6) + (S14-1)
(I-7) + (S1-1); (I-7) + (S1-2); (I-7) + (S1-3); (I-7) + (S1-4); (I-7) + (S1-5); (I-7) + (S1- 6); (I-7) + (S1-7); (I-7) + (S1-8); (I-7) + (S1-9); (I-7) + (S1-10); (I-7) + (S1-11 ); (I-7) + (S1-12); (I-7) + (S1-13); (I-7) + (S2-1); (I-7) + (S2-2); (I-7) + (S2-3); (I-7) + (S2-4); (I-7) + (S2-5); (I-7) + (S2-6); (I-7) + (S2-7); (I-7) + (S2-8); (I-7) + (S2-9); (I-7) + (S2- 10); (I-7) + (S3-1); (I-7) + (S3-2); (I-7) + (S3-3); (I-7) + (S3-4); (I-7) + (S3-5); (I-7) + (S3-6); (I-7) + (S3-7); (I-7) + (S3-8); (I-7) + (S3-9); (I-7) + (S3-10); (I-7) + (S3-11); (I-7) + (S4-1); (I-7) + (S4-2); (I-7) + (S4-3); (I-7) + (S4-4); (I-7) + (S4-5); (I-7) + (S7-
1); (I-7) + (S11-1); (I-7) + (S11-2); (I-7) + (S11-3); (I-7) + (S12-1 ); (I-7) + (S13-1); (I-7) + (S13-2); (I-7) + (S13-3); (I-7) + (S13-4): (I-7) + (S13-5); (I-7) + (S13-6); (I-7) + (S13-7); (I-7) + (S13-8); (I-7) + (S13-9); (I-7) + (S14-1)
(I-8) + (S1-1); (I-8) + (S1-2); (I-8) + (S1 -3); (I-8) + (S1-4); (I-8) + (S1-5); (I-8) + (S1- 6); (I-8) + (S1-7); (I-8) + (S1-8); (I-8) + (S1-9); (I-8) + (S1-10); (I-8) + (S1-1 1); (I-8) + (S1-12); (I-8) + (S1 -13); (I-8) + (S2-1); (I-8) + (S2-2); (I-8) + (S2-3); (I-8) + (S2-4); (I-8) + (S2-5); (I-8) + (S2-6); (I-8) + (S2-7); (I-8) + (S2-8); (I-8) + (S2-9); (I-8) + (S2- 10); (I-8) + (S3-1 ); (I-8) + (S3-2); (I-8) + (S3-3); (I-8) + (S3-4); (I-8) + (S3-5); (I-8) + (S3-6); (I-8) + (S3-7); (I-8) + (S3-8); (I-8) + (S3-9); (I-8) + (S3-10); (I-8) + (S3-11); (I-8) + (S4-1); (I-8) + (S4-2); (I-8) + (S4-3); (I-8) + (S4-4); (I-8) + (S4-5); (I-8) + (S7- 1 ); (I-8) + (S11-1); (I-8) + (S11-2); (I-8) + (S11-3); (I-8) + (S12-1 ); (I-8) + (S13-1); (I-8) + (S13-2); (I-8) + (S13-3); (I-8) + (S13-4): (I-8) + (S13-5); (I-8) + (S13-6); (I-8) + (S13-7); (I-8) + (S13-8); (I-8) + (S13-9); (I-8) + (S14-1)
(I-9) + (S1-1); (I-9) + (S1-2); (I-9) + (S1-3); (I-9) + (S1-4); (I-9) + (S1-5); (I-9) + (S1- 6); (I-9) + (S1-7); (I-9) + (S1-8); (I-9) + (S1-9); (I-9) + (S1-10); (I-9) + (S1-11); (I-9) + (S1-12); (I-9) + (S1-13); (I-9) + (S2-1); (I-9) + (S2-2); (I-9) + (S2-3); (I-9) + (S2-4); (I-9) + (S2-5); (I-9) + (S2-6); (I-9) + (S2-7); (I-9) + (S2-8); (I-9) + (S2-9); (I-9) + (S2- 10); (I-9) + (S3-1); (I-9) + (S3-2); (I-9) + (S3-3); (I-9) + (S3-4); (I-9) + (S3-5); (I-9) + (S3-6); (I-9) + (S3-7); (I-9) + (S3-8); (I-9) + (S3-9); (I-9) + (S3-10); (I-9) + (S3-11); (I-9) + (S4-1); (I-9) + (S4-2); (I-9) + (S4-3); (I-9) + (S4-4); (I-9) + (S4-5); (I-9) + (S7- 1); (I-9) + (S11-1 ); (I-9) + (S11-2); (I-9) + (S11-3); (I-9) + (S12-1); (I-9) + (S13-1); (I-9) + (S13-2); (I-9) + (S13-3); (I-9) + (S13-4): (I-9) + (S13-5); (I-9) + (S13-6); (I-9) + (S13-7); (I-9) + (S13-8); (I-9) + (S13-9); (I-9) + (S14-1)
(1-10) + (S1-1); (1-10) + (S1-2); (1-10) + (S1-3); (1-10) + (S1-4); (1-10) + (S1-5); (I- 10) + (S1-6); (1-10) + (S1-7); (1-10) + (S1-8); (1-10) + (S1-9); (1-10) + (S1-10); (1-10) + (S1-11); (1-10) + (S1-12); (1-10) + (S1-13); (1-10) + (S2-1); (1-10) + (S2-2); (1-10) + (S2-3); (1-10) + (S2-4); (1-10) + (S2-5); (1-10) + (S2-6); (1-10) + (S2-7); (1-10) + (S2- 8); (1-10) + (S2-9); (1-10) + (S2-10); (1-10) + (S3-1 ); (1-10) + (S3-2); (1-10) + (S3-3); (1-10) + (S3-4); (1-10) + (S3-5); (1-10) + (S3-6); (1-10) + (S3-7); (1-10) + (S3-8); (I- 10) + (S3-9); (1-10) + (S3-10); (1-10) + (S3-11); (1-10) + (S4-1 ); (1-10) + (S4-2); (I- 10) + (S4-3); (1-10) + (S4-4); (1-10) + (S4-5); (1-10) + (S7-1); (1-10) + (S11 -1); (1-10) + (S11-2); (1-10) + (S11-3); (1-10) + (S12-1); (1-10) + (S13-1 ); (1-10) + (S13-2); (I-
10) + (S13-3); (1-10) + (S13-4): (1-10) + (S13-5); (1-10) + (S13-6); (1-10) + (S13-7); (1-10) + (S13-8); (1-10) + (S13-9); (1-10) + (S14-1)
(1-11) + (S1-1); (1-11) + (S1-2); (1-11) + (S1-3); (1-11) + (S1-4); (1-11) + (S1-5); (I-
11) + (S1-6); (1-11) + (S1-7); (1-11) + (S1-8); (1-11) + (S1-9); (1-11) + (S1-10); (1-11) + (S1-11); (1-11) + (S1-12); (1-11) + (S1-13); (1-11) + (S2-1); (1-11) + (S2-2); (1-11) + (S2-3); (1-11 ) + (S2-4); (1-11) + (S2-5); (1-11 ) + (S2-6); (1-11 ) + (S2-7); (1-11 ) + (S2- 8); (1-11) + (S2-9); (1-11) + (S2-10); (1-11) + (S3-1); (1-11) + (S3-2); (1-11) + (S3-3); (1-11) + (S3-4); (1-11 ) + (S3-5); (1-11) + (S3-6); (1-11) + (S3-7); (1-11 ) + (S3-8); (I- 11) + (S3-9); (1-11) + (S3-10); (1-11) + (S3-11); (1-11) + (S4-1); (1-11) + (S4-2); (I- 11) + (S4-3); (1-11 ) + (S4-4); (1-11 ) + (S4-5); (1-11 ) + (S7-1 ); (1-11 ) + (S11 -1 ); (1-11 ) + (S11-2); (1-11) + (S11-3); (1-11) + (S12-1); (1-11) + (S13-1); (1-11) + (S13-2); (I-
11) + (S13-3); (1-11) + (S13-4): (1-11) + (S13-5); (1-11) + (S13-6); (1-11) + (S13-7); (1-11) + (S13-8); (1-11) + (S13-9); (1-11) + (S14-1)
(1-12) + (S1-1); (1-12) + (S1-2); (1-12) + (S1-3); (1-12) + (S1-4); (1-12) + (S1-5); (I-
12) + (S1-6); (1-12) + (S1-7); (1-12) + (S1-8); (1-12) + (S1-9); (1-12) + (S1-10); (1-12) + (S1-11); (1-12) + (S1-12); (1-12) + (S1-13); (1-12) + (S2-1); (1-12) + (S2-2); (1-12) + (S2-3); (1-12) + (S2-4); (1-12) + (S2-5); (1-12) + (S2-6); (1-12) + (S2-7); (1-12) + (S2- 8); (1-12) + (S2-9); (1-12) + (S2-10); (1-12) + (S3-1); (1-12) + (S3-2); (1-12) + (S3-3); (1-12) + (S3-4); (1-12) + (S3-5); (1-12) + (S3-6); (1-12) + (S3-7); (1-12) + (S3-8); (I- 12) + (S3-9); (1-12) + (S3-10); (1-12) + (S3-11); (1-12) + (S4-1); (1-12) + (S4-2); (I- 12) + (S4-3); (1-12) + (S4-4); (1-12) + (S4-5); (1-12) + (S7-1); (1-12) + (S11-1); (1-12) + (S11-2); (1-12) + (S11-3); (1-12) + (S12-1); (1-12) + (S13-1); (1-12) + (S13-2); (I-
12) + (S13-3); (1-12) + (S13-4): (1-12) + (S13-5); (1-12) + (S13-6); (1-12) + (S13-7); (1-12) + (S13-8); (1-12) + (S13-9); (1-12) + (S14-1)
(1-13) + (S1-1); (1-13) + (S1-2); (1-13) + (S1-3); (1-13) + (S1-4); (1-13) + (S1-5); (I-
13) + (S1-6); (1-13) + (S1-7); (1-13) + (S1-8); (1-13) + (S1-9); (1-13) + (S1-10); (1-13) + (S1-11); (1-13) + (S1-12); (1-13) + (S1-13); (1-13) + (S2-1); (1-13) + (S2-2); (1-13) + (S2-3); (1-13) + (S2-4); (1-13) + (S2-5); (1-13) + (S2-6); (1-13) + (S2-7); (1-13) + (S2- 8); (1-13) + (S2-9); (1-13) + (S2-10); (1-13) + (S3-1); (1-13) + (S3-2); (1-13) + (S3-3); (1-13) + (S3-4); (1-13) + (S3-5); (1-13) + (S3-6); (1-13) + (S3-7); (1-13) + (S3-8); (I- 13) + (S3-9); (1-13) + (S3-10); (1-13) + (S3-11); (1-13) + (S4-1); (1-13) + (S4-2); (I- 13) + (S4-3); (1-13) + (S4-4); (1-13) + (S4-5); (1-13) + (S7-1); (1-13) + (S11-1); (1-13)
+ (S1 1-2); (1-13) + (S1 1-3); (1-13) + (S12-1 ); (1-13) + (S13-1 ); (1-13) + (S13-2); (I-
13) + (S13-3); (1-13) + (S13-4): (1-13) + (S13-5); (1-13) + (S13-6); (1-13) + (S13-7); (1-13) + (S13-8); (1-13) + (S13-9); (1-13) + (S14-1)
(1-14) + (S1-1); (1-14) + (S1-2); (1-14) + (S1-3); (1-14) + (S1-4); (1-14) + (S1 -5); (I-
14) + (S1-6); (1-14) + (S1-7); (1-14) + (S1-8); (1-14) + (S1-9); (1-14) + (S1-10); (1-14) + (S1 -1 1); (1-14) + (S1-12); (1-14) + (S1-13); (1-14) + (S2-1 ); (1-14) + (S2-2); (1-14) + (S2-3); (1-14) + (S2-4); (1-14) + (S2-5); (1-14) + (S2-6); (1-14) + (S2-7); (1-14) + (S2- 8); (1-14) + (S2-9); (1-14) + (S2-10); (1-14) + (S3-1); (1-14) + (S3-2); (1-14) + (S3-3); (1-14) + (S3-4); (1-14) + (S3-5); (1-14) + (S3-6); (1-14) + (S3-7); (1-14) + (S3-8); (I- 14) + (S3-9); (1-14) + (S3-10); (1-14) + (S3-1 1); (1-14) + (S4-1 ); (1-14) + (S4-2); (I- 14) + (S4-3); (1-14) + (S4-4); (1-14) + (S4-5); (1-14) + (S7-1 ); (1-14) + (S1 1-1 ); (1-14) + (S11-2); (1-14) + (S11-3); (1-14) + (S12-1 ); (1-14) + (S13-1 ); (1-14) + (S13-2); (I-
14) + (S13-3); (1-14) + (S13-4): (1-14) + (S13-5); (1-14) + (S13-6); (1-14) + (S13-7); (1-14) + (S13-8); (1-14) + (S13-9); (1-14) + (S14-1)
(1-15) + (S1-1); (1-15) + (S1-2); (1-15) + (S1-3); (1-15) + (S1-4); (1-15) + (S1-5); (I-
15) + (S1-6); (1-15) + (S1-7); (1-15) + (S1-8); (1-15) + (S1-9); (1-15) + (S1-10); (1-15) + (S1-1 1); (1-15) + (S1-12); (1-15) + (S1-13); (1-15) + (S2-1); (1-15) + (S2-2); (1-15) + (S2-3); (1-15) + (S2-4); (1-15) + (S2-5); (1-15) + (S2-6); (1-15) + (S2-7); (1-15) + (S2- 8); (1-15) + (S2-9); (1-15) + (S2-10); (1-15) + (S3-1); (1-15) + (S3-2); (1-15) + (S3-3); (1-15) + (S3-4); (1-15) + (S3-5); (1-15) + (S3-6); (1-15) + (S3-7); (1-15) + (S3-8); (I- 15) + (S3-9); (1-15) + (S3-10); (1-15) + (S3-1 1); (1-15) + (S4-1); (1-15) + (S4-2); (I- 15) + (S4-3); (1-15) + (S4-4); (1-15) + (S4-5); (1-15) + (S7-1); (1-15) + (S1 1-1 ); (1-15) + (S1 1-2); (1-15) + (S11-3); (1-15) + (S12-1); (1-15) + (S13-1); (1-15) + (S13-2); (I-
15) + (S13-3); (1-15) + (S13-4): (1-15) + (S13-5); (1-15) + (S13-6); (1-15) + (S13-7); (1-15) + (S13-8); (1-15) + (S13-9); (1-15) + (S14-1)
(1-16) + (S1-1); (1-16) + (S1-2); (1-16) + (S1-3); (1-16) + (S1-4); (1-16) + (S1-5); (I-
16) + (S1-6); (1-16) + (S1-7); (1-16) + (S1-8); (1-16) + (S1-9); (1-16) + (S1-10); (1-16) + (S1-1 1 ); (1-16) + (S1-12); (1-16) + (S1-13); (1-16) + (S2-1 ); (1-16) + (S2-2); (1-16) + (S2-3); (1-16) + (S2-4); (1-16) + (S2-5); (1-16) + (S2-6); (1-16) + (S2-7); (1-16) + (S2- 8); (1-16) + (S2-9); (1-16) + (S2-10); (1-16) + (S3-1); (1-16) + (S3-2); (1-16) + (S3-3); (1-16) + (S3-4); (1-16) + (S3-5); (1-16) + (S3-6); (1-16) + (S3-7); (1-16) + (S3-8); (I- 16) + (S3-9); (1-16) + (S3-10); (1-16) + (S3-1 1); (1-16) + (S4-1); (1-16) + (S4-2); (I-
16) + (S4-3); (1-16) + (S4-4); (1-16) + (S4-5); (1-16) + (S7-1); (1-16) + (S11-1); (1-16) + (S11-2); (1-16) + (S11-3); (1-16) + (S12-1); (1-16) + (S13-1); (1-16) + (S13-2); (I-
16) + (S13-3); (1-16) + (S13-4): (1-16) + (S13-5); (1-16) + (S13-6); (1-16) + (S13-7); (1-16) + (S13-8); (1-16) + (S13-9); (1-16) + (S14-1)
(1-17) + (S1-1); (1-17) + (S1-2); (1-17) + (S1-3); (1-17) + (S1-4); (1-17) + (S1-5); (I-
17) + (S1-6); (1-17) + (S1-7); (1-17) + (S1-8); (1-17) + (S1-9); (1-17) + (S1-10); (1-17) + (S1-11); (1-17) + (S1-12); (1-17) + (S1-13); (1-17) + (S2-1); (1-17) + (S2-2); (1-17) + (S2-3); (1-17) + (S2-4); (1-17) + (S2-5); (1-17) + (S2-6); (1-17) + (S2-7); (1-17) + (S2- 8); (1-17) + (S2-9); (1-17) + (S2-10); (1-17) + (S3-1); (1-17) + (S3-2); (1-17) + (S3-3); (1-17) + (S3-4); (1-17) + (S3-5); (1-17) + (S3-6); (1-17) + (S3-7); (1-17) + (S3-8); (I- 17) + (S3-9); (1-17) + (S3-10); (1-17) + (S3-11); (1-17) + (S4-1); (1-17) + (S4-2); (I- 17) + (S4-3); (1-17) + (S4-4); (1-17) + (S4-5); (1-17) + (S7-1); (1-17) + (S11-1); (1-17) + (S11-2); (1-17) + (S11-3); (1-17) + (S12-1); (1-17) + (S13-1); (1-17) + (S13-2); (I-
17) + (S13-3); (1-17) + (S13-4): (1-17) + (S13-5); (1-17) + (S13-6); (1-17) + (S13-7); (1-17) + (S13-8); (1-17) + (S13-9); (1-17) + (S14-1)
(1-18) + (S1-1); (1-18) + (S1-2); (1-18) + (S1-3); (1-18) + (S1-4); (1-18) + (S1-5); (I-
18) + (S1-6); (1-18) + (S1-7); (1-18) + (S1-8); (1-18) + (S1-9); (1-18) + (S1-10); (1-18) + (S1-11); (1-18) + (S1-12); (1-18) + (S1-13); (1-18) + (S2-1); (1-18) + (S2-2); (1-18) + (S2-3); (1-18) + (S2-4); (1-18) + (S2-5); (1-18) + (S2-6); (1-18) + (S2-7); (1-18) + (S2- 8); (1-18) + (S2-9); (1-18) + (S2-10); (1-18) + (S3-1); (1-18) + (S3-2); (1-18) + (S3-3); (1-18) + (S3-4); (1-18) + (S3-5); (1-18) + (S3-6); (1-18) + (S3-7); (1-18) + (S3-8); (I- 18) + (S3-9); (1-18) + (S3-10); (1-18) + (S3-11); (1-18) + (S4-1); (1-18) + (S4-2); (I- 18) + (S4-3); (1-18) + (S4-4); (1-18) + (S4-5); (1-18) + (S7-1); (1-18) + (S11-1); (1-18) + (S11-2); (1-18) + (S11-3); (1-18) + (S12-1); (1-18) + (S13-1); (1-18) + (S13-2); (I-
18) + (S13-3); (1-18) + (S13-4): (1-18) + (S13-5); (1-18) + (S13-6); (1-18) + (S13-7); (1-18) + (S13-8); (1-18) + (S13-9); (1-18) + (S14-1)
(1-19) + (S1-1); (1-19) + (S1-2); (1-19) + (S1-3); (1-19) + (S1-4); (1-19) + (S1-5); (I-
19) + (S1-6); (1-19) + (S1-7); (1-19) + (S1-8); (1-19) + (S1-9); (1-19) + (S1-10); (1-19) + (S1-11); (1-19) + (S1-12); (1-19) + (S1-13); (1-19) + (S2-1); (1-19) + (S2-2); (1-19) + (S2-3); (1-19) + (S2-4); (1-19) + (S2-5); (1-19) + (S2-6); (1-19) + (S2-7); (1-19) + (S2- 8); (1-19) + (S2-9); (1-19) + (S2-10); (1-19) + (S3-1); (1-19) + (S3-2); (1-19) + (S3-3); (1-19) + (S3-4); (1-19) + (S3-5); (1-19) + (S3-6); (1-19) + (S3-7); (1-19) + (S3-8); (I-
19) + (S3-9); (1-19) + (S3-10); (1-19) + (S3-11); (1-19) + (S4-1); (1-19) + (S4-2); (I- 19) + (S4-3); (1-19) + (S4-4); (1-19) + (S4-5); (1-19) + (S7-1 ); (1-19) + (S11-1); (1-19) + (S11-2); (1-19) + (S11-3); (1-19) + (S12-1 ); (1-19) + (S13-1 ); (1-19) + (S13-2); (I-
19) + (S13-3); (1-19) + (S13-4): (1-19) + (S13-5); (1-19) + (S13-6); (1-19) + (S13-7); (1-19) + (S13-8); (1-19) + (S13-9); (1-19) + (S14-1)
(I-20) + (S1-1); (I-20) + (S1-2); (I-20) + (S1-3); (I-20) + (S1-4); (I-20) + (S1-5); (I-
20) + (S1-6); (I-20) + (S1-7); (I-20) + (S1-8); (I-20) + (S1-9); (I-20) + (S1-10); (I-20) + (S1-11); (I-20) + (S1-12); (I-20) + (S1-13); (I-20) + (S2-1 ); (I-20) + (S2-2); (I-20) + (S2-3); (I-20) + (S2-4); (I-20) + (S2-5); (I-20) + (S2-6); (I-20) + (S2-7); (I-20) + (S2- 8); (I-20) + (S2-9); (I-20) + (S2-10); (I-20) + (S3-1); (I-20) + (S3-2); (I-20) + (S3-3); (I-20) + (S3-4); (I-20) + (S3-5); (I-20) + (S3-6); (I-20) + (S3-7); (I-20) + (S3-8); (I- 20) + (S3-9); (I-20) + (S3-10); (I-20) + (S3-11); (I-20) + (S4-1); (I-20) + (S4-2); (I- 20) + (S4-3); (I-20) + (S4-4); (I-20) + (S4-5); (I-20) + (S7-1); (I-20) + (S11-1 ); (I-20) + (S11-2); (I-20) + (S11-3); (I-20) + (S12-1); (I-20) + (S13-1 ); (I-20) + (S13-2); (I-
20) + (S13-3); (I-20) + (S13-4): (I-20) + (S13-5); (I-20) + (S13-6); (I-20) + (S13-7); (I-20) + (S13-8); (I-20) + (S13-9); (I-20) + (S14-1)
(1-21) + (S1-1 ); (1-21) + (S1-2); (1-21 ) + (S1-3); (1-21) + (S1-4); (1-21) + (S1-5); (I-
21) + (S1-6); (1-21) + (S1-7); (1-21) + (S1-8); (1-21) + (S1-9); (1-21 ) + (S1-10); (1-21 ) + (S1-11); (1-21) + (S1-12); (1-21 ) + (S1-13); (1-21) + (S2-1 ); (1-21) + (S2-2); (1-21) + (S2-3); (1-21 ) + (S2-4); (1-21) + (S2-5); (1-21) + (S2-6); (1-21) + (S2-7); (1-21) + (S2- 8); (1-21) + (S2-9); (1-21) + (S2-10); (1-21) + (S3-1); (1-21 ) + (S3-2); (1-21) + (S3-3); (1-21) + (S3-4); (1-21) + (S3-5); (1-21) + (S3-6); (1-21) + (S3-7); (1-21) + (S3-8); (I- 21) + (S3-9); (1-21) + (S3-10); (1-21) + (S3-11); (1-21) + (S4-1); (1-21) + (S4-2); (I- 21) + (S4-3); (1-21) + (S4-4); (1-21) + (S4-5); (1-21) + (S7-1 ); (1-21) + (S11-1); (1-21 ) + (S11-2); (1-21) + (S11-3); (1-21) + (S12-1); (1-21) + (S13-1); (1-21 ) + (S13-2); (I-
21) + (S13-3); (1-21 ) + (S13-4): (1-21) + (S13-5); (1-21) + (S13-6); (1-21) + (S13-7); (1-21) + (S13-8); (1-21) + (S13-9); (1-21 ) + (S14-1)
(I-22) + (S1-1); (I-22) + (S1-2); (I-22) + (S1-3); (I-22) + (S1-4); (I-22) + (S1-5); (I-
22) + (S1-6); (I-22) + (S1-7); (I-22) + (S1-8); (I-22) + (S1-9); (I-22) + (S1-10); (I-22) + (S1-11 ); (I-22) + (S1-12); (I-22) + (S1-13); (I-22) + (S2-1); (I-22) + (S2-2); (I-22) + (S2-3); (I-22) + (S2-4); (I-22) + (S2-5); (I-22) + (S2-6); (I-22) + (S2-7); (I-22) + (S2- 8); (I-22) + (S2-9); (I-22) + (S2-10); (I-22) + (S3-1); (I-22) + (S3-2); (I-22) + (S3-3);
(1-22) + (S3-4); (1-22) + (S3-5); (1-22) + (S3-6); (1-22) + (S3-7); (1-22) + (S3-8); (I- 22) + (S3-9); (1-22) + (S3-10); (I-22) + (S3-11); (I-22) + (S4-1); (I-22) + (S4-2); (I- 22) + (S4-3); (I-22) + (S4-4); (I-22) + (S4-5); (I-22) + (S7-1); (I-22) + (S11-1 ); (I-22) + (S11-2); (I-22) + (S11-3); (I-22) + (S12-1); (I-22) + (S13-1); (I-22) + (S13-2); (I-
22) + (S13-3); (I-22) + (S13-4): (I-22) + (S13-5); (I-22) + (S13-6); (I-22) + (S13-7); (I-22) + (S13-8); (I-22) + (S13-9); (I-22) + (S14-1)
(I-23) + (S1-1); (I-23) + (S1-2); (I-23) + (S1-3); (I-23) + (S1-4); (I-23) + (S1-5); (I-
23) + (S1-6); (I-23) + (S1-7); (I-23) + (S1-8); (I-23) + (S1-9); (I-23) + (S1-10); (I-23) + (S1-11 ); (I-23) + (S1-12); (I-23) + (S1-13); (I-23) + (S2-1); (I-23) + (S2-2); (I-23) + (S2-3); (I-23) + (S2-4); (I-23) + (S2-5); (I-23) + (S2-6); (I-23) + (S2-7); (I-23) + (S2- 8); (I-23) + (S2-9); (I-23) + (S2-10); (I-23) + (S3-1); (I-23) + (S3-2); (I-23) + (S3-3); (I-23) + (S3-4); (I-23) + (S3-5); (I-23) + (S3-6); (I-23) + (S3-7); (I-23) + (S3-8); (I- 23) + (S3-9); (I-23) + (S3-10); (I-23) + (S3-11); (I-23) + (S4-1); (I-23) + (S4-2); (I- 23) + (S4-3); (I-23) + (S4-4); (I-23) + (S4-5); (I-23) + (S7-1); (I-23) + (S11-1); (I-23) + (S11-2); (I-23) + (S11-3); (I-23) + (S12-1); (I-23) + (S13-1); (I-23) + (S13-2); (I-
23) + (S13-3); (I-23) + (S13-4): (I-23) + (S13-5); (I-23) + (S13-6); (I-23) + (S13-7); (I-23) + (S13-8); (I-23) + (S13-9); (I-23) + (S14-1)
(I-24) + (S1-1); (I-24) + (S1-2); (I-24) + (S1-3); (I-24) + (S1-4); (I-24) + (S1-5); (I-
24) + (S1-6); (I-24) + (S1-7); (I-24) + (S1-8); (I-24) + (S1-9); (I-24) + (S1-10); (I-24) + (S1-11); (I-24) + (S1-12); (I-24) + (S1-13); (I-24) + (S2-1); (I-24) + (S2-2); (I-24) + (S2-3); (I-24) + (S2-4); (I-24) + (S2-5); (I-24) + (S2-6); (I-24) + (S2-7); (I-24) + (S2- 8); (I-24) + (S2-9); (I-24) + (S2-10); (I-24) + (S3-1); (I-24) + (S3-2); (I-24) + (S3-3); (I-24) + (S3-4); (I-24) + (S3-5); (I-24) + (S3-6); (I-24) + (S3-7); (I-24) + (S3-8); (I- 24) + (S3-9); (I-24) + (S3-10); (I-24) + (S3-11); (I-24) + (S4-1 ); (I-24) + (S4-2); (I- 24) + (S4-3); (I-24) + (S4-4); (I-24) + (S4-5); (I-24) + (S7-1); (I-24) + (S11-1); (I-24) + (S11-2); (I-24) + (S11-3); (I-24) + (S12-1); (I-24) + (S13-1 ); (I-24) + (S13-2); (I-
24) + (S13-3); (I-24) + (S13-4): (I-24) + (S13-5); (I-24) + (S13-6); (I-24) + (S13-7); (I-24) + (S13-8); (I-24) + (S13-9); (I-24) + (S14-1)
(I-25) + (S1-1); (I-25) + (S1-2); (I-25) + (S1-3); (I-25) + (S1-4); (I-25) + (S1-5); (I-
25) + (S1-6); (I-25) + (S1-7); (I-25) + (S1-8); (I-25) + (S1-9); (I-25) + (S1-10); (I-25) + (S1-11); (I-25) + (S1-12); (I-25) + (S1-13); (I-25) + (S2-1 ); (I-25) + (S2-2); (I-25) + (S2-3); (I-25) + (S2-4); (I-25) + (S2-5); (I-25) + (S2-6); (I-25) + (S2-7); (I-25) + (S2-
8); (I-25) + (S2-9); (I-25) + (S2-10); (I-25) + (S3-1); (I-25) + (S3-2); (I-25) + (S3-3); (I-25) + (S3-4); (I-25) + (S3-5); (I-25) + (S3-6); (I-25) + (S3-7); (I-25) + (S3-8); (I- 25) + (S3-9); (I-25) + (S3-10); (I-25) + (S3-11); (I-25) + (S4-1); (I-25) + (S4-2); (I- 25) + (S4-3); (I-25) + (S4-4); (I-25) + (S4-5); (I-25) + (S7-1); (I-25) + (S11-1 ); (I-25) + (S11-2); (I-25) + (S11-3); (I-25) + (S12-1); (I-25) + (S13-1); (I-25) + (S13-2); (I-
25) + (S13-3); (I-25) + (S13-4): (I-25) + (S13-5); (I-25) + (S13-6); (I-25) + (S13-7); (I-25) + (S13-8); (I-25) + (S13-9); (I-25) + (S14-1 )
(I-26) + (S1-1); (I-26) + (S1-2); (I-26) + (S1-3); (I-26) + (S1-4); (I-26) + (S1-5); (I-
26) + (S1-6); (I-26) + (S1-7); (I-26) + (S1-8); (I-26) + (S1-9); (I-26) + (S1-10); (I-26) + (S1-11 ); (I-26) + (S1-12); (I-26) + (S1-13); (I-26) + (S2-1); (I-26) + (S2-2); (I-26) + (S2-3); (I-26) + (S2-4); (I-26) + (S2-5); (I-26) + (S2-6); (I-26) + (S2-7); (I-26) + (S2- 8); (I-26) + (S2-9); (I-26) + (S2-10); (I-26) + (S3-1); (I-26) + (S3-2); (I-26) + (S3-3); (I-26) + (S3-4); (I-26) + (S3-5); (I-26) + (S3-6); (I-26) + (S3-7); (I-26) + (S3-8); (I- 26) + (S3-9); (I-26) + (S3-10); (I-26) + (S3-11); (I-26) + (S4-1); (I-26) + (S4-2); (I- 26) + (S4-3); (I-26) + (S4-4); (I-26) + (S4-5); (I-26) + (S7-1); (I-26) + (S11-1); (I-26) + (S11-2); (I-26) + (S11-3); (I-26) + (S12-1); (I-26) + (S13-1 ); (I-26) + (S13-2); (I-
26) + (S13-3); (I-26) + (S13-4): (I-26) + (S13-5); (I-26) + (S13-6); (I-26) + (S13-7); (I-26) + (S13-8); (I-26) + (S13-9); (I-26) + (S14-1)
(I-27) + (S1-1); (I-27) + (S1-2); (I-27) + (S1-3); (I-27) + (S1-4); (I-27) + (S1-5); (I-
27) + (S1-6); (I-27) + (S1-7); (I-27) + (S1-8); (I-27) + (S1-9); (I-27) + (S1-10); (I-27) + (S1-11); (I-27) + (S1-12); (I-27) + (S1-13); (I-27) + (S2-1 ); (I-27) + (S2-2); (I-27) + (S2-3); (I-27) + (S2-4); (I-27) + (S2-5); (I-27) + (S2-6); (I-27) + (S2-7); (I-27) + (S2- 8); (I-27) + (S2-9); (I-27) + (S2-10); (I-27) + (S3-1 ); (I-27) + (S3-2); (I-27) + (S3-3); (I-27) + (S3-4); (I-27) + (S3-5); (I-27) + (S3-6); (I-27) + (S3-7); (I-27) + (S3-8); (I- 27) + (S3-9); (I-27) + (S3-10); (I-27) + (S3-11); (I-27) + (S4-1); (I-27) + (S4-2); (I- 27) + (S4-3); (I-27) + (S4-4); (I-27) + (S4-5); (I-27) + (S7-1); (I-27) + (S11-1 ); (I-27) + (S11-2); (I-27) + (S11-3); (I-27) + (S12-1); (I-27) + (S13-1 ); (I-27) + (S13-2); (I-
27) + (S13-3); (I-27) + (S13-4): (I-27) + (S13-5); (I-27) + (S13-6); (I-27) + (S13-7); (I-27) + (S13-8); (I-27) + (S13-9); (I-27) + (S14-1 )
(I-28) + (S1-1 ); (I-28) + (S1-2); (I-28) + (S1-3); (I-28) + (S1-4); (I-28) + (S1-5); (I-
28) + (S1-6); (I-28) + (S1-7); (I-28) + (S1-8); (I-28) + (S1-9); (I-28) + (S1-10); (I-28) + (S1-11); (I-28) + (S1-12); (I-28) + (S1-13); (I-28) + (S2-1 ); (I-28) + (S2-2); (I-28) +
(S2-3); (1-28) + (S2-4); (1-28) + (S2-5); (1-28) + (S2-6); (1-28) + (S2-7); (1-28) + (S2- 8); (1-28) + (S2-9); (1-28) + (S2-10); (I-28) + (S3-1); (I-28) + (S3-2); (I-28) + (S3-3); (I-28) + (S3-4); (I-28) + (S3-5); (I-28) + (S3-6); (I-28) + (S3-7); (I-28) + (S3-8); (I- 28) + (S3-9); (I-28) + (S3-10); (I-28) + (S3-11); (I-28) + (S4-1); (I-28) + (S4-2); (I- 28) + (S4-3); (I-28) + (S4-4); (I-28) + (S4-5); (I-28) + (S7-1 ); (I-28) + (S11-1); (I-28) + (S11-2); (I-28) + (S11-3); (I-28) + (S12-1); (I-28) + (S13-1 ); (I-28) + (S13-2); (I-
28) + (S13-3); (I-28) + (S13-4): (I-28) + (S13-5); (I-28) + (S13-6); (I-28) + (S13-7); (I-28) + (S13-8); (I-28) + (S13-9); (I-28) + (S14-1)
(I-29) + (S1-1 ); (I-29) + (S1-2); (I-29) + (S1-3); (I-29) + (S1-4); (I-29) + (S1-5); (I-
29) + (S1-6); (I-29) + (S1-7); (I-29) + (S1-8); (I-29) + (S1-9); (I-29) + (S1-10); (I-29) + (S1-11); (I-29) + (S1-12); (I-29) + (S1-13); (I-29) + (S2-1); (I-29) + (S2-2); (I-29) + (S2-3); (I-29) + (S2-4); (I-29) + (S2-5); (I-29) + (S2-6); (I-29) + (S2-7); (I-29) + (S2- 8); (I-29) + (S2-9); (I-29) + (S2-10); (I-29) + (S3-1 ); (I-29) + (S3-2); (I-29) + (S3-3); (I-29) + (S3-4); (I-29) + (S3-5); (I-29) + (S3-6); (I-29) + (S3-7); (I-29) + (S3-8); (I- 29) + (S3-9); (I-29) + (S3-10); (I-29) + (S3-11); (I-29) + (S4-1); (I-29) + (S4-2); (I- 29) + (S4-3); (I-29) + (S4-4); (I-29) + (S4-5); (I-29) + (S7-1); (I-29) + (S11-1); (I-29) + (S11-2); (I-29) + (S11-3); (I-29) + (S12-1); (I-29) + (S13-1); (I-29) + (S13-2); (I-
29) + (S13-3); (I-29) + (S13-4): (I-29) + (S13-5); (I-29) + (S13-6); (I-29) + (S13-7); (I-29) + (S13-8); (I-29) + (S13-9); (I-29) + (S14-1)
(I-30) + (S1-1); (I-30) + (S1-2); (I-30) + (S1-3); (I-30) + (S1-4); (I-30) + (S1-5); (I-
30) + (S1-6); (I-30) + (S1-7); (I-30) + (S1-8); (I-30) + (S1-9); (I-30) + (S1-10); (I-30) + (S1-11 ); (I-30) + (S1-12); (I-30) + (S1-13); (I-30) + (S2-1); (I-30) + (S2-2); (I-30) + (S2-3); (I-30) + (S2-4); (I-30) + (S2-5); (I-30) + (S2-6); (I-30) + (S2-7); (I-30) + (S2- 8); (I-30) + (S2-9); (I-30) + (S2-10); (I-30) + (S3-1); (I-30) + (S3-2); (I-30) + (S3-3); (I-30) + (S3-4); (I-30) + (S3-5); (I-30) + (S3-6); (I-30) + (S3-7); (I-30) + (S3-8); (I- 30) + (S3-9); (I-30) + (S3-10); (I-30) + (S3-11); (I-30) + (S4-1 ); (I-30) + (S4-2); (I- 30) + (S4-3); (I-30) + (S4-4); (I-30) + (S4-5); (I-30) + (S7-1); (I-30) + (S11-1); (I-30) + (S11-2); (I-30) + (S11-3); (I-30) + (S12-1); (I-30) + (S13-1 ); (I-30) + (S13-2); (I-
30) + (S13-3); (I-30) + (S13-4): (I-30) + (S13-5); (I-30) + (S13-6); (I-30) + (S13-7); (I-30) + (S13-8); ([-3O) + (S13-9); (I-30) + (S14-1)
(1-31) + (S1-1); (1-31) + (S1-2); (1-31) + (S1-3); (1-31 ) + (S1-4); (1-31) + (S1-5); (I-
31 ) + (S1-6); (1-31) + (S1-7); (1-31 ) + (S1-8); (1-31) + (S1-9); (1-31) + (S1-10); (1-31)
+ (S1-11); (1-31 ) + (S1-12); (1-31 ) + (S1-13); (1-31) + (S2-1); (1-31) + (S2-2); (1-31 ) + (S2-3); (1-31) + (S2-4); (1-31) + (S2-5); (1-31) + (S2-6); (1-31 ) + (S2-7); (1-31) + (S2- 8); (1-31 ) + (S2-9); (1-31) + (S2-10); (1-31) + (S3-1); (1-31) + (S3-2); (1-31 ) + (S3-3); (1-31 ) + (S3-4); (1-31) + (S3-5); (1-31) + (S3-6); (1-31) + (S3-7); (1-31) + (S3-8); (I- 31) + (S3-9); (1-31) + (S3-10); (1-31) + (S3-11); (1-31 ) + (S4-1); (1-31 ) + (S4-2); (I- 31) + (S4-3); (1-31) + (S4-4); (1-31) + (S4-5); (1-31) + (S7-1); (1-31) + (S11-1); (1-31) + (S11-2); (1-31 ) + (S11-3); (1-31 ) + (S12-1); (1-31 ) + (S13-1 ); (1-31) + (S13-2); (I-
31) + (S13-3); (1-31) + (S13-4): (1-31 ) + (S13-5); (1-31) + (S13-6); (1-31) + (S13-7); (1-31) + (S13-8); (1-31 ) + (S13-9); (1-31) + (S14-1 )
(I-32) + (S1-1); (I-32) + (S1-2); (I-32) + (S1-3); (I-32) + (S1-4); (I-32) + (S1-5); (I-
32) + (S1-6); (I-32) + (S1-7); (I-32) + (S1-8); (I-32) + (S1-9); (I-32) + (S1-10); (I-32) + (S1-11 ); (I-32) + (S1-12); (I-32) + (S1-13); (I-32) + (S2-1); (I-32) + (S2-2); (I-32) + (S2-3); (I-32) + (S2-4); (I-32) + (S2-5); (I-32) + (S2-6); (I-32) + (S2-7); (I-32) + (S2- 8); (I-32) + (S2-9); (I-32) + (S2-10); (I-32) + (S3-1); (I-32) + (S3-2); (I-32) + (S3-3); (I-32) + (S3-4); (I-32) + (S3-5); (I-32) + (S3-6); (I-32) + (S3-7); (I-32) + (S3-8); (I- 32) + (S3-9); (I-32) + (S3-10); (I-32) + (S3-1 1); (I-32) + (S4-1); (I-32) + (S4-2); (I- 32) + (S4-3); (I-32) + (S4-4); (I-32) + (S4-5); (I-32) + (S7-1 ); (I-32) + (S11-1); (I-32) + (S11-2); (I-32) + (S11-3); (I-32) + (S12-1); (I-32) + (S13-1); (I-32) + (S13-2); (I-
32) + (S13-3); (I-32) + (S13-4): (I-32) + (S13-5); (I-32) + (S13-6); (I-32) + (S13-7); (I-32) + (S13-8); (I-32) + (S13-9); (I-32) + (S14-1 )
(I-33) + (S1-1 ); (I-33) + (S1-2); (I-33) + (S1-3); (I-33) + (S1-4); (I-33) + (S1-5); (I-
33) + (S1-6); (I-33) + (S1-7); (I-33) + (S1-8); (I-33) + (S1-9); (I-33) + (S1-10); (I-33) + (S1-11 ); (I-33) + (S1-12); (I-33) + (S1-13); (I-33) + (S2-1); (I-33) + (S2-2); (I-33) + (S2-3); (I-33) + (S2-4); (I-33) + (S2-5); (I-33) + (S2-6); (I-33) + (S2-7); (I-33) + (S2- 8); (I-33) + (S2-9); (I-33) + (S2-10); (I-33) + (S3-1); (I-33) + (S3-2); (I-33) + (S3-3); (I-33) + (S3-4); (I-33) + (S3-5); (I-33) + (S3-6); (I-33) + (S3-7); (I-33) + (S3-8); (I- 33) + (S3-9); (I-33) + (S3-10); (I-33) + (S3-11); (I-33) + (S4-1); (I-33) + (S4-2); (I- 33) + (S4-3); (I-33) + (S4-4); (I-33) + (S4-5); (I-33) + (S7-1 ); (I-33) + (S11-1); (I-33) + (S11-2); (I-33) + (S11-3); (I-33) + (S12-1 ); (I-33) + (S13-1); (I-33) + (S13-2); (I- 33) + (S13-3); (I-33) + (S13-4): (I-33) + (S13-5); (I-33) + (S13-6); (I-33) + (S13-7); (I-33) + (S13-8); (I-33) + (S13-9); (I-33) + (S14-1)
(I-34) + (S1-1); (I-34) + (S1-2); (I-34) + (S1 -3); (I-34) + (S1-4); (I-34) + (S1-5); (I-
34) + (S1-6); (I-34) + (S1-7); (I-34) + (S1-8); (I-34) + (S1-9); (I-34) + (S1-10); (I-34) + (S1-11); (I-34) + (S1-12); (I-34) + (S1-13); (I-34) + (S2-1); (I-34) + (S2-2); (I-34) + (S2-3); (I-34) + (S2-4); (I-34) + (S2-5); (I-34) + (S2-6); (I-34) + (S2-7); (I-34) + (S2- 8); (|-34) + (S2-9); (I-34) + (S2-10); (I-34) + (S3-1); (I-34) + (S3-2); (I-34) + (S3-3); (I-34) + (S3-4); (I-34) + (S3-5); (I-34) + (S3-6); (I-34) + (S3-7); (I-34) + (S3-8); (I- 34) + (S3-9); (I-34) + (S3-10); (I-34) + (S3-11); (I-34) + (S4-1); (I-34) + (S4-2); (I- 34) + (S4-3); (I-34) + (S4-4); (I-34) + (S4-5); (I-34) + (S7-1 ); (I-34) + (S11-1 ); (I-34) + (S11-2); (I-34) + (S11-3); (I-34) + (S12-1 ); (I-34) + (S13-1); (I-34) + (S13-2); (I-
34) + (S13-3); (I-34) + (S13-4): (I-34) + (S13-5); (I-34) + (S13-6); (I-34) + (S13-7); (I-34) + (S13-8); (I-34) + (S13-9); (I-34) + (S14-1 )
(I-35) + (S1-1); (I-35) + (S1-2); (I-35) + (S1-3); (I-35) + (S1-4); (I-35) + (S1-5); (I-
35) + (S1-6); (I-35) + (S1-7); (I-35) + (S1-8); (I-35) + (S1-9); (I-35) + (S1-10); (I-35) + (S1-11); (I-35) + (S1-12); (I-35) + (S1-13); (I-35) + (S2-1 ); (I-35) + (S2-2); (I-35) + (S2-3); (I-35) + (S2-4); (I-35) + (S2-5); (I-35) + (S2-6); (I-35) + (S2-7); (I-35) + (S2- 8); (I-35) + (S2-9); (I-35) + (S2-10); (I-35) + (S3-1); (I-35) + (S3-2); (I-35) + (S3-3); (I-35) + (S3-4); (I-35) + (S3-5); (I-35) + (S3-6); (I-35) + (S3-7); (I-35) + (S3-8); (I- 35) + (S3-9); (I-35) + (S3-10); (I-35) + (S3-11); (I-35) + (S4-1); (I-35) + (S4-2); (I- 35) + (S4-3); (I-35) + (S4-4); (I-35) + (S4-5); (I-35) + (S7-1 ); (I-35) + (S11-1); (I-35) + (S11-2); (I-35) + (S11-3); (I-35) + (S12-1); (I-35) + (S13-1); (I-35) + (S13-2); (I-
35) + (S13-3); (I-35) + (S13-4): (I-35) + (S13-5); (I-35) + (S13-6); (I-35) + (S13-7); (I-35) + (S13-8); (I-35) + (S13-9); (I-35) + (S14-1 )
(I-36) + (S1-1); (I-36) + (S1-2); (I-36) + (S1-3); (I-36) + (S1-4); (I-36) + (S1-5); (I-
36) + (S1-6); (I-36) + (S1-7); (I-36) + (S1-8); (I-36) + (S1-9); (I-36) + (S1-10); (I-36) + (S1-11); (I-36) + (S1-12); (I-36) + (S1-13); (I-36) + (S2-1); (I-36) + (S2-2); (I-36) + (S2-3); (I-36) + (S2-4); (I-36) + (S2-5); (I-36) + (S2-6); (I-36) + (S2-7); (I-36) + (S2- 8); (I-36) + (S2-9); (I-36) + (S2-10); (I-36) + (S3-1 ); (I-36) + (S3-2); (I-36) + (S3-3); (I-36) + (S3-4); (I-36) + (S3-5); (I-36) + (S3-6); (I-36) + (S3-7); (I-36) + (S3-8); (I- 36) + (S3-9); (I-36) + (S3-10); (I-36) + (S3-11); (I-36) + (S4-1 ); (I-36) + (S4-2); (I- 36) + (S4-3); (I-36) + (S4-4); (I-36) + (S4-5); (I-36) + (S7-1 ); (I-36) + (S11-1); (I-36) + (S11-2); (I-36) + (S11-3); (I-36) + (S12-1); (I-36) + (S13-1); (I-36) + (S13-2); (I- 36) + (S13-3); (I-36) + (S13-4): (I-36) + (S13-5); (I-36) + (S13-6); (I-36) + (S13-7); (I-36) + (S13-8); (I-36) + (S13-9); (I-36) + (S14-1 )
(1-37) + (SM); (1-37) + (S1-2); (I-37) + (S1-3); (I-37) + (S1-4); (I-37) + (S1-5); (I- 37) + (S1-6); (I-37) + (S1-7); (I-37) + (S1-8); (I-37) + (S1-9); (I-37) + (SMO); (I-37) + (SM 1); (I-37) + (S1-12); (I-37) + (SM3); (I-37) + (S2-1); (I-37) + (S2-2); (I-37) + (S2-3); (I-37) + (S2-4); (I-37) + (S2-5); (I-37) + (S2-6); (I-37) + (S2-7); (I-37) + (S2- 8); (I-37) + (S2-9); (I-37) + (S2-10); (I-37) + (S3-1); (I-37) + (S3-2); (I-37) + (S3-3); (I-37) + (S3-4); (I-37) + (S3-5); (I-37) + (S3-6); (I-37) + (S3-7); (I-37) + (S3-8); (I- 37) + (S3-9); (I-37) + (S3-10); (I-37) + (S3-11); (I-37) + (S4-1); (I-37) + (S4-2); (I- 37) + (S4-3); (I-37) + (S4-4); (I-37) + (S4-5); (I-37) + (S7-1); (I-37) + (S11-1); (I-37) + (S11-2); (I-37) + (S11-3); (I-37) + (S12-1); (I-37) + (S13-1); (I-37) + (S13-2); (I-
37) + (S13-3); (I-37) + (S13-4): (I-37) + (S13-5); (I-37) + (S13-6); (I-37) + (S13-7); (I-37) + (S13-8); (I-37) + (S13-9); (I-37) + (S14-1)
(I-38) + (SM); (I-38) + (S1-2); (I-38) + (S1-3); (I-38) + (S1-4); (I-38) + (S1-5); (I-
38) + (S1-6); (I-38) + (S1-7); (I-38) + (S1-8); (I-38) + (S1-9); (I-38) + (SMO); (I-38) + (SM 1); (I-38) + (SM 2); (I-38) + (SM 3); (I-38) + (S2-1); (I-38) + (S2-2); (I-38) + (S2-3); (I-38) + (S2-4); (I-38) + (S2-5); (I-38) + (S2-6); (I-38) + (S2-7); (I-38) + (S2- 8); (I-38) + (S2-9); (I-38) + (S2-10); (I-38) + (S3-1); (I-38) + (S3-2); (I-38) + (S3-3); (I-38) + (S3-4); (I-38) + (S3-5); (I-38) + (S3-6); (I-38) + (S3-7); (I-38) + (S3-8); (I- 38) + (S3-9); (I-38) + (S3-10); (I-38) + (S3-11); (I-38) + (S4-1); (I-38) + (S4-2); (I- 38) + (S4-3); (I-38) + (S4-4); (I-38) + (S4-5); (I-38) + (S7-1); (I-38) + (S11-1); (I-38) + (S11-2); (I-38) + (S11-3); (I-38) + (S12-1); (I-38) + (S13-1); (I-38) + (S13-2); (I-
38) + (S13-3); (I-38) + (S13-4): (I-38) + (S13-5); (I-38) + (S13-6); (I-38) + (S13-7); (I-38) + (S13-8); (I-38) + (S13-9); (I-38) + (S14-1)
(I-39) + (SM); (I-39) + (S1-2); (I-39) + (S1-3); (I-39) + (S1-4); (I-39) + (S1-5); (I-
39) + (S1-6); (I-39) + (S1-7); (I-39) + (S1-8); (I-39) + (S1-9); (I-39) + (SMO); (I-39) + (S1-11); (I-39) + (SM 2); (I-39) + (SM 3); (I-39) + (S2-1); (I-39) + (S2-2); (I-39) + (S2-3); (I-39) + (S2-4); (I-39) + (S2-5); (I-39) + (S2-6); (I-39) + (S2-7); (I-39) + (S2- 8); (I-39) + (S2-9); (I-39) + (S2-10); (I-39) + (S3-1); (I-39) + (S3-2); (I-39) + (S3-3); (I-39) + (S3-4); (I-39) + (S3-5); (I-39) + (S3-6); (I-39) + (S3-7); (I-39) + (S3-8); (I- 39) + (S3-9); (I-39) + (S3-10); (I-39) + (S3-11); (I-39) + (S4-1); (I-39) + (S4-2); (I- 39) + (S4-3); (I-39) + (S4-4); (I-39) + (S4-5); (I-39) + (S7-1); (I-39) + (S1 M); (I-39) + (S11-2); (I-39) + (S11-3); (I-39) + (S12-1); (I-39) + (S13-1); (I-39) + (S13-2); (I- 39) + (S13-3); (I-39) + (S13-4): (I-39) + (S13-5); (I-39) + (S13-6); (I-39) + (S13-7);
(1-39) + (S13-8); (I-39) + (S13-9); (I-39) + (S14-1)
(I-40) + (SM); (I-40) + (S1-2); (I-40) + (S1-3); (I-40) + (S1-4); (I-40) + (S1-5); (I- 40) + (S1-6); (I-40) + (S1-7); (I-40) + (S1-8); (I-40) + (S1-9); (I-40) + (S1-10); (I-40) + (S1-11 ); (I-40) + (S1-12); (I-40) + (S1-13); (I-40) + (S2-1); (I-40) + (S2-2); (I-40) + (S2-3); (I-40) + (S2-4); (I-40) + (S2-5); (I-40) + (S2-6); (I-40) + (S2-7); (I-40) + (S2- 8); (I-40) + (S2-9); (I-40) + (S2-10); (I-40) + (S3-1); (I-40) + (S3-2); (I-40) + (S3-3); (I-40) + (S3-4); (I-40) + (S3-5); (I-40) + (S3-6); (I-40) + (S3-7); (I-40) + (S3-8); (I- 40) + (S3-9); (I-40) + (S3-10); (I-40) + (S3-11); (I-40) + (S4-1 ); (I-40) + (S4-2); (I- 40) + (S4-3); (I-40) + (S4-4); (I-40) + (S4-5); (I-40) + (S7-1); (I-40) + (S11-1); (I-40) + (S11-2); (I-40) + (S11-3); (I-40) + (S12-1 ); (I-40) + (S13-1 ); (I-40) + (S13-2); (I-
40) + (S13-3); (I-40) + (S13-4): (I-40) + (S13-5); (I-40) + (S13-6); (I-40) + (S13-7); (I-40) + (S13-8); (I-40) + (S13-9); (I-40) + (S14-1)
(1-41) + (S1-1); (1-41) + (S1-2); (1-41) + (S1-3); (1-41) + (S1-4); (1-41) + (S1-5); (I-
41) + (S1-6); (1-41 ) + (S1-7); (1-41 ) + (S1-8); (1-41) + (S1-9); (1-41) + (S1-10); (1-41) + (S1-11 ); (1-41 ) + (S1-12); (1-41) + (S1-13); (1-41) + (S2-1); (1-41) + (S2-2); (1-41) + (S2-3); (1-41) + (S2-4); (1-41 ) + (S2-5); (1-41 ) + (S2-6); (1-41 ) + (S2-7); (1-41) + (S2- 8); (1-41) + (S2-9); (1-41 ) + (S2-10); (1-41) + (S3-1); (1-41) + (S3-2); (1-41) + (S3-3); (1-41) + (S3-4); (1-41) + (S3-5); (1-41) + (S3-6); (1-41) + (S3-7); (1-41) + (S3-8); (I- 41 ) + (S3-9); (1-41) + (S3-10); (1-41) + (S3-11); (1-41) + (S4-1); (1-41) + (S4-2); (I- 41 ) + (S4-3); (1-41) + (S4-4); (1-41 ) + (S4-5); (1-41) + (S7-1); (1-41) + (S11-1); (1-41) + (S11-2); (1-41 ) + (S11-3); (1-41 ) + (S12-1); (1-41) + (S13-1 ); (1-41) + (S13-2); (I-
41 ) + (S13-3); (1-41) + (S13-4): (1-41) + (S13-5); (1-41 ) + (S13-6); (1-41 ) + (S13-7); (1-41 ) + (S13-8); (1-41) + (S13-9); (1-41) + (S14-1 )
(I-42) + (S1-1); (I-42) + (S1-2); (I-42) + (S1-3); (I-42) + (S1-4); (I-42) + (S1-5); (I-
42) + (S1-6); (I-42) + (S1-7); (I-42) + (S1-8); (I-42) + (S1-9); (I-42) + (S1-10); (I-42) + (S1-11 ); (I-42) + (S1-12); (I-42) + (S1-13); (I-42) + (S2-1); (I-42) + (S2-2); (I-42) + (S2-3); (I-42) + (S2-4); (I-42) + (S2-5); (I-42) + (S2-6); (I-42) + (S2-7); (I-42) + (S2- 8); (I-42) + (S2-9); (I-42) + (S2-10); (I-42) + (S3-1); (I-42) + (S3-2); (I-42) + (S3-3); (I-42) + (S3-4); (I-42) + (S3-5); (I-42) + (S3-6); (I-42) + (S3-7); (I-42) + (S3-8); (I- 42) + (S3-9); (I-42) + (S3-10); (I-42) + (S3-11); (I-42) + (S4-1); (I-42) + (S4-2); (I- 42) + (S4-3); (I-42) + (S4-4); (I-42) + (S4-5); (I-42) + (S7-1 ); (I-42) + (S11-1 ); (I-42) + (S11-2); (I-42) + (S11-3); (I-42) + (S12-1); (I-42) + (S13-1); (I-42) + (S13-2); (I-
42) + (S13-3); (I-42) + (S13-4): (I-42) + (S13-5); (I-42) + (S13-6); (I-42) + (S13-7); (I-42) + (S13-8); (I-42) + (S13-9); (I-42) + (S14-1 )
(I-43) + (S1-1); (I-43) + (S1-2); (I-43) + (S1-3); (I-43) + (S1-4); (I-43) + (S1-5); (I-
43) + (S1-6); (I-43) + (S1-7); (I-43) + (S1-8); (I-43) + (S1-9); (I-43) + (S1-10); (I-43) + (S1-11 ); (I-43) + (S1-12); (I-43) + (S1-13); (I-43) + (S2-1); (I-43) + (S2-2); (I-43) + (S2-3); (I-43) + (S2-4); (I-43) + (S2-5); (I-43) + (S2-6); (I-43) + (S2-7); (I-43) + (S2- 8); (I-43) + (S2-9); (I-43) + (S2-10); (I-43) + (S3-1); (I-43) + (S3-2); (I-43) + (S3-3); (I-43) + (S3-4); (I-43) + (S3-5); (I-43) + (S3-6); (I-43) + (S3-7); (I-43) + (S3-8); (I- 43) + (S3-9); (I-43) + (S3-10); (I-43) + (S3-11); (I-43) + (S4-1); (I-43) + (S4-2); (I- 43) + (S4-3); (I-43) + (S4-4); (I-43) + (S4-5); (I-43) + (S7-1 ); (I-43) + (S11-1 ); (I-43) + (S11-2); (I-43) + (S11-3); (I-43) + (S12-1); (I-43) + (S13-1); (I-43) + (S13-2); (I-
43) + (S13-3); (I-43) + (S13-4): (I-43) + (S13-5); (I-43) + (S13-6); (I-43) + (S13-7); (I-43) + (S13-8); (I-43) + (S13-9); (I-43) + (S14-1)
(I-44) + (S1-1); (I-44) + (S1-2); (I-44) + (S1-3); (I-44) + (S1-4); (I-44) + (S1-5); (I-
44) + (S1-6); (I-44) + (S1-7); (I-44) + (S1-8); (I-44) + (S1-9); (I-44) + (S1-10); (I-44) + (S1-11 ); (I-44) + (S1-12); (I-44) + (S1-13); (I-44) + (S2-1); (I-44) + (S2-2); (I-44) + (S2-3); (I-44) + (S2-4); (I-44) + (S2-5); (I-44) + (S2-6); (I-44) + (S2-7); (I-44) + (S2- 8); (I-44) + (S2-9); (I-44) + (S2-10); (I-44) + (S3-1); (I-44) + (S3-2); (I-44) + (S3-3); (I-44) + (S3-4); (I-44) + (S3-5); (I-44) + (S3-6); (I-44) + (S3-7); (I-44) + (S3-8); (I- 44) + (S3-9); (I-44) + (S3-10); (I-44) + (S3-11); (I-44) + (S4-1 ); (I-44) + (S4-2); (I- 44) + (S4-3); (I-44) + (S4-4); (I-44) + (S4-5); (I-44) + (S7-1); (I-44) + (S1 1-1 ); (I-44) + (S11-2); (I-44) + (S11-3); (I-44) + (S12-1); (I-44) + (S13-1 ); (I-44) + (S13-2); (I-
44) + (S13-3); (i-44) + (S13-4): (I-44) + (S13-5); (I-44) + (S13-6); (I-44) + (S13-7); (I-44) + (S13-8); (I-44) + (S13-9); (I-44) + (S14-1)
(I-45) + (S1-1); (I-45) + (S1-2); (I-45) + (S1-3); (I-45) + (S1-4); (I-45) + (S1-5); (I-
45) + (S1-6); (I-45) + (S1-7); (I-45) + (S1-8); (I-45) + (S1-9); (I-45) + (S1-10); (I-45) + (S1-11 ); (I-45) + (S1-12); (I-45) + (S1-13); (I-45) + (S2-1); (I-45) + (S2-2); (I-45) + (S2-3); (I-45) + (S2-4); (I-45) + (S2-5); (I-45) + (S2-6); (I-45) + (S2-7); (I-45) + (S2- 8); (I-45) + (S2-9); (I-45) + (S2-10); (I-45) + (S3-1); (I-45) + (S3-2); (I-45) + (S3-3); (I-45) + (S3-4); (I-45) + (S3-5); (I-45) + (S3-6); (I-45) + (S3-7); (I-45) + (S3-8); (I- 45) + (S3-9); (I-45) + (S3-10); (I-45) + (S3-11); (I-45) + (S4-1); (I-45) + (S4-2); (I- 45) + (S4-3); (I-45) + (S4-4); (I-45) + (S4-5); (I-45) + (S7-1); (I-45) + (S11-1); (I-45)
+ (S11-2); (I-45) + (S11-3); (I-45) + (S12-1); (I-45) + (S13-1 ); (I-45) + (S13-2); (I-
45) + (S13-3); (I-45) + (S13-4): (I-45) + (S13-5); (I-45) + (S13-6); (I-45) + (S13-7); (I-45) + (S13-8); (I-45) + (S13-9); (I-45) + (S14-1)
(I-46) + (S1-1); (I-46) + (S1-2); (I-46) + (S1-3); (I-46) + (S1-4); (I-46) + (S1-5); (I-
46) + (S1-6); (I-46) + (S1-7); (I-46) + (S1-8); (I-46) + (S1-9); (I-46) + (S1-10); (I-46) + (S1-11); (I-46) + (S1-12); (I-46) + (S1-13); (I-46) + (S2-1 ); (I-46) + (S2-2); (I-46) + (S2-3); (I-46) + (S2-4); (I-46) + (S2-5); (I-46) + (S2-6); (I-46) + (S2-7); (I-46) + (S2- 8); (I-46) + (S2-9); (I-46) + (S2-10); (I-46) + (S3-1); (I-46) + (S3-2); (I-46) + (S3-3); (I-46) + (S3-4); (I-46) + (S3-5); (I-46) + (S3-6); (I-46) + (S3-7); (I-46) + (S3-8); (I- 46) + (S3-9); (I-46) + (S3-10); (I-46) + (S3-11); (I-46) + (S4-1); (I-46) + (S4-2); (I- 46) + (S4-3); (I-46) + (S4-4); (I-46) + (S4-5); (I-46) + (S7-1); (I-46) + (S11-1 ); (I-46) + (S11-2); (I-46) + (S11-3); (I-46) + (S12-1); (I-46) + (S13-1 ); (I-46) + (S13-2); (I-
46) + (S13-3); (I-46) + (S13-4): (I-46) + (S13-5); (I-46) + (S13-6); (I-46) + (S13-7); (I-46) + (S13-8); (I-46) + (S13-9); (I-46) + (S14-1)
(I-47) + (S1-1); (I-47) + (S1-2); (I-47) + (S1-3); (I-47) + (S1-4); (I-47) + (S1-5); (I-
47) + (S1-6); (I-47) + (S1-7); (I-47) + (S1-8); (I-47) + (S1-9); (I-47) + (S1-10); (I-47) + (S1-11 ); (I-47) + (S1-12); (I-47) + (S1-13); (I-47) + (S2-1); (I-47) + (S2-2); (I-47) + (S2-3); (I-47) + (S2-4); (I-47) + (S2-5); (I-47) + (S2-6); (I-47) + (S2-7); (I-47) + (S2- 8); (I-47) + (S2-9); (I-47) + (S2-10); (I-47) + (S3-1); (I-47) + (S3-2); (I-47) + (S3-3); (I-47) + (S3-4); (I-47) + (S3-5); (I-47) + (S3-6); (I-47) + (S3-7); (I-47) + (S3-8); (I- 47) + (S3-9); (I-47) + (S3-10); (I-47) + (S3-11); (I-47) + (S4-1); (I-47) + (S4-2); (I- 47) + (S4-3); (I-47) + (S4-4); (I-47) + (S4-5); (I-47) + (S7-1 ); (I-47) + (S1 1-1); (I-47) + (S11-2); (I-47) + (S11-3); (I-47) + (S12-1); (I-47) + (S13-1 ); (I-47) + (S13-2); (I-
47) + (S13-3); (I-47) + (S13-4): (I-47) + (S13-5); (I-47) + (S13-6); (I-47) + (S13-7); (I-47) + (S13-8); (I-47) + (S13-9); (I-47) + (S14-1)
(I-48) + (S1-1); (I-48) + (S1-2); (I-48) + (S1-3); (I-48) + (S1-4); (I-48) + (S1-5); (I-
48) + (S1-6); (I-48) + (S1-7); (I-48) + (S1-8); (I-48) + (S1-9); (I-48) + (S1-10); (I-48) + (S1-11); (I-48) + (S1-12); (I-48) + (S1-13); (I-48) + (S2-1); (I-48) + (S2-2); (I-48) + (S2-3); (I-48) + (S2-4); (I-48) + (S2-5); (I-48) + (S2-6); (I-48) + (S2-7); (I-48) + (S2- 8); (I-48) + (S2-9); (I-48) + (S2-10); (I-48) + (S3-1); (I-48) + (S3-2); (I-48) + (S3-3); (I-48) + (S3-4); (I-48) + (S3-5); (I-48) + (S3-6); (I-48) + (S3-7); (I-48) + (S3-8); (I- 48) + (S3-9); (I-48) + (S3-10); (I-48) + (S3-11); (I-48) + (S4-1); (I-48) + (S4-2); (I-
48) + (S4-3); (1-48) + (S4-4); (1-48) + (S4-5); (1-48) + (S7-1); (I-48) + (S11-1); (I-48) + (S11-2); (I-48) + (S11-3); (I-48) + (S12-1); (I-48) + (S13-1); (I-48) + (S13-2); (I-
48) + (S13-3); (I-48) + (S13-4): (I-48) + (S13-5); (I-48) + (S13-6); (I-48) + (S13-7); (I-48) + (S13-8); (I-48) + (S13-9); (I-48) + (S14-1)
(I-49) + (S1-1); (I-49) + (S1-2); (I-49) + (S1-3); (I-49) + (S1-4); (I-49) + (S1-5); (I-
49) + (S1-6); (I-49) + (S1-7); (I-49) + (S1-8); (I-49) + (S1-9); (I-49) + (S1-10); (I-49) + (S1-11); (I-49) + (S1-12); (I-49) + (S1-13); (I-49) + (S2-1); (I-49) + (S2-2); (I-49) + (S2-3); (I-49) + (S2-4); (I-49) + (S2-5); (I-49) + (S2-6); (I-49) + (S2-7); (I-49) + (S2- 8); (I-49) + (S2-9); (I-49) + (S2-10); (I-49) + (S3-1); (I-49) + (S3-2); (I-49) + (S3-3); (I-49) + (S3-4); (I-49) + (S3-5); (I-49) + (S3-6); (I-49) + (S3-7); (I-49) + (S3-8); (I- 49) + (S3-9); (I-49) + (S3-10); (I-49) + (S3-11); (I-49) + (S4-1); (I-49) + (S4-2); (I- 49) + (S4-3); (I-49) + (S4-4); (I-49) + (S4-5); (I-49) + (S7-1); (I-49) + (S11-1); (I-49) + (S11-2); (I-49) + (S11-3); (I-49) + (S12-1); (I-49) + (S13-1); (I-49) + (S13-2); (I-
49) + (S13-3); (I-49) + (S13-4): (I-49) + (S13-5); (I-49) + (S13-6); (I-49) + (S13-7); (I-49) + (S13-8); (I-49) + (S13-9); (I-49) + (S14-1)
(I-50) + (S1-1); (I-50) + (S1-2); (I-50) + (S1-3); (I-50) + (S1-4); (I-50) + (S1-5); (I-
50) + (S1-6); (I-50) + (S1-7); (I-50) + (S1-8); (I-50) + (S1-9); (I-50) + (S1-10); (I-50) + (S1-11); (I-50) + (S1-12); (I-50) + (S1-13); (I-50) + (S2-1); (I-50) + (S2-2); (I-50) + (S2-3); (I-50) + (S2-4); (I-50) + (S2-5); (I-50) + (S2-6); (I-50) + (S2-7); (I-50) + (S2- 8); (I-50) + (S2-9); (I-50) + (S2-10); (I-50) + (S3-1); (I-50) + (S3-2); (I-50) + (S3-3); (I-50) + (S3-4); (I-50) + (S3-5); (I-50) + (S3-6); (I-50) + (S3-7); (I-50) + (S3-8); (I- 50) + (S3-9); (I-50) + (S3-10); (I-50) + (S3-11); (I-50) + (S4-1); (I-50) + (S4-2); (I- 50) + (S4-3); (I-50) + (S4-4); (I-50) + (S4-5); (I-50) + (S7-1); (I-50) + (S11-1); (I-50) + (S11-2); (I-50) + (S11-3); (I-50) + (S12-1); (I-50) + (S13-1); (I-50) + (S13-2); (I-
50) + (S13-3); (I-50) + (S13-4): (I-50) + (S13-5); (I-50) + (S13-6); (I-50) + (S13-7); (I-50) + (S13-8); (I-50) + (S13-9); (I-50) + (S14-1)
(1-51) + (S1-1); (1-51) + (S1-2); (1-51) + (S1-3); (1-51) + (S1-4); (1-51) + (S1-5); (I-
51) + (S1-6); (1-51) + (S1-7); (1-51) + (S1-8); (1-51) + (S1-9); (1-51) + (S1-10); (1-51) + (S1-11); (1-51) + (S1-12); (1-51) + (S1-13); (1-51) + (S2-1); (1-51) + (S2-2); (1-51) + (S2-3); (1-51) + (S2-4); (1-51) + (S2-5); (1-51) + (S2-6); (1-51) + (S2-7); (1-51) + (S2- 8); (1-51) + (S2-9); (1-51) + (S2-10); (1-51) + (S3-1); (1-51) + (S3-2); (1-51) + (S3-3); (1-51) + (S3-4); (1-51) + (S3-5); (1-51) + (S3-6); (1-51) + (S3-7); (1-51) + (S3-8); (I-
51 ) + (S3-9); (1-51 ) + (S3-10); (1-51 ) + (S3-11); (1-51) + (S4-1 ); (1-51) + (S4-2); (I- 51 ) + (S4-3); (1-51 ) + (S4-4); (1-51) + (S4-5); (1-51) + (S7-1 ); (1-51 ) + (S11-1 ); (1-51) + (S11-2); (1-51) + (S11-3); (1-51) + (S12-1); (1-51 ) + (S13-1); (1-51 ) + (S13-2); (I-
51) + (S13-3); (1-51) + (S13-4): (1-51) + (S13-5); (1-51 ) + (S13-6); (1-51 ) + (S13-7); (1-51) + (S13-8); (1-51 ) + (S13-9); (1-51 ) + (S14-1)
(I-52) + (S1-1 ); (I-52) + (S1-2); (I-52) + (S1-3); (I-52) + (S1-4); (I-52) + (S1-5); (I-
52) + (S1-6); (I-52) + (S1-7); (I-52) + (S1-8); (I-52) + (S1-9); (I-52) + (S1-10); (I-52) + (S1-11); (I-52) + (S1-12); (I-52) + (S1-13); (I-52) + (S2-1 ); (I-52) + (S2-2); (I-52) + (S2-3); (I-52) + (S2-4); (I-52) + (S2-5); (I-52) + (S2-6); (I-52) + (S2-7); (I-52) + (S2- 8); (I-52) + (S2-9); (I-52) + (S2-10); (I-52) + (S3-1); (I-52) + (S3-2); (I-52) + (S3-3); (I-52) + (S3-4); (I-52) + (S3-5); (I-52) + (S3-6); (I-52) + (S3-7); (I-52) + (S3-8); (I- 52) + (S3-9); (I-52) + (S3-10); (I-52) + (S3-11); (I-52) + (S4-1); (I-52) + (S4-2); (I- 52) + (S4-3); (I-52) + (S4-4); (I-52) + (S4-5); (I-52) + (S7-1); (I-52) + (S11-1); (I-52) + (S11-2); (I-52) + (S11-3); (I-52) + (S12-1); (I-52) + (S13-1 ); (I-52) + (S13-2); (I-
52) + (S13-3); (I-52) + (S13-4): (I-52) + (S13-5); (I-52) + (S13-6); (I-52) + (S13-7); (I-52) + (S13-8); (I-52) + (S13-9); (I-52) + (S14-1 )
(I-53) + (S1-1 ); (I-53) + (S1-2); (I-53) + (S1-3); (I-53) + (S1-4); (I-53) + (S1-5); (I-
53) + (S1-6); (I-53) + (S1-7); (I-53) + (S1-8); (I-53) + (S1-9); (I-53) + (S1-10); (I-53) + (S1-11); (I-53) + (S1-12); (I-53) + (S1-13); (I-53) + (S2-1); (I-53) + (S2-2); (I-53) + (S2-3); (I-53) + (S2-4); (I-53) + (S2-5); (I-53) + (S2-6); (I-53) + (S2-7); (I-53) + (S2- 8); (I-53) + (S2-9); (I-53) + (S2-10); (I-53) + (S3-1); (I-53) + (S3-2); (I-53) + (S3-3); (I-53) + (S3-4); (I-53) + (S3-5); (I-53) + (S3-6); (I-53) + (S3-7); (I-53) + (S3-8); (I- 53) + (S3-9); (I-53) + (S3-10); (I-53) + (S3-11); (I-53) + (S4-1); (I-53) + (S4-2); (I- 53) + (S4-3); (I-53) + (S4-4); (I-53) + (S4-5); (I-53) + (S7-1); (I-53) + (S11-1); (I-53) + (S11-2); (I-53) + (S11-3); (I-53) + (S12-1); (I-53) + (S13-1); (I-53) + (S13-2); (I-
53) + (S13-3); (I-53) + (S13-4): (I-53) + (S13-5); (I-53) + (S13-6); (I-53) + (S13-7); (I-53) + (S13-8); (I-53) + (S13-9); (I-53) + (S14-1 )
(I-54) + (S1-1 ); (I-54) + (S1-2); (I-54) + (S1-3); (I-54) + (S1-4); (I-54) + (S1-5); (I-
54) + (S1-6); (I-54) + (S1-7); (I-54) + (S1-8); (I-54) + (S1-9); (I-54) + (S1-10); (I-54) + (S1-11 ); (I-54) + (S1-12); (I-54) + (S1-13); (I-54) + (S2-1); (I-54) + (S2-2); (I-54) + (S2-3); (I-54) + (S2-4); (I-54) + (S2-5); (I-54) + (S2-6); (I-54) + (S2-7); (I-54) + (S2- 8); (I-54) + (S2-9); (I-54) + (S2-10); (I-54) + (S3-1); (I-54) + (S3-2); (I-54) + (S3-3);
(I-54) + (S3-4); (I-54) + (S3-5); (I-54) + (S3-6); (I-54) + (S3-7); (I-54) + (S3-8); (I- 54) + (S3-9); (I-54) + (S3-10); (I-54) + (S3-11); (I-54) + (S4-1); (I-54) + (S4-2); (I- 54) + (S4-3); (I-54) + (S4-4); (I-54) + (S4-5); (I-54) + (S7-1); (I-54) + (S11-1 ); (I-54) + (S11-2); (I-54) + (S11-3); (I-54) + (S12-1); (I-54) + (S13-1 ); (I-54) + (S13-2); (I-
54) + (S13-3); (I-54) + (S13-4): (I-54) + (S13-5); (I-54) + (S13-6); (I-54) + (S13-7); (I-54) + (S13-8); (I-54) + (S13-9); (I-54) + (S14-1 )
(I-55) + (S1-1); (I-55) + (S1-2); (I-55) + (S1-3); (I-55) + (S1-4); (I-55) + (S1-5); (I-
55) + (S1-6); (I-55) + (S1-7); (I-55) + (S1-8); (I-55) + (S1-9); (I-55) + (S1-10); (I-55) + (S1-11); (I-55) + (S1-12); (I-55) + (S1-13); (I-55) + (S2-1); (I-55) + (S2-2); (I-55) + (S2-3); (I-55) + (S2-4); (I-55) + (S2-5); (I-55) + (S2-6); (I-55) + (S2-7); (I-55) + (S2- 8); (I-55) + (S2-9); (I-55) + (S2-10); (I-55) + (S3-1); (I-55) + (S3-2); (I-55) + (S3-3); (I-55) + (S3-4); (I-55) + (S3-5); (I-55) + (S3-6); (I-55) + (S3-7); (I-55) + (S3-8); (I- 55) + (S3-9); (I-55) + (S3-10); (I-55) + (S3-11); (I-55) + (S4-1); (I-55) + (S4-2); (I- 55) + (S4-3); (I-55) + (S4-4); (I-55) + (S4-5); (I-55) + (S7-1 ); (I-55) + (S11-1); (I-55) + (S11-2); (I-55) + (S11-3); (I-55) + (S12-1); (I-55) + (S13-1); (I-55) + (S13-2); (I-
55) + (S13-3); (I-55) + (S13-4): (I-55) + (S13-5); (I-55) + (S13-6); (I-55) + (S13-7); (I-55) + (S13-8); (I-55) + (S13-9); (I-55) + (S14-1)
(I-56) + (S1-1); (I-56) + (S1-2); (I-56) + (S1-3); (I-56) + (S1-4); (I-56) + (S1-5); (I-
56) + (S1-6); (I-56) + (S1-7); (I-56) + (S1-8); (I-56) + (S1-9); (I-56) + (S1-10); (I-56) + (S1-11 ); (I-56) + (S1-12); (I-56) + (S1-13); (I-56) + (S2-1); (I-56) + (S2-2); (I-56) + (S2-3); (I-56) + (S2-4); (I-56) + (S2-5); (I-56) + (S2-6); (I-56) + (S2-7); (I-56) + (S2- 8); (I-56) + (S2-9); (I-56) + (S2-10); (I-56) + (S3-1); (I-56) + (S3-2); (I-56) + (S3-3); (I-56) + (S3-4); (I-56) + (S3-5); (I-56) + (S3-6); (I-56) + (S3-7); (I-56) + (S3-8); (I- 56) + (S3-9); (I-56) + (S3-10); (I-56) + (S3-1 1); (I-56) + (S4-1 ); (I-56) + (S4-2); (I- 56) + (S4-3); (I-56) + (S4-4); (I-56) + (S4-5); (I-56) + (S7-1); (I-56) + (S11-1); (I-56) + (S11-2); (I-56) + (S11-3); (I-56) + (S12-1 ); (I-56) + (S13-1); (I-56) + (S13-2); (I-
56) + (S13-3); (I-56) + (S13-4): (I-56) + (S13-5); (I-56) + (S13-6); (I-56) + (S13-7); (I-56) + (S13-8); (I-56) + (S13-9); (I-56) + (S14-1)
(I-57) + (S1-1); (I-57) + (S1-2); (I-57) + (S1-3); (I-57) + (S1-4); (I-57) + (S1-5); (I-
57) + (S1-6); (I-57) + (S1-7); (I-57) + (S1-8); (I-57) + (S1-9); (I-57) + (S1-10); (I-57) + (S1-11); (I-57) + (S1-12); (I-57) + (S1-13); (I-57) + (S2-1); (I-57) + (S2-2); (I-57) + (S2-3); (I-57) + (S2-4); (I-57) + (S2-5); (I-57) + (S2-6); (I-57) + (S2-7); (I-57) + (S2-
8); (1-57) + (S2-9); (1-57) + (S2-10); (I-57) + (S3-1); (I-57) + (S3-2); (I-57) + (S3-3); (I-57) + (S3-4); (I-57) + (S3-5); (I-57) + (S3-6); (I-57) + (S3-7); (I-57) + (S3-8); (I- 57) + (S3-9); (I-57) + (S3-10); (I-57) + (S3-11); (I-57) + (S4-1 ); (I-57) + (S4-2); (I- 57) + (S4-3); (I-57) + (S4-4); (I-57) + (S4-5); (I-57) + (S7-1); (I-57) + (S11-1 ); (I-57) + (S11-2); (I-57) + (S11-3); (I-57) + (S12-1 ); (I-57) + (S13-1); (I-57) + (S13-2); (I-
57) + (S13-3); (I-57) + (S 13-4): (I-57) + (S13-5); (I-57) + (S13-6); (I-57) + (S13-7); (I-57) + (S13-8); (I-57) + (S13-9); (I-57) + (S14-1)
(I-58) + (S1-1); (I-58) + (S1-2); (I-58) + (S1-3); (I-58) + (S 1-4); (I-58) + (S1-5); (I-
58) + (S1-6); (I-58) + (S1-7); (I-58) + (S1-8); (I-58) + (S1-9); (I-58) + (S1-10); (I-58) + (S1-11 ); (I-58) + (S1-12); (I-58) + (S1-13); (I-58) + (S2-1); (I-58) + (S2-2); (I-58) + (S2-3); (I-58) + (S2-4); (I-58) + (S2-5); (I-58) + (S2-6); (I-58) + (S2-7); (I-58) + (S2- 8); (I-58) + (S2-9); (I-58) + (S2-10); (I-58) + (S3-1); (I-58) + (S3-2); (I-58) + (S3-3); (I-58) + (S3-4); (I-58) + (S3-5); (I-58) + (S3-6); (I-58) + (S3-7); (I-58) + (S3-8); (I- 58) + (S3-9); (I-58) + (S3-10); (I-58) + (S3-11); (I-58) + (S4-1 ); (I-58) + (S4-2); (I- 58) + (S4-3); (I-58) + (S4-4); (I-58) + (S4-5); (I-58) + (S7-1); (I-58) + (S11-1 ); (I-58) + (S11-2); (I-58) + (S11-3); (I-58) + (S12-1 ); (I-58) + (S13-1); (I-58) + (S13-2); (I-
58) + (S13-3); (I-58) + (S13-4): (I-58) + (S13-5); (I-58) + (S13-6); (I-58) + (S13-7); (I-58) + (S13-8); (I-58) + (S13-9); (I-58) + (S14-1 )
(I-59) + (S1-1); (I-59) + (S1-2); (I-59) + (S1-3); (I-59) + (S 1-4); (I-59) + (S1-5); (I-
59) + (S1-6); (I-59) + (S1-7); (I-59) + (S1-8); (I-59) + (S1-9); (I-59) + (S1-10); (I-59) + (S1-1 1); (I-59) + (S1-12); (I-59) + (S1-13); (I-59) + (S2-1); (I-59) + (S2-2); (I-59) + (S2-3); (I-59) + (S2-4); (I-59) + (S2-5); (I-59) + (S2-6); (I-59) + (S2-7); (I-59) + (S2- 8); (I-59) + (S2-9); (I-59) + (S2-10); (I-59) + (S3-1); (I-59) + (S3-2); (I-59) + (S3-3); (I-59) + (S3-4); (I-59) + (S3-5); (I-59) + (S3-6); (I-59) + (S3-7); (I-59) + (S3-8); (I- 59) + (S3-9); (I-59) + (S3-10); (I-59) + (S3-11); (I-59) + (S4-1); (I-59) + (S4-2); (I- 59) + (S4-3); (I-59) + (S4-4); (I-59) + (S4-5); (I-59) + (S7-1); (I-59) + (S11-1); (I-59) + (S11-2); (I-59) + (S11-3); (I-59) + (S12-1 ); (I-59) + (S13-1); (I-59) + (S13-2); (I-
59) + (S13-3); (I-59) + (S13-4): (I-59) + (S13-5); (I-59) + (S13-6); (I-59) + (S13-7); (I-59) + (S13-8); (I-59) + (S13-9); (I-59) + (S14-1)
(I-60) + (SM); (I-60) + (S1-2); (I-60) + (S1-3); (I-60) + (S1-4); (I-60) + (S1-5); (I-
60) + (S1-6); (I-60) + (S1-7); (I-60) + (S1-8); (I-60) + (S1-9); (I-60) + (SMO); (I-60) + (S1-11 ); (I-60) + (S1-12); (I-60) + (S1-13); (I-60) + (S2-1); (I-60) + (S2-2); (I-60) +
(S2-3); (1-60) + (S2-4); (1-60) + (S2-5); (1-60) + (S2-6); (1-60) + (S2-7); (1-60) + (S2- 8); (1-60) + (S2-9); (1-60) + (S2-10); (I-60) + (S3-1 ); (I-60) + (S3-2); (I-60) + (S3-3); (I-60) + (S3-4); (I-60) + (S3-5); (I-60) + (S3-6); (I-60) + (S3-7); (I-60) + (S3-8); (I- 60) + (S3-9); (I-60) + (S3-10); (I-60) + (S3-11); (I-60) + (S4-1 ); (I-60) + (S4-2); (I- 60) + (S4-3); (I-60) + (S4-4); (I-60) + (S4-5); (I-60) + (S7-1); (I-60) + (S11-1); (I-60) + (S11-2); (I-60) + (S11-3); (I-60) + (S12-1); (I-60) + (S13-1 ); (I-60) + (S13-2); (I-
60) + (S13-3); (I-60) + (S13-4): (I-60) + (S13-5); (I-60) + (S13-6); (I-60) + (S13-7); (I-60) + (S13-8); (I-60) + (S13-9); (I-60) + (S14-1)
(1-61 ) + (S1-1); (1-61 ) + (S1-2); (1-61) + (S1-3); (1-61) + (S1-4); (1-61) + (S1-5); (I-
61 ) + (S1-6); (1-61 ) + (S1-7); (1-61) + (S1-8); (1-61) + (S1-9); (1-61) + (S1-10); (1-61 ) + (S1-11); (1-61 ) + (S1-12); (1-61) + (S1-13); (1-61) + (S2-1); (1-61) + (S2-2); (1-61) + (S2-3); (1-61 ) + (S2-4); (1-61) + (S2-5); (1-61 ) + (S2-6); (1-61 ) + (S2-7); (1-61) + (S2- 8); (1-61) + (S2-9); (1-61) + (S2-10); (1-61) + (S3-1); (1-61) + (S3-2); (1-61) + (S3-3); (1-61) + (S3-4); (1-61 ) + (S3-5); (1-61) + (S3-6); (1-61) + (S3-7); (1-61) + (S3-8); (I- 61 ) + (S3-9); (1-61) + (S3-10); (1-61 ) + (S3-11); (1-61 ) + (S4-1 ); (1-61) + (S4-2); (I- 61 ) + (S4-3); (1-61) + (S4-4); (1-61) + (S4-5); (1-61) + (S7-1); (1-61) + (S11-1); (1-61) + (S11-2); (1-61) + (S11-3); (1-61 ) + (S12-1); (1-61) + (S13-1); (1-61) + (S13-2); (I-
61 ) + (S13-3); (1-61 ) + (S13-4): (1-61) + (S13-5); (1-61) + (S13-6); (1-61 ) + (S13-7); (1-61) + (S13-8); (1-61) + (S13-9); (1-61) + (S14-1)
(I-62) + (S1-1); (I-62) + (S1-2); (I-62) + (S1-3); (I-62) + (S1-4); (I-62) + (S1-5); (I-
62) + (S1-6); (I-62) + (S1-7); (I-62) + (S1-8); (I-62) + (S1-9); (I-62) + (S1-10); (I-62) + (S1-11); (I-62) + (S1-12); (I-62) + (S1-13); (I-62) + (S2-1); (I-62) + (S2-2); (I-62) + (S2-3); (I-62) + (S2-4); (I-62) + (S2-5); (I-62) + (S2-6); (I-62) + (S2-7); (I-62) + (S2- 8); (I-62) + (S2-9); (I-62) + (S2-10); (I-62) + (S3-1); (I-62) + (S3-2); (I-62) + (S3-3); (I-62) + (S3-4); (I-62) + (S3-5); (I-62) + (S3-6); (I-62) + (S3-7); (I-62) + (S3-8); (I- 62) + (S3-9); (I-62) + (S3-10); (I-62) + (S3-11); (I-62) + (S4-1); (I-62) + (S4-2); (I- 62) + (S4-3); (I-62) + (S4-4); (I-62) + (S4-5); (I-62) + (S7-1 ); (I-62) + (S11-1); (I-62) + (S11-2); (I-62) + (S11-3); (I-62) + (S12-1); (I-62) + (S13-1); (I-62) + (S13-2); (I-
62) + (S13-3); (I-62) + (S13-4): (I-62) + (S13-5); (I-62) + (S13-6); (I-62) + (S13-7); (I-62) + (S13-8); (I-62) + (S13-9); (I-62) + (S14-1)
(I-63) + (S1-1); (I-63) + (S1-2); (I-63) + (S1-3); (I-63) + (S1-4); (I-63) + (S1-5); (I-
63) + (S1-6); (I-63) + (S1-7); (I-63) + (S1-8); (I-63) + (S1-9); (I-63) + (S1-10); (I-63)
+ (S1-11); (I-63) + (S1-12); (I-63) + (S1-13); (I-63) + (S2-1 ); (I-63) + (S2-2); (I-63) + (S2-3); (I-63) + (S2-4); (I-63) + (S2-5); (I-63) + (S2-6); (I-63) + (S2-7); (I-63) + (S2- 8); (I-63) + (S2-9); (I-63) + (S2-10); (I-63) + (S3-1); (I-63) + (S3-2); (I-63) + (S3-3); (I-63) + (S3-4); (I-63) + (S3-5); (I-63) + (S3-6); (I-63) + (S3-7); (I-63) + (S3-8); (I- 63) + (S3-9); (I-63) + (S3-10); (I-63) + (S3-11); (I-63) + (S4-1 ); (I-63) + (S4-2); (I- 63) + (S4-3); (I-63) + (S4-4); (I-63) + (S4-5); (I-63) + (S7-1); (I-63) + (S11-1); (I-63) + (S11-2); (I-63) + (S11-3); (I-63) + (S12-1); (I-63) + (S13-1); (I-63) + (S13-2); (I-
63) + (S13-3); (I-63) + (S13-4): (I-63) + (S13-5); (I-63) + (S13-6); (I-63) + (S13-7); (I-63) + (S13-8); (I-63) + (S13-9); (I-63) + (S14-1 )
(I-64) + (S1-1); (I-64) + (S1-2); (I-64) + (S1-3); (I-64) + (S1-4); (I-64) + (S1-5); (I-
64) + (S1-6); (I-64) + (S1-7); (I-64) + (S1-8); (I-64) + (S1-9); (I-64) + (S1-10); (I-64) + (S1-11); (I-64) + (S1-12); (I-64) + (S1-13); (I-64) + (S2-1); (I-64) + (S2-2); (I-64) + (S2-3); (I-64) + (S2-4); (I-64) + (S2-5); (I-64) + (S2-6); (I-64) + (S2-7); (I-64) + (S2- 8); (I-64) + (S2-9); (I-64) + (S2-10); (I-64) + (S3-1 ); (I-64) + (S3-2); (I-64) + (S3-3); (I-64) + (S3-4); (I-64) + (S3-5); (I-64) + (S3-6); (I-64) + (S3-7); (I-64) + (S3-8); (I- 64) + (S3-9); (I-64) + (S3-10); (I-64) + (S3-11); (I-64) + (S4-1); (I-64) + (S4-2); (I- 64) + (S4-3); (I-64) + (S4-4); (I-64) + (S4-5); (I-64) + (S7-1); (I-64) + (S11-1); (I-64) + (S11-2); (I-64) + (S11-3); (I-64) + (S12-1); (I-64) + (S13-1); (I-64) + (S13-2); (I-
64) + (S13-3); (I-64) + (S13-4): (I-64) + (S13-5); (I-64) + (S13-6); (I-64) + (S13-7); (I-64) + (S13-8); (I-64) + (S13-9); (I-64) + (S14-1)
(I-65) + (S1-1 ); (I-65) + (S1-2); (I-65) + (S1-3); (I-65) + (S1-4); (I-65) + (S1-5); (I-
65) + (S1-6); (I-65) + (S1-7); (I-65) + (S1-8); (I-65) + (S1-9); (I-65) + (S1-10); (I-65) + (S1-11 ); (I-65) + (S1-12); (I-65) + (S1-13); (I-65) + (S2-1); (I-65) + (S2-2); (I-65) + (S2-3); (I-65) + (S2-4); (I-65) + (S2-5); (I-65) + (S2-6); (I-65) + (S2-7); (I-65) + (S2- 8); (I-65) + (S2-9); (I-65) + (S2-10); (I-65) + (S3-1); (I-65) + (S3-2); (I-65) + (S3-3); (I-65) + (S3-4); (I-65) + (S3-5); (I-65) + (S3-6); (I-65) + (S3-7); (I-65) + (S3-8); (I- 65) + (S3-9); (I-65) + (S3-10); (I-65) + (S3-11); (I-65) + (S4-1); (I-65) + (S4-2); (I- 65) + (S4-3); (I-65) + (S4-4); (I-65) + (S4-5); (I-65) + (S7-1); (I-65) + (S11-1); (I-65) + (S11-2); (I-65) + (S11-3); (I-65) + (S12-1 ); (I-65) + (S13-1); (I-65) + (S13-2); (I- 65) + (S13-3); (I-65) + (S13-4): (I-65) + (S13-5); (I-65) + (S13-6); (I-65) + (S13-7); (I-65) + (S13-8); (I-65) + (S13-9); (I-65) + (S14-1)
(I-66) + (S1-1); (I-66) + (S1-2); (I-66) + (S1-3); (I-66) + (S1-4); (I-66) + (S1-5); (I-
66) + (S1-6); (I-66) + (S1-7); (I-66) + (S1-8); (I-66) + (S1-9); (I-66) + (S1-10); (I-66) + (S1-11); (I-66) + (S1-12); (I-66) + (S1-13); (I-66) + (S2-1); (I-66) + (S2-2); (I-66) + (S2-3); (I-66) + (S2-4); (I-66) + (S2-5); (I-66) + (S2-6); (I-66) + (S2-7); (I-66) + (S2- 8); (I-66) + (S2-9); (I-66) + (S2-10); (I-66) + (S3-1); (I-66) + (S3-2); (I-66) + (S3-3); (I-66) + (S3-4); (I-66) + (S3-5); (I-66) + (S3-6); (I-66) + (S3-7); (I-66) + (S3-8); (I- 66) + (S3-9); (I-66) + (S3-10); (I-66) + (S3-11); (I-66) + (S4-1); (I-66) + (S4-2); (I- 66) + (S4-3); (I-66) + (S4-4); (I-66) + (S4-5); (I-66) + (S7-1 ); (I-66) + (S11-1 ); (I-66) + (S11-2); (I-66) + (S11-3); (I-66) + (S12-1 ); (I-66) + (S13-1); (I-66) + (S13-2); (I-
66) + (S13-3); (I-66) + (S13-4): (I-66) + (S13-5); (I-66) + (S13-6); (I-66) + (S13-7); (I-66) + (S13-8); (I-66) + (S13-9); (I-66) + (S14-1)
(I-67) + (S1-1); (I-67) + (S1-2); (I-67) + (S1-3); (I-67) + (S1-4); (I-67) + (S1-5); (I-
67) + (S1-6); (I-67) + (S1-7); (I-67) + (S1-8); (I-67) + (S1-9); (I-67) + (S1-10); (I-67) + (S1-11); (I-67) + (S1-12); (I-67) + (S1-13); (I-67) + (S2-1); (I-67) + (S2-2); (I-67) + (S2-3); (I-67) + (S2-4); (I-67) + (S2-5); (I-67) + (S2-6); (I-67) + (S2-7); (I-67) + (S2- 8); (I-67) + (S2-9); (I-67) + (S2-10); (I-67) + (S3-1); (I-67) + (S3-2); (I-67) + (S3-3); (I-67) + (S3-4); (I-67) + (S3-5); (I-67) + (S3-6); (I-67) + (S3-7); (I-67) + (S3-8); (I- 67) + (S3-9); (I-67) + (S3-10); (I-67) + (S3-11); (I-67) + (S4-1); (I-67) + (S4-2); (I- 67) + (S4-3); (I-67) + (S4-4); (I-67) + (S4-5); (I-67) + (S7-1 ); (I-67) + (S11-1); (I-67) + (S11-2); (I-67) + (S11-3); (I-67) + (S12-1); (I-67) + (S13-1); (I-67) + (S13-2); (I-
67) + (S13-3); (I-67) + (S13-4): (I-67) + (S13-5); (I-67) + (S13-6); (I-67) + (S13-7); (I-67) + (S13-8); (I-67) + (S13-9); (I-67) + (S14-1)
(I-68) + (S1-1 ); (I-68) + (S1-2); (I-68) + (S1-3); (I-68) + (S1-4); (I-68) + (S1-5); (I-
68) + (S1-6); (I-68) + (S1-7); (I-68) + (S1-8); (I-68) + (S1-9); (I-68) + (S1-10); (I-68) + (S1-11); (I-68) + (S1-12); (I-68) + (S1-13); (I-68) + (S2-1); (I-68) + (S2-2); (I-68) + (S2-3); (I-68) + (S2-4); (I-68) + (S2-5); (I-68) + (S2-6); (I-68) + (S2-7); (I-68) + (S2- 8); (I-68) + (S2-9); (I-68) + (S2-10); (I-68) + (S3-1 ); (I-68) + (S3-2); (I-68) + (S3-3); (I-68) + (S3-4); (I-68) + (S3-5); (I-68) + (S3-6); (I-68) + (S3-7); (I-68) + (S3-8); (I- 68) + (S3-9); (I-68) + (S3-10); (I-68) + (S3-11); (I-68) + (S4-1 ); (I-68) + (S4-2); (I- 68) + (S4-3); (I-68) + (S4-4); (I-68) + (S4-5); (I-68) + (S7-1); (I-68) + (S11-1); (I-68) + (S11-2); (I-68) + (S11-3); (I-68) + (S12-1 ); (I-68) + (S13-1 ); (I-68) + (S13-2); (I- 68) + (S13-3); (I-68) + (S13-4): (I-68) + (S13-5); (I-68) + (S13-6); (I-68) + (S13-7); (I-68) + (S13-8); (I-68) + (S13-9); (I-68) + (S14-1)
(1-69) + (S1-1 ); (I-69) + (S1-2); (I-69) + (S1-3); (I-69) + (S1-4); (I-69) + (S1-5); (I- 69) + (S1-6); (I-69) + (S1-7); (I-69) + (S1-8); (I-69) + (S1-9); (I-69) + (S1-10); (I-69) + (S1-11); (I-69) + (S1-12); (I-69) + (S1-13); (I-69) + (S2-1 ); (I-69) + (S2-2); (I-69) + (S2-3); (I-69) + (S2-4); (I-69) + (S2-5); (I-69) + (S2-6); (I-69) + (S2-7); (I-69) + (S2- 8); (I-69) + (S2-9); (I-69) + (S2-10); (I-69) + (S3-1); (I-69) + (S3-2); (I-69) + (S3-3); (I-69) + (S3-4); (I-69) + (S3-5); (I-69) + (S3-6); (I-69) + (S3-7); (I-69) + (S3-8); (I- 69) + (S3-9); (I-69) + (S3-10); (I-69) + (S3-11); (I-69) + (S4-1); (I-69) + (S4-2); (I- 69) + (S4-3); (I-69) + (S4-4); (I-69) + (S4-5); (I-69) + (S7-1); (I-69) + (S11-1 ); (I-69) + (S11-2); (I-69) + (S11-3); (I-69) + (S12-1 ); (I-69) + (S13-1); (I-69) + (S13-2); (I-
69) + (S13-3); (I-69) + (S13-4): (I-69) + (S13-5); (I-69) + (S13-6); (I-69) + (S13-7); (I-69) + (S13-8); (I-69) + (S13-9); (I-69) + (S14-1 )
(I-70) + (S1-1); (I-70) + (S1-2); (I-70) + (S1-3); (I-70) + (S1-4); (I-70) + (S1-5); (I-
70) + (S1-6); (I-70) + (S1-7); (I-70) + (S1-8); (I-70) + (S1-9); (I-70) + (S1-10); (I-70) + (S1-11); (I-70) + (S1-12); (I-70) + (S1-13); (I-70) + (S2-1); (I-70) + (S2-2); (I-70) + (S2-3); ([-7O) + (S2-4); (I-70) + (S2-5); (I-70) + (S2-6); (I-70) + (S2-7); (I-70) + (S2- 8); (I-70) + (S2-9); (I-70) + (S2-10); (I-70) + (S3-1); (I-70) + (S3-2); (I-70) + (S3-3); (I-70) + (S3-4); (I-70) + (S3-5); (I-70) + (S3-6); (I-70) + (S3-7); (I-70) + (S3-8); (I- 70) + (S3-9); (I-70) + (S3-10); (I-70) + (S3-11); (I-70) + (S4-1); (I-70) + (S4-2); (I- 70) + (S4-3); (I-70) + (S4-4); (I-70) + (S4-5); (I-70) + (S7-1); (I-70) + (S11-1); (I-70) + (S11-2); (I-70) + (S11-3); (I-70) + (S12-1); (I-70) + (S13-1 ); (I-70) + (S13-2); (I-
70) + (S13-3); (I-70) + (S13-4): (I-70) + (S13-5); (I-70) + (S13-6); (I-70) + (S13-7); (I-70) + (S13-8); (I-70) + (S13-9); (I-70) + (S14-1)
(1-71) + (S1-1 ); (1-71 ) + (S1-2); (1-71 ) + (S1-3); (1-71) + (S1-4); (1-71) + (S1-5); (I-
71) + (S1-6); (1-71) + (S1-7); (1-71 ) + (S1-8); (1-71) + (S1-9); (1-71) + (S1-10); (1-71) + (S1-11); (1-71) + (S1-12); (1-71) + (S1-13); (1-71) + (S2-1 ); (1-71) + (S2-2); (1-71 ) + (S2-3); (1-71) + (S2-4); (1-71 ) + (S2-5); (1-71 ) + (S2-6); (1-71) + (S2-7); (1-71 ) + (S2- 8); (1-71) + (S2-9); (1-71 ) + (S2-10); (1-71 ) + (S3-1); (1-71) + (S3-2); (1-71) + (S3-3); (1-71) + (S3-4); (1-71) + (S3-5); (1-71) + (S3-6); (1-71) + (S3-7); (1-71 ) + (S3-8); (I- 71) + (S3-9); (1-71 ) + (S3-10); (1-71) + (S3-11); (1-71) + (S4-1 ); (1-71) + (S4-2); (I- 71) + (S4-3); (1-71 ) + (S4-4); (1-71 ) + (S4-5); (1-71 ) + (S7-1 ); (1-71 ) + (S11-1); (1-71 ) + (S11-2); (1-71 ) + (S11-3); (1-71) + (S12-1); (1-71) + (S13-1); (1-71) + (S13-2); (I- 71) + (S13-3); (1-71) + (S13-4): (1-71) + (S13-5); (1-71) + (S13-6); (1-71 ) + (S13-7);
(1-71) + (S13-8); (1-71 ) + (S13-9); (1-71) + (S14-1 )
(I-72) + (SM); (I-72) + (S1-2); (I-72) + (S1-3); (I-72) + (S1-4); (I-72) + (S1-5); (I- 72) + (S1-6); (I-72) + (S1-7); (I-72) + (S1-8); (I-72) + (S1-9); (I-72) + (SM O); (I-72) + (SM 1); (I-72) + (S1-12); (I-72) + (S1-13); (I-72) + (S2-1); (I-72) + (S2-2); (I-72) + (S2-3); (I-72) + (S2-4); (I-72) + (S2-5); (I-72) + (S2-6); (I-72) + (S2-7); (I-72) + (S2- 8); (I-72) + (S2-9); (I-72) + (S2-10); (I-72) + (S3-1); (I-72) + (S3-2); (I-72) + (S3-3); (I-72) + (S3-4); (I-72) + (S3-5); (I-72) + (S3-6); (I-72) + (S3-7); (I-72) + (S3-8); (I- 72) + (S3-9); (I-72) + (S3-10); (I-72) + (S3-11); (I-72) + (S4-1); (I-72) + (S4-2); (I- 72) + (S4-3); (I-72) + (S4-4); (I-72) + (S4-5); (I-72) + (S7-1); (I-72) + (S1 M); (I-72) + (S11-2); (I-72) + (S11-3); (I-72) + (S12-1); (I-72) + (S13-1); (I-72) + (S13-2); (I-
72) + (S13-3); (I-72) + (S13-4): (I-72) + (S13-5); (I-72) + (S13-6); (I-72) + (S13-7); (I-72) + (S13-8); (I-72) + (S13-9); (I-72) + (S14-1)
(I-73) + (SM); (I-73) + (S1-2); (I-73) + (S1-3); (I-73) + (S1-4); (I-73) + (S1-5); (I-
73) + (S1-6); (I-73) + (S1-7); (I-73) + (S1-8); (I-73) + (S1-9); (I-73) + (SMO); (I-73) + (S1-11); (I-73) + (SM 2); (I-73) + (SM 3); (I-73) + (S2-1); (I-73) + (S2-2); (I-73) + (S2-3); (I-73) + (S2-4); (I-73) + (S2-5); (I-73) + (S2-6); (I-73) + (S2-7); (I-73) + (S2- 8); (I-73) + (S2-9); (I-73) + (S2-10); (I-73) + (S3-1 ); (I-73) + (S3-2); (I-73) + (S3-3); (I-73) + (S3-4); (I-73) + (S3-5); (I-73) + (S3-6); (I-73) + (S3-7); (I-73) + (S3-8); (I- 73) + (S3-9); (I-73) + (S3-10); (I-73) + (S3-11); (I-73) + (S4-1); (I-73) + (S4-2); (I- 73) + (S4-3); (I-73) + (S4-4); (I-73) + (S4-5); (I-73) + (S7-1); (I-73) + (S11-1); (I-73) + (S11-2); (I-73) + (S11-3); (I-73) + (S12-1 ); (I-73) + (S13-1); (I-73) + (S13-2); (I-
73) + (S13-3); (I-73) + (S13-4): (I-73) + (S13-5); (I-73) + (S13-6); (I-73) + (S13-7); (I-73) + (S13-8); (I-73) + (S13-9); (I-73) + (S14-1)
(I-74) + (S1-1 ); (I-74) + (S1-2); (I-74) + (S1-3); (I-74) + (S1-4); (I-74) + (S1-5); (I-
74) + (S1-6); (I-74) + (S1-7); (I-74) + (S1-8); (I-74) + (S1-9); (I-74) + (S1-10); (I-74) + (SM 1); (I-74) + (SM2); (I-74) + (SM 3); (I-74) + (S2-1); (I-74) + (S2-2); (I-74) + (S2-3); (I-74) + (S2-4); (I-74) + (S2-5); (I-74) + (S2-6); (I-74) + (S2-7); (I-74) + (S2- 8); (I-74) + (S2-9); (I-74) + (S2-10); (I-74) + (S3-1 ); (I-74) + (S3-2); (I-74) + (S3-3); (I-74) + (S3-4); (I-74) + (S3-5); (I-74) + (S3-6); (I-74) + (S3-7); (I-74) + (S3-8); (I- 74) + (S3-9); (I-74) + (S3-10); (I-74) + (S3-11); (I-74) + (S4-1 ); (I-74) + (S4-2); (I- 74) + (S4-3); (I-74) + (S4-4); (I-74) + (S4-5); (I-74) + (S7-1); (I-74) + (S1 M); (I-74) + (S11-2); (I-74) + (S11-3); (I-74) + (S12-1); (I-74) + (S13-1); (I-74) + (S13-2); (I-
74) + (S13-3); (I-74) + (S13-4): (I-74) + (S13-5); (I-74) + (S13-6); (I-74) + (S13-7); (I-74) + (S13-8); (I-74) + (S13-9); (I-74) + (S14-1)
(I-75) + (S1-1 ); (I-75) + (S1-2); (I-75) + (S1-3); (I-75) + (S1-4); (I-75) + (S1-5); (I-
75) + (S1-6); (I-75) + (S1-7); (I-75) + (S1-8); (I-75) + (S1-9); (I-75) + (S1-10); (I-75) + (S1-11); (I-75) + (S1-12); (I-75) + (S1-13); (I-75) + (S2-1 ); (I-75) + (S2-2); (I-75) + (S2-3); (I-75) + (S2-4); (I-75) + (S2-5); (I-75) + (S2-6); (I-75) + (S2-7); (I-75) + (S2- 8); (I-75) + (S2-9); (I-75) + (S2-10); (I-75) + (S3-1); (I-75) + (S3-2); (I-75) + (S3-3); (I-75) + (S3-4); (I-75) + (S3-5); (I-75) + (S3-6); (I-75) + (S3-7); (I-75) + (S3-8); (I- 75) + (S3-9); (I-75) + (S3-10); (I-75) + (S3-11); (I-75) + (S4-1 ); (I-75) + (S4-2); (I- 75) + (S4-3); (I-75) + (S4-4); (I-75) + (S4-5); (I-75) + (S7-1); (I-75) + (S11-1); (I-75) + (S11-2); (I-75) + (S11-3); (I-75) + (S12-1); (I-75) + (S13-1); (I-75) + (S13-2); (I-
75) + (S13-3); (I-75) + (S13-4): (I-75) + (S13-5); (I-75) + (S13-6); (I-75) + (S13-7); (I-75) + (S13-8); (I-75) + (S13-9); (I-75) + (S14-1 )
(I-76) + (S1-1); (I-76) + (S1-2); (I-76) + (S1-3); (I-76) + (S1-4); (I-76) + (S1-5); (I-
76) + (S1-6); (I-76) + (S1-7); (I-76) + (S1-8); (I-76) + (S1-9); (I-76) + (S1-10); (I-76) + (S1-11); (I-76) + (S1-12); (I-76) + (S1-13); (I-76) + (S2-1); (I-76) + (S2-2); (I-76) + (S2-3); (I-76) + (S2-4); (I-76) + (S2-5); (I-76) + (S2-6); (I-76) + (S2-7); (I-76) + (S2- 8); (I-76) + (S2-9); (I-76) + (S2-10); (I-76) + (S3-1); (I-76) + (S3-2); (I-76) + (S3-3); (I-76) + (S3-4); (I-76) + (S3-5); (I-76) + (S3-6); (I-76) + (S3-7); (I-76) + (S3-8); (I- 76) + (S3-9); (I-76) + (S3-10); (I-76) + (S3-11); (I-76) + (S4-1); (I-76) + (S4-2); (I- 76) + (S4-3); (I-76) + (S4-4); (I-76) + (S4-5); (I-76) + (S7-1); (I-76) + (S1 1-1 ); (I-76) + (S11-2); (I-76) + (S11-3); (I-76) + (S12-1); (I-76) + (S13-1 ); (I-76) + (S13-2); (I-
76) + (S13-3); (I-76) + (S13-4): (I-76) + (S13-5); (I-76) + (S13-6); (I-76) + (S13-7); (I-76) + (S13-8); (I-76) + (S13-9); (I-76) + (S14-1)
(I-77) + (S1-1); (I-77) + (S1-2); (I-77) + (S1-3); (I-77) + (S1-4); (I-77) + (S1-5); (I-
77) + (S1-6); (I-77) + (S1-7); (I-77) + (S1-8); (I-77) + (S1-9); (I-77) + (S1-10); (I-77) + (S1-11 ); (I-77) + (S1-12); (I-77) + (S1-13); (I-77) + (S2-1 ); (I-77) + (S2-2); (I-77) + (S2-3); (I-77) + (S2-4); (I-77) + (S2-5); (I-77) + (S2-6); (I-77) + (S2-7); (I-77) + (S2- 8); (I-77) + (S2-9); (I-77) + (S2-10); (I-77) + (S3-1 ); (I-77) + (S3-2); (I-77) + (S3-3); (I-77) + (S3-4); (I-77) + (S3-5); (I-77) + (S3-6); (I-77) + (S3-7); (I-77) + (S3-8); (I- 77) + (S3-9); (I-77) + (S3-10); (I-77) + (S3-11); (I-77) + (S4-1 ); (I-77) + (S4-2); (I- 77) + (S4-3); (I-77) + (S4-4); (I-77) + (S4-5); (I-77) + (S7-1 ); (I-77) + (S11-1 ); (I-77)
+ (S11-2); (I-77) + (S11-3); (I-77) + (S12-1 ); (I-77) + (S13-1); (I-77) + (S13-2); (I-
77) + (S13-3); (I-77) + (S13-4): (I-77) + (S13-5); (I-77) + (S13-6); (I-77) + (S13-7); (I-77) + (S13-8); (I-77) + (S13-9); (I-77) + (S14-1 )
(I-78) + (S1-1 ); (I-78) + (S1-2); (I-78) + (S1-3); (I-78) + (S1-4); (I-78) + (S1-5); (I-
78) + (S1-6); (I-78) + (S1-7); (I-78) + (S1-8); (I-78) + (S1-9); (I-78) + (S1-10); (I-78) + (S1-11); (I-78) + (S1-12); (I-78) + (S1-13); (I-78) + (S2-1 ); (I-78) + (S2-2); (I-78) + (S2-3); (I-78) + (S2-4); (I-78) + (S2-5); (I-78) + (S2-6); (I-78) + (S2-7); (I-78) + (S2- 8); (I-78) + (S2-9); (I-78) + (S2-10); (I-78) + (S3-1); (I-78) + (S3-2); (I-78) + (S3-3); (I-78) + (S3-4); (I-78) + (S3-5); (I-78) + (S3-6); (I-78) + (S3-7); (I-78) + (S3-8); (I- 78) + (S3-9); (I-78) + (S3-10); (I-78) + (S3-11); (I-78) + (S4-1); (I-78) + (S4-2); (I- 78) + (S4-3); (I-78) + (S4-4); (I-78) + (S4-5); (I-78) + (S7-1); (I-78) + (S11-1 ); (I-78) + (S11-2); (I-78) + (S11-3); (I-78) + (S12-1); (I-78) + (S13-1 ); (I-78) + (S13-2); (I-
78) + (S13-3); (I-78) + (S13-4): (I-78) + (S13-5); (I-78) + (S13-6); (I-78) + (S13-7); (I-78) + (S13-8); (I-78) + (S13-9); (I-78) + (S14-1)
(I-79) + (S1-1 ); (I-79) + (S1-2); (I-79) + (S1-3); (I-79) + (S1-4); (I-79) + (S1-5); (I-
79) + (S1-6); (I-79) + (S1-7); (I-79) + (S1-8); (I-79) + (S1-9); (I-79) + (S1-10); (I-79) + (S1-11); (I-79) + (S1-12); (I-79) + (S1-13); (I-79) + (S2-1 ); (I-79) + (S2-2); (I-79) + (S2-3); (I-79) + (S2-4); (I-79) + (S2-5); (I-79) + (S2-6); (I-79) + (S2-7); (I-79) + (S2- 8); (I-79) + (S2-9); (I-79) + (S2-10); (I-79) + (S3-1 ); (I-79) + (S3-2); (I-79) + (S3-3); (I-79) + (S3-4); (I-79) + (S3-5); (I-79) + (S3-6); (I-79) + (S3-7); (I-79) + (S3-8); (I- 79) + (S3-9); (I-79) + (S3-10); (I-79) + (S3-11); (I-79) + (S4-1 ); (I-79) + (S4-2); (I- 79) + (S4-3); (I-79) + (S4-4); (I-79) + (S4-5); (I-79) + (S7-1); (I-79) + (S11-1 ); (I-79) + (S11-2); (I-79) + (S11-3); (I-79) + (S12-1 ); (I-79) + (S13-1); (I-79) + (S13-2); (I-
79) + (S13-3); (I-79) + (S13-4): (I-79) + (S13-5); (I-79) + (S13-6); (I-79) + (S13-7); (I-79) + (S13-8); (I-79) + (S13-9); (I-79) + (S14-1)
(I-80) + (S1-1 ); (I-80) + (S1-2); (I-80) + (S1-3); (I-80) + (S1-4); (I-80) + (S1-5); (I-
80) + (S1-6); (I-80) + (S1-7); (I-80) + (S1-8); (I-80) + (S1-9); (I-80) + (S1-10); (I-80) + (S1-11); (I-80) + (S1-12); (I-80) + (S1-13); (I-80) + (S2-1); (I-80) + (S2-2); (I-80) + (S2-3); (I-80) + (S2-4); (I-80) + (S2-5); (I-80) + (S2-6); (I-80) + (S2-7); (I-80) + (S2- 8); (I-80) + (S2-9); (I-80) + (S2-10); (I-80) + (S3-1); (I-80) + (S3-2); (I-80) + (S3-3); (I-80) + (S3-4); (I-80) + (S3-5); (I-80) + (S3-6); (I-80) + (S3-7); (I-80) + (S3-8); (I- 80) + (S3-9); (I-80) + (S3-10); (I-80) + (S3-11); (I-80) + (S4-1); (I-80) + (S4-2); (I-
80) + (S4-3); (1-80) + (S4-4); (1-80) + (S4-5); (1-80) + (S7-1); (I-80) + (S11-1 ); (I-80) + (S1 1-2); (I-80) + (S11-3); (I-80) + (S12-1 ); (I-80) + (S13-1 ); (I-80) + (S13-2); (I-
80) + (S13-3); (I-80) + (S13-4): (I-80) + (S13-5); (I-80) + (S13-6); (I-80) + (S13-7); (I-80) + (S13-8); (I-80) + (S13-9); (I-80) + (S14-1)
(1-81 ) + (S1-1); (1-81) + (S1-2); (1-81) + (S1-3); (1-81) + (S1-4); (1-81 ) + (S1-5); (I-
81) + (S1-6); (1-81 ) + (S1-7); (1-81) + (S1-8); (1-81) + (S1-9); (1-81) + (S1-10); (1-81 ) + (S1-11); (1-81 ) + (S1 -12); (1-81) + (S1-13); (1-81) + (S2-1); (1-81) + (S2-2); (1-81) + (S2-3); (1-81 ) + (S2-4); (1-81) + (S2-5); (1-81 ) + (S2-6); (1-81 ) + (S2-7); (1-81) + (S2- 8); (1-81) + (S2-9); (1-81 ) + (S2-10); (1-81) + (S3-1); (1-81) + (S3-2); (1-81) + (S3-3); (1-81 ) + (S3-4); (1-81) + (S3-5); (1-81 ) + (S3-6); (1-81) + (S3-7); (1-81) + (S3-8); (I- 81) + (S3-9); (1-81) + (S3-10); (1-81) + (S3-11); (1-81) + (S4-1); (1-81) + (S4-2); (I- 81) + (S4-3); (1-81) + (S4-4); (1-81) + (S4-5); (1-81) + (S7-1); (1-81) + (S11-1 ); (1-81 ) + (S11-2); (1-81) + (S11-3); (1-81 ) + (S12-1 ); (1-81) + (S13-1 ); (1-81) + (S13-2); (I-
81) + (S13-3); (1-81) + (S13-4): (1-81 ) + (S13-5); (1-81) + (S13-6); (1-81) + (S13-7); (1-81) + (S13-8); (1-81) + (S13-9); (1-81) + (S14-1)
(I-82) + (S1-1); (I-82) + (S1-2); (I-82) + (S1-3); (I-82) + (S1-4); (I-82) + (S1-5); (I-
82) + (S1-6); (I-82) + (S1-7); (I-82) + (S1-8); (I-82) + (S1-9); (I-82) + (S1-10); (I-82) + (S1-11); (I-82) + (S1-12); (I-82) + (S1-13); (I-82) + (S2-1); (I-82) + (S2-2); (I-82) + (S2-3); (I-82) + (S2-4); (I-82) + (S2-5); (I-82) + (S2-6); (I-82) + (S2-7); (I-82) + (S2- 8); (I-82) + (S2-9); (I-82) + (S2-10); (I-82) + (S3-1); (I-82) + (S3-2); (I-82) + (S3-3); (I-82) + (S3-4); (I-82) + (S3-5); (I-82) + (S3-6); (I-82) + (S3-7); (I-82) + (S3-8); (I- 82) + (S3-9); (I-82) + (S3-10); (I-82) + (S3-11); (I-82) + (S4-1); (I-82) + (S4-2); (I- 82) + (S4-3); (I-82) + (S4-4); (I-82) + (S4-5); (I-82) + (S7-1 ); (I-82) + (S11-1 ); (I-82) + (S11-2); (I-82) + (S11-3); (I-82) + (S12-1); (I-82) + (S13-1); (I-82) + (S13-2); (I-
82) + (S13-3); (I-82) + (S13-4): (I-82) + (S13-5); (I-82) + (S13-6); (I-82) + (S13-7); (I-82) + (S13-8); (I-82) + (S13-9); (I-82) + (S14-1)
(I-83) + (S1-1 ); (I-83) + (S1-2); (I-83) + (S1-3); (I-83) + (S1-4); (I-83) + (S1-5); (I-
83) + (S1-6); (I-83) + (S1-7); (I-83) + (S1-8); (I-83) + (S1-9); (I-83) + (S1-10); (I-83) + (S1-11); (I-83) + (S1-12); (I-83) + (S1-13); (I-83) + (S2-1 ); (I-83) + (S2-2); (I-83) + (S2-3); (I-83) + (S2-4); (I-83) + (S2-5); (I-83) + (S2-6); (I-83) + (S2-7); (I-83) + (S2- 8); (I-83) + (S2-9); (I-83) + (S2-10); (I-83) + (S3-1); (I-83) + (S3-2); (I-83) + (S3-3); (I-83) + (S3-4); (I-83) + (S3-5); (I-83) + (S3-6); (I-83) + (S3-7); (I-83) + (S3-8); (I-
83) + (S3-9); (I-83) + (S3-10); (I-83) + (S3-11); (I-83) + (S4-1); (I-83) + (S4-2); (I- 83) + (S4-3); (I-83) + (S4-4); (I-83) + (S4-5); (I-83) + (S7-1 ); (I-83) + (S11-1 ); (I-83) + (S11-2); (I-83) + (S11-3); (I-83) + (S12-1 ); (I-83) + (S13-1); (I-83) + (S13-2); (I-
83) + (S13-3); (I-83) + (S13-4): (I-83) + (S13-5); (I-83) + (S13-6); (I-83) + (S13-7); (I-83) + (S13-8); (I-83) + (S13-9); (I-83) + (S14-1)
(I-84) + (S1-1); (I-84) + (S1-2); (I-84) + (S1-3); (I-84) + (S1-4); (I-84) + (S1-5); (I-
84) + (S1-6); (I-84) + (S1-7); (I-84) + (S1-8); (I-84) + (S1-9); (I-84) + (S1-10); (I-84) + (S1-11); (I-84) + (S1-12); (I-84) + (S1-13); (I-84) + (S2-1 ); (I-84) + (S2-2); (I-84) + (S2-3); (I-84) + (S2-4); (I-84) + (S2-5); (I-84) + (S2-6); (I-84) + (S2-7); (I-84) + (S2- 8); (I-84) + (S2-9); (I-84) + (S2-10); (I-84) + (S3-1); (I-84) + (S3-2); (I-84) + (S3-3); (I-84) + (S3-4); (I-84) + (S3-5); (I-84) + (S3-6); (I-84) + (S3-7); (I-84) + (S3-8); (I- 84) + (S3-9); (I-84) + (S3-10); (I-84) + (S3-11); (I-84) + (S4-1); (I-84) + (S4-2); (I- 84) + (S4-3); (I-84) + (S4-4); (I-84) + (S4-5); (I-84) + (S7-1); (I-84) + (S11-1 ); (I-84) + (S11-2); (I-84) + (S11-3); (I-84) + (S12-1); (I-84) + (S13-1); (I-84) + (S13-2); (I-
84) + (S13-3); (I-84) + (S13-4): (I-84) + (S13-5); (I-84) + (S13-6); (I-84) + (S13-7); (I-84) + (S13-8); (I-84) + (S13-9); (I-84) + (S14-1)
(I-85) + (SM ); (I-85) + (S1-2); (I-85) + (S1-3); (I-85) + (S1-4); (I-85) + (S1-5); (I-
85) + (S1-6); (I-85) + (S1-7); (I-85) + (S1-8); (I-85) + (S1-9); (I-85) + (SMO); (I-85) + (S1-11); (I-85) + (SM 2); (I-85) + (SM 3); (I-85) + (S2-1); (I-85) + (S2-2); (I-85) + (S2-3); (I-85) + (S2-4); (I-85) + (S2-5); (I-85) + (S2-6); (I-85) + (S2-7); (I-85) + (S2- 8); (I-85) + (S2-9); (I-85) + (S2-10); (I-85) + (S3-1); (I-85) + (S3-2); (I-85) + (S3-3); (I-85) + (S3-4); (I-85) + (S3-5); (I-85) + (S3-6); (I-85) + (S3-7); (I-85) + (S3-8); (I- 85) + (S3-9); (I-85) + (S3-10); (I-85) + (S3-11); (I-85) + (S4-1); (I-85) + (S4-2); (I- 85) + (S4-3); (I-85) + (S4-4); (I-85) + (S4-5); (I-85) + (S7-1); (I-85) + (S11-1); (I-85) + (S11-2); (I-85) + (S11-3); (I-85) + (S12-1); (I-85) + (S13-1); (I-85) + (S13-2); (I-
85) + (S13-3); (I-85) + (S13-4): (I-85) + (S13-5); (I-85) + (S13-6); (I-85) + (S13-7); (I-85) + (S13-8); (I-85) + (S13-9); (I-85) + (S14-1 )
(I-86) + (SM); (I-86) + (S1-2); (I-86) + (S1-3); (I-86) + (S1-4); (I-86) + (S1-5); (I-
86) + (S1-6); (I-86) + (S1-7); (I-86) + (S1-8); (I-86) + (S1-9); (I-86) + (SM O); (I-86) + (SM 1); (I-86) + (SM 2); (I-86) + (SM 3); (I-86) + (S2-1 ); (I-86) + (S2-2); (I-86) + (S2-3); (I-86) + (S2-4); (I-86) + (S2-5); (I-86) + (S2-6); (I-86) + (S2-7); (I-86) + (S2- 8); (I-86) + (S2-9); (I-86) + (S2-10); (I-86) + (S3-1 ); (I-86) + (S3-2); (I-86) + (S3-3);
(1-86) + (S3-4); (1-86) + (S3-5); (1-86) + (S3-6); (1-86) + (S3-7); (1-86) + (S3-8); (I- 86) + (S3-9); (1-86) + (S3-10); (I-86) + (S3-11); (I-86) + (S4-1 ); (I-86) + (S4-2); (I- 86) + (S4-3); (I-86) + (S4-4); (I-86) + (S4-5); (I-86) + (S7-1); (I-86) + (S11-1 ); (I-86) + (S11-2); (I-86) + (S11-3); (I-86) + (S12-1 ); (I-86) + (S13-1 ); (I-86) + (S13-2); (I-
86) + (S13-3); (I-86) + (S13-4): (I-86) + (S13-5); (I-86) + (S13-6); (I-86) + (S13-7); (I-86) + (S13-8); (I-86) + (S13-9); (I-86) + (S14-1 )
(I-87) + (S1-1 ); (I-87) + (S1-2); (I-87) + (S1-3); (I-87) + (S1-4); (I-87) + (S1-5); (I-
87) + (S1-6); (I-87) + (S1-7); (I-87) + (S1-8); (I-87) + (S1-9); (I-87) + (S1-10); (I-87) + (S1-11); (I-87) + (S1-12); (I-87) + (S1-13); (I-87) + (S2-1); (I-87) + (S2-2); (I-87) + (S2-3); (I-87) + (S2-4); (I-87) + (S2-5); (I-87) + (S2-6); (I-87) + (S2-7); (I-87) + (S2- 8); (I-87) + (S2-9); (I-87) + (S2-10); (I-87) + (S3-1); (I-87) + (S3-2); (I-87) + (S3-3); (I-87) + (S3-4); (I-87) + (S3-5); (I-87) + (S3-6); (I-87) + (S3-7); (I-87) + (S3-8); (I- 87) + (S3-9); (I-87) + (S3-10); (I-87) + (S3-11); (I-87) + (S4-1); (I-87) + (S4-2); (I- 87) + (S4-3); (I-87) + (S4-4); (I-87) + (S4-5); (I-87) + (S7-1); (I-87) + (S11-1); (I-87) + (S11-2); (I-87) + (S11-3); (I-87) + (S12-1); (I-87) + (S13-1); (I-87) + (S13-2); (I-
87) + (S13-3); (I-87) + (S13-4): (I-87) + (S13-5); (I-87) + (S13-6); (I-87) + (S13-7); (I-87) + (S13-8); (I-87) + (S13-9); (I-87) + (S14-1)
(I-88) + (S1-1); (I-88) + (S1-2); (I-88) + (S1-3); (I-88) + (S1-4); (I-88) + (S1-5); (I-
88) + (S1-6); (I-88) + (S1 -7); (I-88) + (S1-8); (I-88) + (S1-9); (I-88) + (S1-10); (I-88) + (S1-11 ); (I-88) + (S1-12); (I-88) + (S1-13); (I-88) + (S2-1); (I-88) + (S2-2); (I-88) + (S2-3); (I-88) + (S2-4); (I-88) + (S2-5); (I-88) + (S2-6); (I-88) + (S2-7); (I-88) + (S2- 8); (I-88) + (S2-9); (I-88) + (S2-10); (I-88) + (S3-1 ); (I-88) + (S3-2); (I-88) + (S3-3); (I-88) + (S3-4); (I-88) + (S3-5); (I-88) + (S3-6); (I-88) + (S3-7); (I-88) + (S3-8); (I- 88) + (S3-9); (I-88) + (S3-10); (I-88) + (S3-11); (I-88) + (S4-1); (I-88) + (S4-2); (I- 88) + (S4-3); (I-88) + (S4-4); (I-88) + (S4-5); (I-88) + (S7-1); (I-88) + (S11-1 ); (I-88) + (S11-2); (I-88) + (S11-3); (I-88) + (S12-1); (I-88) + (S13-1 ); (I-88) + (S13-2); (I-
88) + (S13-3); (I-88) + (S13-4): (I-88) + (S13-5); (I-88) + (S13-6); (I-88) + (S13-7); (I-88) + (S13-8); (I-88) + (S13-9); (I-88) + (S14-1)
(I-89) + (S1-1 ); (I-89) + (S1-2); (I-89) + (S1-3); (I-89) + (S1-4); (I-89) + (S1-5); (I-
89) + (S1-6); (I-89) + (S1-7); (I-89) + (S1-8); (I-89) + (S1-9); (I-89) + (S1-10); (I-89) + (S1-11); (I-89) + (S1-12); (I-89) + (S1-13); (I-89) + (S2-1); (I-89) + (S2-2); (I-89) + (S2-3); (I-89) + (S2-4); (I-89) + (S2-5); (I-89) + (S2-6); (I-89) + (S2-7); (I-89) + (S2-
8); (1-89) + (S2-9); (1-89) + (S2-10); (I-89) + (S3-1); (I-89) + (S3-2); (I-89) + (S3-3); (I-89) + (S3-4); (I-89) + (S3-5); (I-89) + (S3-6); (I-89) + (S3-7); (I-89) + (S3-8); (I- 89) + (S3-9); (I-89) + (S3-10); (I-89) + (S3-11); (I-89) + (S4-1); (I-89) + (S4-2); (I- 89) + (S4-3); (I-89) + (S4-4); (I-89) + (S4-5); (I-89) + (S7-1 ); (I-89) + (S11-1 ); (I-89) + (S11-2); (I-89) + (S11-3); (I-89) + (S12-1 ); (I-89) + (S13-1 ); (I-89) + (S13-2); (I-
89) + (S13-3); (I-89) + (S13-4): (I-89) + (S13-5); (I-89) + (S13-6); (I-89) + (S13-7); (I-89) + (S13-8); (I-89) + (S13-9); (I-89) + (S14-1)
(I-90) + (S1-1 ); (I-90) + (S1-2); (I-90) + (S1-3); (I-90) + (S1-4); (I-90) + (S1-5); (I-
90) + (S1-6); (I-90) + (S1-7); (I-90) + (S1-8); (I-90) + (S1-9); (I-90) + (S1-10); (I-90) + (S1-11); (I-90) + (S1-12); (I-90) + (S1-13); (I-90) + (S2-1); (I-90) + (S2-2); (I-90) + (S2-3); (I-90) + (S2-4); (I-90) + (S2-5); (I-90) + (S2-6); (I-90) + (S2-7); (I-90) + (S2- 8); (I-90) + (S2-9); (I-90) + (S2-10); (I-90) + (S3-1); (I-90) + (S3-2); (I-90) + (S3-3); (I-90) + (S3-4); (I-90) + (S3-5); (I-90) + (S3-6); (I-90) + (S3-7); (I-90) + (S3-8); (I- 90) + (S3-9); (I-90) + (S3-10); (I-90) + (S3-11); (I-90) + (S4-1); (I-90) + (S4-2); (I- 90) + (S4-3); (I-90) + (S4-4); (I-90) + (S4-5); (I-90) + (S7-1); (I-90) + (S11-1 ); (I-90) + (S11-2); (I-90) + (S11-3); (I-90) + (S12-1 ); (I-90) + (S13-1); (I-90) + (S13-2); (I-
90) + (S13-3); (I-90) + (S13-4): (I-90) + (S13-5); (I-90) + (S13-6); (I-90) + (S13-7); (I-90) + (S13-8); (I-90) + (S13-9); (I-90) + (S14-1)
(1-91 ) + (S1-1 ); (1-91 ) + (S1-2); (1-91 ) + (S1-3); (1-91) + (S1-4); (1-91) + (S1-5); (I-
91) + (S1-6); (1-91 ) + (S1-7); (1-91) + (S1-8); (1-91) + (S1-9); (1-91) + (S1-10); (1-91 ) + (S1-11); (1-91) + (S1-12); (1-91) + (S1-13); (1-91) + (S2-1); (1-91) + (S2-2); (1-91) + (S2-3); (1-91 ) + (S2-4); (1-91) + (S2-5); (1-91) + (S2-6); (1-91 ) + (S2-7); (1-91) + (S2- 8); (1-91) + (S2-9); (1-91) + (S2-10); (1-91) + (S3-1); (1-91) + (S3-2); (1-91 ) + (S3-3); (1-91) + (S3-4); (1-91) + (S3-5); (1-91) + (S3-6); (1-91) + (S3-7); (1-91) + (S3-8); (I- 91) + (S3-9); (1-91) + (S3-10); (1-91) + (S3-11); (1-91) + (S4-1); (1-91) + (S4-2); (I- 91) + (S4-3); (1-91) + (S4-4); (1-91) + (S4-5); (1-91) + (S7-1); (1-91) + (S11-1); (1-91) + (S11-2); (1-91) + (S11-3); (1-91) + (S12-1); (1-91) + (S13-1 ); (1-91) + (S13-2); (I-
91) + (S13-3); (1-91 ) + (S13-4): (1-91) + (S13-5); (1-91) + (S13-6); (1-91) + (S13-7); (1-91) + (S13-8); (1-91 ) + (S13-9); (1-91 ) + (S14-1 )
(I-92) + (S1-1); (I-92) + (S1-2); (I-92) + (S1-3); (I-92) + (S1-4); (I-92) + (S1-5); (I-
92) + (S1-6); (I-92) + (S1-7); (I-92) + (S1-8); (I-92) + (S1-9); (I-92) + (S1-10); (I-92) + (S1-11 ); (I-92) + (S1-12); (I-92) + (S1-13); (I-92) + (S2-1 ); (I-92) + (S2-2); (I-92) +
(S2-3); (1-92) + (S2-4); (1-92) + (S2-5); (1-92) + (S2-6); (1-92) + (S2-7); (1-92) + (S2- 8); (1-92) + (S2-9); (1-92) + (S2-10); (I-92) + (S3-1 ); (I-92) + (S3-2); (I-92) + (S3-3); (I-92) + (S3-4); (I-92) + (S3-5); (I-92) + (S3-6); (I-92) + (S3-7); (I-92) + (S3-8); (I- 92) + (S3-9); (I-92) + (S3-10); (I-92) + (S3-11); (I-92) + (S4-1); (I-92) + (S4-2); (I- 92) + (S4-3); (I-92) + (S4-4); (I-92) + (S4-5); (I-92) + (S7-1); (I-92) + (S11-1); (I-92) + (S11-2); (I-92) + (S11-3); (I-92) + (S12-1 ); (I-92) + (S13-1); (I-92) + (S13-2); (I-
92) + (S13-3); (I-92) + (S13-4): (I-92) + (S13-5); (I-92) + (S13-6); (I-92) + (S13-7); (I-92) + (S13-8); (I-92) + (S13-9); (I-92) + (S14-1 )
(I-93) + (S1-1 ); (I-93) + (S1-2); (I-93) + (S1-3); (I-93) + (S1-4); (I-93) + (S1-5); (I-
93) + (S1-6); (I-93) + (S1-7); (I-93) + (S1-8); (I-93) + (S1-9); (I-93) + (S1-10); (I-93) + (S1-11); (I-93) + (S1-12); (I-93) + (S1-13); (I-93) + (S2-1); (I-93) + (S2-2); (I-93) + (S2-3); (I-93) + (S2-4); (I-93) + (S2-5); (I-93) + (S2-6); (I-93) + (S2-7); (I-93) + (S2- 8); (I-93) + (S2-9); (I-93) + (S2-10); (I-93) + (S3-1); (I-93) + (S3-2); (I-93) + (S3-3); (I-93) + (S3-4); (I-93) + (S3-5); (I-93) + (S3-6); (I-93) + (S3-7); (I-93) + (S3-8); (I- 93) + (S3-9); (I-93) + (S3-10); (I-93) + (S3-11); (I-93) + (S4-1 ); (I-93) + (S4-2); (I- 93) + (S4-3); (I-93) + (S4-4); (I-93) + (S4-5); (I-93) + (S7-1); (I-93) + (S11-1); (I-93) + (S11-2); (I-93) + (S11-3); (I-93) + (S12-1); (I-93) + (S13-1); (I-93) + (S13-2); (I-
93) + (S13-3); (I-93) + (S13-4): (I-93) + (S13-5); (I-93) + (S13-6); (I-93) + (S13-7); (I-93) + (S13-8); (I-93) + (S13-9); (I-93) + (S14-1)
(I-94) + (S1-1 ); (I-94) + (S1-2); (I-94) + (S1-3); (I-94) + (S1-4); (I-94) + (S1-5); (I-
94) + (S1-6); (I-94) + (S1-7); (I-94) + (S1-8); (I-94) + (S1-9); (I-94) + (S1-10); (I-94) + (S1-11); (I-94) + (S1-12); (I-94) + (S1-13); (I-94) + (S2-1); (I-94) + (S2-2); (I-94) + (S2-3); (I-94) + (S2-4); (I-94) + (S2-5); (I-94) + (S2-6); (I-94) + (S2-7); (I-94) + (S2- 8); (I-94) + (S2-9); (I-94) + (S2-10); (I-94) + (S3-1); (I-94) + (S3-2); (I-94) + (S3-3); (I-94) + (S3-4); (I-94) + (S3-5); (I-94) + (S3-6); (I-94) + (S3-7); (I-94) + (S3-8); (I- 94) + (S3-9); (I-94) + (S3-10); (I-94) + (S3-11); (I-94) + (S4-1 ); (I-94) + (S4-2); (I- 94) + (S4-3); (I-94) + (S4-4); (I-94) + (S4-5); (I-94) + (S7-1); (I-94) + (S11-1); (I-94) + (S1 1-2); (I-94) + (S11-3); (I-94) + (S12-1); (I-94) + (S13-1); (I-94) + (S13-2); (I-
94) + (S13-3); (I-94) + (S13-4): (I-94) + (S13-5); (I-94) + (S13-6); (I-94) + (S13-7); (I-94) + (S13-8); (I-94) + (S13-9); (I-94) + (S14-1)
(I-95) + (S1-1); (I-95) + (S1-2); (I-95) + (S1-3); (I-95) + (S1-4); (I-95) + (S1-5); (I-
95) + (S1-6); (I-95) + (S1-7); (I-95) + (S1-8); (I-95) + (S1-9); (I-95) + (S1-10); (I-95)
+ (S1-11); (I-95) + (S1-12); (I-95) + (S1-13); (I-95) + (S2-1); (I-95) + (S2-2); (I-95) + (S2-3); (I-95) + (S2-4); (I-95) + (S2-5); (I-95) + (S2-6); (I-95) + (S2-7); (I-95) + (S2- 8); (I-95) + (S2-9); (I-95) + (S2-10); (I-95) + (S3-1); (I-95) + (S3-2); (I-95) + (S3-3); (I-95) + (S3-4); (I-95) + (S3-5); (I-95) + (S3-6); (I-95) + (S3-7); (I-95) + (S3-8); (I- 95) + (S3-9); (I-95) + (S3-10); (I-95) + (S3-11); (I-95) + (S4-1); (I-95) + (S4-2); (I- 95) + (S4-3); (I-95) + (S4-4); (I-95) + (S4-5); (I-95) + (S7-1); (I-95) + (S11-1); (I-95) + (S11-2); (I-95) + (S11-3); (I-95) + (S12-1); (I-95) + (S13-1); (I-95) + (S13-2); (I-
95) + (S13-3); (I-95) + (S13-4): (I-95) + (S13-5); (I-95) + (S13-6); (I-95) + (S13-7); (I-95) + (S13-8); (I-95) + (S13-9); (I-95) + (S14-1)
(I-96) + (S1-1); (I-96) + (S1-2); (I-96) + (S1-3); (I-96) + (S1-4); (I-96) + (S1-5); (I-
96) + (S1-6); (I-96) + (S1-7); (I-96) + (S1-8); (I-96) + (S1-9); (I-96) + (S1-10); (I-96) + (S1-11); (I-96) + (S1-12); (I-96) + (S1-13); (I-96) + (S2-1); (I-96) + (S2-2); (I-96) + (S2-3); (I-96) + (S2-4); (I-96) + (S2-5); (I-96) + (S2-6); (I-96) + (S2-7); (I-96) + (S2- 8); (I-96) + (S2-9); (I-96) + (S2-10); (I-96) + (S3-1); (I-96) + (S3-2); (I-96) + (S3-3); (I-96) + (S3-4); (I-96) + (S3-5); (I-96) + (S3-6); (I-96) + (S3-7); (I-96) + (S3-8); (I- 96) + (S3-9); (I-96) + (S3-10); (I-96) + (S3-11); (I-96) + (S4-1 ); (I-96) + (S4-2); (I- 96) + (S4-3); (I-96) + (S4-4); (I-96) + (S4-5); (I-96) + (S7-1); (I-96) + (S11-1); (I-96) + (S11-2); (I-96) + (S11-3); (I-96) + (S12-1); (I-96) + (S13-1); (I-96) + (S13-2); (I-
96) + (S13-3); (I-96) + (S13-4): (I-96) + (S13-5); (I-96) + (S13-6); (I-96) + (S13-7); (I-96) + (S13-8); (I-96) + (S13-9); (I-96) + (S14-1)
(I-97) + (S1-1); (I-97) + (S1-2); (I-97) + (S1-3); (I-97) + (S1-4); (I-97) + (S1-5); (I-
97) + (S1-6); (I-97) + (S1-7); (I-97) + (S1-8); (I-97) + (S1-9); (I-97) + (S1-10); (I-97) + (S1-11); (I-97) + (S1-12); (I-97) + (S1-13); (I-97) + (S2-1); (I-97) + (S2-2); (I-97) + (S2-3); (I-97) + (S2-4); (I-97) + (S2-5); (I-97) + (S2-6); (I-97) + (S2-7); (I-97) + (S2- 8); (I-97) + (S2-9); (I-97) + (S2-10); (I-97) + (S3-1 ); (I-97) + (S3-2); (I-97) + (S3-3); (I-97) + (S3-4); (I-97) + (S3-5); (I-97) + (S3-6); (I-97) + (S3-7); (I-97) + (S3-8); (I- 97) + (S3-9); (I-97) + (S3-10); (I-97) + (S3-11); (I-97) + (S4-1); (I-97) + (S4-2); (I- 97) + (S4-3); (I-97) + (S4-4); (I-97) + (S4-5); (I-97) + (S7-1); (I-97) + (S11-1); (I-97) + (S11-2); (I-97) + (S11-3); (I-97) + (S12-1 ); (I-97) + (S13-1 ); (I-97) + (S13-2); (I- 97) + (S13-3); (I-97) + (S13-4): (I-97) + (S13-5); (I-97) + (S13-6); (I-97) + (S13-7); (I-97) + (S13-8); (I-97) + (S13-9); (I-97) + (S14-1)
(I-98) + (S1-1); (I-98) + (S1-2); (I-98) + (S1-3); (I-98) + (S1-4); (I-98) + (S1-5); (I-
98) + (S1-6); (I-98) + (S1-7); (I-98) + (S1-8); (I-98) + (S1-9); (I-98) + (S1-10); (I-98) + (S1-11 ); (I-98) + (S1-12); (I-98) + (S1-13); (I-98) + (S2-1); (I-98) + (S2-2); (I-98) + (S2-3); (I-98) + (S2-4); (I-98) + (S2-5); (I-98) + (S2-6); (I-98) + (S2-7); (I-98) + (S2- 8); (I-98) + (S2-9); (I-98) + (S2-10); (I-98) + (S3-1); (I-98) + (S3-2); (I-98) + (S3-3); (I-98) + (S3-4); (I-98) + (S3-5); (I-98) + (S3-6); (I-98) + (S3-7); (I-98) + (S3-8); (I- 98) + (S3-9); (I-98) + (S3-10); (I-98) + (S3-11); (I-98) + (S4-1); (I-98) + (S4-2); (I- 98) + (S4-3); (I-98) + (S4-4); (I-98) + (S4-5); (I-98) + (S7-1); (I-98) + (S11-1); (I-98) + (S11-2); (I-98) + (S11-3); (I-98) + (S12-1 ); (I-98) + (S13-1); (I-98) + (S13-2); (I-
98) + (S13-3); (I-98) + (S13-4): (I-98) + (S13-5); (I-98) + (S13-6); (I-98) + (S13-7); (I-98) + (S13-8); (I-98) + (S13-9); (I-98) + (S14-1 )
(I-99) + (S1-1 ); (I-99) + (S1-2); (I-99) + (S1-3); (I-99) + (S1-4); (I-99) + (S1-5); (I-
99) + (S1-6); (I-99) + (S1-7); (I-99) + (S1-8); (I-99) + (S1-9); (I-99) + (S1-10); (I-99) + (S1-11 ); (I-99) + (S1-12); (I-99) + (S1-13); (I-99) + (S2-1); (I-99) + (S2-2); (I-99) + (S2-3); (I-99) + (S2-4); (I-99) + (S2-5); (I-99) + (S2-6); (I-99) + (S2-7); (I-99) + (S2- 8); (I-99) + (S2-9); (I-99) + (S2-10); (I-99) + (S3-1); (I-99) + (S3-2); (I-99) + (S3-3); (I-99) + (S3-4); (I-99) + (S3-5); (I-99) + (S3-6); (I-99) + (S3-7); (I-99) + (S3-8); (I- 99) + (S3-9); (I-99) + (S3-10); (I-99) + (S3-11); (I-99) + (S4-1); (I-99) + (S4-2); (I- 99) + (S4-3); (I-99) + (S4-4); (I-99) + (S4-5); (I-99) + (S7-1 ); (I-99) + (S1 1-1); (I-99) + (S11-2); (I-99) + (S11-3); (I-99) + (S12-1); (I-99) + (S13-1); (I-99) + (S13-2); (I-
99) + (S13-3); (I-99) + (S13-4): (I-99) + (S13-5); (I-99) + (S13-6); (I-99) + (S13-7); (I-99) + (S13-8); (I-99) + (S13-9); (I-99) + (S14-1)
(1-100) + (S1-1 ); (1-100) + (S1-2); (1-100) + (S1-3); (1-100) + (S1-4); (1-100) + (S1- 5); (1-100) + (S1-6); (1-100) + (S1-7); (1-100) + (S1-8); (1-100) + (S1-9); (1-100) + (S1-10); (1-100) + (S1-11 ); (1-100) + (S1-12); (1-100) + (S1-13); (1-100) + (S2-1); (I-
100) + (S2-2); (1-100) + (S2-3); (1-100) + (S2-4); (1-100) + (S2-5); (1-100) + (S2-6); (1-100) + (S2-7); (1-100) + (S2-8); (1-100) + (S2-9); (1-100) + (S2-10); (1-100) + (S3- 1); (1-100) + (S3-2); (1-100) + (S3-3); (1-100) + (S3-4); (1-100) + (S3-5); (1-100) + (S3-6); (1-100) + (S3-7); (1-100) + (S3-8); (1-100) + (S3-9); (1-100) + (S3-10); (1-100) + (S3-11); (1-100) + (S4-1 ); (1-100) + (S4-2); (1-100) + (S4-3); (1-100) + (S4-4); (I- 100) + (S4-5); (1-100) + (S7-1 ); (1-100) + (S11-1); (1-100) + (S11-2); (1-100) + (S11- 3); (1-100) + (S12-1); (1-100) + (S13-1); (1-100) + (S13-2); (1-100) + (S13-3); (1-100) + (S13-4): (1-100) + (S13-5); (1-100) + (S13-6); (1-100) + (S13-7); (1-100) + (S13-8);
(1-100) + (S13-9); (1-100) + (S14-1)
(1-101 ) + (S1-1 ); (1-101) + (S1-2); (1-101 ) + (S1-3); (1-101 ) + (S1-4); (1-101 ) + (S1- 5); (1-101) + (S1-6); (1-101) + (S1-7); (1-101) + (S1-8); (1-101) + (S1-9); (1-101 ) + (S1-10); (1-101) + (S1-11); (1-101) + (S1-12); (1-101) + (S1-13); (1-101) + (S2-1 ); (I- 101) + (S2-2); (1-101) + (S2-3); (1-101) + (S2^); (1-101) + (S2-5); (1-101) + (S2-6); (1-101 ) + (S2-7); (1-101) + (S2-8); (1-101 ) + (S2-9); (1-101 ) + (S2-10); (1-101) + (S3- 1 ); (1-101) + (S3-2); (1-101) + (S3-3); (1-101) + (S3-4); (1-101) + (S3-5); (1-101) + (S3-6); (1-101) + (S3-7); (1-101 ) + (S3-8); (1-101) + (S3-9); (1-101) + (S3-10); (1-101 ) + (S3-11 ); (1-101) + (S4-1); (1-101) + (S4-2); (1-101) + (S4-3); (1-101) + (S4-4); (I-
101) + (S4-5); (1-101) + (S7-1 ); (1-101) + (S11-1 ); (1-101) + (S11-2); (1-101 ) + (S11- 3); (1-101) + (S12-1); (1-101) + (S13-1); (1-101) + (S13-2); (1-101) + (S13-3); (1-101 ) + (S13-4): (1-101) + (S13-5); (1-101) + (S13-6); (1-101) + (S13-7); (1-101) + (S13-8); (1-101 ) + (S13-9); (1-101) + (S14-1 )
(1-102) + (S1-1); (1-102) + (S1-2); (1-102) + (S1-3); (1-102) + (S1^); (1-102) + (S1- 5); (1-102) + (S1-6); (1-102) + (S1-7); (1-102) + (S1-8); (1-102) + (S1-9); (1-102) + (S1-10); (1-102) + (S1-11 ); (1-102) + (S1-12); (1-102) + (S1-13); (1-102) + (S2-1); (I-
102) + (S2-2); (1-102) + (S2-3); (1-102) + (S2-4); (1-102) + (S2-5); (1-102) + (S2-6); (1-102) + (S2-7); (1-102) + (S2-8); (1-102) + (S2-9); (1-102) + (S2-10); (1-102) + (S3- 1); (1-102) + (S3-2); (1-102) + (S3-3); (1-102) + (S3-4); (1-102) + (S3-5); (1-102) + (S3-6); (1-102) + (S3-7); (1-102) + (S3-8); (1-102) + (S3-9); (1-102) + (S3-10); (1-102) + (S3-11 ); (1-102) + (S4-1); (1-102) + (S4-2); (1-102) + (S4-3); (1-102) + (S4-4); (I-
102) + (S4-5); (1-102) + (S7-1); (1-102) + (S11-1 ); (1-102) + (S11-2); (1-102) + (S1 1- 3); (1-102) + (S12-1); (1-102) + (S13-1 ); (1-102) + (S13-2); (1-102) + (S13-3); (1-102) + (S13-4): (1-102) + (S13-5); (1-102) + (S13-6); (1-102) + (S13-7); (1-102) + (S13-8); (1-102) + (S13-9); (1-102) + (S14-1 )
(1-103) + (S1-1); (1-103) + (S1-2); (1-103) + (S1-3); (1-103) + (S1-4); (1-103) + (S1- 5); (1-103) + (S1-6); (1-103) + (S1-7); (1-103) + (S1-8); (1-103) + (S1-9); (1-103) + (S1-10); (1-103) + (S1-11); (1-103) + (S1-12); (1-103) + (S1-13); (1-103) + (S2-1 ); (I-
103) + (S2-2); (1-103) + (S2-3); (1-103) + (S2-4); (1-103) + (S2-5); (1-103) + (S2-6); (1-103) + (S2-7); (1-103) + (S2-8); (1-103) + (S2-9); (1-103) + (S2-10); (1-103) + (S3- 1); (1-103) + (S3-2); (1-103) + (S3-3); (1-103) + (S3-4); (1-103) + (S3-5); (1-103) + (S3-6); (1-103) + (S3-7); (1-103) + (S3-8); (1-103) + (S3-9); (1-103) + (S3-10); (1-103)
+ (S3-11); (1-103) + (S4-1); (1-103) + (S4-2); (1-103) + (S4-3); (1-103) + (S4-4); (I-
103) + (S4-5); (1-103) + (S7-1 ); (1-103) + (S11-1 ); (1-103) + (S11-2); (1-103) + (S11- 3); (1-103) + (S12-1); (1-103) + (S13-1); (1-103) + (S13-2); (1-103) + (S13-3); (1-103) + (S13-4): (1-103) + (S13-5); (1-103) + (S13-6); (1-103) + (S13-7); (1-103) + (S13-8); (1-103) + (S13-9); (1-103) + (S14-1)
(1-104) + (S1-1); (1-104) + (S1-2); (1-104) + (S1-3); (1-104) + (S1-4); (1-104) + (S1- 5); (|-1 O4) + (S1-6); (1-104) + (S1-7); (1-104) + (S1-8); (1-104) + (S1-9); (1-104) + (S1-10); (1-104) + (S1-11); (1-104) + (S1-12); (1-104) + (S1-13); (1-104) + (S2-1); (I-
104) + (S2-2); (1-104) + (S2-3); (1-104) + (S2-4); (1-104) + (S2-5); (1-104) + (S2-6); (1-104) + (S2-7); (1-104) + (S2-8); (1-104) + (S2-9); (1-104) + (S2-10); (1-104) + (S3- 1); (1-104) + (S3-2); (1-104) + (S3-3); (1-104) + (S3-4); (1-104) + (S3-5); (1-104) + (S3-6); (1-104) + (S3-7); (1-104) + (S3-8); (1-104) + (S3-9); (1-104) + (S3-10); (1-104) + (S3-11); (1-104) + (S4-1); (1-104) + (S4-2); (1-104) + (S4-3); (1-104) + (S4-4); (I-
104) + (S4-5); (1-104) + (S7-1 ); (1-104) + (S11-1); (1-104) + (S11-2); (1-104) + (S11- 3); (1-104) + (S12-1 ); (1-104) + (S13-1 ); (1-104) + (S13-2); (1-104) + (S13-3); (1-104) + (S13-4): (1-104) + (S13-5); (1-104) + (S13-6); (1-104) + (S13-7); (1-104) + (S13-8); (1-104) + (S13-9); (1-104) + (S14-1)
(1-105) + (S1-1); (1-105) + (S1-2); (1-105) + (S1-3); (1-105) + (S1^); (1-105) + (S1- 5); (1-105) + (S1-6); (1-105) + (S1-7); (1-105) + (S1-8); (1-105) + (S1-9); (1-105) + (S1-10); (1-105) + (S1-11); (1-105) + (S1-12); (1-105) + (S1-13); (1-105) + (S2-1); (I-
105) + (S2-2); (1-105) + (S2-3); (1-105) + (S2-4); (1-105) + (S2-5); (1-105) + (S2-6); (1-105) + (S2-7); (1-105) + (S2-8); (1-105) + (S2-9); (1-105) + (S2-10); (1-105) + (S3- 1 ); (1-105) + (S3-2); (1-105) + (S3-3); (1-105) + (S3-4); (1-105) + (S3-5); (1-105) + (S3-6); (1-105) + (S3-7); (1-105) + (S3-8); (1-105) + (S3-9); (1-105) + (S3-10); (1-105) + (S3-11); (1-105) + (S4-1); (1-105) + (S4-2); (1-105) + (S4-3); (1-105) + (S4-4); (I- 105) + (S4-5); (1-105) + (S7-1 ); (1-105) + (S11-1 ); (1-105) + (S11-2); (1-105) + (S11- 3); (1-105) + (S12-1); (1-105) + (S13-1); (1-105) + (S13-2); (1-105) + (S13-3); (1-105) + (S13-4): (1-105) + (S13-5); (1-105) + (S13-6); (1-105) + (S13-7); (1-105) + (S13-8); (1-105) + (S13-9); (1-105) + (S14-1)
(1-106) + (S1-1); (1-106) + (S1-2); (1-106) + (S1-3); (1-106) + (S1-4); (1-106) + (S1- 5); (1-106) + (S1-6); (1-106) + (S1-7); (1-106) + (S1-8); (1-106) + (S1-9); (1-106) + (S1-10); (1-106) + (S1-11); (1-106) + (S1-12); (1-106) + (S1-13); (1-106) + (S2-1); (I-
106) + (S2-2); (1-106) + (S2-3); (1-106) + (S2-4); (1-106) + (S2-5); (1-106) + (S2-6); (1-106) + (S2-7); (1-106) + (S2-8); (1-106) + (S2-9); (1-106) + (S2-10); (1-106) + (S3- 1); (1-106) + (S3-2); (1-106) + (S3-3); (1-106) + (S3-4); (1-106) + (S3-5); (1-106) + (S3-6); (1-106) + (S3-7); (1-106) + (S3-8); (1-106) + (S3-9); (1-106) + (S3-10); (1-106) + (S3-11); (1-106) + (S4-1); (1-106) + (S4-2); (1-106) + (S4-3); (1-106) + (S4-4); (I-
106) + (S4-5); (1-106) + (S7-1); (1-106) + (S11-1); (1-106) + (S11-2); (1-106) + (S11- 3); (1-106) + (S12-1); (1-106) + (S13-1); (1-106) + (S13-2); (1-106) + (S13-3); (1-106) + (S13-4): (1-106) + (S13-5); (1-106) + (S13-6); (1-106) + (S13-7); (1-106) + (S13-8); (1-106) + (S13-9); (1-106) + (S14-1)
(1-107) + (S1-1); (1-107) + (S1-2); (1-107) + (S1-3); (1-107) + (S1-4); (1-107) + (S1- 5); (1-107) + (S1-6); (1-107) + (S1-7); (1-107) + (S1-8); (1-107) + (S1-9); (1-107) + (S1-10); (1-107) + (S1-11); (1-107) + (S1-12); (1-107) + (S1-13); (1-107) + (S2-1); (I-
107) + (S2-2); (1-107) + (S2-3); (1-107) + (S2-4); (1-107) + (S2-5); (1-107) + (S2-6); (1-107) + (S2-7); (1-107) + (S2-8); (1-107) + (S2-9); (1-107) + (S2-10); (1-107) + (S3- 1); (1-107) + (S3-2); (1-107) + (S3-3); (1-107) + (S3-4); (1-107) + (S3-5); (1-107) + (S3-6); (1-107) + (S3-7); (1-107) + (S3-8); (1-107) + (S3-9); (1-107) + (S3-10); (1-107) + (S3-11); (1-107) + (S4-1); (1-107) + (S4-2); (1-107) + (S4-3); (1-107) + (S4-4); (I-
107) + (S4-5); (1-107) + (S7-1); (1-107) + (S11-1); (1-107) + (S11-2); (1-107) + (S11- 3); (1-107) + (S12-1); (1-107) + (S13-1); (1-107) + (S13-2); (1-107) + (S13-3); (1-107) + (S13-4): (1-107) + (S13-5); (1-107) + (S13-6); (1-107) + (S13-7); (1-107) + (S13-8); (1-107) + (S13-9); (1-107) + (S14-1)
(1-108) + (S1-1); (1-108) + (S1-2); (1-108) + (S1-3); (1-108) + (S1-4); (1-108) + (S1- 5); (1-108) + (S1-6); (1-108) + (S1-7); (1-108) + (S1-8); (1-108) + (S1-9); (1-108) + (S1-10); (1-108) + (S1-11); (1-108) + (S1-12); (1-108) + (S1-13); (1-108) + (S2-1); (I-
108) + (S2-2); (1-108) + (S2-3); (1-108) + (S2-4); (1-108) + (S2-5); (1-108) + (S2-6); (1-108) + (S2-7); (1-108) + (S2-8); (1-108) + (S2-9); (1-108) + (S2-10); (1-108) + (S3- 1); (1-108) + (S3-2); (1-108) + (S3-3); (1-108) + (S3-4); (1-108) + (S3-5); (1-108) + (S3-6); (1-108) + (S3-7); (1-108) + (S3-8); (1-108) + (S3-9); (1-108) + (S3-10); (1-108) + (S3-11); (1-108) + (S4-1); (1-108) + (S4-2); (1-108) + (S4-3); (1-108) + (S4-4); (I- 108) + (S4-5); (1-108) + (S7-1); (1-108) + (S11-1); (1-108) + (S11-2); (1-108) + (S11- 3); (1-108) + (S12-1); (1-108) + (S13-1); (1-108) + (S13-2); (1-108) + (S13-3); (1-108) + (S13-4): (1-108) + (S13-5); (1-108) + (S13-6); (1-108) + (S13-7); (1-108) + (S13-8);
(1-108) + (S13-9); (1-108) + (S14-1)
(1-109) + (S1-1); (1-109) + (S1-2); (1-109) + (S1-3); (1-109) + (S1-4); (1-109) + (S1- 5); (1-109) + (S1-6); (1-109) + (S1-7); (1-109) + (S1-8); (1-109) + (S1-9); (1-109) + (S1-10); (1-109) + (S1-11); (1-109) + (S1-12); (1-109) + (S1-13); (1-109) + (S2-1 ); (I- 109) + (S2-2); (1-109) + (S2-3); (1-109) + (S2-4); (1-109) + (S2-5); (1-109) + (S2-6); (1-109) + (S2-7); (1-109) + (S2-8); (1-109) + (S2-9); (1-109) + (S2-10); (1-109) + (S3- 1); (1-109) + (S3-2); (1-109) + (S3-3); (1-109) + (S3-4); (1-109) + (S3-5); (1-109) + (S3-6); (1-109) + (S3-7); (1-109) + (S3-8); (1-109) + (S3-9); (1-109) + (S3-10); (1-109) + (S3-11); (1-109) + (S4-1 ); (1-109) + (S4-2); (1-109) + (S4-3); (1-109) + (S4-4); (I-
109) + (S4-5); (1-109) + (S7-1); (1-109) + (S11-1); (1-109) + (S11-2); (1-109) + (S11- 3); (1-109) + (S12-1); (1-109) + (S13-1); (1-109) + (S13-2); (1-109) + (S13-3); (1-109) + (S13-4): (1-109) + (S13-5); (1-109) + (S13-6); (1-109) + (S13-7); (1-109) + (S13-8); (1-109) + (S13-9); (1-109) + (S14-1 )
(1-110) + (S1-1); (1-110) + (S1-2); (1-110) + (S1-3); (1-110) + (S1-4); (1-110) + (S1- 5); (1-110) + (S1-6); (1-110) + (S1-7); (1-110) + (S1-8); (1-110) + (S1-9); (1-110) + (S1-10); (1-110) + (S1-1 1); (1-110) + (S1-12); (1-110) + (S1-13); (1-110) + (S2-1); (I-
110) + (S2-2); (1-110) + (S2-3); (1-110) + (S2-4); (1-110) + (S2-5); (1-110) + (S2-6); (1-110) + (S2-7); (1-110) + (S2-8); (1-110) + (S2-9); (1-110) + (S2-10); (1-110) + (S3- 1 ); (1-110) + (S3-2); (1-110) + (S3-3); (1-110) + (S3-4); (1-110) + (S3-5); (1-110) + (S3-6); (1-110) + (S3-7); (1-110) + (S3-8); (1-110) + (S3-9); (1-110) + (S3-10); (1-110) + (S3-11 ); (1-110) + (S4-1 ); (1-1 10) + (S4-2); (1-110) + (S4-3); (1-110) + (S4-4); (I-
110) + (S4-5); (1-110) + (S7-1); (1-110) + (S11-1 ); (1-110) + (S11-2); (1-110) + (S11- 3); (1-110) + (S12-1); (1-110) + (S13-1); (1-110) + (S13-2); (1-110) + (S13-3); (1-110) + (S13-4): (1-110) + (S13-5); (1-110) + (S13-6); (1-110) + (S13-7); (1-110) + (S13-8); (1-110) + (S13-9); (1-110) + (S14-1)
(1-111) + (S1-1); (1-111) + (S1-2); (1-111) + (S1-3); (1-111) + (S1-4); (1-111 ) + (S1- 5); (1-111) + (S1-6); (1-111 ) + (S1-7); (1-111 ) + (S1-8); (1-111) + (S1-9); (1-111 ) + (S1-10); (1-111) + (S1-11); (1-111) + (S1-12); (1-111) + (S1-13); (1-111) + (S2-1); (I-
111) + (S2-2); (1-111 ) + (S2-3); (1-111) + (S2-4); (1-111) + (S2-5); (1-111 ) + (S2-6); (1-111) + (S2-7); (1-111) + (S2-8); (1-11 1) + (S2-9); (1-111) + (S2-10); (1-111 ) + (S3- 1 ); (1-1 11 ) + (S3-2); (1-111) + (S3-3); (1-111) + (S3-4); (1-111) + (S3-5); (1-111) + (S3-6); (1-111) + (S3-7); (1-111 ) + (S3-8); (1-111) + (S3-9); (1-111 ) + (S3-10); (1-111 )
+ (S3-11 ); (1-111 ) + (S4-1 ); (1-111) + (S4-2); (1-111 ) + (S4-3); (1-111) + (S4-4); (I-
111) + (S4-5); (1-111 ) + (S7-1 ); (1-1 11) + (S11-1); (1-111 ) + (S11-2); (1-11 1 ) + (S11- 3); (1-111 ) + (S12-1); (1-111) + (S13-1); (1-111) + (S13-2); (1-111) + (S13-3); (1-111) + (S13-4): (1-111 ) + (S13-5); (1-1 11) + (S13-6); (1-111) + (S13-7); (1-111) + (S13-8); (1-111 ) + (S13-9); (1-111 ) + (S14-1)
(1-112) + (S1-1 ); (1-112) + (S1-2); (1-112) + (S1-3); (1-112) + (S1-4); (1-112) + (S1- 5); (1-112) + (S1-6); (1-112) + (S1-7); (1-112) + (S1-8); (1-112) + (S1-9); (1-112) + (S1-10); (1-112) + (S1-11 ); (1-112) + (S1-12); (1-112) + (S1-13); (1-112) + (S2-1); (I-
112) + (S2-2); (1-112) + (S2-3); (1-112) + (S2^); (1-112) + (S2-5); (1-112) + (S2-6); (1-112) + (S2-7); (1-112) + (S2-8); (1-112) + (S2-9); (1-112) + (S2-10); (1-112) + (S3- 1 ); (1-112) + (S3-2); (1-112) + (S3-3); (1-112) + (S3-4); (1-112) + (S3-5); (1-112) + (S3-6); (1-112) + (S3-7); (1-112) + (S3-8); (1-112) + (S3-9); (1-112) + (S3-10); (1-112) + (S3-11); (1-112) + (S4-1); (1-112) + (S4-2); (1-112) + (S4-3); (1-112) + (S4-4); (I-
112) + (S4-5); (1-112) + (S7-1); (1-112) + (S11-1 ); (1-112) + (S11-2); (1-1 12) + (S11- 3); (1-112) + (S12-1); (1-112) + (S13-1); (1-112) + (S13-2); (1-112) + (S13-3); (1-112) + (S13-4): (1-112) + (S13-5); (1-112) + (S13-6); (1-112) + (S13-7); (1-112) + (S13-8); (1-112) + (S13-9); (1-112) + (S14-1)
(1-113) + (S1-1 ); (1-113) + (S1-2); (1-113) + (S1-3); (1-113) + (S1-4); (1-113) + (S1- 5); (1-113) + (S1-6); (1-113) + (S1 -7); (1-113) + (S1-8); (1-113) + (S1-9); (1-113) + (S1-10); (1-113) + (S1-1 1 ); (1-113) + (S1-12); (1-113) + (S1-13); (1-113) + (S2-1); (I-
113) + (S2-2); (1-113) + (S2-3); (1-113) + (S2-4); (1-113) + (S2-5); (1-113) + (S2-6); (1-113) + (S2-7); (1-113) + (S2-8); (1-113) + (S2-9); (1-113) + (S2-10); (1-113) + (S3- 1 ); (1-113) + (S3-2); (1-113) + (S3-3); (1-113) + (S3-4); (1-113) + (S3-5); (1-113) + (S3-6); (1-113) + (S3-7); (1-113) + (S3-8); (1-113) + (S3-9); (1-113) + (S3-10); (1-113) + (S3-11 ); (1-113) + (S4-1 ); (1-113) + (S4-2); (1-113) + (S4-3); (1-113) + (S4-4); (I- 113) + (S4-5); (1-113) + (S7-1); (1-113) + (S11-1); (1-113) + (S11-2); (1-113) + (S11- 3); (1-113) + (S12-1 ); (1-113) + (S13-1); (1-113) + (S13-2); (1-113) + (S13-3); (1-113) + (S13-4): (1-113) + (S13-5); (1-113) + (S13-6); (1-113) + (S13-7); (1-113) + (S13-8); (1-113) + (S13-9); (1-113) + (S14-1)
(1-114) + (S1-1); (1-114) + (S1-2); (1-114) + (S1-3); (1-114) + (S1-4); (1-114) + (S1- 5); (1-114) + (S1-6); (1-114) + (S1-7); (1-114) + (S1-8); (1-114) + (S1-9); (1-1 14) + (S1-10); (1-114) + (S1-11); (1-114) + (S1-12); (1-114) + (S1-13); (1-114) + (S2-1); (I-
114) + (S2-2); (1-114) + (S2-3); (1-114) + (S2-4); (1-114) + (S2-5); (1-114) + (S2-6); (1-114) + (S2-7); (1-114) + (S2-8); (1-114) + (S2-9); (1-114) + (S2-10); (1-114) + (S3- 1 ); (1-114) + (S3-2); (1-114) + (S3-3); (1-114) + (S3-4); (1-114) + (S3-5); (1-114) + (S3-6); (1-114) + (S3-7); (1-114) + (S3-8); (1-114) + (S3-9); (1-114) + (S3-10); (1-114) + (S3-11); (1-114) + (S4-1); (1-114) + (S4-2); (1-114) + (S4-3); (1-114) + (S4-4); (I-
114) + (S4-5); (1-114) + (S7-1); (1-114) + (S11-1); (1-114) + (S11-2); (1-114) + (S11- 3); (1-114) + (S12-1); (1-114) + (S13-1); (1-114) + (S13-2); (1-114) + (S13-3); (1-114) + (S13-4): (1-114) + (S13-5); (1-114) + (S13-6); (1-114) + (S13-7); (1-114) + (S13-8); (1-114) + (S13-9); (1-114) + (S14-1)
(1-115) + (S1-1 ); (1-115) + (S1-2); (1-115) + (S1-3); (1-115) + (S1-4); (1-115) + (S1- 5); (1-115) + (S1-6); (1-115) + (S1-7); (1-115) + (S1-8); (1-115) + (S1-9); (1-115) + (S1-10); (1-115) + (S1-11); (1-115) + (S1-12); (1-115) + (S1-13); (1-115) + (S2-1); (I-
115) + (S2-2); (1-115) + (S2-3); (1-115) + (S2-4); (1-115) + (S2-5); (1-115) + (S2-6); (1-115) + (S2-7); (1-115) + (S2-8); (1-115) + (S2-9); (1-115) + (S2-10); (1-115) + (S3- 1 ); (1-115) + (S3-2); (1-115) + (S3-3); (1-115) + (S3-4); (1-115) + (S3-5); (1-115) + (S3-6); (1-115) + (S3-7); (1-115) + (S3-8); (1-115) + (S3-9); (1-115) + (S3-10); (1-115) + (S3-11); (1-115) + (S4-1 ); (1-115) + (S4-2); (1-115) + (S4-3); (1-115) + (S4-4); (I-
115) + (S4-5); (1-115) + (S7-1); (1-115) + (S11-1); (1-115) + (S11-2); (1-115) + (S11- 3); (1-115) + (S12-1); (1-115) + (S13-1 ); (1-115) + (S13-2); (1-115) + (S13-3); (1-115) + (S13-4): (1-115) + (S13-5); (1-115) + (S13-6); (1-115) + (S13-7); (1-115) + (S13-8); (1-115) + (S13-9); (1-115) + (S14-1)
(1-116) + (S1-1); (1-116) + (S1-2); (1-116) + (S1-3); (1-116) + (S1-4); (1-116) + (S1- 5); (1-116) + (S1-6); (1-116) + (S1-7); (1-116) + (S1-8); (1-116) + (S1-9); (1-116) + (S1-10); (1-116) + (S1-11 ); (1-116) + (S1-12); (1-116) + (S1-13); (1-116) + (S2-1 ); (I-
116) + (S2-2); (1-116) + (S2-3); (1-116) + (S2-4); (1-116) + (S2-5); (1-116) + (S2-6); (1-116) + (S2-7); (1-116) + (S2-8); (1-116) + (S2-9); (1-116) + (S2-10); (1-116) + (S3- 1); (1-116) + (S3-2); (1-116) + (S3-3); (1-116) + (S3-4); (1-116) + (S3-5); (1-116) + (S3-6); (1-116) + (S3-7); (1-116) + (S3-8); (1-116) + (S3-9); (1-116) + (S3-10); (1-116) + (S3-11); (1-116) + (S4-1); (1-116) + (S4-2); (1-116) + (S4-3); (1-116) + (S4-4); (I- 116) + (S4-5); (1-116) + (S7-1); (1-116) + (S11-1); (1-116) + (S11-2); (1-116) + (S11- 3); (1-116) + (S12-1); (1-116) + (S13-1); (1-116) + (S13-2); (1-116) + (S13-3); (1-116) + (S13-4): (1-116) + (S13-5); (1-116) + (S13-6); (1-116) + (S13-7); (1-116) + (S13-8);
(1-116) + (S13-9); (1-116) + (S14-1)
(1-117) + (S1-1); (1-117) + (S1-2); (1-117) + (S1-3); (1-117) + (S 1-4); (1-117) + (S1- 5); (1-117) + (S1-6); (1-117) + (S1-7); (1-117) + (S1-8); (1-117) + (S1-9); (1-1 17) + (S1-10); (1-117) + (S1-11); (1-117) + (S1-12); (1-117) + (S1-13); (1-117) + (S2-1); (I- 117) + (S2-2); (1-117) + (S2-3); (1-117) + (S2-4); (1-117) + (S2-5); (1-117) + (S2-6); (1-117) + (S2-7); (1-117) + (S2-8); (1-117) + (S2-9); (1-1 17) + (S2-10); (1-117) + (S3- 1 ); (1-117) + (S3-2); (1-117) + (S3-3); (1-117) + (S3-4); (1-117) + (S3-5); (1-117) + (S3-6); (1-117) + (S3-7); (1-117) + (S3-8); (1-117) + (S3-9); (1-117) + (S3-10); (1-117) + (S3-11); (1-117) + (S4-1); (1-117) + (S4-2); (1-117) + (S4-3); (1-117) + (S4-4); (I-
117) + (S4-5); (1-117) + (S7-1 ); (1-117) + (S11-1); (1-117) + (S11-2); (1-117) + (S11- 3); (1-117) + (S12-1); (1-117) + (S13-1); (1-117) + (S13-2); (1-117) + (S13-3); (1-117) + (S13-4): (1-117) + (S13-5); (1-117) + (S13-6); (1-117) + (S13-7); (1-117) + (S13-8); (1-117) + (S13-9); (1-117) + (S14-1)
(1-118) + (S1-1 ); (1-1 18) + (S1-2); (1-118) + (S1-3); (1-118) + (S1-4); (1-118) + (S1- 5); (1-118) + (S1-6); (1-118) + (S1-7); (1-118) + (S1-8); (1-118) + (S1-9); (1-118) + (S1-10); (1-118) + (S1-11 ); (1-118) + (S1-12); (1-118) + (S1-13); (1-118) + (S2-1); (I-
118) + (S2-2); (1-118) + (S2-3); (1-118) + (S2-4); (1-118) + (S2-5); (1-118) + (S2-6); (1-118) + (S2-7); (1-118) + (S2-8); (1-118) + (S2-9); (1-118) + (S2-10); (1-118) + (S3- 1 ); (1-118) + (S3-2); (1-118) + (S3-3); (1-118) + (S3-4); (1-118) + (S3-5); (1-118) + (S3-6); (1-118) + (S3-7); (1-118) + (S3-8); (1-118) + (S3-9); (1-118) + (S3-10); (1-118) + (S3-11 ); (1-118) + (S4-1 ); (1-118) + (S4-2); (1-118) + (S4-3); (1-118) + (S4-4); (I-
118) + (S4-5); (1-118) + (S7-1); (1-118) + (S11-1); (1-118) + (S11-2); (1-118) + (S11- 3); (1-118) + (S12-1); (1-118) + (S13-1); (1-118) + (S13-2); (1-118) + (S13-3); (1-118) + (S13-4): (1-118) + (S13-5); (1-118) + (S13-6); (1-118) + (S13-7); (1-118) + (S13-8); (1-118) + (S13-9); (1-118) + (S14-1)
(1-119) + (S1-1); (1-119) + (S1-2); (1-119) + (S1-3); (1-119) + (S1-4); (1-119) + (S1- 5); (1-119) + (S1-6); (1-119) + (S1-7); (1-119) + (S1-8); (1-119) + (S1-9); (1-1 19) + (S1-10); (1-119) + (S1-11); (1-119) + (S1-12); (1-119) + (S1-13); (1-119) + (S2-1); (I-
119) + (S2-2); (1-119) + (S2-3); (1-119) + (S2-4); (1-119) + (S2-5); (1-119) + (S2-6); (1-119) + (S2-7); (1-119) + (S2-8); (1-119) + (S2-9); (1-1 19) + (S2-10); (1-119) + (S3- 1); (1-119) + (S3-2); (1-119) + (S3-3); (1-119) + (S3-4); (1-1 19) + (S3-5); (1-1 19) + (S3-6); (1-119) + (S3-7); (1-119) + (S3-8); (1-119) + (S3-9); (1-119) + (S3-10); (1-119)
+ (S3-11 ); (1-119) + (S4-1 ); (1-119) + (S4-2); (1-119) + (S4-3); (1-119) + (S4-4); (I-
119) + (S4-5); (1-119) + (S7-1); (1-1 19) + (S11-1); (1-119) + (S11-2); (1-1 19) + (S11- 3); (1-119) + (S12-1); (1-119) + (S13-1 ); (1-119) + (S13-2); (1-119) + (S13-3); (1-119) + (S13-4): (1-119) + (S13-5); (1-119) + (S13-6); (1-119) + (S13-7); (1-119) + (S13-8); (1-119) + (S13-9); (1-119) + (S14-1)
(1-120) + (S1-1); (1-120) + (S1 -2); (1-120) + (S1-3); (1-120) + (S1-4); (1-120) + (S1- 5); (1-120) + (S1-6); (1-120) + (S1-7); (1-120) + (S1-8); (1-120) + (S1-9); (1-120) + (S1-10); (1-120) + (S1-11); (1-120) + (S1-12); (1-120) + (S1-13); (1-120) + (S2-1 ); (I-
120) + (S2-2); (1-120) + (S2-3); (1-120) + (S2-4); (1-120) + (S2-5); (1-120) + (S2-6); (1-120) + (S2-7); (1-120) + (S2-8); (1-120) + (S2-9); (1-120) + (S2-10); (1-120) + (S3- 1 ); (1-120) + (S3-2); (1-120) + (S3-3); (1-120) + (S3-4); (1-120) + (S3-5); (1-120) + (S3-6); (1-120) + (S3-7); (1-120) + (S3-8); (1-120) + (S3-9); (1-120) + (S3-10); (1-120) + (S3-11); (1-120) + (S4-1); (1-120) + (S4-2); (1-120) + (S4-3); (1-120) + (S4-4); (I-
120) + (S4-5); (1-120) + (S7-1); (1-120) + (S11-1); (1-120) + (S11-2); (1-120) + (S11- 3); (1-120) + (S12-1); (1-120) + (S13-1); (1-120) + (S13-2); (1-120) + (S13-3); (1-120) + (S13-4): (1-120) + (S13-5); (1-120) + (S13-6); (1-120) + (S13-7); (1-120) + (S13-8); (1-120) + (S13-9); (1-120) + (S14-1)
(1-121) + (S1-1 ); (1-121) + (S1-2); (1-121) + (S1-3); (1-121) + (S1-4); (1-121) + (S1- 5); (1-121) + (S1-6); (1-121) + (S1-7); (1-121) + (S1-8); (1-121) + (S1-9); (1-121) + (S1-10); (1-121 ) + (S1-11); (1-121) + (S1-12); (1-121) + (S1-13); (1-121) + (S2-1); (I-
121) + (S2-2); (1-121) + (S2-3); (1-121) + (S2-4); (1-121) + (S2-5); (1-121) + (S2-6); (1-121 ) + (S2-7); (1-121) + (S2-8); (1-121) + (S2-9); (1-121) + (S2-10); (1-121) + (S3- 1); (1-121) + (S3-2); (1-121) + (S3-3); (1-121 ) + (S3-4); (1-121) + (S3-5); (1-121) + (S3-6); (1-121) + (S3-7); (1-121) + (S3-8); (1-121) + (S3-9); (1-121 ) + (S3-10); (1-121) + (S3-11); (1-121) + (S4-1); (1-121) + (S4-2); (1-121 ) + (S4-3); (1-121 ) + (S4-4); (I- 121 ) + (S4-5); (1-121 ) + (S7-1 ); (1-121) + (S11-1); (1-121 ) + (S11-2); (1-121) + (S11- 3); (1-121) + (S12-1); (1-121) + (S13-1); (1-121) + (S13-2); (1-121) + (S13-3); (1-121) + (S13-4): (1-121) + (S13-5); (1-121) + (S13-6); (1-121) + (S13-7); (1-121) + (S13-8); (1-121) + (S13-9); (1-121 ) + (S14-1)
(1-122) + (S1-1); (1-122) + (S1-2); (1-122) + (S1-3); (1-122) + (S1-4); (1-122) + (S1- 5); (1-122) + (S1-6); (1-122) + (S1-7); (1-122) + (S1-8); (1-122) + (S1-9); (1-122) + (S1-10); (1-122) + (S1-11); (1-122) + (S1-12); (1-122) + (S1-13); (1-122) + (S2-1); (I-
122) + (S2-2); (1-122) + (S2-3); (1-122) + (S2-4); (1-122) + (S2-5); (1-122) + (S2-6); (1-122) + (S2-7); (1-122) + (S2-8); (1-122) + (S2-9); (1-122) + (S2-10); (1-122) + (S3- 1 ); (1-122) + (S3-2); (1-122) + (S3-3); (1-122) + (S3-4); (1-122) + (S3-5); (1-122) + (S3-6); (1-122) + (S3-7); (1-122) + (S3-8); (1-122) + (S3-9); (1-122) + (S3-10); (1-122) + (S3-1 1 ); (1-122) + (S4-1); (1-122) + (S4-2); (1-122) + (S4-3); (1-122) + (S4-4); (I-
122) + (S4-5); (1-122) + (S7-1); (1-122) + (S11-1); (1-122) + (S11-2); (1-122) + (S11- 3); (1-122) + (S12-1); (1-122) + (S13-1); (1-122) + (S13-2); (1-122) + (S13-3); (1-122) + (S 13-4): (1-122) + (S13-5); (1-122) + (S13-6); (1-122) + (S13-7); (1-122) + (S13-8); (1-122) + (S13-9); (1-122) + (S14-1)
(1-123) + (S1-1); (1-123) + (S1-2); (1-123) + (S1-3); (1-123) + (S 1-4); (1-123) + (S1- 5); (1-123) + (S1-6); (1-123) + (S1-7); (1-123) + (S1-8); (1-123) + (S1-9); (1-123) + (S1-10); (1-123) + (S1-11); (1-123) + (S1-12); (1-123) + (S1-13); (1-123) + (S2-1); (I-
123) + (S2-2); (1-123) + (S2-3); (1-123) + (S2-4); (1-123) + (S2-5); (1-123) + (S2-6); (1-123) + (S2-7); (1-123) + (S2-8); (1-123) + (S2-9); (1-123) + (S2-10); (1-123) + (S3- 1); (1-123) + (S3-2); (1-123) + (S3-3); (1-123) + (S3-4); (1-123) + (S3-5); (1-123) + (S3-6); (1-123) + (S3-7); (1-123) + (S3-8); (1-123) + (S3-9); (1-123) + (S3-10); (1-123) + (S3-11 ); (1-123) + (S4-1); (1-123) + (S4-2); (1-123) + (S4-3); (1-123) + (S4-4); (I-
123) + (S4-5); (1-123) + (S7-1); (1-123) + (S11-1); (1-123) + (S11-2); (1-123) + (S11- 3); (1-123) + (S12-1); (1-123) + (S13-1 ); (1-123) + (S13-2); (1-123) + (S13-3); (1-123) + (S13-4): (1-123) + (S13-5); (1-123) + (S13-6); (1-123) + (S13-7); (1-123) + (S13-8); (1-123) + (S13-9); (1-123) + (S14-1 )
(1-124) + (S1-1); (1-124) + (S1-2); (1-124) + (S1-3); (1-124) + (S1^); (1-124) + (S1- 5); (1-124) + (S1-6); (1-124) + (S1-7); (1-124) + (S1-8); (1-124) + (S1-9); (1-124) + (S1-10); (1-124) + (S1-11 ); (1-124) + (S1-12); (1-124) + (S1-13); (1-124) + (S2-1); (I-
124) + (S2-2); (1-124) + (S2-3); (1-124) + (S2-4); (1-124) + (S2-5); (1-124) + (S2-6); (1-124) + (S2-7); (1-124) + (S2-8); (1-124) + (S2-9); (1-124) + (S2-10); (1-124) + (S3- 1 ); (1-124) + (S3-2); (1-124) + (S3-3); (1-124) + (S3-4); (1-124) + (S3-5); (1-124) + (S3-6); (1-124) + (S3-7); (1-124) + (S3-8); (1-124) + (S3-9); (1-124) + (S3-10); (1-124) + (S3-11 ); (1-124) + (S4-1); (1-124) + (S4-2); (1-124) + (S4-3); (1-124) + (S4-4); (I- 124) + (S4-5); (1-124) + (S7-1); (1-124) + (S11-1 ); (1-124) + (S11-2); (1-124) + (S11- 3); (1-124) + (S12-1); (1-124) + (S13-1 ); (1-124) + (S13-2); (1-124) + (S13-3); (1-124) + (S13-4): (1-124) + (S13-5); (1-124) + (S13-6); (1-124) + (S13-7); (1-124) + (S13-8);
(1-124) + (S13-9); (1-124) + (S14-1 )
(1-125) + (SM ); (1-125) + (S1-2); (1-125) + (S1-3); (1-125) + (S1-4); (1-125) + (S1- 5); (1-125) + (S1-6); (1-125) + (S1-7); (1-125) + (S1-8); (1-125) + (S1-9); (1-125) + (SM O); (1-125) + (S1-11); (1-125) + (S1-12); (1-125) + (S1-13); (1-125) + (S2-1); (I- 125) + (S2-2); (1-125) + (S2-3); (1-125) + (S2-4); (1-125) + (S2-5); (1-125) + (S2-6); (1-125) + (S2-7); (1-125) + (S2-8); (1-125) + (S2-9); (1-125) + (S2-10); (1-125) + (S3- 1); (1-125) + (S3-2); (1-125) + (S3-3); (1-125) + (S3-4); (1-125) + (S3-5); (1-125) + (S3-6); (1-125) + (S3-7); (1-125) + (S3-8); (1-125) + (S3-9); (1-125) + (S3-10); (1-125) + (S3-11); (1-125) + (S4-1); (1-125) + (S4-2); (1-125) + (S4-3); (1-125) + (S4-4); (I-
125) + (S4-5); (1-125) + (S7-1); (1-125) + (S11-1); (1-125) + (S11-2); (1-125) + (S11- 3); (1-125) + (S12-1); (1-125) + (S13-1); (1-125) + (S13-2); (1-125) + (S13-3); (1-125) + (S13-4): (1-125) + (S13-5); (1-125) + (S13-6); (1-125) + (S13-7); (1-125) + (S13-8); (1-125) + (S13-9); (1-125) + (S14-1)
(1-126) + (SM); (1-126) + (S1-2); (1-126) + (S1-3); (1-126) + (S1-4); (1-126) + (S1- 5); (1-126) + (S1-6); (1-126) + (S1-7); (1-126) + (S1-8); (1-126) + (S1-9); (1-126) + (SMO); (1-126) + (S1-11); (1-126) + (S1-12); (1-126) + (S1-13); (1-126) + (S2-1); (I-
126) + (S2-2); (1-126) + (S2-3); (1-126) + (S2-4); (1-126) + (S2-5); (1-126) + (S2-6); (1-126) + (S2-7); (1-126) + (S2-8); (1-126) + (S2-9); (1-126) + (S2-10); (1-126) + (S3- 1); (1-126) + (S3-2); (1-126) + (S3-3); (1-126) + (S3-4); (1-126) + (S3-5); (1-126) + (S3-6); (1-126) + (S3-7); (1-126) + (S3-8); (1-126) + (S3-9); (1-126) + (S3-10); (1-126) + (S3-11); (1-126) + (S4-1 ); (1-126) + (S4-2); (1-126) + (S4-3); (1-126) + (S4-4); (I-
126) + (S4-5); (1-126) + (S7-1); (1-126) + (S11-1); (1-126) + (S11 -2); (1-126) + (S11- 3); (1-126) + (S12-1); (1-126) + (S13-1); (1-126) + (S13-2); (1-126) + (S13-3); (1-126) + (S13-4): (1-126) + (S13-5); (1-126) + (S13-6); (1-126) + (S13-7); (1-126) + (S13-8); (1-126) + (S13-9); (1-126) + (S14-1)
(1-127) + (SM); (1-127) + (S1-2); (1-127) + (S1-3); (1-127) + (S1-4); (1-127) + (S1- 5); (1-127) + (S1-6); (1-127) + (S1-7); (1-127) + (S1-8); (1-127) + (S1-9); (1-127) + (SM O); (1-127) + (SM 1 ); (1-127) + (S1-12); (1-127) + (S1-13); (1-127) + (S2-1); (I-
127) + (S2-2); (1-127) + (S2-3); (1-127) + (S2-4); (1-127) + (S2-5); (1-127) + (S2-6); (1-127) + (S2-7); (1-127) + (S2-8); (1-127) + (S2-9); (1-127) + (S2-10); (1-127) + (S3- 1 ); (1-127) + (S3-2); (1-127) + (S3-3); (1-127) + (S3-4); (1-127) + (S3-5); (1-127) + (S3-6); (1-127) + (S3-7); (1-127) + (S3-8); (1-127) + (S3-9); (1-127) + (S3-10); (1-127)
+ (S3-11 ); (1-127) + (S4-1 ); (1-127) + (S4-2); (1-127) + (S4-3); (1-127) + (S4-4); (I-
127) + (S4-5); (1-127) + (S7-1); (1-127) + (S11-1); (1-127) + (S11-2); (1-127) + (S11- 3); (1-127) + (S12-1 ); (1-127) + (S13-1); (1-127) + (S13-2); (1-127) + (S13-3); (1-127) + (S13-4): (1-127) + (S13-5); (1-127) + (S13-6); (1-127) + (S13-7); (1-127) + (S13-8); (1-127) + (S13-9); (1-127) + (S14-1 )
(1-128) + (S1-1); (1-128) + (S1-2); (1-128) + (S1-3); (1-128) + (S1-4); (1-128) + (S1- 5); (1-128) + (S1-6); (1-128) + (S1-7); (1-128) + (S1-8); (1-128) + (S1-9); (1-128) + (S1-10); (1-128) + (S1-11); (1-128) + (S1-12); (1-128) + (S1-13); (1-128) + (S2-1); (I-
128) + (S2-2); (1-128) + (S2-3); (1-128) + (S2-4); (1-128) + (S2-5); (1-128) + (S2-6); (1-128) + (S2-7); (1-128) + (S2-8); (1-128) + (S2-9); (1-128) + (S2-10); (1-128) + (S3- 1); (1-128) + (S3-2); (1-128) + (S3-3); (1-128) + (S3-4); (1-128) + (S3-5); (1-128) + (S3-6); (1-128) + (S3-7); (1-128) + (S3-8); (1-128) + (S3-9); (1-128) + (S3-10); (1-128) + (S3-11 ); (1-128) + (S4-1); (1-128) + (S4-2); (1-128) + (S4-3); (1-128) + (S4-4); (I-
128) + (S4-5); (1-128) + (S7-1); (1-128) + (S11-1); (1-128) + (S11-2); (1-128) + (S11- 3); (1-128) + (S12-1); (1-128) + (S13-1 ); (1-128) + (S13-2); (1-128) + (S13-3); (1-128) + (S13-4): (1-128) + (S13-5); (1-128) + (S13-6); (1-128) + (S13-7); (1-128) + (S13-8); (1-128) + (S13-9); (1-128) + (S14-1)
(1-129) + (S1-1 ); (1-129) + (S1-2); (1-129) + (S1-3); (1-129) + (S1-4); (1-129) + (S1- 5); (1-129) + (S1-6); (1-129) + (S1-7); (1-129) + (S1-8); (1-129) + (S1-9); (1-129) + (S1-10); (1-129) + (S1-11); (1-129) + (S1-12); (1-129) + (S1-13); (1-129) + (S2-1 ); (I-
129) + (S2-2); (1-129) + (S2-3); (1-129) + (S2-4); (1-129) + (S2-5); (1-129) + (S2-6); (1-129) + (S2-7); (1-129) + (S2-8); (1-129) + (S2-9); (1-129) + (S2-10); (1-129) + (S3- 1); (1-129) + (S3-2); (1-129) + (S3-3); (1-129) + (S3-4); (1-129) + (S3-5); (1-129) + (S3-6); (1-129) + (S3-7); (1-129) + (S3-8); (1-129) + (S3-9); (1-129) + (S3-10); (1-129) + (S3-11); (1-129) + (S4-1 ); (1-129) + (S4-2); (1-129) + (S4-3); (1-129) + (S4-4); (I- 129) + (S4-5); (1-129) + (S7-1); (1-129) + (S11-1); (1-129) + (S11-2); (1-129) + (S11- 3); (1-129) + (S12-1); (1-129) + (S13-1 ); (1-129) + (S13-2); (1-129) + (S13-3); (1-129) + (S13-4): (1-129) + (S13-5); (1-129) + (S13-6); (1-129) + (S13-7); (1-129) + (S13-8); (1-129) + (S13-9); (1-129) + (S14-1)
(1-130) + (S1-1 ); (1-130) + (S1-2); (1-130) + (S1-3); (1-130) + (S1-4); (1-130) + (S1- 5); (1-130) + (S1-6); (1-130) + (S1-7); (1-130) + (S1-8); (1-130) + (S1-9); (1-130) + (S1-10); (1-130) + (S1-11); (1-130) + (S1-12); (1-130) + (S1-13); (1-130) + (S2-1); (I-
130) + (S2-2); (1-130) + (S2-3); (1-130) + (S2-4); (1-130) + (S2-5); (1-130) + (S2-6); (1-130) + (S2-7); (1-130) + (S2-8); (1-130) + (S2-9); (1-130) + (S2-10); (1-130) + (S3- 1); (1-130) + (S3-2); (1-130) + (S3-3); (1-130) + (S3-4); (1-130) + (S3-5); (1-130) + (S3-6); (1-130) + (S3-7); (1-130) + (S3-8); (1-130) + (S3-9); (1-130) + (S3-10); (1-130) + (S3-1 1); (1-130) + (S4-1); (1-130) + (S4-2); (1-130) + (S4-3); (1-130) + (S4-4); (I-
130) + (S4-5); (1-130) + (S7-1 ); (1-130) + (S11-1); (1-130) + (S1 1-2); (1-130) + (S1 1- 3); (1-130) + (S12-1 ); (1-130) + (S13-1); (1-130) + (S13-2); (1-130) + (S13-3); (1-130) + (S13-4): (1-130) + (S13-5); (1-130) + (S13-6); (1-130) + (S13-7); (1-130) + (S13-8); (1-130) + (S13-9); (1-130) + (S14-1)
(1-131) + (S1-1); (1-131) + (S1-2); (1-131) + (S1-3); (1-131 ) + (S1-4); (1-131) + (S1- 5); (1-131 ) + (S1-6); (1-131) + (S1-7); (1-131 ) + (S1-8); (1-131) + (S1-9); (1-131 ) + (S1-10); (1-131) + (S1-1 1 ); (1-131) + (S1-12); (1-131) + (S1-13); (1-131) + (S2-1 ); (I-
131) + (S2-2); (1-131) + (S2-3); (1-131 ) + (S2-4); (1-131 ) + (S2-5); (1-131) + (S2-6); (1-131) + (S2-7); (1-131) + (S2-8); (1-131) + (S2-9); (1-131) + (S2-10); (1-131 ) + (S3- 1); (1-131 ) + (S3-2); (1-131) + (S3-3); (1-131) + (S3-4); (1-131) + (S3-5); (1-131) + (S3-6); (1-131) + (S3-7); (1-131) + (S3-8); (1-131 ) + (S3-9); (1-131) + (S3-10); (1-131) + (S3-11); (1-131) + (S4-1); (1-131) + (S4-2); (1-131) + (S4-3); (1-131) + (S4-4); (I-
131) + (S4-5); (1-131) + (S7-1 ); (1-131) + (S11-1 ); (1-131) + (S11-2); (1-131) + (S1 1- 3); (1-131) + (S12-1); (1-131 ) + (S13-1); (1-131) + (S13-2); (1-131) + (S13-3); (1-131) + (S13-4): (1-131) + (S13-5); (1-131 ) + (S13-6); (1-131) + (S13-7); (1-131) + (S13-8); (1-131) + (S13-9); (1-131) + (S14-1)
(1-132) + (S1-1); (1-132) + (S1-2); (1-132) + (S1-3); (1-132) + (S1-4); (1-132) + (S1- 5); (1-132) + (S1-6); (1-132) + (S1-7); (1-132) + (S1-8); (1-132) + (S1-9); (1-132) + (S1-10); (1-132) + (S1-11); (1-132) + (S1-12); (1-132) + (S1-13); (1-132) + (S2-1); (I-
132) + (S2-2); (1-132) + (S2-3); (1-132) + (S2-4); (1-132) + (S2-5); (1-132) + (S2-6); (1-132) + (S2-7); (1-132) + (S2-8); (1-132) + (S2-9); (1-132) + (S2-10); (1-132) + (S3- 1 ); (1-132) + (S3-2); (1-132) + (S3-3); (1-132) + (S3-4); (1-132) + (S3-5); (1-132) + (S3-6); (1-132) + (S3-7); (1-132) + (S3-8); (1-132) + (S3-9); (1-132) + (S3-10); (1-132) + (S3-11); (1-132) + (S4-1); (1-132) + (S4-2); (1-132) + (S4-3); (1-132) + (S4-4); (I- 132) + (S4-5); (1-132) + (S7-1); (1-132) + (S11-1); (1-132) + (S11-2); (1-132) + (S1 1- 3); (1-132) + (S12-1); (1-132) + (S13-1 ); (1-132) + (S13-2); (1-132) + (S13-3); (1-132) + (S13-4): (1-132) + (S13-5); (1-132) + (S13-6); (1-132) + (S13-7); (1-132) + (S13-8);
(1-132) + (S13-9); (1-132) + (S14-1)
(1-133) + (S1-1); (1-133) + (S1-2); (1-133) + (S1-3); (1-133) + (S1-4); (1-133) + (S1- 5); (1-133) + (S1-6); (1-133) + (S1-7); (1-133) + (S1-8); (1-133) + (S1-9); (1-133) + (S1-10); (1-133) + (S1-11); (1-133) + (S1-12); (1-133) + (S1-13); (1-133) + (S2-1); (I- 133) + (S2-2); (1-133) + (S2-3); (1-133) + (S2-4); (1-133) + (S2-5); (1-133) + (S2-6); (1-133) + (S2-7); (1-133) + (S2-8); (1-133) + (S2-9); (1-133) + (S2-10); (1-133) + (S3- 1); (1-133) + (S3-2); (1-133) + (S3-3); (1-133) + (S3-4); (1-133) + (S3-5); (1-133) + (S3-6); (1-133) + (S3-7); (1-133) + (S3-8); (1-133) + (S3-9); (1-133) + (S3-10); (1-133) + (S3-11); (1-133) + (S4-1); (1-133) + (S4-2); (1-133) + (S4-3); (1-133) + (S4-4); (I-
133) + (S4-5); (1-133) + (S7-1); (1-133) + (S11-1); (1-133) + (S11-2); (1-133) + (S11- 3); (1-133) + (S12-1); (1-133) + (S13-1); (1-133) + (S13-2); (1-133) + (S13-3); (1-133) + (S13-4): (1-133) + (S13-5); (1-133) + (S13-6); (1-133) + (S13-7); (1-133) + (S13-8); (1-133) + (S13-9); (1-133) + (S14-1)
(1-134) + (S1-1); (1-134) + (S1-2); (1-134) + (S1-3); (1-134) + (S1-4); (1-134) + (S1- 5); (1-134) + (S1-6); (1-134) + (S1-7); (1-134) + (S1-8); (1-134) + (S1-9); (1-134) + (S1-10); (1-134) + (S1-11); (1-134) + (S1-12); (1-134) + (S1-13); (1-134) + (S2-1); (I-
134) + (S2-2); (1-134) + (S2-3); (1-134) + (S2-4); (1-134) + (S2-5); (1-134) + (S2-6); (1-134) + (S2-7); (1-134) + (S2-8); (1-134) + (S2-9); (1-134) + (S2-10); (1-134) + (S3- 1); (1-134) + (S3-2); (1-134) + (S3-3); (1-134) + (S3-4); (1-134) + (S3-5); (1-134) + (S3-6); (1-134) + (S3-7); (1-134) + (S3-8); (1-134) + (S3-9); (1-134) + (S3-10); (1-134) + (S3-11); (1-134) + (S4-1); (1-134) + (S4-2); (1-134) + (S4-3); (1-134) + (S4-4); (I-
134) + (S4-5); (1-134) + (S7-1); (1-134) + (S11-1); (1-134) + (S11-2); (1-134) + (S11- 3); (1-134) + (S12-1); (1-134) + (S13-1); (1-134) + (S13-2); (1-134) + (S13-3); (1-134) + (S13-4): (1-134) + (S13-5); (1-134) + (S13-6); (1-134) + (S13-7); (1-134) + (S13-8); (1-134) + (S13-9); (1-134) + (S14-1)
(1-135) + (S1-1); (1-135) + (S1-2); (1-135) + (S1-3); (1-135) + (S1-4); (1-135) + (S1- 5); (1-135) + (S1-6); (1-135) + (S1-7); (1-135) + (S1-8); (1-135) + (S1-9); (1-135) + (S1-10); (1-135) + (S1-11); (1-135) + (S1-12); (1-135) + (S1-13); (1-135) + (S2-1); (I-
135) + (S2-2); (1-135) + (S2-3); (1-135) + (S2-4); (1-135) + (S2-5); (1-135) + (S2-6); (1-135) + (S2-7); (1-135) + (S2-8); (1-135) + (S2-9); (1-135) + (S2-10); (1-135) + (S3- 1); (1-135) + (S3-2); (1-135) + (S3-3); (1-135) + (S3-4); (1-135) + (S3-5); (1-135) + (S3-6); (1-135) + (S3-7); (1-135) + (S3-8); (1-135) + (S3-9); (1-135) + (S3-10); (1-135)
+ (S3-1 1); (1-135) + (S4-1); (1-135) + (S4-2); (1-135) + (S4-3); (1-135) + (S4-4); (I-
135) + (S4-5); (1-135) + (S7-1); (1-135) + (S11-1); (1-135) + (S11-2); (1-135) + (S1 1- 3); (1-135) + (S12-1); (1-135) + (S13-1); (1-135) + (S13-2); (1-135) + (S13-3); (1-135) + (S13-4): (1-135) + (S13-5); (1-135) + (S13-6); (1-135) + (S13-7); (1-135) + (S13-8); (1-135) + (S13-9); (1-135) + (S14-1 )
(1-136) + (S1-1); (1-136) + (S1-2); (1-136) + (S1-3); (1-136) + (S1-4); (1-136) + (S1- 5); (1-136) + (S1-6); (1-136) + (S1-7); (1-136) + (S1-8); (1-136) + (S1-9); (1-136) + (S1-10); (1-136) + (S1-1 1 ); (1-136) + (S1-12); (1-136) + (S1-13); (1-136) + (S2-1); (I-
136) + (S2-2); (1-136) + (S2-3); (1-136) + (S2-4); (1-136) + (S2-5); (1-136) + (S2-6); (1-136) + (S2-7); (1-136) + (S2-8); (1-136) + (S2-9); (1-136) + (S2-10); (1-136) + (S3- 1); (1-136) + (S3-2); (1-136) + (S3-3); (1-136) + (S3-4); (1-136) + (S3-5); (1-136) + (S3-6); (1-136) + (S3-7); (1-136) + (S3-8); (1-136) + (S3-9); (1-136) + (S3-10); (1-136) + (S3-1 1); (1-136) + (S4-1 ); (1-136) + (S4-2); (1-136) + (S4-3); (1-136) + (S4-4); (I-
136) + (S4-5); (1-136) + (S7-1); (1-136) + (S11-1 ); (1-136) + (S11-2); (1-136) + (S1 1- 3); (1-136) + (S12-1 ); (1-136) + (S13-1 ); (1-136) + (S13-2); (1-136) + (S13-3); (1-136) + (S13-4): (1-136) + (S13-5); (1-136) + (S13-6); (1-136) + (S13-7); (1-136) + (S13-8); (1-136) + (S13-9); (1-136) + (S14-1)
(1-137) + (S1-1 ); (1-137) + (S1-2); (1-137) + (S1-3); (1-137) + (S1-4); (1-137) + (S1- 5); (1-137) + (S1-6); (1-137) + (S1-7); (1-137) + (S1-8); (1-137) + (S1-9); (1-137) + (S1-10); (1-137) + (S1-1 1); (1-137) + (S1-12); (1-137) + (S1-13); (1-137) + (S2-1); (I-
137) + (S2-2); (1-137) + (S2-3); (1-137) + (S2-4); (1-137) + (S2-5); (1-137) + (S2-6); (1-137) + (S2-7); (1-137) + (S2-8); (1-137) + (S2-9); (1-137) + (S2-10); (1-137) + (S3- 1 ); (1-137) + (S3-2); (1-137) + (S3-3); (1-137) + (S3-4); (1-137) + (S3-5); (1-137) + (S3-6); (1-137) + (S3-7); (1-137) + (S3-8); (1-137) + (S3-9); (1-137) + (S3-10); (1-137) + (S3-1 1 ); (1-137) + (S4-1 ); (1-137) + (S4-2); (1-137) + (S4-3); (1-137) + (S4-4); (I- 137) + (S4-5); (1-137) + (S7-1); (1-137) + (S1 1-1); (1-137) + (S11-2); (1-137) + (S1 1- 3); (1-137) + (S12-1); (1-137) + (S13-1); (1-137) + (S13-2); (1-137) + (S13-3); (1-137) + (S13-4): (1-137) + (S13-5); (1-137) + (S13-6); (1-137) + (S13-7); (1-137) + (S13-8); (1-137) + (S13-9); (1-137) + (S14-1)
(1-138) + (S1-1 ); (1-138) + (S1-2); (1-138) + (S1-3); (1-138) + (S1^); (1-138) + (S1- 5); (1-138) + (S1 -6); (1-138) + (S1-7); (1-138) + (S1-8); (1-138) + (S1-9); (1-138) + (S1-10); (1-138) + (S1-1 1); (1-138) + (S1-12); (1-138) + (S1-13); (1-138) + (S2-1 ); (I-
138) + (S2-2); (1-138) + (S2-3); (1-138) + (S2-4); (1-138) + (S2-5); (1-138) + (S2-6); (1-138) + (S2-7); (1-138) + (S2-8); (1-138) + (S2-9); (1-138) + (S2-10); (1-138) + (S3- 1 ); (1-138) + (S3-2); (1-138) + (S3-3); (1-138) + (S3-4); (1-138) + (S3-5); (1-138) + (S3-6); (1-138) + (S3-7); (1-138) + (S3-8); (1-138) + (S3-9); (1-138) + (S3-10); (1-138) + (S3-11 ); (1-138) + (S4-1); (1-138) + (S4-2); (1-138) + (S4-3); (1-138) + (S4-4); (I-
138) + (S4-5); (1-138) + (S7-1 ); (1-138) + (S11-1); (1-138) + (S11-2); (1-138) + (S11- 3); (1-138) + (S12-1); (1-138) + (S13-1); (1-138) + (S13-2); (1-138) + (S13-3); (1-138) + (S13-4): (1-138) + (S13-5); (1-138) + (S13-6); (1-138) + (S13-7); (1-138) + (S13-8); (1-138) + (S13-9); (1-138) + (S14-1 )
(1-139) + (S1-1); (1-139) + (S1-2); (1-139) + (S1-3); (1-139) + (S1^); (1-139) + (S1- 5); (1-139) + (S1-6); (1-139) + (S1-7); (1-139) + (S1-8); (1-139) + (S1-9); (1-139) + (S1-10); (1-139) + (S1-11); (1-139) + (S1-12); (1-139) + (S1-13); (1-139) + (S2-1); (I-
139) + (S2-2); (1-139) + (S2-3); (1-139) + (S2-4); (1-139) + (S2-5); (1-139) + (S2-6); (1-139) + (S2-7); (1-139) + (S2-8); (1-139) + (S2-9); (1-139) + (S2-10); (1-139) + (S3- 1 ); (1-139) + (S3-2); (1-139) + (S3-3); (1-139) + (S3-4); (1-139) + (S3-5); (1-139) + (S3-6); (1-139) + (S3-7); (1-139) + (S3-8); (1-139) + (S3-9); (1-139) + (S3-10); (1-139) + (S3-11 ); (1-139) + (S4-1); (1-139) + (S4-2); (1-139) + (S4-3); (1-139) + (S4-4); (I-
139) + (S4-5); (1-139) + (S7-1); (1-139) + (S11-1 ); (1-139) + (S11-2); (1-139) + (S11- 3); (1-139) + (S12-1); (1-139) + (S13-1 ); (1-139) + (S13-2); (1-139) + (S13-3); (1-139) + (S13-4): (1-139) + (S13-5); (1-139) + (S13-6); (1-139) + (S13-7); (1-139) + (S13-8); (1-139) + (S13-9); (1-139) + (S14-1)
(1-140) + (S1-1 ); (1-140) + (S1-2); (1-140) + (S1-3); (1-140) + (S1^); (1-140) + (S1- 5); (1-140) + (S1-6); (1-140) + (S1-7); (1-140) + (S1-8); (1-140) + (S1-9); (1-140) + (S1-10); (1-140) + (S1-11 ); (1-140) + (S1-12); (1-140) + (S1-13); (1-140) + (S2-1); (I-
140) + (S2-2); (1-140) + (S2-3); (1-140) + (S2-4); (1-140) + (S2-5); (1-140) + (S2-6); (1-140) + (S2-7); (1-140) + (S2-8); (1-140) + (S2-9); (1-140) + (S2-10); (1-140) + (S3- 1); (1-140) + (S3-2); (1-140) + (S3-3); (1-140) + (S3-4); (1-140) + (S3-5); (1-140) + (S3-6); (1-140) + (S3-7); (1-140) + (S3-8); (1-140) + (S3-9); (1-140) + (S3-10); (1-140) + (S3-11); (1-140) + (S4-1); (1-140) + (S4-2); (1-140) + (S4-3); (1-140) + (S4-4); (I- 140) + (S4-5); (1-140) + (S7-1); (1-140) + (S11-1); (1-140) + (S11-2); (1-140) + (S1 1- 3); (1-140) + (S12-1 ); (1-140) + (S13-1); (1-140) + (S13-2); (1-140) + (S13-3); (1-140) + (S13-4): (1-140) + (S13-5); (1-140) + (S13-6); (1-140) + (S13-7); (1-140) + (S13-8);
(1-140) + (S13-9); (1-140) + (S14-1 )
(1-141) + (S1-1 ); (1-141) + (S1-2); (1-141) + (S1-3); (1-141) + (S1^); (1-141) + (S1- 5); (1-141) + (S1-6); (1-141 ) + (S1-7); (1-141 ) + (S1-8); (1-141 ) + (S1-9); (1-141) + (S1-10); (1-141) + (S1-11); (1-141 ) + (S1-12); (1-141) + (S1-13); (1-141) + (S2-1 ); (I- 141) + (S2-2); (1-141) + (S2-3); (1-141 ) + (S2-4); (1-141) + (S2-5); (1-141) + (S2-6); (1-141) + (S2-7); (1-141) + (S2-8); (1-141) + (S2-9); (1-141) + (S2-10); (1-141) + (S3- 1); (1-141) + (S3-2); (1-141 ) + (S3-3); (1-141) + (S3-4); (1-141 ) + (S3-5); (1-141) + (S3-6); (1-141) + (S3-7); (1-141) + (S3-8); (1-141 ) + (S3-9); (1-141 ) + (S3-10); (1-141) + (S3-11); (1-141) + (S4-1); (1-141) + (S4-2); (1-141) + (S4-3); (1-141 ) + (S4-4); (I-
141) + (S4-5); (1-141) + (S7-1 ); (1-141 ) + (S11-1); (1-141) + (S11-2); (1-141) + (S11- 3); (1-141 ) + (S12-1); (1-141) + (S13-1); (1-141) + (S13-2); (1-141 ) + (S13-3); (1-141) + (S13-4): (1-141) + (S13-5); (1-141 ) + (S13-6); (1-141) + (S13-7); (1-141 ) + (S13-8); (1-141) + (S13-9); (1-141) + (S14-1)
(1-142) + (S1-1 ); (1-142) + (S1-2); (1-142) + (S1-3); (1-142) + (S1-4); (1-142) + (S1- 5); (1-142) + (S1-6); (1-142) + (S1-7); (1-142) + (S1-8); (1-142) + (S1-9); (1-142) + (S1-10); (1-142) + (S1-11); (1-142) + (S1-12); (1-142) + (S1-13); (1-142) + (S2-1); (I-
142) + (S2-2); (1-142) + (S2-3); (1-142) + (S2-4); (1-142) + (S2-5); (1-142) + (S2-6); (1-142) + (S2-7); (1-142) + (S2-8); (1-142) + (S2-9); (1-142) + (S2-10); (1-142) + (S3- 1); (1-142) + (S3-2); (1-142) + (S3-3); (1-142) + (S3-4); (1-142) + (S3-5); (1-142) + (S3-6); (1-142) + (S3-7); (1-142) + (S3-8); (1-142) + (S3-9); (1-142) + (S3-10); (1-142) + (S3-11 ); (1-142) + (S4-1); (1-142) + (S4-2); (1-142) + (S4-3); (1-142) + (S4-4); (I-
142) + (S4-5); (1-142) + (S7-1); (1-142) + (S11-1); (1-142) + (S11-2); (1-142) + (S11- 3); (1-142) + (S12-1); (1-142) + (S13-1); (1-142) + (S13-2); (1-142) + (S13-3); (1-142) + (S13-4): (1-142) + (S13-5); (1-142) + (S13-6); (1-142) + (S13-7); (1-142) + (S13-8); (1-142) + (S13-9); (1-142) + (S14-1)
(1-143) + (S1-1); (1-143) + (S1-2); (1-143) + (S1-3); (1-143) + (S1^); (1-143) + (S1- 5); (1-143) + (S1-6); (1-143) + (S1-7); (1-143) + (S1-8); (1-143) + (S1-9); (1-143) + (S1-10); (1-143) + (S1-11); (1-143) + (S1-12); (1-143) + (S1-13); (1-143) + (S2-1 ); (I-
143) + (S2-2); (1-143) + (S2-3); (1-143) + (S2-4); (1-143) + (S2-5); (1-143) + (S2-6); (1-143) + (S2-7); (1-143) + (S2-8); (1-143) + (S2-9); (1-143) + (S2-10); (1-143) + (S3- 1 ); (1-143) + (S3-2); (1-143) + (S3-3); (1-143) + (S3-4); (1-143) + (S3-5); (1-143) + (S3-6); (1-143) + (S3-7); (1-143) + (S3-8); (1-143) + (S3-9); (1-143) + (S3-10); (1-143)
+ (S3-11); (1-143) + (S4-1); (1-143) + (S4-2); (1-143) + (S4-3); (1-143) + (S4-4); (I-
143) + (S4-5); (1-143) + (S7-1); (1-143) + (S11-1); (1-143) + (S11-2); (1-143) + (S11- 3); (1-143) + (S12-1 ); (1-143) + (S13-1); (1-143) + (S13-2); (1-143) + (S13-3); (1-143) + (S13-4): (1-143) + (S13-5); (1-143) + (S13-6); (1-143) + (S13-7); (1-143) + (S13-8); (1-143) + (S13-9); (1-143) + (S14-1)
(1-144) + (S1-1); (1-144) + (S1-2); (1-144) + (S1-3); (1-144) + (S1-4); (1-144) + (S1- 5); (|.144) + (S1-6); (1-144) + (S1-7); (1-144) + (S1-8); (1-144) + (S1-9); (1-144) + (S1-10); (1-144) + (S1-11); (1-144) + (S1-12); (1-144) + (S1-13); (1-144) + (S2-1); (I-
144) + (S2-2); (1-144) + (S2-3); (1-144) + (S2^); (1-144) + (S2-5); (1-144) + (S2-6); (1-144) + (S2-7); (1-144) + (S2-8); (1-144) + (S2-9); (1-144) + (S2-10); (1-144) + (S3- 1 ); (1-144) + (S3-2); (1-144) + (S3-3); (1-144) + (S3-4); (1-144) + (S3-5); (1-144) + (S3-6); (1-144) + (S3-7); (1-144) + (S3-8); (1-144) + (S3-9); (1-144) + (S3-10); (1-144) + (S3-11); (1-144) + (S4-1); (1-144) + (S4-2); (1-144) + (S4-3); (1-144) + (S4-4); (I-
144) + (S4-5); (1-144) + (S7-1); (1-144) + (S11-1 ); (1-144) + (S11-2); (1-144) + (S11- 3); (1-144) + (S12-1 ); (1-144) + (S13-1); (1-144) + (S13-2); (1-144) + (S13-3); (1-144) + (S13-4): (1-144) + (S13-5); (1-144) + (S13-6); (1-144) + (S13-7); (1-144) + (S13-8); (1-144) + (S13-9); (1-144) + (S14-1)
(1-145) + (S1-1 ); (1-145) + (S1-2); (1-145) + (S1-3); (1-145) + (S1-4); (1-145) + (S1- 5); (1-145) + (S1-6); (1-145) + (S1-7); (1-145) + (S1-8); (1-145) + (S1-9); (1-145) + (S1-10); (1-145) + (S1-11); (1-145) + (S1-12); (1-145) + (S1-13); (1-145) + (S2-1); (I-
145) + (S2-2); (1-145) + (S2-3); (1-145) + (S2-4); (1-145) + (S2-5); (1-145) + (S2-6); (1-145) + (S2-7); (1-145) + (S2-8); (1-145) + (S2-9); (1-145) + (S2-10); (1-145) + (S3- 1); (1-145) + (S3-2); (1-145) + (S3-3); (1-145) + (S3-4); (1-145) + (S3-5); (1-145) + (S3-6); (1-145) + (S3-7); (1-145) + (S3-8); (1-145) + (S3-9); (1-145) + (S3-10); (1-145) + (S3-11); (1-145) + (S4-1); (1-145) + (S4-2); (1-145) + (S4-3); (1-145) + (S4-4); (I- 145) + (S4-5); (1-145) + (S7-1); (1-145) + (S11-1); (1-145) + (S11-2); (1-145) + (S11- 3); (1-145) + (S12-1 ); (1-145) + (S13-1 ); (1-145) + (S13-2); (1-145) + (S13-3); (1-145) + (S13-4): (1-145) + (S13-5); (1-145) + (S13-6); (1-145) + (S13-7); (1-145) + (S13-8); (1-145) + (S13-9); (1-145) + (S14-1)
(1-146) + (S1-1); (1-146) + (S1-2); (1-146) + (S1-3); (1-146) + (S1-4); (1-146) + (S1 - 5); (1-146) + (S1-6); (1-146) + (S1-7); (1-146) + (S1-8); (1-146) + (S1-9); (1-146) + (S1-10); (1-146) + (S1-11); (1-146) + (S1-12); (1-146) + (S1-13); (1-146) + (S2-1); (I-
146) + (S2-2); (1-146) + (S2-3); (1-146) + (S2-4); (1-146) + (S2-5); (1-146) + (S2-6); (1-146) + (S2-7); (1-146) + (S2-8); (1-146) + (S2-9); (1-146) + (S2-10); (1-146) + (S3- 1); (1-146) + (S3-2); (1-146) + (S3-3); (1-146) + (S3-4); (1-146) + (S3-5); (1-146) + (S3-6); (1-146) + (S3-7); (1-146) + (S3-8); (1-146) + (S3-9); (1-146) + (S3-10); (1-146) + (S3-11); (1-146) + (S4-1); (1-146) + (S4-2); (1-146) + (S4-3); (1-146) + (S4-4); (I-
146) + (S4-5); (1-146) + (S7-1); (1-146) + (S11-1); (1-146) + (S11-2); (1-146) + (S11- 3); (1-146) + (S12-1); (1-146) + (S13-1); (1-146) + (S13-2); (1-146) + (S13-3); (1-146) + (S 13-4): (1-146) + (S13-5); (1-146) + (S13-6); (1-146) + (S13-7); (1-146) + (S13-8); (1-146) + (S13-9); (1-146) + (S14-1)
(1-147) + (S1-1); (1-147) + (S1-2); (1-147) + (S1-3); (1-147) + (S 1-4); (1-147) + (S1- 5); (1-147) + (S1-6); (1-147) + (S1-7); (1-147) + (S1-8); (1-147) + (S1-9); (1-147) + (S1-10); (1-147) + (S1-11); (1-147) + (S1-12); (1-147) + (S1-13); (1-147) + (S2-1); (I-
147) + (S2-2); (1-147) + (S2-3); (1-147) + (S2-4); (1-147) + (S2-5); (1-147) + (S2-6); (1-147) + (S2-7); (1-147) + (S2-8); (1-147) + (S2-9); (1-147) + (S2-10); (1-147) + (S3- 1); (1-147) + (S3-2); (1-147) + (S3-3); (1-147) + (S3-4); (1-147) + (S3-5); (1-147) + (S3-6); (1-147) + (S3-7); (1-147) + (S3-8); (1-147) + (S3-9); (1-147) + (S3-10); (1-147) + (S3-11); (1-147) + (S4-1); (1-147) + (S4-2); (1-147) + (S4-3); (1-147) + (S4-4); (I-
147) + (S4-5); (1-147) + (S7-1); (1-147) + (S11-1); (1-147) + (S11-2); (1-147) + (S11- 3); (1-147) + (S12-1); (1-147) + (S13-1); (1-147) + (S13-2); (1-147) + (S13-3); (1-147) + (S13-4): (1-147) + (S13-5); (1-147) + (S13-6); (1-147) + (S13-7); (1-147) + (S13-8); (1-147) + (S13-9); (1-147) + (S14-1)
(1-148) + (S1-1); (1-148) + (S1-2); (1-148) + (S1-3); (1-148) + (S1-4); (1-148) + (S1- 5); (1-148) + (S1-6); (1-148) + (S1-7); (1-148) + (S1-8); (1-148) + (S1-9); (1-148) + (S1-10); (1-148) + (S1-11); (1-148) + (S1-12); (1-148) + (S1-13); (1-148) + (S2-1); (I-
148) + (S2-2); (1-148) + (S2-3); (1-148) + (S2-4); (1-148) + (S2-5); (1-148) + (S2-6); (1-148) + (S2-7); (1-148) + (S2-8); (1-148) + (S2-9); (1-148) + (S2-10); (1-148) + (S3- 1); (1-148) + (S3-2); (1-148) + (S3-3); (1-148) + (S3-4); (1-148) + (S3-5); (1-148) + (S3-6); (1-148) + (S3-7); (1-148) + (S3-8); (1-148) + (S3-9); (1-148) + (S3-10); (1-148) + (S3-11); (1-148) + (S4-1); (1-148) + (S4-2); (1-148) + (S4-3); (1-148) + (S4-4); (I- 148) + (S4-5); (1-148) + (S7-1); (1-148) + (S11-1); (1-148) + (S11-2); (1-148) + (S11- 3); (1-148) + (S12-1); (1-148) + (S13-1); (1-148) + (S13-2); (1-148) + (S13-3); (1-148) + (S13-4): (1-148) + (S13-5); (1-148) + (S13-6); (1-148) + (S13-7); (1-148) + (S13-8);
(1-148) + (S13-9); (1-148) + (S14-1 )
(1-149) + (S1-1 ); (1-149) + (S1-2); (1-149) + (S1-3); (1-149) + (S1-4); (1-149) + (S1- 5); (1-149) + (S1-6); (1-149) + (S1-7); (1-149) + (S1-8); (1-149) + (S1-9); (1-149) + (S1-10); (1-149) + (S1-11 ); (1-149) + (S1-12); (1-149) + (S1-13); (1-149) + (S2-1 ); (I- 149) + (S2-2); (1-149) + (S2-3); (1-149) + (S2-4); (1-149) + (S2-5); (1-149) + (S2-6); (1-149) + (S2-7); (1-149) + (S2-8); (1-149) + (S2-9); (1-149) + (S2-10); (1-149) + (S3- 1); (1-149) + (S3-2); (1-149) + (S3-3); (1-149) + (S3-4); (1-149) + (S3-5); (1-149) + (S3-6); (1-149) + (S3-7); (1-149) + (S3-8); (1-149) + (S3-9); (1-149) + (S3-10); (1-149) + (S3-11); (1-149) + (S4-1); (1-149) + (S4-2); (1-149) + (S4-3); (1-149) + (S4-4); (I-
149) + (S4-5); (1-149) + (S7-1); (1-149) + (S11-1); (1-149) + (S11-2); (1-149) + (S11- 3); (1-149) + (S12-1); (1-149) + (S13-1); (1-149) + (S13-2); (1-149) + (S13-3); (1-149) + (S13-4): (1-149) + (S13-5); (1-149) + (S13-6); (1-149) + (S13-7); (1-149) + (S13-8); (1-149) + (S13-9); (1-149) + (S14-1)
(1-150) + (S1-1); (1-150) + (S1-2); (1-150) + (S1-3); (1-150) + (S1^); (1-150) + (S1- 5); (1-150) + (S1-6); (1-150) + (S1-7); (1-150) + (S1-8); (1-150) + (S1-9); (1-150) + (S1-10); (1-150) + (S1-11); (1-150) + (S1-12); (1-150) + (S1-13); (1-150) + (S2-1 ); (I-
150) + (S2-2); (1-150) + (S2-3); (1-150) + (S2-4); (1-150) + (S2-5); (1-150) + (S2-6); (1-150) + (S2-7); (1-150) + (S2-8); (1-150) + (S2-9); (1-150) + (S2-10); (1-150) + (S3- 1 ); (1-150) + (S3-2); (1-150) + (S3-3); (1-150) + (S3-4); (1-150) + (S3-5); (1-150) + (S3-6); (1-150) + (S3-7); (1-150) + (S3-8); (1-150) + (S3-9); (1-150) + (S3-10); (1-150) + (S3-11); (1-150) + (S4-1); (1-150) + (S4-2); (1-150) + (S4-3); (1-150) + (S4-4); (I-
150) + (S4-5); (1-150) + (S7-1); (1-150) + (S11-1); (1-150) + (S11-2); (1-150) + (S11- 3); (1-150) + (S12-1); (1-150) + (S13-1); (1-150) + (S13-2); (1-150) + (S13-3); (1-150) + (S13-4): (1-150) + (S13-5); (1-150) + (S13-6); (1-150) + (S13-7); (1-150) + (S13-8); (1-150) + (S13-9); (1-150) + (S14-1)
(1-151 ) + (S1-1 ); (1-151) + (S1-2); (1-151 ) + (S1-3); (1-151 ) + (S1-4); (1-151 ) + (S1- 5); (1-151) + (S1-6); (1-151 ) + (S1-7); (1-151) + (S1-8); (1-151) + (S1-9); (1-151 ) + (S1-10); (1-151) + (S1-11); (1-151 ) + (S1-12); (1-151 ) + (S1-13); (1-151) + (S2-1); (I-
151) + (S2-2); (1-151) + (S2-3); (1-151) + (S2-4); (1-151 ) + (S2-5); (1-151) + (S2-6); (1-151) + (S2-7); (1-151) + (S2-8); (1-151) + (S2-9); (1-151) + (S2-10); (1-151) + (S3- 1); (1-151 ) + (S3-2); (1-151) + (S3-3); (1-151) + (S3-4); (1-151) + (S3-5); (1-151 ) + (S3-6); (1-151) + (S3-7); (1-151 ) + (S3-8); (1-151 ) + (S3-9); (1-151) + (S3-10); (1-151)
+ (S3-11 ); (1-151 ) + (S4-1); (1-151) + (S4-2); (1-151) + (S4-3); (1-151) + (S4-4); (I-
151 ) + (S4-5); (1-151) + (S7-1); (1-151 ) + (S11-1 ); (1-151) + (S11-2); (1-151 ) + (S11- 3); (1-151 ) + (S12-1 ); (1-151 ) + (S13-1 ); (1-151) + (S13-2); (1-151) + (S13-3); (1-151 ) + (S13-4): (1-151 ) + (S13-5); (1-151) + (S13-6); (1-151) + (S13-7); (1-151) + (S13-8); (1-151) + (S13-9); (1-151 ) + (S14-1 )
(1-152) + (S1-1); (1-152) + (S1-2); (1-152) + (S1-3); (1-152) + (S1-4); (1-152) + (S1- 5); (1-152) + (S1-6); (1-152) + (S1-7); (1-152) + (S1-8); (1-152) + (S1-9); (1-152) + (S1-10); (1-152) + (S1-11); (1-152) + (S1-12); (1-152) + (S1-13); (1-152) + (S2-1 ); (I-
152) + (S2-2); (1-152) + (S2-3); (1-152) + (S2^); (1-152) + (S2-5); (1-152) + (S2-6); (1-152) + (S2-7); (1-152) + (S2-8); (1-152) + (S2-9); (1-152) + (S2-10); (1-152) + (S3- 1); (1-152) + (S3-2); (1-152) + (S3-3); (1-152) + (S3-4); (1-152) + (S3-5); (1-152) + (S3-6); (1-152) + (S3-7); (1-152) + (S3-8); (1-152) + (S3-9); (1-152) + (S3-10); (1-152) + (S3-11); (1-152) + (S4-1 ); (1-152) + (S4-2); (1-152) + (S4-3); (1-152) + (S4-4); (I-
152) + (S4-5); (1-152) + (S7-1); (1-152) + (S11-1); (1-152) + (S11-2); (1-152) + (S11- 3); (1-152) + (S12-1 ); (1-152) + (S13-1 ); (1-152) + (S13-2); (1-152) + (S13-3); (1-152) + (S13-4): (1-152) + (S13-5); (1-152) + (S13-6); (1-152) + (S13-7); (1-152) + (S13-8); (1-152) + (S13-9); (1-152) + (S14-1)
(1-153) + (S1-1); (1-153) + (S1-2); (1-153) + (S1-3); (1-153) + (S1^); (1-153) + (S1- 5); (1-153) + (S1-6); (1-153) + (S1 -7); (1-153) + (S1-8); (1-153) + (S1-9); (1-153) + (S1-10); (1-153) + (S1-11); (1-153) + (S1-12); (1-153) + (S1-13); (1-153) + (S2-1); (I-
153) + (S2-2); (1-153) + (S2-3); (1-153) + (S2-4); (1-153) + (S2-5); (1-153) + (S2-6); (1-153) + (S2-7); (1-153) + (S2-8); (1-153) + (S2-9); (1-153) + (S2-10); (1-153) + (S3- 1); (1-153) + (S3-2); (1-153) + (S3-3); (1-153) + (S3-4); (1-153) + (S3-5); (1-153) + (S3-6); (1-153) + (S3-7); (1-153) + (S3-8); (1-153) + (S3-9); (1-153) + (S3-10); (1-153) + (S3-11); (1-153) + (S4-1 ); (1-153) + (S4-2); (1-153) + (S4-3); (1-153) + (S4-4); (I- 153) + (S4-5); (1-153) + (S7-1); (1-153) + (S11-1); (1-153) + (S11-2); (1-153) + (S11- 3); (1-153) + (S12-1); (1-153) + (S13-1); (1-153) + (S13-2); (1-153) + (S13-3); (1-153) + (S13-4): (1-153) + (S13-5); (1-153) + (S13-6); (1-153) + (S13-7); (1-153) + (S13-8); (1-153) + (S13-9); (1-153) + (S14-1 )
(1-154) + (S1-1); (1-154) + (S1-2); (1-154) + (S1-3); (1-154) + (S1-4); (1-154) + (S1- 5); (1-154) + (S1-6); (1-154) + (S1 -7); (1-154) + (S1-8); (1-154) + (S1-9); (1-154) + (S1-10); (1-154) + (S1-11 ); (1-154) + (S1-12); (1-154) + (S1-13); (1-154) + (S2-1); (I-
154) + (S2-2); (1-154) + (S2-3); (1-154) + (S2-4); (1-154) + (S2-5); (1-154) + (S2-6); (1-154) + (S2-7); (1-154) + (S2-8); (1-154) + (S2-9); (1-154) + (S2-10); (1-154) + (S3- 1); (1-154) + (S3-2); (1-154) + (S3-3); (1-154) + (S3-4); (1-154) + (S3-5); (1-154) + (S3-6); (1-154) + (S3-7); (1-154) + (S3-8); (1-154) + (S3-9); (1-154) + (S3-10); (1-154) + (S3-11 ); (1-154) + (S4-1); (1-154) + (S4-2); (1-154) + (S4-3); (1-154) + (S4-4); (I-
154) + (S4-5); (1-154) + (S7-1 ); (1-154) + (S11-1 ); (1-154) + (S11-2); (1-154) + (S11- 3); (1-154) + (S12-1); (1-154) + (S13-1); (1-154) + (S13-2); (1-154) + (S13-3); (1-154) + (S13-4): (1-154) + (S13-5); (1-154) + (S13-6); (1-154) + (S13-7); (1-154) + (S13-8); (1-154) + (S13-9); (1-154) + (S14-1 )
(1-155) + (S1-1); (1-155) + (S1-2); (1-155) + (S1-3); (1-155) + (S1-4); (1-155) + (S1- 5); (1-155) + (S1-6); (1-155) + (S1-7); (1-155) + (S1-8); (1-155) + (S1-9); (1-155) + (S1-10); (1-155) + (S1-11); (1-155) + (S1-12); (1-155) + (S1-13); (1-155) + (S2-1); (I-
155) + (S2-2); (1-155) + (S2-3); (1-155) + (S2-4); (1-155) + (S2-5); (1-155) + (S2-6); (1-155) + (S2-7); (1-155) + (S2-8); (1-155) + (S2-9); (1-155) + (S2-10); (1-155) + (S3- 1); (1-155) + (S3-2); (1-155) + (S3-3); (1-155) + (S3-4); (1-155) + (S3-5); (1-155) + (S3-6); (1-155) + (S3-7); (1-155) + (S3-8); (1-155) + (S3-9); (1-155) + (S3-10); (1-155) + (S3-11 ); (1-155) + (S4-1); (1-155) + (S4-2); (1-155) + (S4-3); (1-155) + (S4-4); (I-
155) + (S4-5); (1-155) + (S7-1); (1-155) + (S11-1); (1-155) + (S11-2); (1-155) + (S1 1- 3); (1-155) + (S12-1); (1-155) + (S13-1); (1-155) + (S13-2); (1-155) + (S13-3); (1-155) + (S13-4): (1-155) + (S13-5); (1-155) + (S13-6); (1-155) + (S13-7); (1-155) + (S13-8); (1-155) + (S13-9); (1-155) + (S14-1)
(1-156) + (S1-1 ); (1-156) + (S1-2); (1-156) + (S1-3); (1-156) + (S1-4); (1-156) + (S1- 5); (1-156) + (S1-6); (1-156) + (S1-7); (1-156) + (S1-8); (1-156) + (S1-9); (1-156) + (S1-10); (1-156) + (S1-11 ); (1-156) + (S1-12); (1-156) + (S1-13); (1-156) + (S2-1); (I-
156) + (S2-2); (1-156) + (S2-3); (1-156) + (S2-4); (1-156) + (S2-5); (1-156) + (S2-6); (1-156) + (S2-7); (1-156) + (S2-8); (1-156) + (S2-9); (1-156) + (S2-10); (1-156) + (S3- 1); (1-156) + (S3-2); (1-156) + (S3-3); (1-156) + (S3-4); (1-156) + (S3-5); (1-156) + (S3-6); (1-156) + (S3-7); (1-156) + (S3-8); (1-156) + (S3-9); (1-156) + (S3-10); (1-156) + (S3-11 ); (1-156) + (S4-1 ); (1-156) + (S4-2); (1-156) + (S4-3); (1-156) + (S4-4); (I- 156) + (S4-5); (1-156) + (S7-1 ); (1-156) + (S11-1); (1-156) + (S11-2); (1-156) + (S11- 3); (1-156) + (S12-1); (1-156) + (S13-1); (1-156) + (S13-2); (1-156) + (S13-3); (1-156) + (S13-4): (1-156) + (S13-5); (1-156) + (S13-6); (1-156) + (S13-7); (1-156) + (S13-8);
(1-156) + (S13-9); (1-156) + (S14-1)
(1-157) + (SM ); (1-157) + (S1-2); (1-157) + (S1-3); (1-157) + (S1-4); (1-157) + (S1- 5); (1-157) + (S1-6); (1-157) + (S1-7); (1-157) + (S1-8); (1-157) + (S1-9); (1-157) + (SMO); (1-157) + (SM 1 ); (1-157) + (SM2); (1-157) + (S1-13); (1-157) + (S2-1); (I- 157) + (S2-2); (1-157) + (S2-3); (1-157) + (S2-4); (1-157) + (S2-5); (1-157) + (S2-6); (1-157) + (S2-7); (1-157) + (S2-8); (1-157) + (S2-9); (1-157) + (S2-10); (1-157) + (S3- 1); (1-157) + (S3-2); (1-157) + (S3-3); (1-157) + (S3-4); (1-157) + (S3-5); (1-157) + (S3-6); (1-157) + (S3-7); (1-157) + (S3-8); (1-157) + (S3-9); (1-157) + (S3-10); (1-157) + (S3-11); (1-157) + (S4-1); (1-157) + (S4-2); (1-157) + (S4-3); (1-157) + (S4-4); (I-
157) + (S4-5); (1-157) + (S7-1 ); (1-157) + (S11-1); (1-157) + (S11-2); (1-157) + (S11- 3); (1-157) + (S12-1); (1-157) + (S13-1 ); (1-157) + (S13-2); (1-157) + (S13-3); (1-157) + (S13-4): (1-157) + (S13-5); (1-157) + (S13-6); (1-157) + (S13-7); (1-157) + (S13-8); (1-157) + (S13-9); (1-157) + (S14-1)
(1-158) + (SM); (1-158) + (S1-2); (1-158) + (S1-3); (1-158) + (S1-4); (1-158) + (S1 - 5); (1-158) + (S1-6); (1-158) + (S1-7); (1-158) + (S1-8); (1-158) + (S1-9); (1-158) + (SM O); (1-158) + (SM 1); (1-158) + (S1-12); (1-158) + (S1-13); (1-158) + (S2-1 ); (I-
158) + (S2-2); (1-158) + (S2-3); (1-158) + (S2-4); (1-158) + (S2-5); (1-158) + (S2-6); (1-158) + (S2-7); (1-158) + (S2-8); (1-158) + (S2-9); (1-158) + (S2-10); (1-158) + (S3- 1); (1-158) + (S3-2); (1-158) + (S3-3); (1-158) + (S3-4); (1-158) + (S3-5); (1-158) + (S3-6); (1-158) + (S3-7); (1-158) + (S3-8); (1-158) + (S3-9); (1-158) + (S3-10); (1-158) + (S3-11); (1-158) + (S4-1); (1-158) + (S4-2); (1-158) + (S4-3); (1-158) + (S4-4); (I-
158) + (S4-5); (1-158) + (S7-1); (1-158) + (S11-1); (1-158) + (S11-2); (1-158) + (S11- 3); (1-158) + (S12-1 ); (1-158) + (S13-1 ); (1-158) + (S13-2); (1-158) + (S13-3); (1-158) + (S13-4): (1-158) + (S13-5); (1-158) + (S13-6); (1-158) + (S13-7); (1-158) + (S13-8); (1-158) + (S13-9); (1-158) + (S14-1)
(1-159) + (S1-1); (1-159) + (S1-2); (1-159) + (S1-3); (1-159) + (S1-4); (1-159) + (S1- 5); (1-159) + (S1-6); (1-159) + (S1-7); (1-159) + (S1-8); (1-159) + (S1-9); (1-159) + (SM O); (1-159) + (S1-11 ); (1-159) + (S1-12); (1-159) + (S1-13); (1-159) + (S2-1 ); (I-
159) + (S2-2); (1-159) + (S2-3); (1-159) + (S2-4); (1-159) + (S2-5); (1-159) + (S2-6); (1-159) + (S2-7); (1-159) + (S2-8); (1-159) + (S2-9); (1-159) + (S2-10); (1-159) + (S3- 1); (1-159) + (S3-2); (1-159) + (S3-3); (1-159) + (S3-4); (1-159) + (S3-5); (1-159) + (S3-6); (1-159) + (S3-7); (1-159) + (S3-8); (1-159) + (S3-9); (1-159) + (S3-10); (1-159)
+ (S3-11); (1-159) + (S4-1); (1-159) + (S4-2); (1-159) + (S4-3); (1-159) + (S4-4); (I-
159) + (S4-5); (1-159) + (S7-1); (1-159) + (S11-1 ); (1-159) + (S11-2); (1-159) + (S11- 3); (1-159) + (S12-1); (1-159) + (S13-1); (1-159) + (S13-2); (1-159) + (S13-3); (1-159) + (S13-4): (1-159) + (S13-5); (1-159) + (S13-6); (1-159) + (S13-7); (1-159) + (S13-8); (1-159) + (S13-9); (1-159) + (S14-1 )
(1-160) + (S1 -1); (1-160) + (S1-2); (1-160) + (S1-3); (1-160) + (S1-4); (1-160) + (S1- 5); (1-160) + (S1-6); (1-160) + (S1-7); (1-160) + (S1-8); (1-160) + (S1-9); (1-160) + (S1-10); (1-160) + (S1-11); (1-160) + (S1-12); (1-160) + (S1-13); (1-160) + (S2-1); (I-
160) + (S2-2); (1-160) + (S2-3); (1-160) + (S2^); (1-160) + (S2-5); (1-160) + (S2-6); (1-160) + (S2-7); (1-160) + (S2-8); (1-160) + (S2-9); (1-160) + (S2-10); (1-160) + (S3- 1); (1-160) + (S3-2); (1-160) + (S3-3); (1-160) + (S3-4); (1-160) + (S3-5); (1-160) + (S3-6); (1-160) + (S3-7); (1-160) + (S3-8); (1-160) + (S3-9); (1-160) + (S3-10); (1-160) + (S3-11); (1-160) + (S4-1 ); (1-160) + (S4-2); (1-160) + (S4-3); (1-160) + (S4-4); (I-
160) + (S4-5); (1-160) + (S7-1); (1-160) + (S11-1 ); (1-160) + (S11-2); (1-160) + (S11- 3); (1-160) + (S12-1); (1-160) + (S13-1); (1-160) + (S13-2); (1-160) + (S13-3); (1-160) + (S13-4): (1-160) + (S13-5); (1-160) + (S13-6); (1-160) + (S13-7); (1-160) + (S13-8); (1-160) + (S13-9); (1-160) + (S14-1)
(1-161) + (S1-1); (1-161) + (S1-2); (1-161) + (S1-3); (1-161 ) + (S1-4); (1-161) + (S1- 5); (1-161) + (S1-6); (1-161) + (S1-7); (1-161) + (S1-8); (1-161 ) + (S1-9); (1-161) + (S1-10); (1-161) + (S1-11); (1-161) + (S1-12); (1-161) + (S1-13); (1-161) + (S2-1); (I-
161) + (S2-2); (1-161) + (S2-3); (1-161 ) + (S2-4); (1-161) + (S2-5); (1-161 ) + (S2-6); (1-161 ) + (S2-7); (1-161) + (S2-8); (1-161 ) + (S2-9); (1-161) + (S2-10); (1-161) + (S3- 1); (1-161) + (S3-2); (1-161) + (S3-3); (1-161) + (S3-4); (1-161 ) + (S3-5); (1-161 ) + (S3-6); (1-161) + (S3-7); (1-161) + (S3-8); (1-161 ) + (S3-9); (1-161) + (S3-10); (1-161) + (S3-11); (1-161) + (S4-1); (1-161 ) + (S4-2); (1-161) + (S4-3); (1-161 ) + (S4-4); (I- 161 ) + (S4-5); (1-161) + (S7-1); (1-161 ) + (S11-1); (1-161 ) + (S11-2); (1-161 ) + (S11- 3); (1-161) + (S12-1); (1-161) + (S13-1); (1-161) + (S13-2); (1-161) + (S13-3); (1-161) + (S13-4): (1-161) + (S13-5); (1-161) + (S13-6); (1-161) + (S13-7); (1-161) + (S13-8); (1-161) + (S13-9); (1-161) + (S14-1 )
(1-162) + (SM); (1-162) + (S1-2); (1-162) + (S1-3); (1-162) + (S1-4); (1-162) + (S1- 5); (1-162) + (S1-6); (1-162) + (S1-7); (1-162) + (S1-8); (1-162) + (S1-9); (1-162) + (S1-10); (1-162) + (S1-11); (1-162) + (S1-12); (1-162) + (S1-13); (1-162) + (S2-1); (I-
162) + (S2-2); (1-162) + (S2-3); (1-162) + (S2-4); (1-162) + (S2-5); (1-162) + (S2-6); (1-162) + (S2-7); (1-162) + (S2-8); (1-162) + (S2-9); (1-162) + (S2-10); (1-162) + (S3- 1); (1-162) + (S3-2); (1-162) + (S3-3); (1-162) + (S3-4); (1-162) + (S3-5); (1-162) + (S3-6); (1-162) + (S3-7); (1-162) + (S3-8); (1-162) + (S3-9); (1-162) + (S3-10); (1-162) + (S3-11); (1-162) + (S4-1 ); (1-162) + (S4-2); (1-162) + (S4-3); (1-162) + (S4-4); (I-
162) + (S4-5); (1-162) + (S7-1 ); (1-162) + (S11-1); (1-162) + (S11-2); (1-162) + (S11- 3); (1-162) + (S12-1); (1-162) + (S13-1); (1-162) + (S13-2); (1-162) + (S13-3); (1-162) + (S13-4): (1-162) + (S13-5); (1-162) + (S13-6); (1-162) + (S13-7); (1-162) + (S13-8); (1-162) + (S13-9); (1-162) + (S14-1 )
(1-163) + (S1-1); (1-163) + (S1-2); (1-163) + (S1-3); (1-163) + (S1-4); (1-163) + (S1- 5); (1-163) + (S1-6); (1-163) + (S1-7); (1-163) + (S1-8); (1-163) + (S1-9); (1-163) + (S1-10); (1-163) + (S1-11); (1-163) + (S1-12); (1-163) + (S1-13); (1-163) + (S2-1 ); (I-
163) + (S2-2); (1-163) + (S2-3); (1-163) + (S2^); (1-163) + (S2-5); (1-163) + (S2-6); (1-163) + (S2-7); (1-163) + (S2-8); (1-163) + (S2-9); (1-163) + (S2-10); (1-163) + (S3- 1); (1-163) + (S3-2); (1-163) + (S3-3); (1-163) + (S3-4); (1-163) + (S3-5); (1-163) + (S3-6); (1-163) + (S3-7); (1-163) + (S3-8); (1-163) + (S3-9); (1-163) + (S3-10); (1-163) + (S3-11); (1-163) + (S4-1); (1-163) + (S4-2); (1-163) + (S4-3); (1-163) + (S4-4); (I-
163) + (S4-5); (1-163) + (S7-1); (1-163) + (S11-1 ); (1-163) + (S11-2); (1-163) + (S11- 3); (1-163) + (S12-1); (1-163) + (S13-1 ); (1-163) + (S13-2); (1-163) + (S13-3); (1-163) + (S13-4): (1-163) + (S13-5); (1-163) + (S13-6); (1-163) + (S13-7); (1-163) + (S13-8); (1-163) + (S13-9); (1-163) + (S14-1 )
(1-164) + (S1-1 ); (1-164) + (S1-2); (1-164) + (S1-3); (1-164) + (S1-4); (1-164) + (S1- 5); (1-164) + (S1-6); (1-164) + (S1 -7); (1-164) + (S1-8); (1-164) + (S1-9); (1-164) + (S1-10); (1-164) + (S1-11 ); (1-164) + (S1-12); (1-164) + (S1-13); (1-164) + (S2-1); (I-
164) + (S2-2); (1-164) + (S2-3); (1-164) + (S2-4); (1-164) + (S2-5); (1-164) + (S2-6); (1-164) + (S2-7); (1-164) + (S2-8); (1-164) + (S2-9); (1-164) + (S2-10); (1-164) + (S3- 1); (1-164) + (S3-2); (1-164) + (S3-3); (1-164) + (S3-4); (1-164) + (S3-5); (1-164) + (S3-6); (1-164) + (S3-7); (1-164) + (S3-8); (1-164) + (S3-9); (1-164) + (S3-10); (1-164) + (S3-11 ); (1-164) + (S4-1 ); (1-164) + (S4-2); (1-164) + (S4-3); (1-164) + (S4-4); (I- 164) + (S4-5); (1-164) + (S7-1 ); (1-164) + (S11-1); (1-164) + (S11-2); (1-164) + (S11 - 3); (1-164) + (S12-1); (1-164) + (S13-1); (1-164) + (S13-2); (1-164) + (S13-3); (1-164) + (S13-4): (1-164) + (S13-5); (1-164) + (S13-6); (1-164) + (S13-7); (1-164) + (S13-8);
(1-164) + (S13-9); (1-164) + (S14-1)
(1-165) + (S1-1 ); (1-165) + (S1-2); (1-165) + (S1-3); (1-165) + (S1-4); (1-165) + (S1- 5); (1-165) + (S1-6); (1-165) + (S1-7); (1-165) + (S1-8); (1-165) + (S1 -9); (1-165) + (S1-10); (1-165) + (S1-11 ); (1-165) + (S1-12); (1-165) + (S1-13); (1-165) + (S2-1 ); (I- 165) + (S2-2); (1-165) + (S2-3); (1-165) + (S2-4); (1-165) + (S2-5); (1-165) + (S2-6); (1-165) + (S2-7); (1-165) + (S2-8); (1-165) + (S2-9); (1-165) + (S2-10); (1-165) + (S3- 1); (1-165) + (S3-2); (1-165) + (S3-3); (1-165) + (S3-4); (1-165) + (S3-5); (1-165) + (S3-6); (1-165) + (S3-7); (1-165) + (S3-8); (1-165) + (S3-9); (1-165) + (S3-10); (1-165) + (S3-11); (1-165) + (S4-1); (1-165) + (S4-2); (1-165) + (S4-3); (1-165) + (S4-4); (I-
165) + (S4-5); (1-165) + (S7-1); (1-165) + (S11-1); (1-165) + (S11-2); (1-165) + (S11- 3); (1-165) + (S12-1 ); (1-165) + (S13-1); (1-165) + (S13-2); (1-165) + (S13-3); (1-165) + (S13-4): (1-165) + (S13-5); (1-165) + (S13-6); (1-165) + (S13-7); (1-165) + (S13-8); (1-165) + (S13-9); (1-165) + (S14-1 )
(1-166) + (S1-1); (1-166) + (S1-2); (1-166) + (S1-3); (1-166) + (S1-4); (1-166) + (S1- 5); (1-166) + (S1-6); (1-166) + (S1-7); (1-166) + (S1-8); (1-166) + (S1-9); (1-166) + (S1-10); (1-166) + (S1-11); (1-166) + (S1-12); (1-166) + (S1-13); (1-166) + (S2-1); (I-
166) + (S2-2); (1-166) + (S2-3); (1-166) + (S2-4); (1-166) + (S2-5); (1-166) + (S2-6); (1-166) + (S2-7); (1-166) + (S2-8); (1-166) + (S2-9); (1-166) + (S2-10); (1-166) + (S3- 1); (1-166) + (S3-2); (1-166) + (S3-3); (1-166) + (S3-4); (1-166) + (S3-5); (1-166) + (S3-6); (1-166) + (S3-7); (1-166) + (S3-8); (1-166) + (S3-9); (1-166) + (S3-10); (1-166) + (S3-11 ); (1-166) + (S4-1); (1-166) + (S4-2); (1-166) + (S4-3); (1-166) + (S4-4); (I-
166) + (S4-5); (1-166) + (S7-1); (1-166) + (S11-1); (1-166) + (S11-2); (1-166) + (S11- 3); (1-166) + (S12-1); (1-166) + (S13-1); (1-166) + (S13-2); (1-166) + (S13-3); (1-166) + (S13-4): (1-166) + (S13-5); (1-166) + (S13-6); (1-166) + (S13-7); (1-166) + (S13-8); (1-166) + (S13-9); (1-166) + (S14-1)
(1-167) + (SM); (1-167) + (S1-2); (1-167) + (S1-3); (1-167) + (S1-4); (1-167) + (S1- 5); (1-167) + (S1-6); (1-167) + (S1-7); (1-167) + (S1-8); (1-167) + (S1-9); (1-167) + (S1-10); (1-167) + (S1-11); (1-167) + (S1-12); (1-167) + (S1-13); (1-167) + (S2-1); (I-
167) + (S2-2); (1-167) + (S2-3); (1-167) + (S2-4); (1-167) + (S2-5); (1-167) + (S2-6); (1-167) + (S2-7); (1-167) + (S2-8); (1-167) + (S2-9); (1-167) + (S2-10); (1-167) + (S3- 1); (1-167) + (S3-2); (1-167) + (S3-3); (1-167) + (S3-4); (1-167) + (S3-5); (1-167) + (S3-6); (1-167) + (S3-7); (1-167) + (S3-8); (1-167) + (S3-9); (1-167) + (S3-10); (1-167)
+ (S3-11 ); (1-167) + (S4-1); (1-167) + (S4-2); (1-167) + (S4-3); (1-167) + (S4-4); (I-
167) + (S4-5); (1-167) + (S7-1); (1-167) + (S11-1 ); (1-167) + (S11-2); (1-167) + (S11- 3); (1-167) + (S12-1 ); (1-167) + (S13-1); (1-167) + (S13-2); (1-167) + (S13-3); (1-167) + (S13-4): (1-167) + (S13-5); (1-167) + (S13-6); (1-167) + (S13-7); (1-167) + (S13-8); (1-167) + (S13-9); (1-167) + (S14-1)
(1-168) + (S1-1); (1-168) + (S1-2); (1-168) + (S1-3); (1-168) + (S1-4); (1-168) + (S1- 5); (1-168) + (S1-6); (1-168) + (S1-7); (1-168) + (S1-8); (1-168) + (S1-9); (1-168) + (S1-10); (1-168) + (S1-11); (1-168) + (S1-12); (1-168) + (S1-13); (1-168) + (S2-1); (I-
168) + (S2-2); (1-168) + (S2-3); (1-168) + (S2-4); (1-168) + (S2-5); (1-168) + (S2-6); (1-168) + (S2-7); (1-168) + (S2-8); (1-168) + (S2-9); (1-168) + (S2-10); (1-168) + (S3- 1); (1-168) + (S3-2); (1-168) + (S3-3); (1-168) + (S3-4); (1-168) + (S3-5); (1-168) + (S3-6); (1-168) + (S3-7); (1-168) + (S3-8); (1-168) + (S3-9); (1-168) + (S3-10); (1-168) + (S3-11 ); (1-168) + (S4-1 ); (1-168) + (S4-2); (1-168) + (S4-3); (1-168) + (S4-4); (I-
168) + (S4-5); (1-168) + (S7-1); (1-168) + (S11-1); (1-168) + (S11-2); (1-168) + (S11- 3); (1-168) + (S12-1); (1-168) + (S13-1 ); (1-168) + (S13-2); (1-168) + (S13-3); (1-168) + (S13-4): (1-168) + (S13-5); (1-168) + (S13-6); (1-168) + (S13-7); (1-168) + (S13-8); (1-168) + (S13-9); (1-168) + (S14-1)
(1-169) + (S1-1); (1-169) + (S1-2); (1-169) + (S1-3); (1-169) + (S1-4); (1-169) + (S1- 5); (1-169) + (S1-6); (1-169) + (S1-7); (1-169) + (S1-8); (1-169) + (S1-9); (1-169) + (S1-10); (1-169) + (S1-11); (1-169) + (S1-12); (1-169) + (S1-13); (1-169) + (S2-1 ); (I-
169) + (S2-2); (1-169) + (S2-3); (1-169) + (S2-4); (1-169) + (S2-5); (1-169) + (S2-6); (1-169) + (S2-7); (1-169) + (S2-8); (1-169) + (S2-9); (1-169) + (S2-10); (1-169) + (S3- 1); (1-169) + (S3-2); (1-169) + (S3-3); (1-169) + (S3-4); (1-169) + (S3-5); (1-169) + (S3-6); (1-169) + (S3-7); (1-169) + (S3-8); (1-169) + (S3-9); (1-169) + (S3-10); (1-169) + (S3-11); (1-169) + (S4-1); (1-169) + (S4-2); (1-169) + (S4-3); (1-169) + (S4-4); (I- 169) + (S4-5); (1-169) + (S7-1 ); (1-169) + (S11-1); (1-169) + (S11-2); (1-169) + (S11- 3); (1-169) + (S12-1); (1-169) + (S13-1); (1-169) + (S13-2); (1-169) + (S13-3); (1-169) + (S13-4): (1-169) + (S13-5); (1-169) + (S13-6); (1-169) + (S13-7); (1-169) + (S13-8); (1-169) + (S13-9); (1-169) + (S14-1 )
(1-170) + (S1-1); (1-170) + (S1-2); (1-170) + (S1-3); (1-170) + (S1-4); (1-170) + (S1- 5); (1-170) + (S1-6); (1-170) + (S1-7); (1-170) + (S1-8); (1-170) + (S1-9); (1-170) + (S1-10); (1-170) + (S1-11 ); (1-170) + (S1-12); (1-170) + (S1-13); (1-170) + (S2-1 ); (I-
170) + (S2-2); (1-170) + (S2-3); (1-170) + (S2-4); (1-170) + (S2-5); (1-170) + (S2-6); (1-170) + (S2-7); (1-170) + (S2-8); (1-170) + (S2-9); (1-170) + (S2-10); (1-170) + (S3- 1); (1-170) + (S3-2); (1-170) + (S3-3); (1-170) + (S3-4); (1-170) + (S3-5); (1-170) + (S3-6); (1-170) + (S3-7); (1-170) + (S3-8); (1-170) + (S3-9); (1-170) + (S3-10); (1-170) + (S3-11); (1-170) + (S4-1 ); (1-170) + (S4-2); (1-170) + (S4-3); (1-170) + (S4-4); (I-
170) + (S4-5); (1-170) + (S7-1); (1-170) + (S11-1); (1-170) + (S11-2); (1-170) + (S11- 3); (1-170) + (S12-1); (1-170) + (S13-1); (1-170) + (S13-2); (1-170) + (S13-3); (1-170) + (S13-4): (1-170) + (S13-5); (1-170) + (S13-6); (1-170) + (S13-7); (1-170) + (S13-8); (1-170) + (S13-9); (1-170) + (S14-1)
(1-171) + (S1-1); (1-171 ) + (S1-2); (1-171) + (S1-3); (1-171 ) + (S1-4); (1-171) + (S1- 5); (1-171 ) + (S1-6); (1-171 ) + (S1-7); (1-171) + (S1-8); (1-171 ) + (S1-9); (1-171) + (S1-10); (1-171) + (S1 -11); (1-171) + (S1-12); (1-171 ) + (S1-13); (1-171) + (S2-1 ); (I-
171 ) + (S2-2); (1-171) + (S2-3); (1-171 ) + (S2-4); (1-171) + (S2-5); (1-171) + (S2-6); (1-171) + (S2-7); (1-171) + (S2-8); (1-171) + (S2-9); (1-171) + (S2-10); (1-171) + (S3- 1); (1-171) + (S3-2); (1-171) + (S3-3); (1-171) + (S3-4); (1-171 ) + (S3-5); (1-171 ) + (S3-6); (1-171 ) + (S3-7); (1-171) + (S3-8); (1-171) + (S3-9); (1-171 ) + (S3-10); (1-171) + (S3-11); (1-171) + (S4-1 ); (1-171) + (S4-2); (1-171) + (S4-3); (1-171) + (S4-4); (I-
171 ) + (S4-5); (1-171) + (S7-1 ); (1-171 ) + (S11-1); (1-171 ) + (S11-2); (1-171) + (S11- 3); (1-171) + (S12-1 ); (1-171 ) + (S13-1 ); (1-171) + (S13-2); (1-171 ) + (S13-3); (1-171) + (S13-4): (1-171) + (S13-5); (1-171) + (S13-6); (1-171) + (S13-7); (1-171) + (S13-8); (1-171) + (S13-9); (1-171) + (S14-1)
(1-172) + (S1-1 ); (1-172) + (S1-2); (1-172) + (S1-3); (1-172) + (S1-4); (1-172) + (S1- 5); (1-172) + (S1-6); (1-172) + (S1-7); (1-172) + (S1-8); (1-172) + (S1-9); (1-172) + (S1-10); (1-172) + (S1-11 ); (1-172) + (S1-12); (1-172) + (S1-13); (1-172) + (S2-1); (I-
172) + (S2-2); (1-172) + (S2-3); (1-172) + (S2-4); (1-172) + (S2-5); (1-172) + (S2-6); (1-172) + (S2-7); (1-172) + (S2-8); (1-172) + (S2-9); (1-172) + (S2-10); (1-172) + (S3- 1); (1-172) + (S3-2); (1-172) + (S3-3); (1-172) + (S3-4); (1-172) + (S3-5); (1-172) + (S3-6); (1-172) + (S3-7); (1-172) + (S3-8); (1-172) + (S3-9); (1-172) + (S3-10); (1-172) + (S3-11); (1-172) + (S4-1); (1-172) + (S4-2); (1-172) + (S4-3); (1-172) + (S4-4); (I- 172) + (S4-5); (1-172) + (S7-1); (1-172) + (S11-1); (1-172) + (S11-2); (1-172) + (S11- 3); (1-172) + (S12-1); (1-172) + (S13-1); (1-172) + (S13-2); (1-172) + (S13-3); (1-172) + (S13-4): (1-172) + (S13-5); (1-172) + (S13-6); (1-172) + (S13-7); (1-172) + (S13-8);
(1-172) + (S13-9); (1-172) + (S14-1)
(1-173) + (S1-1); (1-173) + (S1-2); (1-173) + (S1-3); (1-173) + (S1-4); (1-173) + (S1 - 5); (1-173) + (S1-6); (1-173) + (S1-7); (1-173) + (S1-8); (1-173) + (S1-9); (1-173) + (S1-10); (1-173) + (S1-11 ); (1-173) + (S1-12); (1-173) + (S1-13); (1-173) + (S2-1 ); (I- 173) + (S2-2); (1-173) + (S2-3); (1-173) + (S2-4); (1-173) + (S2-5); (1-173) + (S2-6); (1-173) + (S2-7); (1-173) + (S2-8); (1-173) + (S2-9); (1-173) + (S2-10); (1-173) + (S3- 1); (1-173) + (S3-2); (1-173) + (S3-3); (1-173) + (S3-4); (1-173) + (S3-5); (1-173) + (S3-6); (1-173) + (S3-7); (1-173) + (S3-8); (1-173) + (S3-9); (1-173) + (S3-10); (1-173) + (S3-11); (1-173) + (S4-1 ); (1-173) + (S4-2); (1-173) + (S4-3); (1-173) + (S4-4); (I-
173) + (S4-5); (1-173) + (S7-1 ); (1-173) + (S11-1); (1-173) + (S11-2); (1-173) + (S1 1- 3); (1-173) + (S12-1); (1-173) + (S13-1); (1-173) + (S13-2); (1-173) + (S13-3); (1-173) + (S13-4): (1-173) + (S13-5); (1-173) + (S13-6); (1-173) + (S13-7); (1-173) + (S13-8); (1-173) + (S13-9); (1-173) + (S14-1)
(1-174) + (S1-1 ); (1-174) + (S1-2); (1-174) + (S1-3); (1-174) + (S1-4); (1-174) + (S1- 5); (1-174) + (S1-6); (1-174) + (S1-7); (1-174) + (S1-8); (1-174) + (S1-9); (1-174) + (S1-10); (1-174) + (S1-11); (1-174) + (S1-12); (1-174) + (S1-13); (1-174) + (S2-1 ); (I-
174) + (S2-2); (1-174) + (S2-3); (1-174) + (S2-4); (1-174) + (S2-5); (1-174) + (S2-6); (1-174) + (S2-7); (1-174) + (S2-8); (1-174) + (S2-9); (1-174) + (S2-10); (1-174) + (S3- 1); (1-174) + (S3-2); (1-174) + (S3-3); (1-174) + (S3-4); (1-174) + (S3-5); (1-174) + (S3-6); (1-174) + (S3-7); (1-174) + (S3-8); (1-174) + (S3-9); (1-174) + (S3-10); (1-174) + (S3-11); (1-174) + (S4-1); (1-174) + (S4-2); (1-174) + (S4-3); (1-174) + (S4-4); (I-
174) + (S4-5); (1-174) + (S7-1 ); (1-174) + (S11-1 ); (1-174) + (S11-2); (1-174) + (S11- 3); (1-174) + (S12-1); (1-174) + (S13-1); (1-174) + (S13-2); (1-174) + (S13-3); (1-174) + (S13-4): (1-174) + (S13-5); (1-174) + (S13-6); (1-174) + (S13-7); (1-174) + (S13-8); (1-174) + (S13-9); (1-174) + (S14-1 )
(1-175) + (S1-1); (1-175) + (S1-2); (1-175) + (S1-3); (1-175) + (S1-4); (1-175) + (S1- 5); (1-175) + (S1-6); (1-175) + (S1-7); (1-175) + (S1-8); (1-175) + (S1-9); (1-175) + (S1-10); (1-175) + (S1-11); (1-175) + (S1-12); (1-175) + (S1-13); (1-175) + (S2-1); (I-
175) + (S2-2); (1-175) + (S2-3); (1-175) + (S2-4); (1-175) + (S2-5); (1-175) + (S2-6); (1-175) + (S2-7); (1-175) + (S2-8); (1-175) + (S2-9); (1-175) + (S2-10); (1-175) + (S3- 1); (1-175) + (S3-2); (1-175) + (S3-3); (1-175) + (S3-4); (1-175) + (S3-5); (1-175) + (S3-6); (1-175) + (S3-7); (1-175) + (S3-8); (1-175) + (S3-9); (1-175) + (S3-10); (1-175)
+ (S3-1 1 ); (1-175) + (S4-1); (1-175) + (S4-2); (1-175) + (S4-3); (1-175) + (S4-4); (I-
175) + (S4-5); (1-175) + (S7-1); (1-175) + (S11-1); (1-175) + (S11-2); (1-175) + (S11- 3); (1-175) + (S12-1); (1-175) + (S13-1); (1-175) + (S13-2); (1-175) + (S13-3); (1-175) + (S13-4): (1-175) + (S13-5); (1-175) + (S13-6); (1-175) + (S13-7); (1-175) + (S13-8); (1-175) + (S13-9); (1-175) + (S14-1 )
(1-176) + (S1-1); (1-176) + (S1-2); (1-176) + (S1-3); (1-176) + (S1-4); (1-176) + (S1- 5); (1-176) + (S1-6); (1-176) + (S1-7); (1-176) + (S1-8); (1-176) + (S1-9); (1-176) + (S1-10); (1-176) + (S1-11); (1-176) + (S1-12); (1-176) + (S1-13); (1-176) + (S2-1); (I-
176) + (S2-2); (1-176) + (S2-3); (1-176) + (S2^); (1-176) + (S2-5); (1-176) + (S2-6); (1-176) + (S2-7); (1-176) + (S2-8); (1-176) + (S2-9); (1-176) + (S2-10); (1-176) + (S3- 1); (1-176) + (S3-2); (1-176) + (S3-3); (1-176) + (S3-4); (1-176) + (S3-5); (1-176) + (S3-6); (1-176) + (S3-7); (1-176) + (S3-8); (1-176) + (S3-9); (1-176) + (S3-10); (1-176) + (S3-11); (1-176) + (S4-1); (1-176) + (S4-2); (1-176) + (S4-3); (1-176) + (S4-4); (I-
176) + (S4-5); (1-176) + (S7-1); (1-176) + (S11-1); (1-176) + (S11-2); (1-176) + (S11- 3); (1-176) + (S12-1); (1-176) + (S13-1 ); (1-176) + (S13-2); (1-176) + (S13-3); (1-176) + (S13-4): (1-176) + (S13-5); (1-176) + (S13-6); (1-176) + (S13-7); (1-176) + (S13-8); (1-176) + (S13-9); (1-176) + (S14-1 )
(1-177) + (S1-1 ); (1-177) + (S1-2); (1-177) + (S1-3); (1-177) + (S1-4); (1-177) + (S1- 5); (1-177) + (S1-6); (1-177) + (S1-7); (1-177) + (S1-8); (1-177) + (S1-9); (1-177) + (S1-10); (1-177) + (S1-1 1); (1-177) + (S1-12); (1-177) + (S1-13); (1-177) + (S2-1 ); (I-
177) + (S2-2); (1-177) + (S2-3); (1-177) + (S2^); (1-177) + (S2-5); (1-177) + (S2-6); (1-177) + (S2-7); (1-177) + (S2-8); (1-177) + (S2-9); (1-177) + (S2-10); (1-177) + (S3- 1); (1-177) + (S3-2); (1-177) + (S3-3); (1-177) + (S3-4); (1-177) + (S3-5); (1-177) + (S3-6); (1-177) + (S3-7); (1-177) + (S3-8); (1-177) + (S3-9); (1-177) + (S3-10); (1-177) + (S3-11); (1-177) + (S4-1); (1-177) + (S4-2); (1-177) + (S4-3); (1-177) + (S4-4); (I- 177) + (S4-5); (1-177) + (S7-1); (1-177) + (S11-1); (1-177) + (S11-2); (1-177) + (S11- 3); (1-177) + (S12-1 ); (1-177) + (S13-1); (1-177) + (S13-2); (1-177) + (S13-3); (1-177) + (S13-4): (1-177) + (S13-5); (1-177) + (S13-6); (1-177) + (S13-7); (1-177) + (S13-8); (1-177) + (S13-9); (1-177) + (S14-1)
(1-178) + (S1-1 ); (1-178) + (S1-2); (1-178) + (S1-3); (1-178) + (S1-4); (1-178) + (S1- 5); (1-178) + (S1-6); (1-178) + (S1-7); (1-178) + (S1-8); (1-178) + (S1-9); (1-178) + (S1-10); (1-178) + (S1-11); (1-178) + (S1-12); (1-178) + (S1-13); (1-178) + (S2-1); (I-
178) + (S2-2); (1-178) + (S2-3); (1-178) + (S2-4); (1-178) + (S2-5); (1-178) + (S2-6); (1-178) + (S2-7); (1-178) + (S2-8); (1-178) + (S2-9); (1-178) + (S2-10); (1-178) + (S3- 1); (1-178) + (S3-2); (1-178) + (S3-3); (1-178) + (S3-4); (1-178) + (S3-5); (1-178) + (S3-6); (1-178) + (S3-7); (1-178) + (S3-8); (1-178) + (S3-9); (1-178) + (S3-10); (1-178) + (S3-11); (1-178) + (S4-1 ); (1-178) + (S4-2); (1-178) + (S4-3); (1-178) + (S4-4); (I-
178) + (S4-5); (1-178) + (S7-1); (1-178) + (S11-1); (1-178) + (S11-2); (1-178) + (S11- 3); (1-178) + (S12-1); (1-178) + (S13-1); (1-178) + (S13-2); (1-178) + (S13-3); (1-178) + (S13-4): (1-178) + (S13-5); (1-178) + (S13-6); (1-178) + (S13-7); (1-178) + (S13-8); (1-178) + (S13-9); (1-178) + (S14-1 )
(1-179) + (S1-1); (1-179) + (S1-2); (1-179) + (S1-3); (1-179) + (S1-4); (1-179) + (S1- 5); (1-179) + (S1-6); (1-179) + (S1-7); (1-179) + (S1-8); (1-179) + (S1-9); (1-179) + (S1-10); (1-179) + (S1-11 ); (1-179) + (S1-12); (1-179) + (S1-13); (1-179) + (S2-1); (I-
179) + (S2-2); (1-179) + (S2-3); (1-179) + (S2-4); (1-179) + (S2-5); (1-179) + (S2-6); (1-179) + (S2-7); (1-179) + (S2-8); (1-179) + (S2-9); (1-179) + (S2-10); (1-179) + (S3- 1 ); (1-179) + (S3-2); (1-179) + (S3-3); (1-179) + (S3-4); (1-179) + (S3-5); (1-179) + (S3-6); (1-179) + (S3-7); (1-179) + (S3-8); (1-179) + (S3-9); (1-179) + (S3-10); (1-179) + (S3-11); (1-179) + (S4-1 ); (1-179) + (S4-2); (1-179) + (S4-3); (1-179) + (S4-4); (I-
179) + (S4-5); (1-179) + (S7-1); (1-179) + (S11-1); (1-179) + (S11-2); (1-179) + (S11- 3); (1-179) + (S12-1); (1-179) + (S13-1); (1-179) + (S13-2); (1-179) + (S13-3); (1-179) + (S13-4): (1-179) + (S13-5); (1-179) + (S13-6); (1-179) + (S13-7); (1-179) + (S13-8); (1-179) + (S13-9); (1-179) + (S14-1 )
(1-180) + (S1-1); (1-180) + (S1-2); (1-180) + (S1-3); (1-180) + (S1-4); (1-180) + (S1- 5); (1-180) + (S1-6); (1-180) + (S1-7); (1-180) + (S1-8); (1-180) + (S1-9); (1-180) + (S1-10); (1-180) + (S1-11); (1-180) + (S1-12); (1-180) + (S1-13); (1-180) + (S2-1); (I-
180) + (S2-2); (1-180) + (S2-3); (1-180) + (S2-4); (1-180) + (S2-5); (1-180) + (S2-6); (1-180) + (S2-7); (1-180) + (S2-8); (1-180) + (S2-9); (1-180) + (S2-10); (1-180) + (S3- 1); (1-180) + (S3-2); (1-180) + (S3-3); (1-180) + (S3-4); (1-180) + (S3-5); (1-180) + (S3-6); (1-180) + (S3-7); (1-180) + (S3-8); (1-180) + (S3-9); (1-180) + (S3-10); (1-180) + (S3-11 ); (1-180) + (S4-1); (1-180) + (S4-2); (1-180) + (S4-3); (1-180) + (S4-4); (I- 180) + (S4-5); (1-180) + (S7-1); (1-180) + (S11-1); (1-180) + (S11-2); (1-180) + (S11- 3); (1-180) + (S12-1); (1-180) + (S13-1); (1-180) + (S13-2); (1-180) + (S13-3); (1-180) + (S13-4): (1-180) + (S13-5); (1-180) + (S13-6); (1-180) + (S13-7); (1-180) + (S13-8);
(1-180) + (S13-9); (1-180) + (S14-1)
(1-181) + (S1-1); (1-181) + (S1-2); (1-181 ) + (S1-3); (1-181) + (SI^); (1-181 ) + (S1- 5); (1-181 ) + (S1 -6); (1-181 ) + (S1-7); (1-181) + (S1-8); (1-181 ) + (S1-9); (1-181) + (S1-10); (1-181 ) + (S1-1 1); (1-181) + (S1-12); (1-181) + (S1-13); (1-181 ) + (S2-1 ); (I- 181) + (S2-2); (1-181 ) + (S2-3); (1-181 ) + (S2-4); (1-181) + (S2-5); (1-181) + (S2-6); (1-181 ) + (S2-7); (1-181) + (S2-8); (1-181 ) + (S2-9); (1-181) + (S2-10); (1-181) + (S3- 1 ); (1-181) + (S3-2); (1-181) + (S3-3); (1-181 ) + (S3-4); (1-181 ) + (S3-5); (1-181) + (S3-6); (1-181) + (S3-7); (1-181) + (S3-8); (1-181) + (S3-9); (1-181) + (S3-10); (1-181) + (S3-11); (1-181 ) + (S4-1 ); (1-181) + (S4-2); (1-181) + (S4-3); (1-181 ) + (S4-4); (I-
181) + (S4-5); (1-181 ) + (S7-1); (1-181 ) + (S11-1); (1-181) + (S11-2); (1-181 ) + (S11- 3); (1-181) + (S12-1); (1-181) + (S13-1 ); (1-181) + (S13-2); (1-181) + (S13-3); (1-181 ) + (S13-4): (1-181 ) + (S13-5); (1-181 ) + (S13-6); (1-181) + (S13-7); (1-181 ) + (S13-8); (1-181 ) + (S13-9); (1-181 ) + (S14-1)
(1-182) + (S1-1 ); (1-182) + (S1-2); (1-182) + (S1-3); (1-182) + (S1-4); (1-182) + (S1- 5); (1-182) + (S1-6); (1-182) + (S1-7); (1-182) + (S1-8); (1-182) + (S1-9); (1-182) + (S1-10); (1-182) + (S1-11); (1-182) + (S1-12); (1-182) + (S1-13); (1-182) + (S2-1); (I-
182) + (S2-2); (1-182) + (S2-3); (1-182) + (S2^); (1-182) + (S2-5); (1-182) + (S2-6); (1-182) + (S2-7); (1-182) + (S2-8); (1-182) + (S2-9); (1-182) + (S2-10); (1-182) + (S3- 1 ); (1-182) + (S3-2); (1-182) + (S3-3); (1-182) + (S3-4); (1-182) + (S3-5); (1-182) + (S3-6); (1-182) + (S3-7); (1-182) + (S3-8); (1-182) + (S3-9); (1-182) + (S3-10); (1-182) + (S3-11); (1-182) + (S4-1); (1-182) + (S4-2); (1-182) + (S4-3); (1-182) + (S4-4); (I-
182) + (S4-5); (1-182) + (S7-1); (1-182) + (S11-1 ); (1-182) + (S11-2); (1-182) + (S11- 3); (1-182) + (S12-1 ); (1-182) + (S13-1); (1-182) + (S13-2); (1-182) + (S13-3); (1-182) + (S13-4): (1-182) + (S13-5); (1-182) + (S13-6); (1-182) + (S13-7); (1-182) + (S13-8); (1-182) + (S13-9); (1-182) + (S14-1)
(1-183) + (S1-1); (1-183) + (S1-2); (1-183) + (S1-3); (1-183) + (S1-4); (1-183) + (S1- 5); (1-183) + (S1-6); (1-183) + (S1-7); (1-183) + (S1-8); (1-183) + (S1-9); (1-183) + (S1-10); (1-183) + (S1-11); (1-183) + (S1-12); (1-183) + (S1-13); (1-183) + (S2-1); (I-
183) + (S2-2); (1-183) + (S2-3); (1-183) + (S2-4); (1-183) + (S2-5); (1-183) + (S2-6); (1-183) + (S2-7); (1-183) + (S2-8); (1-183) + (S2-9); (1-183) + (S2-10); (1-183) + (S3- 1); (1-183) + (S3-2); (1-183) + (S3-3); (1-183) + (S3-4); (1-183) + (S3-5); (1-183) + (S3-6); (1-183) + (S3-7); (1-183) + (S3-8); (1-183) + (S3-9); (1-183) + (S3-10); (1-183)
+ (S3-11); (1-183) + (S4-1 ); (1-183) + (S4-2); (1-183) + (S4-3); (1-183) + (S4-4); (I-
183) + (S4-5); (1-183) + (S7-1); (1-183) + (S11-1); (1-183) + (S11-2); (1-183) + (S11- 3); (1-183) + (S12-1 ); (1-183) + (S13-1 ); (1-183) + (S13-2); (1-183) + (S13-3); (1-183) + (S13-4): (1-183) + (S13-5); (1-183) + (S13-6); (1-183) + (S13-7); (1-183) + (S13-8); (1-183) + (S13-9); (1-183) + (S14-1 )
(1-184) + (S1-1 ); (1-184) + (S1-2); (1-184) + (S1-3); (1-184) + (S1-4); (1-184) + (S1- 5); (1-184) + (S1-6); (1-184) + (S1-7); (1-184) + (S1-8); (1-184) + (S1-9); (1-184) + (S1-10); (1-184) + (S1-11); (1-184) + (S1-12); (1-184) + (S1-13); (1-184) + (S2-1 ); (I-
184) + (S2-2); (1-184) + (S2-3); (1-184) + (S2-4); (1-184) + (S2-5); (1-184) + (S2-6); (1-184) + (S2-7); (1-184) + (S2-8); (1-184) + (S2-9); (1-184) + (S2-10); (1-184) + (S3- 1); (1-184) + (S3-2); (1-184) + (S3-3); (1-184) + (S3-4); (1-184) + (S3-5); (1-184) + (S3-6); (1-184) + (S3-7); (1-184) + (S3-8); (1-184) + (S3-9); (1-184) + (S3-10); (1-184) + (S3-11); (1-184) + (S4-1); (1-184) + (S4-2); (1-184) + (S4-3); (1-184) + (S4-4); (I-
184) + (S4-5); (1-184) + (S7-1); (1-184) + (S11-1); (1-184) + (S11-2); (1-184) + (S11- 3); (1-184) + (S12-1); (1-184) + (S13-1 ); (1-184) + (S13-2); (1-184) + (S13-3); (1-184) + (S13-4): (1-184) + (S13-5); (1-184) + (S13-6); (1-184) + (S13-7); (1-184) + (S13-8); (1-184) + (S13-9); (1-184) + (S14-1 )
(1-185) + (S1-1); (1-185) + (S1-2); (1-185) + (S1-3); (1-185) + (S1-4); (1-185) + (S1- 5); (1-185) + (S1-6); (1-185) + (S1-7); (1-185) + (S1-8); (1-185) + (S1-9); (1-185) + (S1-10); (1-185) + (S1-11); (1-185) + (S1-12); (1-185) + (S1-13); (1-185) + (S2-1); (I-
185) + (S2-2); (1-185) + (S2-3); (1-185) + (S2-4); (1-185) + (S2-5); (1-185) + (S2-6); (1-185) + (S2-7); (1-185) + (S2-8); (1-185) + (S2-9); (1-185) + (S2-10); (1-185) + (S3- 1); (1-185) + (S3-2); (1-185) + (S3-3); (1-185) + (S3-4); (1-185) + (S3-5); (1-185) + (S3-6); (1-185) + (S3-7); (1-185) + (S3-8); (1-185) + (S3-9); (1-185) + (S3-10); (1-185) + (S3-11); (1-185) + (S4-1 ); (1-185) + (S4-2); (1-185) + (S4-3); (1-185) + (S4-4); (I- 185) + (S4-5); (1-185) + (S7-1); (1-185) + (S11-1 ); (1-185) + (S11-2); (1-185) + (S11- 3); (1-185) + (S12-1); (1-185) + (S13-1 ); (1-185) + (S13-2); (1-185) + (S13-3); (1-185) + (S13-4): (1-185) + (S13-5); (1-185) + (S13-6); (1-185) + (S13-7); (1-185) + (S13-8); (1-185) + (S13-9); (1-185) + (S14-1)
(1-186) + (S1 -1); (1-186) + (S1-2); (1-186) + (S1-3); (1-186) + (S1^); (1-186) + (S1- 5); (1-186) + (S1-6); (1-186) + (S1-7); (1-186) + (S1-8); (1-186) + (S1-9); (1-186) + (S1-10); (1-186) + (S1-11); (1-186) + (S1-12); (1-186) + (S1-13); (1-186) + (S2-1 ); (I-
186) + (S2-2); (1-186) + (S2-3); (1-186) + (S2-4); (1-186) + (S2-5); (1-186) + (S2-6); (1-186) + (S2-7); (1-186) + (S2-8); (1-186) + (S2-9); (1-186) + (S2-10); (1-186) + (S3- 1); (1-186) + (S3-2); (1-186) + (S3-3); (1-186) + (S3-4); (1-186) + (S3-5); (1-186) + (S3-6); (1-186) + (S3-7); (1-186) + (S3-8); (1-186) + (S3-9); (1-186) + (S3-10); (1-186) + (S3-11); (1-186) + (S4-1); (1-186) + (S4-2); (1-186) + (S4-3); (1-186) + (S4-4); (I-
186) + (S4-5); (1-186) + (S7-1); (1-186) + (S11-1 ); (1-186) + (S11-2); (1-186) + (S11- 3); (1-186) + (S12-1 ); (1-186) + (S13-1); (1-186) + (S13-2); (1-186) + (S13-3); (1-186) + (S13-4): (1-186) + (S13-5); (1-186) + (S13-6); (1-186) + (S13-7); (1-186) + (S13-8); (1-186) + (S13-9); (1-186) + (S14-1 )
(1-187) + (SM ); (1-187) + (S1-2); (1-187) + (S1-3); (1-187) + (S1-4); (1-187) + (S1- 5); (1-187) + (S1-6); (1-187) + (S1-7); (1-187) + (S1-8); (1-187) + (S1-9); (1-187) + (SM O); (1-187) + (S1-1 1 ); (1-187) + (S1-12); (1-187) + (S1-13); (1-187) + (S2-1); (I-
187) + (S2-2); (1-187) + (S2-3); (1-187) + (S2-4); (1-187) + (S2-5); (1-187) + (S2-6); (1-187) + (S2-7); (1-187) + (S2-8); (1-187) + (S2-9); (1-187) + (S2-10); (1-187) + (S3- 1); (1-187) + (S3-2); (1-187) + (S3-3); (1-187) + (S3-4); (1-187) + (S3-5); (1-187) + (S3-6); (1-187) + (S3-7); (1-187) + (S3-8); (1-187) + (S3-9); (1-187) + (S3-10); (1-187) + (S3-11); (1-187) + (S4-1); (1-187) + (S4-2); (1-187) + (S4-3); (1-187) + (S4-4); (I-
187) + (S4-5); (1-187) + (S7-1); (1-187) + (S1 M); (1-187) + (S11 -2); (1-187) + (S11- 3); (1-187) + (S12-1); (1-187) + (S13-1); (1-187) + (S13-2); (1-187) + (S13-3); (1-187) + (S13-4): (1-187) + (S13-5); (1-187) + (S13-6); (1-187) + (S13-7); (1-187) + (S13-8); (1-187) + (S13-9); (1-187) + (S14-1)
(1-188) + (SM ); (1-188) + (S1-2); (1-188) + (S1-3); (1-188) + (S1^); (1-188) + (S1- 5); (1-188) + (S1-6); (1-188) + (S1-7); (1-188) + (S1-8); (1-188) + (S1 -9); (1-188) + (SM O); (1-188) + (S1-11); (1-188) + (S1-12); (1-188) + (S1-13); (1-188) + (S2-1); (I-
188) + (S2-2); (1-188) + (S2-3); (1-188) + (S2-4); (1-188) + (S2-5); (1-188) + (S2-6); (1-188) + (S2-7); (1-188) + (S2-8); (1-188) + (S2-9); (1-188) + (S2-10); (1-188) + (S3- 1); (1-188) + (S3-2); (1-188) + (S3-3); (1-188) + (S3-4); (1-188) + (S3-5); (1-188) + (S3-6); (1-188) + (S3-7); (1-188) + (S3-8); (1-188) + (S3-9); (1-188) + (S3-10); (1-188) + (S3-11); (1-188) + (S4-1); (1-188) + (S4-2); (1-188) + (S4-3); (1-188) + (S4-4); (I- 188) + (S4-5); (1-188) + (S7-1); (1-188) + (S11-1); (1-188) + (S11-2); (1-188) + (S11- 3); (1-188) + (S12-1); (1-188) + (S13-1 ); (1-188) + (S13-2); (1-188) + (S13-3); (1-188) + (S13-4): (1-188) + (S13-5); (1-188) + (S13-6); (1-188) + (S13-7); (1-188) + (S13-8);
(1-188) + (S13-9); (1-188) + (S14-1)
(1-189) + (S1-1); (1-189) + (S1-2); (1-189) + (S1-3); (1-189) + (S1-4); (1-189) + (S1- 5); (1-189) + (S1-6); (1-189) + (S1-7); (1-189) + (S1-8); (1-189) + (S1-9); (1-189) + (S1-10); (1-189) + (S1-11); (1-189) + (S1-12); (1-189) + (S1 -13); (1-189) + (S2-1); (I- 189) + (S2-2); (1-189) + (S2-3); (1-189) + (S2-4); (1-189) + (S2-5); (1-189) + (S2-6); (1-189) + (S2-7); (1-189) + (S2-8); (1-189) + (S2-9); (1-189) + (S2-10); (1-189) + (S3- 1); (1-189) + (S3-2); (1-189) + (S3-3); (1-189) + (S3-4); (1-189) + (S3-5); (1-189) + (S3-6); (1-189) + (S3-7); (1-189) + (S3-8); (1-189) + (S3-9); (1-189) + (S3-10); (1-189) + (S3-11); (1-189) + (S4-1); (1-189) + (S4-2); (1-189) + (S4-3); (1-189) + (S4-4); (I-
189) + (S4-5); (1-189) + (S7-1); (1-189) + (S11-1); (1-189) + (S11-2); (1-189) + (S11- 3); (1-189) + (S12-1); (1-189) + (S13-1); (1-189) + (S13-2); (1-189) + (S13-3); (1-189) + (S13-4): (1-189) + (S13-5); (1-189) + (S13-6); (1-189) + (S13-7); (1-189) + (S13-8); (1-189) + (S13-9); (1-189) + (S14-1)
(1-190) + (S1-1); (1-190) + (S1-2); (1-190) + (S1-3); (1-190) + (S1-4); (1-190) + (S1- 5); (1-190) + (S1-6); (1-190) + (S1-7); (1-190) + (S1-8); (1-190) + (S1-9); (1-190) + (S1-10); (1-190) + (S1-11 ); (1-190) + (S1-12); (1-190) + (S1-13); (1-190) + (S2-1); (I-
190) + (S2-2); (1-190) + (S2-3); (1-190) + (S2-4); (1-190) + (S2-5); (1-190) + (S2-6); (1-190) + (S2-7); (1-190) + (S2-8); (1-190) + (S2-9); (1-190) + (S2-10); (1-190) + (S3- 1); (1-190) + (S3-2); (1-190) + (S3-3); (1-190) + (S3-4); (1-190) + (S3-5); (1-190) + (S3-6); (1-190) + (S3-7); (1-190) + (S3-8); (1-190) + (S3-9); (1-190) + (S3-10); (1-190) + (S3-11 ); (1-190) + (S4-1 ); (1-190) + (S4-2); (1-190) + (S4-3); (1-190) + (S4-4); (I-
190) + (S4-5); (1-190) + (S7-1); (1-190) + (S11-1); (1-190) + (S11-2); (1-190) + (S11- 3); (1-190) + (S12-1); (1-190) + (S13-1 ); (1-190) + (S13-2); (1-190) + (S13-3); (1-190) + (S13-4): (1-190) + (S13-5); (1-190) + (S13-6); (1-190) + (S13-7); (1-190) + (S13-8); (1-190) + (S13-9); (1-190) + (S14-1 )
(1-191) + (S1-1); (1-191) + (S1-2); (1-191 ) + (S1-3); (1-191) + (S1-4); (1-191 ) + (S1- 5); (1-191 ) + (S1-6); (1-191 ) + (S1-7); (1-191 ) + (S1-8); (1-191 ) + (S1-9); (1-191 ) + (S1-10); (1-191) + (S1-1 1); (1-191) + (S1-12); (1-191) + (S1-13); (1-191) + (S2-1 ); (I-
191) + (S2-2); (1-191) + (S2-3); (1-191 ) + (S2^); (1-191) + (S2-5); (1-191) + (S2-6); (1-191) + (S2-7); (1-191) + (S2-8); (1-191 ) + (S2-9); (1-191) + (S2-10); (1-191) + (S3- 1); (1-191) + (S3-2); (1-191 ) + (S3-3); (1-191 ) + (S3-4); (1-191) + (S3-5); (1-191 ) + (S3-6); (1-191) + (S3-7); (1-191) + (S3-8); (1-191) + (S3-9); (1-191) + (S3-10); (1-191)
+ (S3-11 ); (1-191) + (S4-1 ); (1-191) + (S4-2); (1-191 ) + (S4-3); (1-191 ) + (S4-4); (I-
191) + (S4-5); (1-191) + (S7-1 ); (1-191) + (S11-1); (1-191 ) + (S11-2); (1-191 ) + (S11- 3); (1-191 ) + (S12-1 ); (1-191 ) + (S13-1); (1-191) + (S13-2); (1-191 ) + (S13-3); (1-191) + (S13-4): (1-191 ) + (S13-5); (1-191) + (S13-6); (1-191 ) + (S13-7); (1-191 ) + (S13-8); (1-191) + (S13-9); (1-191) + (S14-1)
(1-192) + (S1-1); (1-192) + (S1-2); (1-192) + (S1-3); (1-192) + (S1-4); (1-192) + (S1- 5); (1-192) + (S1-6); (1-192) + (S1-7); (1-192) + (S1-8); (1-192) + (S1-9); (1-192) + (S1-10); (1-192) + (S1-1 1); (1-192) + (S1-12); (1-192) + (S1-13); (1-192) + (S2-1); (I-
192) + (S2-2); (1-192) + (S2-3); (1-192) + (S2-4); (1-192) + (S2-5); (1-192) + (S2-6); (1-192) + (S2-7); (1-192) + (S2-8); (1-192) + (S2-9); (1-192) + (S2-10); (1-192) + (S3- 1); (1-192) + (S3-2); (1-192) + (S3-3); (1-192) + (S3-4); (1-192) + (S3-5); (1-192) + (S3-6); (1-192) + (S3-7); (1-192) + (S3-8); (1-192) + (S3-9); (1-192) + (S3-10); (1-192) + (S3-11); (1-192) + (S4-1); (1-192) + (S4-2); (1-192) + (S4-3); (1-192) + (S4-4); (I-
192) + (S4-5); (1-192) + (S7-1 ); (1-192) + (S11-1); (1-192) + (S11-2); (1-192) + (S11- 3); (1-192) + (S12-1); (1-192) + (S13-1); (1-192) + (S13-2); (1-192) + (S13-3); (1-192) + (S13-4): (1-192) + (S13-5); (1-192) + (S13-6); (1-192) + (S13-7); (1-192) + (S13-8); (1-192) + (S13-9); (1-192) + (S14-1)
(1-193) + (S1-1); (1-193) + (S1-2); (1-193) + (S1-3); (1-193) + (S1^); (1-193) + (S1- 5); (1-193) + (S1-6); (1-193) + (S1-7); (1-193) + (S1-8); (1-193) + (S1-9); (1-193) + (S1-10); (1-193) + (S1-11 ); (1-193) + (S1-12); (1-193) + (S1-13); (1-193) + (S2-1); (I-
193) + (S2-2); (1-193) + (S2-3); (1-193) + (S2-4); (1-193) + (S2-5); (1-193) + (S2-6); (1-193) + (S2-7); (1-193) + (S2-8); (1-193) + (S2-9); (1-193) + (S2-10); (1-193) + (S3- 1); (1-193) + (S3-2); (1-193) + (S3-3); (1-193) + (S3-4); (1-193) + (S3-5); (1-193) + (S3-6); (1-193) + (S3-7); (1-193) + (S3-8); (1-193) + (S3-9); (1-193) + (S3-10); (1-193) + (S3-11); (1-193) + (S4-1); (1-193) + (S4-2); (1-193) + (S4-3); (1-193) + (S4-4); (I- 193) + (S4-5); (1-193) + (S7-1); (1-193) + (S11-1); (1-193) + (S11-2); (1-193) + (S11- 3); (1-193) + (S12-1); (1-193) + (S13-1); (1-193) + (S13-2); (1-193) + (S13-3); (1-193) + (S13-4): (1-193) + (S13-5); (1-193) + (S13-6); (1-193) + (S13-7); (1-193) + (S13-8); (1-193) + (S13-9); (1-193) + (S14-1)
(1-194) + (S1-1); (1-194) + (S1-2); (1-194) + (S1-3); (1-194) + (S1-4); (1-194) + (S1- 5); (1-194) + (S1-6); (1-194) + (S1-7); (1-194) + (S1-8); (1-194) + (S1-9); (1-194) + (S1-10); (1-194) + (S1-11 ); (1-194) + (S1-12); (1-194) + (S1-13); (1-194) + (S2-1); (I-
194) + (S2-2); (1-194) + (S2-3); (1-194) + (S2-4); (1-194) + (S2-5); (1-194) + (S2-6); (1-194) + (S2-7); (1-194) + (S2-8); (1-194) + (S2-9); (1-194) + (S2-10); (1-194) + (S3- 1); (1-194) + (S3-2); (1-194) + (S3-3); (1-194) + (S3-4); (1-194) + (S3-5); (1-194) + (S3-6); (1-194) + (S3-7); (1-194) + (S3-8); (1-194) + (S3-9); (1-194) + (S3-10); (1-194) + (S3-11 ); (1-194) + (S4-1); (1-194) + (S4-2); (1-194) + (S4-3); (1-194) + (S4-4); (I-
194) + (S4-5); (1-194) + (S7-1 ); (1-194) + (S11 -1 ); (1-194) + (S11 -2); (1-194) + (S11 - 3); (1-194) + (S12-1); (1-194) + (S13-1); (1-194) + (S13-2); (1-194) + (S13-3); (1-194) + (S13-4): (1-194) + (S13-5); (1-194) + (S13-6); (1-194) + (S13-7); (1-194) + (S13-8); (1-194) + (S13-9); (1-194) + (S14-1)
(1-195) + (S1-1 ); (1-195) + (S1-2); (1-195) + (S1-3); (1-195) + (S1^); (1-195) + (S1- 5); (1-195) + (S1-6); (1-195) + (S1-7); (1-195) + (S1-8); (1-195) + (S1-9); (1-195) + (S1-10); (1-195) + (S1-11); (1-195) + (S1-12); (1-195) + (S1-13); (1-195) + (S2-1 ); (I-
195) + (S2-2); (1-195) + (S2-3); (1-195) + (S2^); (1-195) + (S2-5); (1-195) + (S2-6); (1-195) + (S2-7); (1-195) + (S2-8); (1-195) + (S2-9); (1-195) + (S2-10); (1-195) + (S3- 1); (1-195) + (S3-2); (1-195) + (S3-3); (1-195) + (S3-4); (1-195) + (S3-5); (1-195) + (S3-6); (1-195) + (S3-7); (1-195) + (S3-8); (1-195) + (S3-9); (1-195) + (S3-10); (1-195) + (S3-11); (1-195) + (S4-1); (1-195) + (S4-2); (1-195) + (S4-3); (1-195) + (S4-4); (I-
195) + (S4-5); (1-195) + (S7-1); (1-195) + (S11-1 ); (1-195) + (S11-2); (1-195) + (S11- 3); (1-195) + (S12-1); (1-195) + (S13-1); (1-195) + (S13-2); (1-195) + (S13-3); (1-195) + (S13-4): (1-195) + (S13-5); (1-195) + (S13-6); (1-195) + (S13-7); (1-195) + (S13-8); (1-195) + (S13-9); (1-195) + (S14-1 )
(1-196) + (S1-1 ); (1-196) + (S1-2); (1-196) + (S1-3); (1-196) + (S1-4); (1-196) + (S1- 5); (1-196) + (S1-6); (1-196) + (S1-7); (1-196) + (S1-8); (1-196) + (S1-9); (1-196) + (S1-10); (1-196) + (S1-11); (1-196) + (S1-12); (1-196) + (S1-13); (1-196) + (S2-1 ); (I-
196) + (S2-2); (1-196) + (S2-3); (1-196) + (S2-4); (1-196) + (S2-5); (1-196) + (S2-6); (1-196) + (S2-7); (1-196) + (S2-8); (1-196) + (S2-9); (1-196) + (S2-10); (1-196) + (S3- 1); (1-196) + (S3-2); (1-196) + (S3-3); (1-196) + (S3-4); (1-196) + (S3-5); (1-196) + (S3-6); (1-196) + (S3-7); (1-196) + (S3-8); (1-196) + (S3-9); (1-196) + (S3-10); (1-196) + (S3-11); (1-196) + (S4-1); (1-196) + (S4-2); (1-196) + (S4-3); (1-196) + (S4-4); (I- 196) + (S4-5); (1-196) + (S7-1); (1-196) + (S11-1); (1-196) + (S11-2); (1-196) + (S11- 3); (1-196) + (S12-1); (1-196) + (S13-1); (1-196) + (S13-2); (1-196) + (S13-3); (1-196) + (S13-4): (1-196) + (S13-5); (1-196) + (S13-6); (1-196) + (S13-7); (1-196) + (S13-8);
(1-196) + (S13-9); (1-196) + (S14-1)
(1-197) + (SM); (1-197) + (S1-2); (1-197) + (S1-3); (1-197) + (S1-4); (1-197) + (S1- 5); (1-197) + (S1 -6); (1-197) + (S1-7); (1-197) + (S1-8); (1-197) + (S1-9); (1-197) + (SM O); (1-197) + (S1-11 ); (1-197) + (S1-12); (1-197) + (S1-13); (1-197) + (S2-1); (I- 197) + (S2-2); (1-197) + (S2-3); (1-197) + (S2^l); (1-197) + (S2-5); (1-197) + (S2-6); (1-197) + (S2-7); (1-197) + (S2-8); (1-197) + (S2-9); (1-197) + (S2-10); (1-197) + (S3- 1 ); (1-197) + (S3-2); (1-197) + (S3-3); (1-197) + (S3-4); (1-197) + (S3-5); (1-197) + (S3-6); (1-197) + (S3-7); (1-197) + (S3-8); (1-197) + (S3-9); (1-197) + (S3-10); (1-197) + (S3-11); (1-197) + (S4-1); (1-197) + (S4-2); (1-197) + (S4-3); (1-197) + (S4-4); (I-
197) + (S4-5); (1-197) + (S7-1); (1-197) + (S11-1); (1-197) + (S11-2); (1-197) + (S11- 3); (1-197) + (S12-1); (1-197) + (S13-1); (1-197) + (S13-2); (1-197) + (S13-3); (1-197) + (S13-4): (1-197) + (S13-5); (1-197) + (S13-6); (1-197) + (S13-7); (1-197) + (S13-8); (1-197) + (S13-9); (1-197) + (S14-1)
(1-198) + (SM ); (1-198) + (S1-2); (1-198) + (S1-3); (1-198) + (S1-4); (1-198) + (S1- 5); (1-198) + (S1-6); (1-198) + (S1-7); (1-198) + (S1-8); (1-198) + (S1-9); (1-198) + (SMO); (1-198) + (S1-11 ); (1-198) + (SM2); (1-198) + (S1-13); (1-198) + (S2-1); (I-
198) + (S2-2); (1-198) + (S2-3); (1-198) + (S2-4); (1-198) + (S2-5); (1-198) + (S2-6); (1-198) + (S2-7); (1-198) + (S2-8); (1-198) + (S2-9); (1-198) + (S2-10); (1-198) + (S3- 1 ); (1-198) + (S3-2); (1-198) + (S3-3); (1-198) + (S3-4); (1-198) + (S3-5); (1-198) + (S3-6); (1-198) + (S3-7); (1-198) + (S3-8); (1-198) + (S3-9); (1-198) + (S3-10); (1-198) + (S3-11 ); (1-198) + (S4-1); (1-198) + (S4-2); (1-198) + (S4-3); (1-198) + (S4-4); (I-
198) + (S4-5); (1-198) + (S7-1 ); (1-198) + (S11-1); (1-198) + (S11-2); (1-198) + (S11- 3); (1-198) + (S12-1 ); (1-198) + (S13-1 ); (1-198) + (S13-2); (1-198) + (S13-3); (1-198) + (S13-4): (1-198) + (S13-5); (1-198) + (S13-6); (1-198) + (S13-7); (1-198) + (S13-8); (1-198) + (S13-9); (1-198) + (S14-1)
(1-199) + (SM); (1-199) + (S1-2); (1-199) + (S1-3); (1-199) + (S1-4); (1-199) + (S1- 5); (1-199) + (S1-6); (1-199) + (S1-7); (1-199) + (S1-8); (1-199) + (S1-9); (1-199) + (SM O); (1-199) + (SM 1 ); (1-199) + (SM2); (1-199) + (S1-13); (1-199) + (S2-1 ); (I-
199) + (S2-2); (1-199) + (S2-3); (1-199) + (S2-4); (1-199) + (S2-5); (1-199) + (S2-6); (1-199) + (S2-7); (1-199) + (S2-8); (1-199) + (S2-9); (1-199) + (S2-10); (1-199) + (S3- 1 ); (1-199) + (S3-2); (1-199) + (S3-3); (1-199) + (S3-4); (1-199) + (S3-5); (1-199) + (S3-6); (1-199) + (S3-7); (1-199) + (S3-8); (1-199) + (S3-9); (1-199) + (S3-10); (1-199)
+ (S3-11); (1-199) + (S4-1 ); (1-199) + (S4-2); (1-199) + (S4-3); (1-199) + (S4-4); (I-
199) + (S4-5); (1-199) + (S7-1 ); (1-199) + (S11-1 ); (1-199) + (S11-2); (1-199) + (S11- 3); (1-199) + (S12-1 ); (1-199) + (S13-1 ); (1-199) + (S13-2); (1-199) + (S13-3); (1-199) + (S13-4): (1-199) + (S13-5); (1-199) + (S13-6); (1-199) + (S13-7); (1-199) + (S13-8); (1-199) + (S13-9); (1-199) + (S14-1 )
(I-200) + (S1-1); (I-200) + (S1-2); (I-200) + (S1-3); (I-200) + (S1-4); (I-200) + (S1- 5); (I-200) + (S1-6); (I-200) + (S1-7); (I-200) + (S1-8); (I-200) + (S1-9); (I-200) + (S1-10); (I-200) + (S1-11); (I-200) + (S1-12); (I-200) + (S1-13); (I-200) + (S2-1); (I-
200) + (S2-2); (I-200) + (S2-3); (I-200) + (S2-4); (I-200) + (S2-5); (I-200) + (S2-6); (I-200) + (S2-7); (I-200) + (S2-8); (I-200) + (S2-9); (I-200) + (S2-10); (I-200) + (S3- 1 ); (I-200) + (S3-2); (I-200) + (S3-3); (I-200) + (S3-4); (I-200) + (S3-5); (I-200) + (S3-6); (I-200) + (S3-7); (I-200) + (S3-8); (I-200) + (S3-9); (I-200) + (S3-10); (I-200) + (S3-11); (I-200) + (S4-1); (I-200) + (S4-2); (I-200) + (S4-3); (I-200) + (S4-4); (I-
200) + (S4-5); (I-200) + (S7-1); (I-200) + (S11-1); (I-200) + (S11-2); (I-200) + (S11- 3); (I-200) + (S12-1); (I-200) + (S13-1); (I-200) + (S13-2); (I-200) + (S13-3); (I-200) + (S13-4): (I-200) + (S13-5); (I-200) + (S13-6); (I-200) + (S13-7); (I-200) + (S13-8); (I-200) + (S13-9); (I-200) + (S14-1 )
(1-201) + (S1-1 ); (1-201) + (S1-2); (1-201 ) + (S1-3); (1-201) + (S1-4); (1-201 ) + (S1- 5); (1-201 ) + (S1-6); (1-201) + (S1-7); (1-201) + (S1-8); (1-201) + (S1-9); (1-201) + (S1-10); (1-201 ) + (S1-11); (1-201 ) + (S1-12); (1-201) + (S1-13); (1-201 ) + (S2-1); (I-
201) + (S2-2); (1-201) + (S2-3); (1-201) + (S2^); (1-201) + (S2-5); (1-201) + (S2-6); (1-201) + (S2-7); (1-201) + (S2-8); (1-201 ) + (S2-9); (1-201) + (S2-10); (1-201) + (S3- 1 ); (1-201) + (S3-2); (1-201) + (S3-3); (1-201) + (S3-4); (1-201) + (S3-5); (1-201) + (S3-6); (1-201) + (S3-7); (1-201) + (S3-8); (1-201) + (S3-9); (1-201 ) + (S3-10); (1-201 ) + (S3-11 ); (1-201 ) + (S4-1 ); (1-201 ) + (S4-2); (1-201) + (S4-3); (1-201) + (S4-4); (I- 201) + (S4-5); (1-201) + (S7-1 ); (1-201) + (S11-1); (1-201) + (S11-2); (1-201 ) + (S1 1- 3); (1-201 ) + (S12-1); (1-201) + (S13-1); (1-201) + (S13-2); (1-201) + (S13-3); (1-201 ) + (S13-4): (1-201) + (S13-5); (1-201) + (S13-6); (1-201) + (S13-7); (1-201) + (S13-8); (1-201) + (S13-9); (1-201) + (S14-1)
(I-202) + (SM); (I-202) + (S1-2); (I-202) + (S1-3); (I-202) + (S1-4); (I-202) + (S1- 5); (I-202) + (S1-6); (I-202) + (S1-7); (I-202) + (S1-8); (I-202) + (S1-9); (I-202) + (S1-10); (I-202) + (S1-1 1); (I-202) + (S1-12); (I-202) + (S1-13); (I-202) + (S2-1 ); (I-
202) + (S2-2); (I-202) + (S2-3); (I-202) + (S2-4); (I-202) + (S2-5); (I-202) + (S2-6); (I-202) + (S2-7); (I-202) + (S2-8); (I-202) + (S2-9); (I-202) + (S2-10); (I-202) + (S3- 1); (I-202) + (S3-2); (I-202) + (S3-3); (I-202) + (S3-4); (I-202) + (S3-5); (I-202) + (S3-6); (I-202) + (S3-7); (I-202) + (S3-8); (I-202) + (S3-9); (I-202) + (S3-10); (I-202) + (S3-11 ); (I-202) + (S4-1 ); (I-202) + (S4-2); (I-202) + (S4-3); (I-202) + (S4-4); (I-
202) + (S4-5); (I-202) + (S7-1); (I-202) + (S11-1); (I-202) + (S11-2); (I-202) + (S11- 3); (I-202) + (S12-1); (I-202) + (S13-1 ); (I-202) + (S13-2); (I-202) + (S13-3); (I-202) + (S13-4): (I-202) + (S13-5); (I-202) + (S13-6); (I-202) + (S13-7); (I-202) + (S13-8); (I-202) + (S13-9); (I-202) + (S14-1)
(I-203) + (S1-1); (I-203) + (S1-2); (I-203) + (S1-3); (I-203) + (S1-4); (I-203) + (S1- 5); (I-203) + (S1-6); (I-203) + (S1-7); (I-203) + (S1-8); (I-203) + (S1-9); (I-203) + (S1-10); (I-203) + (S1-1 1 ); (I-203) + (S1-12); (I-203) + (S1-13); (I-203) + (S2-1 ); (I-
203) + (S2-2); (I-203) + (S2-3); (I-203) + (S2-4); (I-203) + (S2-5); (I-203) + (S2-6); (I-203) + (S2-7); (I-203) + (S2-8); (I-203) + (S2-9); (I-203) + (S2-10); (I-203) + (S3- 1); (I-203) + (S3-2); (I-203) + (S3-3); (I-203) + (S3-4); (I-203) + (S3-5); (I-203) + (S3-6); (I-203) + (S3-7); (I-203) + (S3-8); (I-203) + (S3-9); (I-203) + (S3-10); (I-203) + (S3-11 ); (I-203) + (S4-1); (I-203) + (S4-2); (I-203) + (S4-3); (I-203) + (S4-4); (I-
203) + (S4-5); (I-203) + (S7-1); (I-203) + (S11-1); (I-203) + (S11-2); (I-203) + (S11- 3); (I-203) + (S12-1); (I-203) + (S13-1 ); (I-203) + (S13-2); (I-203) + (S13-3); (I-203) + (S13-4): (I-203) + (S13-5); (I-203) + (S13-6); (I-203) + (S13-7); (I-203) + (S13-8); (I-203) + (S13-9); (I-203) + (S14-1)
(I-204) + (S1-1 ); (I-204) + (S1-2); (I-204) + (S1-3); (I-204) + (S1-4); (I-204) + (S1 - 5); (I-204) + (S1-6); (I-204) + (S1-7); (I-204) + (S1-8); (I-204) + (S1-9); (I-204) + (S1-10); (I-204) + (S1-1 1 ); (I-204) + (S1 -12); (I-204) + (S1-13); (I-204) + (S2-1 ); (I-
204) + (S2-2); (I-204) + (S2-3); (I-204) + (S2-4); (I-204) + (S2-5); (I-204) + (S2-6); (I-204) + (S2-7); (I-204) + (S2-8); (I-204) + (S2-9); (I-204) + (S2-10); (I-204) + (S3- 1 ); (I-204) + (S3-2); (I-204) + (S3-3); (I-204) + (S3-4); (I-204) + (S3-5); (I-204) + (S3-6); (I-204) + (S3-7); (I-204) + (S3-8); (I-204) + (S3-9); (I-204) + (S3-10); (I-204) + (S3-11); (I-204) + (S4-1 ); (I-204) + (S4-2); (I-204) + (S4-3); (I-204) + (S4-4); (I- 204) + (S4-5); (I-204) + (S7-1); (I-204) + (S11-1 ); (I-204) + (S11-2); (I-204) + (S1 1 - 3); (I-204) + (S12-1); (I-204) + (S13-1 ); (I-204) + (S13-2); (I-204) + (S13-3); (I-204) + (S13-4): (I-204) + (S13-5); (I-204) + (S13-6); (I-204) + (S13-7); (I-204) + (S13-8);
(I-204) + (S13-9); (I-204) + (S14-1)
(I-205) + (S1-1); (I-205) + (S1-2); (I-205) + (S1-3); (I-205) + (S1-4); (I-205) + (S1- 5); (I-205) + (S1-6); (I-205) + (S1-7); (I-205) + (S1-8); (I-205) + (S1-9); (I-205) + (S1-10); (I-205) + (S1-11); (I-205) + (S1-12); (I-205) + (S1-13); (I-205) + (S2-1); (I- 205) + (S2-2); (I-205) + (S2-3); (I-205) + (S2^); (I-205) + (S2-5); (I-205) + (S2-6); (I-205) + (S2-7); (I-205) + (S2-8); (I-205) + (S2-9); (I-205) + (S2-10); (I-205) + (S3- 1); (I-205) + (S3-2); (I-205) + (S3-3); (I-205) + (S3-4); (I-205) + (S3-5); (I-205) + (S3-6); (I-205) + (S3-7); (I-205) + (S3-8); (I-205) + (S3-9); (I-205) + (S3-10); (I-205) + (S3-11); (I-205) + (S4-1); (I-205) + (S4-2); (I-205) + (S4-3); (I-205) + (S4-4); (I-
205) + (S4-5); (I-205) + (S7-1 ); (I-205) + (S11-1); (I-205) + (S11-2); (I-205) + (S11- 3); (I-205) + (S12-1); (I-205) + (S13-1 ); (I-205) + (S13-2); (I-205) + (S13-3); (I-205) + (S13-4): (I-205) + (S13-5); (I-205) + (S13-6); (I-205) + (S13-7); (I-205) + (S13-8); (I-205) + (S13-9); (I-205) + (S14-1)
(I-206) + (S1-1); (I-206) + (S1-2); (I-206) + (S1-3); (I-206) + (S1-4); (I-206) + (S1- 5); (I-206) + (S1-6); (I-206) + (S1-7); (I-206) + (S1-8); (I-206) + (S1-9); (I-206) + (S1-10); (I-206) + (S1-11); (I-206) + (S1-12); (I-206) + (S1-13); (I-206) + (S2-1); (I-
206) + (S2-2); (I-206) + (S2-3); (I-206) + (S2-4); (I-206) + (S2-5); (I-206) + (S2-6); (I-206) + (S2-7); (I-206) + (S2-8); (I-206) + (S2-9); (I-206) + (S2-10); (I-206) + (S3- 1); (I-206) + (S3-2); (I-206) + (S3-3); (I-206) + (S3-4); (I-206) + (S3-5); (I-206) + (S3-6); (I-206) + (S3-7); (I-206) + (S3-8); (I-206) + (S3-9); (I-206) + (S3-10); (I-206) + (S3-11); (I-206) + (S4-1); (I-206) + (S4-2); (I-206) + (S4-3); (I-206) + (S4-4); (I-
206) + (S4-5); (I-206) + (S7-1 ); (I-206) + (S11-1); (I-206) + (S11-2); (I-206) + (S11- 3); (I-206) + (S12-1); (I-206) + (S13-1); (I-206) + (S13-2); (I-206) + (S13-3); (I-206) + (S13-4): (I-206) + (S13-5); (I-206) + (S13-6); (I-206) + (S13-7); (I-206) + (S13-8); (I-206) + (S13-9); (I-206) + (S14-1)
(I-207) + (S1-1); (I-207) + (S1-2); (I-207) + (S1-3); (I-207) + (S1-4); (I-207) + (S1- 5); (I-207) + (S1-6); (I-207) + (S1-7); (I-207) + (S1-8); (I-207) + (S1-9); (I-207) + (S1-10); (I-207) + (S1-11); (I-207) + (S1-12); (I-207) + (S1-13); (I-207) + (S2-1); (I-
207) + (S2-2); (I-207) + (S2-3); (I-207) + (S2-4); (I-207) + (S2-5); (I-207) + (S2-6); (I-207) + (S2-7); (I-207) + (S2-8); (I-207) + (S2-9); (I-207) + (S2-10); (I-207) + (S3- 1); (I-207) + (S3-2); (I-207) + (S3-3); (I-207) + (S3-4); (I-207) + (S3-5); (I-207) + (S3-6); (I-207) + (S3-7); (I-207) + (S3-8); (I-207) + (S3-9); (I-207) + (S3-10); (I-207)
+ (S3-11 ); (I-207) + (S4-1); (I-207) + (S4-2); (I-207) + (S4-3); (I-207) + (S4-4); (I-
207) + (S4-5); (I-207) + (S7-1 ); (I-207) + (S11-1 ); (I-207) + (S11-2); (I-207) + (S11- 3); (I-207) + (S12-1); (I-207) + (S13-1); (I-207) + (S13-2); (I-207) + (S13-3); (I-207) + (S13-4): (I-207) + (S13-5); (I-207) + (S13-6); (I-207) + (S13-7); (I-207) + (S13-8); (I-207) + (S13-9); (I-207) + (S14-1)
(I-208) + (S1-1 ); (I-208) + (S1-2); (I-208) + (S1-3); (I-208) + (S1-4); (I-208) + (S1- 5); (I-208) + (S1-6); (I-208) + (S1-7); (I-208) + (S1-8); (I-208) + (S1-9); (I-208) + (S1-10); (I-208) + (S1-11); (I-208) + (S1-12); (1-208) + (S1-13); (I-208) + (S2-1 ); (I-
208) + (S2-2); (I-208) + (S2-3); (I-208) + (S2-4); (I-208) + (S2-5); (I-208) + (S2-6); (I-208) + (S2-7); (I-208) + (S2-8); (I-208) + (S2-9); (I-208) + (S2-10); (I-208) + (S3- 1); (I-208) + (S3-2); (I-208) + (S3-3); (I-208) + (S3-4); (I-208) + (S3-5); (I-208) + (S3-6); (I-208) + (S3-7); (I-208) + (S3-8); (I-208) + (S3-9); (I-208) + (S3-10); (I-208) + (S3-11); (I-208) + (S4-1 ); (I-208) + (S4-2); (I-208) + (S4-3); (I-208) + (S4-4); (I-
208) + (S4-5); (I-208) + (S7-1); (I-208) + (S11-1); (I-208) + (S11-2); (I-208) + (S11- 3); (I-208) + (S12-1); (I-208) + (S13-1); (I-208) + (S13-2); (I-208) + (S13-3); (I-208) + (S13-4): (I-208) + (S13-5); (I-208) + (S13-6); (I-208) + (S13-7); (I-208) + (S13-8); (I-208) + (S13-9); (I-208) + (S14-1)
(I-209) + (S1-1); (I-209) + (S1-2); (I-209) + (S1-3); (I-209) + (S1-4); (I-209) + (S1- 5); (I-209) + (S1-6); (I-209) + (S1-7); (I-209) + (S1-8); (I-209) + (S1-9); (I-209) + (S1-10); (I-209) + (S1-11); (I-209) + (S1-12); (I-209) + (S1-13); (I-209) + (S2-1); (I-
209) + (S2-2); (I-209) + (S2-3); (I-209) + (S2-4); (I-209) + (S2-5); (I-209) + (S2-6); (I-209) + (S2-7); (I-209) + (S2-8); (I-209) + (S2-9); (I-209) + (S2-10); (I-209) + (S3- 1); (I-209) + (S3-2); (I-209) + (S3-3); (I-209) + (S3-4); (I-209) + (S3-5); (I-209) + (S3-6); (I-209) + (S3-7); (I-209) + (S3-8); (I-209) + (S3-9); (I-209) + (S3-10); (I-209) + (S3-11); (I-209) + (S4-1); (I-209) + (S4-2); (I-209) + (S4-3); (I-209) + (S4-4); (I- 209) + (S4-5); (I-209) + (S7-1 ); (I-209) + (S11-1); (I-209) + (S11-2); (I-209) + (S11- 3); (i-209) + (S12-1 ); (I-209) + (S13-1 ); (I-209) + (S13-2); (I-209) + (S13-3); (I-209) + (S13-4): (I-209) + (S13-5); (I-209) + (S13-6); (I-209) + (S13-7); (I-209) + (S13-8); (I-209) + (S13-9); (I-209) + (S14-1 )
(1-210) + (S1-1); (1-210) + (S1-2); (1-210) + (S1-3); (1-210) + (S1-4); (1-210) + (S1- 5); (1-210) + (S1-6); (1-210) + (S1-7); (1-210) + (S1-8); (1-210) + (S1-9); (1-210) + (S1-10); (1-210) + (S1-11); (1-210) + (S1-12); (1-210) + (S1-13); (1-210) + (S2-1 ); (I-
210) + (S2-2); (1-210) + (S2-3); (1-210) + (S2-4); (1-210) + (S2-5); (1-210) + (S2-6); (1-210) + (S2-7); (1-210) + (S2-8); (1-210) + (S2-9); (1-210) + (S2-10); (1-210) + (S3- 1); (1-210) + (S3-2); (1-210) + (S3-3); (1-210) + (S3-4); (1-210) + (S3-5); (1-210) + (S3-6); (1-210) + (S3-7); (1-210) + (S3-8); (1-210) + (S3-9); (1-210) + (S3-10); (1-210) + (S3-11); (1-210) + (S4-1); (1-210) + (S4-2); (1-210) + (S4-3); (1-210) + (S4-4); (I-
210) + (S4-5); (1-210) + (S7-1 ); (1-210) + (S11-1 ); (1-210) + (S11-2); (1-210) + (S11- 3); (1-210) + (S12-1); (1-210) + (S13-1); (1-210) + (S13-2); (1-210) + (S13-3); (1-210) + (S13-4): (1-210) + (S13-5); (1-210) + (S13-6); (1-210) + (S13-7); (1-210) + (S13-8); (1-210) + (S13-9); (1-210) + (S14-1)
(1-211) + (S1-1); (1-211) + (S1-2); (1-211) + (S1-3); (1-21 1) + (S1-4); (1-211) + (S1- 5); (1-211) + (S1-6); (1-211) + (S1-7); (1-211) + (S1-8); (1-211 ) + (S1-9); (1-211 ) + (S1-10); (1-211) + (S1-11 ); (1-211 ) + (S1-12); (1-211) + (S1-13); (1-211) + (S2-1); (I-
211 ) + (S2-2); (1-211) + (S2-3); (1-211) + (S2-4); (1-211) + (S2-5); (1-211) + (S2-6); (1-21 1) + (S2-7); (1-211) + (S2-8); (1-211 ) + (S2-9); (1-211 ) + (S2-10); (1-211) + (S3- 1 ); (1-211) + (S3-2); (1-211 ) + (S3-3); (1-211) + (S3-4); (1-211 ) + (S3-5); (1-211 ) + (S3-6); (1-211) + (S3-7); (1-211) + (S3-8); (1-211) + (S3-9); (1-211) + (S3-10); (1-211 ) + (S3-11); (1-211 ) + (S4-1); (1-211) + (S4-2); (1-211 ) + (S4-3); (1-211) + (S4-4); (I-
211) + (S4-5); (1-211) + (S7-1); (1-211) + (S11-1 ); (1-211 ) + (S11-2); (1-211) + (S11- 3); (1-211) + (S12-1 ); (1-211) + (S13-1 ); (1-211) + (S13-2); (1-211) + (S13-3); (1-211) + (S13-4): (1-211 ) + (S13-5); (1-211) + (S13-6); (1-211) + (S13-7); (1-211) + (S13-8); (1-211) + (S13-9); (1-211 ) + (S14-1)
(1-212) + (S1-1); (1-212) + (S1-2); (1-212) + (S1-3); (1-212) + (S1-4); (1-212) + (S1- 5); (1-212) + (S1-6); (1-212) + (S1-7); (1-212) + (S1-8); (1-212) + (S1 -9); (1-212) + (S1-10); (1-212) + (S1-11 ); (1-212) + (S1-12); (1-212) + (S1-13); (1-212) + (S2-1); (I-
212) + (S2-2); (1-212) + (S2-3); (1-212) + (S2-4); (1-212) + (S2-5); (1-212) + (S2-6); (1-212) + (S2-7); (1-212) + (S2-8); (1-212) + (S2-9); (1-212) + (S2-10); (1-212) + (S3- 1); (1-212) + (S3-2); (1-212) + (S3-3); (1-212) + (S3-4); (1-212) + (S3-5); (1-212) + (S3-6); (1-212) + (S3-7); (1-212) + (S3-8); (1-212) + (S3-9); (1-212) + (S3-10); (1-212) + (S3-11); (1-212) + (S4-1); (1-212) + (S4-2); (1-212) + (S4-3); (1-212) + (S4-4); (I- 212) + (S4-5); (1-212) + (S7-1); (1-212) + (S11-1); (1-212) + (S11-2); (1-212) + (S11- 3); (1-212) + (S12-1 ); (1-212) + (S13-1 ); (1-212) + (S13-2); (1-212) + (S13-3); (1-212) + (S13-4): (1-212) + (S13-5); (1-212) + (S13-6); (1-212) + (S13-7); (1-212) + (S13-8);
(1-212) + (S13-9); (1-212) + (S14-1)
(1-213) + (S1-1); (1-213) + (S1-2); (1-213) + (S1-3); (1-213) + (S1-4); (1-213) + (S1- 5); (1-213) + (S1-6); (1-213) + (S1-7); (1-213) + (S1-8); (1-213) + (S1-9); (1-213) + (S1-10); (1-213) + (S1-11); (1-213) + (S1-12); (1-213) + (S1-13); (1-213) + (S2-1 ); (I- 213) + (S2-2); (1-213) + (S2-3); (1-213) + (S2^); (1-213) + (S2-5); (1-213) + (S2-6); (1-213) + (S2-7); (1-213) + (S2-8); (1-213) + (S2-9); (1-213) + (S2-10); (1-213) + (S3- 1); (1-213) + (S3-2); (1-213) + (S3-3); (1-213) + (S3-4); (1-213) + (S3-5); (1-213) + (S3-6); (1-213) + (S3-7); (1-213) + (S3-8); (1-213) + (S3-9); (1-213) + (S3-10); (1-213) + (S3-11); (1-213) + (S4-1); (1-213) + (S4-2); (1-213) + (S4-3); (1-213) + (S4-4); (I-
213) + (S4-5); (1-213) + (S7-1); (1-213) + (S11-1); (1-213) + (S11-2); (1-213) + (S11- 3); (1-213) + (S12-1); (1-213) + (S13-1); (1-213) + (S13-2); (1-213) + (S13-3); (1-213) + (S13-4): (1-213) + (S13-5); (1-213) + (S13-6); (1-213) + (S13-7); (1-213) + (S13-8); (1-213) + (S13-9); (1-213) + (S14-1 )
(1-214) + (S1-1); (1-214) + (S1-2); (1-214) + (S1-3); (1-214) + (S1-4); (1-214) + (S1- 5); (1-214) + (S1-6); (1-214) + (S1-7); (1-214) + (S1-8); (1-214) + (S1-9); (1-214) + (S1-10); (1-214) + (S1-11); (1-214) + (S1-12); (1-214) + (S1-13); (1-214) + (S2-1); (I-
214) + (S2-2); (1-214) + (S2-3); (1-214) + (S2-4); (1-214) + (S2-5); (1-214) + (S2-6); (1-214) + (S2-7); (1-214) + (S2-8); (1-214) + (S2-9); (1-214) + (S2-10); (1-214) + (S3- 1); (1-214) + (S3-2); (1-214) + (S3-3); (1-214) + (S3-4); (1-214) + (S3-5); (1-214) + (S3-6); (1-214) + (S3-7); (1-214) + (S3-8); (1-214) + (S3-9); (1-214) + (S3-10); (1-214) + (S3-11); (1-214) + (S4-1); (1-214) + (S4-2); (1-214) + (S4-3); (1-214) + (S4-4); (I-
214) + (S4-5); (1-214) + (S7-1 ); (1-214) + (S11-1); (1-214) + (S11-2); (1-214) + (S11- 3); (1-214) + (S12-1 ); (1-214) + (S13-1 ); (1-214) + (S13-2); (1-214) + (S13-3); (1-214) + (S13-4): (1-214) + (S13-5); (1-214) + (S13-6); (1-214) + (S13-7); (1-214) + (S13-8); (1-214) + (S13-9); (1-214) + (S14-1)
(1-215) + (S1-1); (1-215) + (S1-2); (1-215) + (S1-3); (1-215) + (S1-4); (1-215) + (S1- 5); (1-215) + (S1-6); (1-215) + (S1-7); (1-215) + (S1-8); (1-215) + (S1-9); (1-215) + (S1-10); (1-215) + (S1-11 ); (1-215) + (S1-12); (1-215) + (S1-13); (1-215) + (S2-1); (I-
215) + (S2-2); (1-215) + (S2-3); (1-215) + (S2^); (1-215) + (S2-5); (1-215) + (S2-6); (1-215) + (S2-7); (1-215) + (S2-8); (1-215) + (S2-9); (1-215) + (S2-10); (1-215) + (S3- 1); (1-215) + (S3-2); (1-215) + (S3-3); (1-215) + (S3-4); (1-215) + (S3-5); (1-215) + (S3-6); (1-215) + (S3-7); (1-215) + (S3-8); (1-215) + (S3-9); (1-215) + (S3-10); (1-215)
+ (S3-11); (1-215) + (S4-1 ); (1-215) + (S4-2); (1-215) + (S4-3); (1-215) + (S4-4); (I-
215) + (S4-5); (1-215) + (S7-1 ); (1-215) + (S11-1); (1-215) + (S11-2); (1-215) + (S11- 3); (1-215) + (S12-1); (1-215) + (S13-1 ); (1-215) + (S13-2); (1-215) + (S13-3); (1-215) + (S13-4): (1-215) + (S13-5); (1-215) + (S13-6); (1-215) + (S13-7); (1-215) + (S13-8); (1-215) + (S13-9); (1-215) + (S14-1)
(1-216) + (S1-1); (1-216) + (S1-2); (1-216) + (S1-3); (1-216) + (S1-4); (1-216) + (S1- 5); (1-216) + (S1-6); (1-216) + (S1-7); (1-216) + (S1-8); (1-216) + (S1-9); (1-216) + (S1-10); (1-216) + (S1-11); (1-216) + (S1-12); (1-216) + (S1-13); (1-216) + (S2-1); (I-
216) + (S2-2); (1-216) + (S2-3); (1-216) + (S2-4); (1-216) + (S2-5); (1-216) + (S2-6); (1-216) + (S2-7); (1-216) + (S2-8); (1-216) + (S2-9); (1-216) + (S2-10); (1-216) + (S3- 1 ); (1-216) + (S3-2); (1-216) + (S3-3); (1-216) + (S3-4); (1-216) + (S3-5); (1-216) + (S3-6); (1-216) + (S3-7); (1-216) + (S3-8); (1-216) + (S3-9); (1-216) + (S3-10); (1-216) + (S3-11 ); (1-216) + (S4-1); (1-216) + (S4-2); (1-216) + (S4-3); (1-216) + (S4-4); (I-
216) + (S4-5); (1-216) + (S7-1); (1-216) + (S11-1); (1-216) + (S11-2); (1-216) + (S11- 3); (1-216) + (S12-1 ); (1-216) + (S13-1); (1-216) + (S13-2); (1-216) + (S13-3); (1-216) + (S13-4): (1-216) + (S13-5); (1-216) + (S13-6); (1-216) + (S13-7); (1-216) + (S13-8); (1-216) + (S13-9); (1-216) + (S14-1)
(1-217) + (S1-1); (1-217) + (S1-2); (1-217) + (S1-3); (1-217) + (S1^); (1-217) + (S1- 5); (1-217) + (S1-6); (1-217) + (S1-7); (1-217) + (S1-8); (1-217) + (S1-9); (1-217) + (S1-10); (1-217) + (S1-11); (1-217) + (S1-12); (1-217) + (S1-13); (1-217) + (S2-1); (I-
217) + (S2-2); (1-217) + (S2-3); (1-217) + (S2^); (1-217) + (S2-5); (1-217) + (S2-6); (1-217) + (S2-7); (1-217) + (S2-8); (1-217) + (S2-9); (1-217) + (S2-10); (1-217) + (S3- 1); (1-217) + (S3-2); (1-217) + (S3-3); (1-217) + (S3-4); (1-217) + (S3-5); (1-217) + (S3-6); (1-217) + (S3-7); (1-217) + (S3-8); (1-217) + (S3-9); (1-217) + (S3-10); (1-217) + (S3-11); (1-217) + (S4-1); (1-217) + (S4-2); (1-217) + (S4-3); (1-217) + (S4-4); (I- 217) + (S4-5); (1-217) + (S7-1); (1-217) + (S11-1 ); (1-217) + (S11-2); (1-217) + (S11- 3); (1-217) + (S12-1 ); (1-217) + (S13-1); (1-217) + (S13-2); (1-217) + (S13-3); (1-217) + (S13-4): (1-217) + (S13-5); (1-217) + (S13-6); (1-217) + (S13-7); (1-217) + (S13-8); (1-217) + (S13-9); (1-217) + (S14-1 )
(1-218) + (S1 -1); (1-218) + (S1-2); (1-218) + (S1-3); (1-218) + (S1^); (1-218) + (S1- 5); (1-218) + (S1-6); (1-218) + (S1-7); (1-218) + (S1-8); (1-218) + (S1-9); (1-218) + (S1-10); (1-218) + (S1-11); (1-218) + (S1-12); (1-218) + (S1-13); (1-218) + (S2-1); (I-
218) + (S2-2); (1-218) + (S2-3); (1-218) + (S2-4); (1-218) + (S2-5); (1-218) + (S2-6); (1-218) + (S2-7); (1-218) + (S2-8); (1-218) + (S2-9); (1-218) + (S2-10); (1-218) + (S3- 1); (1-218) + (S3-2); (1-218) + (S3-3); (1-218) + (S3-4); (1-218) + (S3-5); (1-218) + (S3-6); (1-218) + (S3-7); (1-218) + (S3-8); (1-218) + (S3-9); (1-218) + (S3-10); (1-218) + (S3-11); (1-218) + (S4-1); (1-218) + (S4-2); (1-218) + (S4-3); (1-218) + (S4-4); (I-
218) + (S4-5); (1-218) + (S7-1 ); (1-218) + (S11-1); (1-218) + (S11-2); (1-218) + (S11- 3); (1-218) + (S12-1 ); (1-218) + (S13-1 ); (1-218) + (S13-2); (1-218) + (S13-3); (1-218) + (S13-4): (1-218) + (S13-5); (1-218) + (S13-6); (1-218) + (S13-7); (1-218) + (S13-8); (1-218) + (S13-9); (1-218) + (S14-1)
(1-219) + (S1-1); (1-219) + (S1-2); (1-219) + (S1-3); (1-219) + (S1-4); (1-219) + (S1- 5); (1-219) + (S1-6); (1-219) + (S1-7); (1-219) + (S1-8); (1-219) + (S1-9); (1-219) + (S1-10); (1-219) + (S1-11); (1-219) + (S1-12); (1-219) + (S1-13); (1-219) + (S2-1); (I-
219) + (S2-2); (1-219) + (S2-3); (1-219) + (S2-4); (1-219) + (S2-5); (1-219) + (S2-6); (1-219) + (S2-7); (1-219) + (S2-8); (1-219) + (S2-9); (1-219) + (S2-10); (1-219) + (S3- 1); (1-219) + (S3-2); (1-219) + (S3-3); (1-219) + (S3-4); (1-219) + (S3-5); (1-219) + (S3-6); (1-219) + (S3-7); (1-219) + (S3-8); (1-219) + (S3-9); (1-219) + (S3-10); (1-219) + (S3-11); (1-219) + (S4-1); (1-219) + (S4-2); (1-219) + (S4-3); (1-219) + (S4-4); (I-
219) + (S4-5); (1-219) + (S7-1 ); (1-219) + (S11-1); (1-219) + (S11-2); (1-219) + (S11- 3); (1-219) + (S12-1 ); (1-219) + (S13-1); (1-219) + (S13-2); (1-219) + (S13-3); (1-219) + (S13-4): (1-219) + (S13-5); (1-219) + (S13-6); (1-219) + (S13-7); (1-219) + (S13-8); (1-219) + (S13-9); (1-219) + (S14-1)
(I-220) + (S1 -1 ); (I-220) + (S1-2); (I-220) + (S1-3); (I-220) + (S1-4); (I-220) + (S1- 5); (I-220) + (S1-6); (I-220) + (S1-7); (I-220) + (S1-8); (I-220) + (S1-9); (I-220) + (S1-10); (I-220) + (S1-11 ); (I-220) + (S1-12); (I-220) + (S1-13); (I-220) + (S2-1 ); (I-
220) + (S2-2); (I-220) + (S2-3); (I-220) + (S2^); (I-220) + (S2-5); (I-220) + (S2-6); (I-220) + (S2-7); (I-220) + (S2-8); (I-220) + (S2-9); (I-220) + (S2-10); (I-220) + (S3- 1); (I-220) + (S3-2); (I-220) + (S3-3); (I-220) + (S3-4); (I-220) + (S3-5); (I-220) + (S3-6); (I-220) + (S3-7); (I-220) + (S3-8); (I-220) + (S3-9); (I-220) + (S3-10); (I-220) + (S3-11); (I-220) + (S4-1 ); (I-220) + (S4-2); (I-220) + (S4-3); (I-220) + (S4-4); (I- 220) + (S4-5); (I-220) + (S7-1); (I-220) + (S11-1); (I-220) + (S11-2); (I-220) + (S11- 3); (I-220) + (S12-1 ); (I-220) + (S13-1 ); (I-220) + (S13-2); (I-220) + (S13-3); (I-220) + (S13-4): (I-220) + (S13-5); (I-220) + (S13-6); (I-220) + (S13-7); (I-220) + (S13-8);
(I-220) + (S13-9); (I-220) + (S14-1 )
(1-221) + (S1-1); (1-221) + (S1-2); (1-221) + (S1-3); (1-221) + (S1-4); (1-221) + (S1- 5); (1-221) + (S1-6); (1-221 ) + (S1-7); (1-221 ) + (S1-8); (1-221 ) + (S1-9); (1-221) + (S1-10); (1-221) + (S1-11); (1-221) + (S1-12); (1-221) + (S1-13); (1-221 ) + (S2-1 ); (I- 221 ) + (S2-2); (1-221 ) + (S2-3); (1-221 ) + (S2-4); (1-221) + (S2-5); (1-221 ) + (S2-6); (1-221 ) + (S2-7); (1-221) + (S2-8); (1-221) + (S2-9); (1-221 ) + (S2-10); (1-221 ) + (S3- 1); (1-221) + (S3-2); (1-221) + (S3-3); (1-221) + (S3-4); (1-221) + (S3-5); (1-221) + (S3-6); (1-221 ) + (S3-7); (1-221) + (S3-8); (1-221) + (S3-9); (1-221) + (S3-10); (1-221 ) + (S3-11); (1-221) + (S4-1); (1-221) + (S4-2); (1-221) + (S4-3); (1-221) + (S4-4); (I-
221) + (S4-5); (1-221) + (S7-1); (1-221 ) + (S11-1); (1-221) + (S11-2); (1-221) + (S11- 3); (1-221) + (S12-1); (1-221) + (S13-1); (1-221) + (S13-2); (1-221) + (S13-3); (1-221) + (S13-4): (1-221) + (S13-5); (1-221 ) + (S13-6); (1-221) + (S13-7); (1-221 ) + (S13-8); (1-221) + (S13-9); (1-221) + (S14-1)
(I-222) + (S1-1); (I-222) + (S1-2); (I-222) + (S1-3); (I-222) + (S1-4); (I-222) + (S1- 5); (I-222) + (S1-6); (I-222) + (S1-7); (I-222) + (S1-8); (I-222) + (S1-9); (I-222) + (S1-10); (I-222) + (S1-11); (I-222) + (S1-12); (I-222) + (S1-13); (I-222) + (S2-1); (I-
222) + (S2-2); (I-222) + (S2-3); (I-222) + (S2-4); (I-222) + (S2-5); (I-222) + (S2-6); (I-222) + (S2-7); (I-222) + (S2-8); (I-222) + (S2-9); (I-222) + (S2-10); (I-222) + (S3- 1); (I-222) + (S3-2); (I-222) + (S3-3); (I-222) + (S3-4); (I-222) + (S3-5); (I-222) + (S3-6); (I-222) + (S3-7); (I-222) + (S3-8); (I-222) + (S3-9); (I-222) + (S3-10); (I-222) + (S3-11); (I-222) + (S4-1); (I-222) + (S4-2); (I-222) + (S4-3); (I-222) + (S4-4); (I-
222) + (S4-5); (I-222) + (S7-1 ); (I-222) + (S11-1); (I-222) + (S11-2); (I-222) + (S1 1- 3); (I-222) + (S12-1); (I-222) + (S13-1 ); (I-222) + (S13-2); (I-222) + (S13-3); (I-222) + (S13-4): (I-222) + (S13-5); (I-222) + (S13-6); (I-222) + (S13-7); (I-222) + (S13-8); (I-222) + (S13-9); (I-222) + (S14-1)
(I-223) + (S1-1); (I-223) + (S1-2); (I-223) + (S1-3); (I-223) + (S1-4); (I-223) + (S1- 5); (I-223) + (S1-6); (I-223) + (S1-7); (I-223) + (S1-8); (I-223) + (S1-9); (I-223) + (S1-10); (I-223) + (S1-11); (I-223) + (S1-12); (I-223) + (S1-13); (I-223) + (S2-1); (I-
223) + (S2-2); (I-223) + (S2-3); (I-223) + (S2-4); (I-223) + (S2-5); (I-223) + (S2-6); (I-223) + (S2-7); (I-223) + (S2-8); (I-223) + (S2-9); (I-223) + (S2-10); (I-223) + (S3- 1 ); (I-223) + (S3-2); (I-223) + (S3-3); (I-223) + (S3-4); (I-223) + (S3-5); (I-223) + (S3-6); (I-223) + (S3-7); (I-223) + (S3-8); (I-223) + (S3-9); (I-223) + (S3-10); (I-223)
+ (S3-11); (I-223) + (S4-1); (I-223) + (S4-2); (I-223) + (S4-3); (I-223) + (S4-4); (I-
223) + (S4-5); (I-223) + (S7-1 ); (I-223) + (S11-1 ); (I-223) + (S11-2); (I-223) + (S11- 3); (I-223) + (S12-1); (I-223) + (S13-1); (I-223) + (S13-2); (I-223) + (S13-3); (I-223) + (S13-4): (I-223) + (S13-5); (I-223) + (S13-6); (I-223) + (S13-7); (I-223) + (S13-8); (I-223) + (S13-9); (I-223) + (S14-1 )
(I-224) + (S1-1); (I-224) + (S1-2); (I-224) + (S1-3); (I-224) + (S1-4); (I-224) + (S1- 5); (I-224) + (S1-6); (I-224) + (S1-7); (I-224) + (S1-8); (I-224) + (S1-9); (I-224) + (S1-10); (I-224) + (S1-11); (I-224) + (S1-12); (I-224) + (S1-13); (I-224) + (S2-1); (I-
224) + (S2-2); (I-224) + (S2-3); (I-224) + (S2-4); (I-224) + (S2-5); (I-224) + (S2-6); (I-224) + (S2-7); (I-224) + (S2-8); (I-224) + (S2-9); (I-224) + (S2-10); (I-224) + (S3- 1 ); (I-224) + (S3-2); (I-224) + (S3-3); (I-224) + (S3-4); (I-224) + (S3-5); (I-224) + (S3-6); (I-224) + (S3-7); (I-224) + (S3-8); (I-224) + (S3-9); (I-224) + (S3-10); (I-224) + (S3-11); (I-224) + (S4-1); (I-224) + (S4-2); (I-224) + (S4-3); (I-224) + (S4-4); (I-
224) + (S4-5); (I-224) + (S7-1); (I-224) + (S11-1); (I-224) + (S11-2); (I-224) + (S11- 3); (I-224) + (S12-1); (I-224) + (S13-1); (I-224) + (S13-2); (I-224) + (S13-3); (I-224) + (S13-4): (I-224) + (S13-5); (I-224) + (S13-6); (I-224) + (S13-7); (I-224) + (S13-8); (I-224) + (S13-9); (I-224) + (S14-1)
(I-225) + (S1-1); (I-225) + (S1-2); (I-225) + (S1-3); (I-225) + (S1-4); (I-225) + (S1- 5); (I-225) + (S1-6); (I-225) + (S1-7); (I-225) + (S1-8); (I-225) + (S1-9); (I-225) + (S1-10); (I-225) + (S1-11); (I-225) + (S1-12); (I-225) + (S1-13); (I-225) + (S2-1); (I-
225) + (S2-2); (I-225) + (S2-3); (I-225) + (S2-4); (I-225) + (S2-5); (I-225) + (S2-6); (I-225) + (S2-7); (I-225) + (S2-8); (I-225) + (S2-9); (I-225) + (S2-10); (I-225) + (S3- 1); (I-225) + (S3-2); (I-225) + (S3-3); (I-225) + (S3-4); (I-225) + (S3-5); (I-225) + (S3-6); (I-225) + (S3-7); (I-225) + (S3-8); (I-225) + (S3-9); (I-225) + (S3-10); (I-225) + (S3-11); (I-225) + (S4-1); (I-225) + (S4-2); (I-225) + (S4-3); (I-225) + (S4-4); (I- 225) + (S4-5); (I-225) + (S7-1); (I-225) + (S11-1); (I-225) + (S11-2); (I-225) + (S11- 3); (I-225) + (S12-1); (I-225) + (S13-1); (I-225) + (S13-2); (I-225) + (S13-3); (I-225) + (S13-4): (I-225) + (S13-5); (I-225) + (S13-6); (I-225) + (S13-7); (I-225) + (S13-8); (I-225) + (S13-9); (I-225) + (S14-1)
(I-226) + (S1-1 ); (I-226) + (S1-2); (I-226) + (S1-3); (I-226) + (S1-4); (I-226) + (S1- 5); (I-226) + (S1-6); (I-226) + (S1-7); (I-226) + (S1-8); (I-226) + (S1-9); (I-226) + (S1-10); (I-226) + (S1-11); (I-226) + (S1-12); (I-226) + (S1-13); (I-226) + (S2-1 ); (I-
226) + (S2-2); (I-226) + (S2-3); (I-226) + (S2-4); (I-226) + (S2-5); (I-226) + (S2-6); (I-226) + (S2-7); (I-226) + (S2-8); (I-226) + (S2-9); (I-226) + (S2-10); (I-226) + (S3- 1); (I-226) + (S3-2); (I-226) + (S3-3); (I-226) + (S3-4); (I-226) + (S3-5); (I-226) + (S3-6); (I-226) + (S3-7); (I-226) + (S3-8); (I-226) + (S3-9); (I-226) + (S3-10); (I-226) + (S3-11); (I-226) + (S4-1); (I-226) + (S4-2); (I-226) + (S4-3); (1-226) + (S4-4); (I-
226) + (S4-5); (I-226) + (S7-1); (I-226) + (S11-1); (I-226) + (S11-2); (I-226) + (S11- 3); (I-226) + (S12-1); (I-226) + (S13-1); (I-226) + (S13-2); (I-226) + (S13-3); (I-226) + (S13-4): (I-226) + (S13-5); (I-226) + (S13-6); (I-226) + (S13-7); (I-226) + (S13-8); (I-226) + (S13-9); (I-226) + (S14-1)
(I-227) + (S1-1); (I-227) + (S1-2); (I-227) + (S1-3); (I-227) + (S1-4); (I-227) + (S1- 5); (I-227) + (S1-6); (I-227) + (S1-7); (I-227) + (S1-8); (I-227) + (S1-9); (I-227) + (S1-10); (I-227) + (S1-11); (I-227) + (S1-12); (I-227) + (S1-13); (I-227) + (S2-1); (I-
227) + (S2-2); (I-227) + (S2-3); (I-227) + (S2-4); (I-227) + (S2-5); (I-227) + (S2-6); (I-227) + (S2-7); (I-227) + (S2-8); (I-227) + (S2-9); (I-227) + (S2-10); (I-227) + (S3- 1); (I-227) + (S3-2); (I-227) + (S3-3); (I-227) + (S3-4); (I-227) + (S3-5); (I-227) + (S3-6); (I-227) + (S3-7); (I-227) + (S3-8); (I-227) + (S3-9); (I-227) + (S3-10); (I-227) + (S3-11); (I-227) + (S4-1); (I-227) + (S4-2); (I-227) + (S4-3); (I-227) + (S4-4); (I-
227) + (S4-5); (I-227) + (S7-1); (I-227) + (S11-1); (I-227) + (S11-2); (I-227) + (S11- 3); (I-227) + (S12-1); (I-227) + (S13-1); (I-227) + (S13-2); (I-227) + (S13-3); (I-227) + (S13-4): (I-227) + (S13-5); (I-227) + (S13-6); (I-227) + (S13-7); (I-227) + (S13-8); (I-227) + (S13-9); (I-227) + (S14-1)
(I-228) + (S1-1); (I-228) + (S1-2); (I-228) + (S1-3); (I-228) + (S1-4); (I-228) + (S1- 5); (I-228) + (S1-6); (I-228) + (S1-7); (I-228) + (S1-8); (I-228) + (S1-9); (I-228) + (S1-10); (I-228) + (S1-11); (I-228) + (S1-12); (I-228) + (S1-13); (I-228) + (S2-1); (I-
228) + (S2-2); (I-228) + (S2-3); (I-228) + (S2-4); (I-228) + (S2-5); (I-228) + (S2-6); (I-228) + (S2-7); (I-228) + (S2-8); (I-228) + (S2-9); (I-228) + (S2-10); (I-228) + (S3- 1); (I-228) + (S3-2); (I-228) + (S3-3); (I-228) + (S3-4); (I-228) + (S3-5); (I-228) + (S3-6); (I-228) + (S3-7); (I-228) + (S3-8); (I-228) + (S3-9); (I-228) + (S3-10); (I-228) + (S3-11); (I-228) + (S4-1); (I-228) + (S4-2); (I-228) + (S4-3); (I-228) + (S4-4); (I- 228) + (S4-5); (I-228) + (S7-1); (I-228) + (S11-1); (I-228) + (S11-2); (I-228) + (S11- 3); (I-228) + (S12-1); (I-228) + (S13-1); (I-228) + (S13-2); (I-228) + (S13-3); (I-228) + (S13-4): (I-228) + (S13-5); (I-228) + (S13-6); (I-228) + (S13-7); (I-228) + (S13-8);
(I-228) + (S13-9); (I-228) + (S14-1 )
(I-229) + (S1-1); (I-229) + (S1-2); (I-229) + (S1-3); (I-229) + (S1-4); (I-229) + (S1- 5); (I-229) + (S1-6); (I-229) + (S1-7); (I-229) + (S1-8); (I-229) + (S1-9); (I-229) + (S1-10); (I-229) + (S1-11 ); (I-229) + (S1-12); (I-229) + (S1-13); (I-229) + (S2-1); (I- 229) + (S2-2); (I-229) + (S2-3); (I-229) + (S2^); (I-229) + (S2-5); (I-229) + (S2-6); (I-229) + (S2-7); (I-229) + (S2-8); (I-229) + (S2-9); (I-229) + (S2-10); (I-229) + (S3- 1 ); (I-229) + (S3-2); (I-229) + (S3-3); (I-229) + (S3-4); (I-229) + (S3-5); (I-229) + (S3-6); (I-229) + (S3-7); (I-229) + (S3-8); (I-229) + (S3-9); (I-229) + (S3-10); (I-229) + (S3-11 ); (I-229) + (S4-1); (I-229) + (S4-2); (I-229) + (S4-3); (I-229) + (S4-4); (I-
229) + (S4-5); (I-229) + (S7-1); (I-229) + (S11-1); (I-229) + (S11-2); (I-229) + (S11- 3); (I-229) + (S12-1); (I-229) + (S13-1); (I-229) + (S13-2); (I-229) + (S13-3); (I-229) + (S13-4): (I-229) + (S13-5); (I-229) + (S13-6); (I-229) + (S13-7); (I-229) + (S13-8); (I-229) + (S13-9); (I-229) + (S14-1)
(I-230) + (S1-1 ); (I-230) + (S1-2); (I-230) + (S1-3); (I-230) + (S1-4); (I-230) + (S1- 5); (I-230) + (S1-6); (I-230) + (S1-7); (I-230) + (S1-8); (I-230) + (S1-9); (I-230) + (S1-10); (I-230) + (S1-11); (I-230) + (S1-12); (I-230) + (S1-13); (I-230) + (S2-1 ); (I-
230) + (S2-2); (I-230) + (S2-3); (I-230) + (S2-4); (I-230) + (S2-5); (I-230) + (S2-6); (I-230) + (S2-7); (I-230) + (S2-8); (I-230) + (S2-9); (I-230) + (S2-10); (I-230) + (S3- 1); (I-230) + (S3-2); (I-230) + (S3-3); (I-230) + (S3-4); (I-230) + (S3-5); (I-230) + (S3-6); (I-230) + (S3-7); (I-230) + (S3-8); (I-230) + (S3-9); (I-230) + (S3-10); (I-230) + (S3-11); (I-230) + (S4-1 ); (I-230) + (S4-2); (I-230) + (S4-3); (I-230) + (S4-4); (I-
230) + (S4-5); (I-230) + (S7-1 ); (I-230) + (S11-1); (I-230) + (S11-2); (I-230) + (S11- 3); (I-230) + (S12-1); (I-230) + (S13-1); (I-230) + (S13-2); (I-230) + (S13-3); (I-230) + (S13-4): (I-230) + (S13-5); (I-230) + (S13-6); (I-230) + (S13-7); (I-230) + (S13-8); (I-230) + (S13-9); (I-230) + (S14-1)
(1-231) + (S1-1); (1-231) + (S1-2); (1-231) + (S1-3); (1-231) + (S1-4); (1-231) + (S1- 5); (1-231) + (S1-6); (1-231) + (S1-7); (1-231) + (S1-8); (1-231) + (S1-9); (1-231 ) + (S1-10); (1-231) + (S1-11); (1-231) + (S1-12); (1-231 ) + (S1-13); (1-231) + (S2-1); (I-
231) + (S2-2); (1-231 ) + (S2-3); (1-231) + (S2-4); (1-231 ) + (S2-5); (1-231) + (S2-6); (1-231 ) + (S2-7); (1-231) + (S2-8); (1-231 ) + (S2-9); (1-231) + (S2-10); (1-231 ) + (S3- 1); (1-231) + (S3-2); (1-231) + (S3-3); (1-231) + (S3-4); (1-231) + (S3-5); (1-231) + (S3-6); (1-231) + (S3-7); (1-231 ) + (S3-8); (1-231 ) + (S3-9); (1-231) + (S3-10); (1-231)
+ (S3-11 ); (1-231) + (S4-1 ); (1-231) + (S4-2); (1-231) + (S4-3); (1-231 ) + (S4-4); (I-
231 ) + (S4-5); (1-231) + (S7-1 ); (1-231) + (S11-1 ); (1-231) + (S11-2); (1-231) + (S11- 3); (1-231) + (S12-1 ); (1-231 ) + (S13-1); (1-231) + (S13-2); (1-231) + (S13-3); (1-231) + (S13-4): (1-231 ) + (S13-5); (1-231) + (S13-6); (1-231) + (S13-7); (1-231) + (S13-8); (1-231) + (S13-9); (1-231) + (S14-1)
(I-232) + (S1 -1); (I-232) + (S1-2); (I-232) + (S1-3); (I-232) + (S1-4); (I-232) + (S1- 5); (I-232) + (S1-6); (I-232) + (S1-7); (I-232) + (S1-8); (I-232) + (S1-9); (I-232) + (S1-10); (I-232) + (S1-11); (I-232) + (S1-12); (I-232) + (S1-13); (I-232) + (S2-1); (I-
232) + (S2-2); (I-232) + (S2-3); (I-232) + (S2-4); (I-232) + (S2-5); (I-232) + (S2-6); (I-232) + (S2-7); (I-232) + (S2-8); (I-232) + (S2-9); (I-232) + (S2-10); (I-232) + (S3- 1); (I-232) + (S3-2); (I-232) + (S3-3); (I-232) + (S3-4); (I-232) + (S3-5); (I-232) + (S3-6); (I-232) + (S3-7); (I-232) + (S3-8); (I-232) + (S3-9); (I-232) + (S3-10); (I-232) + (S3-1 1); (I-232) + (S4-1); (I-232) + (S4-2); (I-232) + (S4-3); (I-232) + (S4-4); (I-
232) + (S4-5); (I-232) + (S7-1); (I-232) + (S11-1); (I-232) + (S11-2); (I-232) + (S1 1- 3); (I-232) + (S12-1); (I-232) + (S13-1); (I-232) + (S13-2); (I-232) + (S13-3); (I-232) + (S13-4): (I-232) + (S13-5); (I-232) + (S13-6); (I-232) + (S13-7); (I-232) + (S13-8); (I-232) + (S13-9); (I-232) + (S14-1)
(I-233) + (S1-1 ); (I-233) + (S1-2); (I-233) + (S1-3); (I-233) + (S1-4); (I-233) + (S1- 5); (I-233) + (S1-6); (I-233) + (S1-7); (I-233) + (S1-8); (I-233) + (S1-9); (I-233) + (S1-10); (I-233) + (S1-11); (I-233) + (S1-12); (I-233) + (S1-13); (I-233) + (S2-1 ); (I-
233) + (S2-2); (I-233) + (S2-3); (I-233) + (S2-4); (I-233) + (S2-5); (I-233) + (S2-6); (I-233) + (S2-7); (I-233) + (S2-8); (I-233) + (S2-9); (I-233) + (S2-10); (I-233) + (S3- 1 ); (I-233) + (S3-2); (I-233) + (S3-3); (I-233) + (S3-4); (I-233) + (S3-5); (I-233) + (S3-6); (I-233) + (S3-7); (I-233) + (S3-8); (I-233) + (S3-9); (I-233) + (S3-10); (I-233) + (S3-11); (I-233) + (S4-1); (I-233) + (S4-2); (I-233) + (S4-3); (I-233) + (S4-4); (I- 233) + (S4-5); (I-233) + (S7-1); (I-233) + (S11-1); (I-233) + (S11-2); (I-233) + (S11- 3); (I-233) + (S12-1); (I-233) + (S13-1); (I-233) + (S13-2); (I-233) + (S13-3); (I-233) + (S13-4): (I-233) + (S13-5); (I-233) + (S13-6); (I-233) + (S13-7); (I-233) + (S13-8); (I-233) + (S13-9); (I-233) + (S14-1)
(I-234) + (S1-1 ); (I-234) + (S1-2); (I-234) + (S1-3); (I-234) + (S1-4); (I-234) + (S1- 5); (I-234) + (S1-6); (I-234) + (S1-7); (I-234) + (S1-8); (I-234) + (S1-9); (I-234) + (S1-10); (I-234) + (S1-11 ); (I-234) + (S1-12); (I-234) + (S1-13); (I-234) + (S2-1); (I-
234) + (S2-2); (I-234) + (S2-3); (I-234) + (S2-4); (I-234) + (S2-5); (I-234) + (S2-6); (I-234) + (S2-7); (I-234) + (S2-8); (I-234) + (S2-9); (I-234) + (S2-10); (I-234) + (S3- 1 ); (I-234) + (S3-2); (I-234) + (S3-3); (I-234) + (S3-4); (I-234) + (S3-5); (I-234) + (S3-6); (I-234) + (S3-7); (I-234) + (S3-8); (I-234) + (S3-9); (I-234) + (S3-10); (I-234) + (S3-11 ); (I-234) + (S4-1); (I-234) + (S4-2); (I-234) + (S4-3); (I-234) + (S4-4); (I-
234) + (S4-5); (I-234) + (S7-1 ); (I-234) + (S11-1 ); (I-234) + (S11-2); (I-234) + (S11- 3); (I-234) + (S12-1); (I-234) + (S13-1 ); (I-234) + (S13-2); (I-234) + (S13-3); (I-234) + (S13-4): (I-234) + (S13-5); (I-234) + (S13-6); (I-234) + (S13-7); (I-234) + (S13-8); (I-234) + (S13-9); (I-234) + (S14-1)
(I-235) + (S1-1 ); (I-235) + (S1-2); (I-235) + (S1-3); (I-235) + (S1-4); (I-235) + (S1- 5); (I-235) + (S1-6); (I-235) + (S1-7); (I-235) + (S1-8); (I-235) + (S1-9); (I-235) + (S1-10); (I-235) + (S1-11); (I-235) + (S1-12); (I-235) + (S1-13); (I-235) + (S2-1 ); (I-
235) + (S2-2); (I-235) + (S2-3); (I-235) + (S2-4); (I-235) + (S2-5); (I-235) + (S2-6); (I-235) + (S2-7); (I-235) + (S2-8); (I-235) + (S2-9); (I-235) + (S2-10); (I-235) + (S3- 1); (I-235) + (S3-2); (I-235) + (S3-3); (I-235) + (S3-4); (I-235) + (S3-5); (I-235) + (S3-6); (I-235) + (S3-7); (I-235) + (S3-8); (I-235) + (S3-9); (I-235) + (S3-10); (I-235) + (S3-11); (I-235) + (S4-1); (I-235) + (S4-2); (I-235) + (S4-3); (I-235) + (S4-4); (I-
235) + (S4-5); (I-235) + (S7-1); (I-235) + (S11-1); (I-235) + (S11-2); (I-235) + (S11- 3); (I-235) + (S12-1 ); (I-235) + (S13-1); (I-235) + (S13-2); (I-235) + (S13-3); (I-235) + (S13-4): (I-235) + (S13-5); (I-235) + (S13-6); (I-235) + (S13-7); (I-235) + (S13-8); (I-235) + (S13-9); (I-235) + (S14-1)
(I-236) + (S1-1); (I-236) + (S1-2); (I-236) + (S1-3); (I-236) + (S1-4); (I-236) + (S1- 5); (I-236) + (S1-6); (I-236) + (S1-7); (I-236) + (S1-8); (I-236) + (S1-9); (I-236) + (S1-10); (I-236) + (S1-11 ); (I-236) + (S1-12); (I-236) + (S1-13); (I-236) + (S2-1); (I-
236) + (S2-2); (I-236) + (S2-3); (I-236) + (S2-4); (I-236) + (S2-5); (I-236) + (S2-6); (I-236) + (S2-7); (I-236) + (S2-8); (I-236) + (S2-9); (I-236) + (S2-10); (I-236) + (S3- 1); (I-236) + (S3-2); (I-236) + (S3-3); (I-236) + (S3-4); (I-236) + (S3-5); (I-236) + (S3-6); (I-236) + (S3-7); (I-236) + (S3-8); (I-236) + (S3-9); (I-236) + (S3-10); (I-236) + (S3-11 ); (I-236) + (S4-1 ); (I-236) + (S4-2); (I-236) + (S4-3); (I-236) + (S4-4); (I- 236) + (S4-5); (I-236) + (S7-1 ); (I-236) + (S11-1 ); (I-236) + (S11-2); (I-236) + (S11- 3); (I-236) + (S12-1); (I-236) + (S13-1 ); (I-236) + (S13-2); (I-236) + (S13-3); (I-236) + (S13-4): (I-236) + (S13-5); (I-236) + (S13-6); (I-236) + (S13-7); (I-236) + (S13-8);
(I-236) + (S13-9); (I-236) + (S14-1 )
(I-237) + (S1-1); (I-237) + (S1-2); (I-237) + (S1-3); (I-237) + (S1-4); (I-237) + (S1- 5); (I-237) + (S1-6); (I-237) + (S1-7); (I-237) + (S1-8); (I-237) + (S1-9); (I-237) + (S1-10); (I-237) + (S1-11 ); (I-237) + (S1-12); (I-237) + (S1-13); (I-237) + (S2-1); (I- 237) + (S2-2); (I-237) + (S2-3); (I-237) + (S2-4); (I-237) + (S2-5); (I-237) + (S2-6); (I-237) + (S2-7); (I-237) + (S2-8); (I-237) + (S2-9); (I-237) + (S2-10); (I-237) + (S3- 1 ); (I-237) + (S3-2); (I-237) + (S3-3); (I-237) + (S3-4); (I-237) + (S3-5); (I-237) + (S3-6); (I-237) + (S3-7); (I-237) + (S3-8); (I-237) + (S3-9); (I-237) + (S3-10); (I-237) + (S3-11); (I-237) + (S4-1); (I-237) + (S4-2); (I-237) + (S4-3); (I-237) + (S4-4); (I-
237) + (S4-5); (I-237) + (S7-1); (I-237) + (S11-1); (I-237) + (S11-2); (I-237) + (S11- 3); (I-237) + (S12-1); (I-237) + (S13-1); (I-237) + (S13-2); (I-237) + (S13-3); (I-237) + (S13-4): (I-237) + (S13-5); (I-237) + (S13-6); (I-237) + (S13-7); (I-237) + (S13-8); (I-237) + (S13-9); (I-237) + (S14-1 )
(I-238) + (S1-1); (I-238) + (S1-2); (I-238) + (S1-3); (I-238) + (S1-4); (I-238) + (S1- 5); (I-238) + (S1-6); (I-238) + (S1-7); (I-238) + (S1-8); (I-238) + (S1-9); (I-238) + (S1-10); (I-238) + (S1-11 ); (I-238) + (S1-12); (I-238) + (S1-13); (I-238) + (S2-1 ); (I-
238) + (S2-2); (I-238) + (S2-3); (I-238) + (S2-4); (I-238) + (S2-5); (I-238) + (S2-6); (I-238) + (S2-7); (I-238) + (S2-8); (I-238) + (S2-9); (I-238) + (S2-10); (I-238) + (S3- 1); (I-238) + (S3-2); (I-238) + (S3-3); (I-238) + (S3-4); (I-238) + (S3-5); (I-238) + (S3-6); (I-238) + (S3-7); (I-238) + (S3-8); (I-238) + (S3-9); (I-238) + (S3-10); (I-238) + (S3-11); (I-238) + (S4-1); (I-238) + (S4-2); (I-238) + (S4-3); (I-238) + (S4-4); (I-
238) + (S4-5); (I-238) + (S7-1); (I-238) + (S11-1); (I-238) + (S11-2); (I-238) + (S11- 3); (I-238) + (S12-1); (I-238) + (S13-1); (I-238) + (S13-2); (I-238) + (S13-3); (I-238) + (S13-4): (I-238) + (S13-5); (I-238) + (S13-6); (I-238) + (S13-7); (I-238) + (S13-8); (I-238) + (S13-9); (I-238) + (S14-1 )
(I-239) + (S1-1 ); (I-239) + (S1-2); (I-239) + (S1-3); (I-239) + (S1-4); (I-239) + (S1- 5); (I-239) + (S1-6); (I-239) + (S1-7); (I-239) + (S1-8); (I-239) + (S1-9); (I-239) + (S1-10); (I-239) + (S1-11); (I-239) + (S1-12); (I-239) + (S1-13); (I-239) + (S2-1); (I-
239) + (S2-2); (I-239) + (S2-3); (I-239) + (S2-4); (I-239) + (S2-5); (I-239) + (S2-6); (I-239) + (S2-7); (I-239) + (S2-8); (I-239) + (S2-9); (I-239) + (S2-10); (I-239) + (S3- 1); (I-239) + (S3-2); (I-239) + (S3-3); (I-239) + (S3-4); (I-239) + (S3-5); (I-239) + (S3-6); (I-239) + (S3-7); (I-239) + (S3-8); (I-239) + (S3-9); (I-239) + (S3-10); (I-239)
+ (S3-11 ); (I-239) + (S4-1); (I-239) + (S4-2); (I-239) + (S4-3); (I-239) + (S4-4); (I-
239) + (S4-5); (I-239) + (S7-1); (I-239) + (S11-1 ); (I-239) + (S11-2); (I-239) + (S11- 3); (I-239) + (S12-1); (I-239) + (S13-1 ); (I-239) + (S13-2); (I-239) + (S13-3); (I-239) + (S13-4): (I-239) + (S13-5); (I-239) + (S13-6); (I-239) + (S13-7); (I-239) + (S13-8); (I-239) + (S13-9); (I-239) + (S14-1 )
(I-240) + (S1-1); (I-240) + (S1-2); (I-240) + (S1-3); (I-240) + (S1-4); (I-240) + (S1- 5); (I-240) + (S1-6); (I-240) + (S1-7); (I-240) + (S1-8); (I-240) + (S1-9); (I-240) + (S1-10); (I-240) + (S1-11 ); (I-240) + (S1-12); (I-240) + (S1 -13); (I-240) + (S2-1 ); (I-
240) + (S2-2); (I-240) + (S2-3); (I-240) + (S2-4); (I-240) + (S2-5); (I-240) + (S2-6); (I-240) + (S2-7); (I-240) + (S2-8); (I-240) + (S2-9); (I-240) + (S2-10); (I-240) + (S3- 1); (I-240) + (S3-2); (I-240) + (S3-3); (I-240) + (S3-4); (I-240) + (S3-5); (I-240) + (S3-6); (I-240) + (S3-7); (I-240) + (S3-8); (I-240) + (S3-9); (I-240) + (S3-10); (I-240) + (S3-11); (I-240) + (S4-1); (I-240) + (S4-2); (I-240) + (S4-3); (I-240) + (S4-4); (I-
240) + (S4-5); (I-240) + (S7-1); (I-240) + (S11-1); (I-240) + (S11-2); (I-240) + (S1 1- 3); (I-240) + (S12-1); (I-240) + (S13-1 ); (I-240) + (S13-2); (I-240) + (S13-3); (I-240) + (S13-4): (I-240) + (S13-5); (I-240) + (S13-6); (I-240) + (S13-7); (I-240) + (S13-8); (I-240) + (S13-9); (I-240) + (S14-1)
(1-241) + (S1-1); (1-241) + (S1-2); (1-241) + (S1-3); (1-241) + (S1-4); (1-241) + (S1- 5); (1-241) + (S1-6); (1-241) + (S1-7); (1-241) + (S1-8); (1-241 ) + (S1-9); (1-241) + (S1 -10); (1-241) + (S1-11); (1-241) + (S1-12); (1-241 ) + (S1-13); (1-241 ) + (S2-1); (I-
241) + (S2-2); (1-241 ) + (S2-3); (1-241 ) + (S2-4); (1-241) + (S2-5); (1-241 ) + (S2-6); (1-241) + (S2-7); (1-241) + (S2-8); (1-241) + (S2-9); (1-241) + (S2-10); (1-241) + (S3- 1); (1-241 ) + (S3-2); (1-241) + (S3-3); (1-241 ) + (S3-4); (1-241 ) + (S3-5); (1-241 ) + (S3-6); (1-241 ) + (S3-7); (1-241) + (S3-8); (1-241 ) + (S3-9); (1-241) + (S3-10); (1-241) + (S3-11); (1-241) + (S4-1 ); (1-241) + (S4-2); (1-241) + (S4-3); (1-241 ) + (S4-4); (I- 241) + (S4-5); (1-241) + (S7-1); (1-241 ) + (S11-1 ); (1-241) + (S11-2); (1-241) + (S11- 3); (1-241) + (S12-1); (1-241 ) + (S13-1 ); (1-241) + (S13-2); (1-241 ) + (S13-3); (1-241 ) + (S13-4): (1-241) + (S13-5); (1-241) + (S13-6); (1-241) + (S13-7); (1-241) + (S13-8); (1-241 ) + (S13-9); (1-241) + (S14-1)
(I-242) + (S1-1); (I-242) + (S1-2); (I-242) + (S1-3); (I-242) + (S1-4); (I-242) + (S1- 5); (I-242) + (S1-6); (I-242) + (S1-7); (I-242) + (S1-8); (I-242) + (S1-9); (I-242) + (S1-10); (I-242) + (S1-11); (I-242) + (S1-12); (I-242) + (S1-13); (I-242) + (S2-1 ); (I-
242) + (S2-2); (I-242) + (S2-3); (I-242) + (S2-4); (I-242) + (S2-5); (I-242) + (S2-6); (I-242) + (S2-7); (I-242) + (S2-8); (I-242) + (S2-9); (I-242) + (S2-10); (I-242) + (S3- 1); (I-242) + (S3-2); (I-242) + (S3-3); (I-242) + (S3-4); (I-242) + (S3-5); (I-242) + (S3-6); (I-242) + (S3-7); (I-242) + (S3-8); (I-242) + (S3-9); (I-242) + (S3-10); (I-242) + (S3-11); (I-242) + (S4-1); (I-242) + (S4-2); (I-242) + (S4-3); (I-242) + (S4-4); (I-
242) + (S4-5); (I-242) + (S7-1 ); (I-242) + (S11-1 ); (I-242) + (S11-2); (I-242) + (S11- 3); (I-242) + (S12-1); (I-242) + (S13-1 ); (I-242) + (S13-2); (I-242) + (S13-3); (I-242) + (S13-4): (I-242) + (S13-5); (I-242) + (S13-6); (I-242) + (S13-7); (I-242) + (S13-8); (I-242) + (S 13-9); (I-242) + (S 14-1)
(I-243) + (S1-1); (I-243) + (S1-2); (I-243) + (S1-3); (I-243) + (S1-4); (I-243) + (S1- 5); (I-243) + (S1-6); (I-243) + (S1-7); (I-243) + (S1-8); (I-243) + (S1-9); (I-243) + (S1 -10); (I-243) + (S1-11 ); (I-243) + (S1-12); (I-243) + (S1-13); (I-243) + (S2-1); (I-
243) + (S2-2); (I-243) + (S2-3); (I-243) + (S2-4); (I-243) + (S2-5); (I-243) + (S2-6); (I-243) + (S2-7); (I-243) + (S2-8); (I-243) + (S2-9); (I-243) + (S2-10); (I-243) + (S3- 1); (I-243) + (S3-2); (I-243) + (S3-3); (I-243) + (S3-4); (I-243) + (S3-5); (I-243) + (S3-6); (I-243) + (S3-7); (I-243) + (S3-8); (I-243) + (S3-9); (I-243) + (S3-10); (I-243) + (S3-11 ); (I-243) + (S4-1); (I-243) + (S4-2); (I-243) + (S4-3); (I-243) + (S4-4); (I-
243) + (S4-5); (I-243) + (S7-1); (I-243) + (S11-1); (I-243) + (S11-2); (I-243) + (S11- 3); (I-243) + (S12-1); (I-243) + (S13-1); (I-243) + (S13-2); (I-243) + (S13-3); (I-243) + (S13-4): (I-243) + (S13-5); (I-243) + (S13-6); (I-243) + (S13-7); (I-243) + (S13-8); (I-243) + (S13-9); (I-243) + (S14-1)
(I-244) + (S1-1); (I-244) + (S1-2); (I-244) + (S1-3); (I-244) + (S1-4); (I-244) + (S1- 5); (I-244) + (S1-6); (I-244) + (S1-7); (I-244) + (S1-8); (I-244) + (S1-9); (I-244) + (S1-10); (I-244) + (S1-11); (I-244) + (S1-12); (I-244) + (S1-13); (I-244) + (S2-1 ); (I-
244) + (S2-2); (I-244) + (S2-3); (I-244) + (S2-4); (I-244) + (S2-5); (I-244) + (S2-6); (I-244) + (S2-7); (I-244) + (S2-8); (I-244) + (S2-9); (I-244) + (S2-10); (I-244) + (S3- 1); (I-244) + (S3-2); (I-244) + (S3-3); (I-244) + (S3-4); (I-244) + (S3-5); (I-244) + (S3-6); (I-244) + (S3-7); (I-244) + (S3-8); (I-244) + (S3-9); (I-244) + (S3-10); (I-244) + (S3-11); (I-244) + (S4-1); (I-244) + (S4-2); (I-244) + (S4-3); (I-244) + (S4-4); (I- 244) + (S4-5); (I-244) + (S7-1); (I-244) + (S11-1); (I-244) + (S11-2); (I-244) + (S11- 3); (I-244) + (S12-1 ); (I-244) + (S13-1); (I-244) + (S13-2); (I-244) + (S13-3); (I-244) + (S13-4): (I-244) + (S13-5); (I-244) + (S13-6); (I-244) + (S13-7); (I-244) + (S13-8);
(I-244) + (S13-9); (I-244) + (S14-1)
(I-245) + (S1-1 ); (I-245) + (S1-2); (I-245) + (S1-3); (I-245) + (S1-4); (I-245) + (S1- 5); (I-245) + (S1-6); (I-245) + (S1 -7); (I-245) + (S1-8); (I-245) + (S1-9); (I-245) + (S1-10); (I-245) + (S1-11); (I-245) + (S1-12); (I-245) + (S1-13); (I-245) + (S2-1); (I- 245) + (S2-2); (I-245) + (S2-3); (I-245) + (S2-4); (I-245) + (S2-5); (I-245) + (S2-6); (I-245) + (S2-7); (I-245) + (S2-8); (I-245) + (S2-9); (I-245) + (S2-10); (I-245) + (S3- 1); (I-245) + (S3-2); (I-245) + (S3-3); (I-245) + (S3-4); (I-245) + (S3-5); (I-245) + (S3-6); (I-245) + (S3-7); (I-245) + (S3-8); (I-245) + (S3-9); (I-245) + (S3-10); (I-245) + (S3-11); (I-245) + (S4-1); (I-245) + (S4-2); (I-245) + (S4-3); (I-245) + (S4-4); (I-
245) + (S4-5); (I-245) + (S7-1); (I-245) + (S11-1); (I-245) + (S11-2); (I-245) + (S11- 3); (I-245) + (S12-1); (I-245) + (S13-1); (I-245) + (S13-2); (I-245) + (S13-3); (I-245) + (S13-4): (I-245) + (S13-5); (I-245) + (S13-6); (I-245) + (S13-7); (I-245) + (S13-8); (I-245) + (S13-9); (I-245) + (S14-1 )
(I-246) + (S1-1); (I-246) + (S1-2); (I-246) + (S1-3); (I-246) + (S1-4); (I-246) + (S1- 5); (I-246) + (S1-6); (I-246) + (S1-7); (I-246) + (S1-8); (I-246) + (S1-9); (I-246) + (S1-10); (I-246) + (S1-11 ); (I-246) + (S1-12); (I-246) + (S1-13); (I-246) + (S2-1); (I-
246) + (S2-2); (I-246) + (S2-3); (I-246) + (S2-4); (I-246) + (S2-5); (I-246) + (S2-6); (I-246) + (S2-7); (I-246) + (S2-8); (I-246) + (S2-9); (I-246) + (S2-10); (I-246) + (S3- 1); (I-246) + (S3-2); (I-246) + (S3-3); (I-246) + (S3-4); (I-246) + (S3-5); (I-246) + (S3-6); (I-246) + (S3-7); (I-246) + (S3-8); (I-246) + (S3-9); (I-246) + (S3-10); (I-246) + (S3-11); (I-246) + (S4-1); (I-246) + (S4-2); (I-246) + (S4-3); (I-246) + (S4-4); (I-
246) + (S4-5); (I-246) + (S7-1); (I-246) + (S11-1); (I-246) + (S11-2); (I-246) + (S11- 3); (I-246) + (S12-1); (I-246) + (S13-1 ); (I-246) + (S13-2); (I-246) + (S13-3); (I-246) + (S13-4): (I-246) + (S13-5); (I-246) + (S13-6); (I-246) + (S13-7); (I-246) + (S13-8); (I-246) + (S13-9); (I-246) + (S14-1)
(I-247) + (S1-1); (I-247) + (S1-2); (I-247) + (S1-3); (I-247) + (S1-4); (I-247) + (S1- 5); (I-247) + (S1-6); (I-247) + (S1-7); (I-247) + (S1-8); (I-247) + (S1-9); (I-247) + (S1-10); (I-247) + (S1-11 ); (I-247) + (S1-12); (I-247) + (S1-13); (I-247) + (S2-1 ); (I-
247) + (S2-2); (I-247) + (S2-3); (I-247) + (S2^); (I-247) + (S2-5); (I-247) + (S2-6); (I-247) + (S2-7); (I-247) + (S2-8); (I-247) + (S2-9); (I-247) + (S2-10); (I-247) + (S3- 1); (I-247) + (S3-2); (I-247) + (S3-3); (I-247) + (S3-4); (I-247) + (S3-5); (I-247) + (S3-6); (I-247) + (S3-7); (I-247) + (S3-8); (I-247) + (S3-9); (I-247) + (S3-10); (I-247)
+ (S3-11); (I-247) + (S4-1); (I-247) + (S4-2); (I-247) + (S4-3); (I-247) + (S4-4); (I-
247) + (S4-5); (I-247) + (S7-1 ); (I-247) + (S11-1 ); (I-247) + (S11-2); (I-247) + (S1 1- 3); (I-247) + (S12-1); (I-247) + (S13-1 ); (I-247) + (S13-2); (I-247) + (S13-3); (I-247) + (S13-4): (I-247) + (S13-5); (I-247) + (S13-6); (I-247) + (S13-7); (I-247) + (S13-8); (I-247) + (S13-9); (I-247) + (S14-1 )
(I-248) + (S1-1); (I-248) + (S1-2); (I-248) + (S1-3); (I-248) + (S1-4); (I-248) + (S1 - 5); (I-248) + (S1-6); (I-248) + (S1-7); (I-248) + (S1-8); (I-248) + (S1-9); (I-248) + (S1-10); (I-248) + (S1-11); (I-248) + (S1-12); (I-248) + (S1-13); (I-248) + (S2-1); (I-
248) + (S2-2); (I-248) + (S2-3); (I-248) + (S2-4); (I-248) + (S2-5); (I-248) + (S2-6); (I-248) + (S2-7); (I-248) + (S2-8); (I-248) + (S2-9); (I-248) + (S2-10); (I-248) + (S3- 1 ); (I-248) + (S3-2); (I-248) + (S3-3); (I-248) + (S3-4); (I-248) + (S3-5); (I-248) + (S3-6); (I-248) + (S3-7); (I-248) + (S3-8); (I-248) + (S3-9); (I-248) + (S3-10); (I-248) + (S3-11); (I-248) + (S4-1 ); (I-248) + (S4-2); (I-248) + (S4-3); (I-248) + (S4-4); (I-
248) + (S4-5); (I-248) + (S7-1); (I-248) + (S11-1); (I-248) + (S11-2); (I-248) + (S11- 3); (I-248) + (S12-1 ); (I-248) + (S13-1); (I-248) + (S13-2); (I-248) + (S13-3); (I-248) + (S13-4): (I-248) + (S13-5); (I-248) + (S13-6); (I-248) + (S13-7); (I-248) + (S13-8); (I-248) + (S13-9); (I-248) + (S14-1 )
(I-249) + (S1-1); (I-249) + (S1-2); (I-249) + (S1-3); (I-249) + (S1-4); (I-249) + (S1- 5); (I-249) + (S1-6); (I-249) + (S1-7); (I-249) + (S1-8); (I-249) + (S1-9); (I-249) + (S1-10); (I-249) + (S1-11 ); (I-249) + (S1-12); (I-249) + (S1-13); (I-249) + (S2-1 ); (I-
249) + (S2-2); (I-249) + (S2-3); (I-249) + (S2-4); (I-249) + (S2-5); (I-249) + (S2-6); (I-249) + (S2-7); (I-249) + (S2-8); (I-249) + (S2-9); (I-249) + (S2-10); (I-249) + (S3- 1); (I-249) + (S3-2); (I-249) + (S3-3); (I-249) + (S3-4); (I-249) + (S3-5); (I-249) + (S3-6); (I-249) + (S3-7); (I-249) + (S3-8); (I-249) + (S3-9); (I-249) + (S3-10); (I-249) + (S3-11); (I-249) + (S4-1); (I-249) + (S4-2); (I-249) + (S4-3); (I-249) + (S4-4); (I- 249) + (S4-5); (I-249) + (S7-1); (I-249) + (S11-1 ); (I-249) + (S11-2); (I-249) + (S11- 3); (I-249) + (S12-1); (I-249) + (S13-1); (I-249) + (S13-2); (I-249) + (S13-3); (I-249) + (S13-4): (I-249) + (S13-5); (I-249) + (S13-6); (I-249) + (S13-7); (I-249) + (S13-8); (I-249) + (S13-9); (I-249) + (S14-1)
(I-250) + (S1-1 ); (I-250) + (S1-2); (I-250) + (S1-3); (I-250) + (S1-4); (I-250) + (S1- 5); (I-250) + (S1-6); (I-250) + (S1-7); (I-250) + (S1-8); (I-250) + (S1-9); (I-250) + (S1-10); (I-250) + (S1-11); (I-250) + (S1-12); (I-250) + (S1-13); (I-250) + (S2-1 ); (I-
250) + (S2-2); (I-250) + (S2-3); (I-250) + (S2-4); (I-250) + (S2-5); (I-250) + (S2-6); (I-250) + (S2-7); (I-250) + (S2-8); (I-250) + (S2-9); (I-250) + (S2-10); (I-250) + (S3- 1); (I-250) + (S3-2); (I-250) + (S3-3); (I-250) + (S3-4); (I-250) + (S3-5); (I-250) + (S3-6); (I-250) + (S3-7); (I-250) + (S3-8); (I-250) + (S3-9); (I-250) + (S3-10); (I-250) + (S3-11 ); (I-250) + (S4-1 ); (I-250) + (S4-2); (I-250) + (S4-3); (I-250) + (S4-4); (I-
250) + (S4-5); (I-250) + (S7-1); (I-250) + (S11-1); (I-250) + (S11-2); (I-250) + (S11- 3); (I-250) + (S12-1 ); (I-250) + (S13-1 ); (I-250) + (S13-2); (I-250) + (S13-3); (I-250) + (S13-4): (I-250) + (S13-5); (I-250) + (S13-6); (I-250) + (S13-7); (I-250) + (S13-8); (I-250) + (S13-9); (I-250) + (S14-1 )
(1-251) + (S1-1); (1-251) + (S1-2); (1-251) + (S1-3); (1-251) + (S1-4); (1-251) + (S1- 5); (1-251) + (S1-6); (1-251) + (S1-7); (1-251) + (S1-8); (1-251) + (S1-9); (1-251) + (S1-10); (1-251) + (S1-11 ); (1-251) + (S1-12); (1-251) + (S1-13); (1-251) + (S2-1); (I-
251) + (S2-2); (1-251 ) + (S2-3); (1-251 ) + (S2-4); (1-251) + (S2-5); (1-251) + (S2-6); (1-251) + (S2-7); (1-251) + (S2-8); (1-251) + (S2-9); (1-251) + (S2-10); (1-251) + (S3- 1 ); (1-251) + (S3-2); (1-251 ) + (S3-3); (1-251 ) + (S3-4); (1-251) + (S3-5); (1-251) + (S3-6); (1-251 ) + (S3-7); (1-251) + (S3-8); (1-251 ) + (S3-9); (1-251) + (S3-10); (1-251) + (S3-11); (1-251) + (S4-1); (1-251) + (S4-2); (1-251 ) + (S4-3); (1-251) + (S4-4); (I-
251) + (S4-5); (1-251 ) + (S7-1 ); (1-251) + (S11-1); (1-251) + (S11-2); (1-251) + (S11- 3); (1-251) + (S12-1); (1-251) + (S13-1 ); (1-251) + (S13-2); (1-251) + (S13-3); (1-251) + (S13-4): (1-251) + (S13-5); (1-251 ) + (S13-6); (1-251) + (S13-7); (1-251 ) + (S13-8); (1-251) + (S13-9); (1-251 ) + (S14-1)
(I-252) + (S1-1); (I-252) + (S1-2); (I-252) + (S1-3); (I-252) + (S1-4); (I-252) + (S1- 5); (I-252) + (S1-6); (I-252) + (S1-7); (I-252) + (S1-8); (I-252) + (S1-9); (I-252) + (S1-10); (I-252) + (S1-11); (I-252) + (S1-12); (I-252) + (S1-13); (I-252) + (S2-1); (I-
252) + (S2-2); (I-252) + (S2-3); (I-252) + (S2-4); (I-252) + (S2-5); (I-252) + (S2-6); (I-252) + (S2-7); (I-252) + (S2-8); (I-252) + (S2-9); (I-252) + (S2-10); (I-252) + (S3- 1); (I-252) + (S3-2); (I-252) + (S3-3); (I-252) + (S3-4); (I-252) + (S3-5); (I-252) + (S3-6); (I-252) + (S3-7); (I-252) + (S3-8); (I-252) + (S3-9); (I-252) + (S3-10); (I-252) + (S3-11); (I-252) + (S4-1 ); (I-252) + (S4-2); (I-252) + (S4-3); (I-252) + (S4-4); (I- 252) + (S4-5); (I-252) + (S7-1); (I-252) + (S11-1); (I-252) + (S11-2); (I-252) + (S11- 3); (I-252) + (S12-1); (I-252) + (S13-1 ); (I-252) + (S13-2); (I-252) + (S13-3); (I-252) + (S13-4): (I-252) + (S13-5); (I-252) + (S13-6); (I-252) + (S13-7); (I-252) + (S13-8);
(I-252) + (S13-9); (I-252) + (S14-1)
(I-253) + (S1-1); (I-253) + (S1-2); (I-253) + (S1-3); (I-253) + (S1-4); (I-253) + (S1- 5); (I-253) + (S1-6); (I-253) + (S1-7); (I-253) + (S1-8); (I-253) + (S1-9); (I-253) + (S1-10); (I-253) + (S1-11); (I-253) + (S1-12); (I-253) + (S1-13); (I-253) + (S2-1); (I- 253) + (S2-2); (I-253) + (S2-3); (I-253) + (S2-4); (I-253) + (S2-5); (I-253) + (S2-6); (I-253) + (S2-7); (I-253) + (S2-8); (I-253) + (S2-9); (I-253) + (S2-10); (I-253) + (S3- 1 ); (I-253) + (S3-2); (I-253) + (S3-3); (I-253) + (S3-4); (I-253) + (S3-5); (I-253) + (S3-6); (I-253) + (S3-7); (I-253) + (S3-8); (I-253) + (S3-9); (I-253) + (S3-10); (I-253) + (S3-11); (I-253) + (S4-1); (I-253) + (S4-2); (I-253) + (S4-3); (I-253) + (S4-4); (I-
253) + (S4-5); (I-253) + (S7-1); (I-253) + (S11-1); (I-253) + (S11-2); (I-253) + (S11- 3); (I-253) + (S12-1); (I-253) + (S13-1 ); (I-253) + (S13-2); (I-253) + (S13-3); (I-253) + (S13-4): (I-253) + (S13-5); (I-253) + (S13-6); (I-253) + (S13-7); (I-253) + (S13-8); (I-253) + (S13-9); (I-253) + (S14-1)
(I-254) + (S1-1); (I-254) + (S1-2); (I-254) + (S1-3); (I-254) + (S1-4); (I-254) + (S1- 5); (I-254) + (S1-6); (I-254) + (S1-7); (I-254) + (S1-8); (I-254) + (S1-9); (I-254) + (S1-10); (I-254) + (S1-11); (I-254) + (S1-12); (I-254) + (S1-13); (I-254) + (S2-1); (I-
254) + (S2-2); (I-254) + (S2-3); (I-254) + (S2-4); (I-254) + (S2-5); (I-254) + (S2-6); (I-254) + (S2-7); (I-254) + (S2-8); (I-254) + (S2-9); (I-254) + (S2-10); (I-254) + (S3- 1); (I-254) + (S3-2); (I-254) + (S3-3); (I-254) + (S3-4); (I-254) + (S3-5); (I-254) + (S3-6); (I-254) + (S3-7); (I-254) + (S3-8); (I-254) + (S3-9); (I-254) + (S3-10); (I-254) + (S3-11 ); (I-254) + (S4-1); (I-254) + (S4-2); (I-254) + (S4-3); (I-254) + (S4-4); (I-
254) + (S4-5); (I-254) + (S7-1); (I-254) + (S11-1); (I-254) + (S11-2); (I-254) + (S11- 3); (I-254) + (S12-1); (I-254) + (S13-1 ); (I-254) + (S13-2); (I-254) + (S13-3); (I-254) + (S13-4): (I-254) + (S13-5); (I-254) + (S13-6); (I-254) + (S13-7); (I-254) + (S13-8); (I-254) + (S13-9); (I-254) + (S14-1 )
(I-255) + (S1-1); (I-255) + (S1-2); (I-255) + (S1-3); (I-255) + (S1-4); (I-255) + (S1- 5); (I-255) + (S1-6); (I-255) + (S1-7); (I-255) + (S1-8); (I-255) + (S1-9); (I-255) + (S1-10); (I-255) + (S1-11); (I-255) + (S1-12); (I-255) + (S1-13); (I-255) + (S2-1); (I-
255) + (S2-2); (I-255) + (S2-3); (I-255) + (S2-4); (I-255) + (S2-5); (I-255) + (S2-6); (I-255) + (S2-7); (I-255) + (S2-8); (I-255) + (S2-9); (I-255) + (S2-10); (I-255) + (S3- 1); (I-255) + (S3-2); (I-255) + (S3-3); (I-255) + (S3-4); (I-255) + (S3-5); (I-255) + (S3-6); (I-255) + (S3-7); (I-255) + (S3-8); (I-255) + (S3-9); (I-255) + (S3-10); (I-255)
+ (S3-11); (I-255) + (S4-1); (I-255) + (S4-2); (I-255) + (S4-3); (I-255) + (S4-4); (I-
255) + (S4-5); (I-255) + (S7-1 ); (I-255) + (S11-1); (I-255) + (S11-2); (I-255) + (S11- 3); (I-255) + (S12-1); (I-255) + (S13-1 ); (I-255) + (S13-2); (I-255) + (S13-3); (I-255) + (S13-4): (I-255) + (S13-5); (I-255) + (S13-6); (I-255) + (S13-7); (I-255) + (S13-8); (I-255) + (S13-9); (I-255) + (S14-1)
(I-256) + (S1-1 ); (I-256) + (S1-2); (I-256) + (S1-3); (I-256) + (S1-4); (I-256) + (S1- 5); (I-256) + (S1-6); (I-256) + (S1-7); (I-256) + (S1-8); (I-256) + (S1-9); (I-256) + (S1-10); (I-256) + (S1-11); (I-256) + (S1-12); (I-256) + (S1-13); (I-256) + (S2-1); (I-
256) + (S2-2); (I-256) + (S2-3); (I-256) + (S2-4); (I-256) + (S2-5); (I-256) + (S2-6); (I-256) + (S2-7); (I-256) + (S2-8); (I-256) + (S2-9); (I-256) + (S2-10); (I-256) + (S3- 1); (I-256) + (S3-2); (I-256) + (S3-3); (I-256) + (S3-4); (I-256) + (S3-5); (I-256) + (S3-6); (I-256) + (S3-7); (I-256) + (S3-8); (I-256) + (S3-9); (I-256) + (S3-10); (I-256) + (S3-1 1); (I-256) + (S4-1 ); (I-256) + (S4-2); (I-256) + (S4-3); (I-256) + (S4-4); (I-
256) + (S4-5); (I-256) + (S7-1); (I-256) + (S11-1); (I-256) + (S11-2); (I-256) + (S11- 3); (I-256) + (S12-1 ); (I-256) + (S13-1 ); (I-256) + (S13-2); (I-256) + (S13-3); (I-256) + (S13-4): (I-256) + (S13-5); (I-256) + (S13-6); (I-256) + (S13-7); (I-256) + (S13-8); (I-256) + (S13-9); (I-256) + (S14-1)
(I-257) + (S1-1); (I-257) + (S1-2); (I-257) + (S1-3); (I-257) + (S1-4); (I-257) + (S1- 5); (I-257) + (S1-6); (I-257) + (S1-7); (I-257) + (S1-8); (I-257) + (S1-9); (I-257) + (S1-10); (I-257) + (S1-11); (I-257) + (S1-12); (I-257) + (S1-13); (I-257) + (S2-1 ); (I-
257) + (S2-2); (I-257) + (S2-3); (I-257) + (S2-4); (I-257) + (S2-5); (I-257) + (S2-6); (I-257) + (S2-7); (I-257) + (S2-8); (I-257) + (S2-9); (I-257) + (S2-10); (I-257) + (S3- 1); (I-257) + (S3-2); (I-257) + (S3-3); (I-257) + (S3-4); (I-257) + (S3-5); (I-257) + (S3-6); (I-257) + (S3-7); (I-257) + (S3-8); (I-257) + (S3-9); (I-257) + (S3-10); (I-257) + (S3-11); (I-257) + (S4-1 ); (I-257) + (S4-2); (I-257) + (S4-3); (I-257) + (S4-4); (I- 257) + (S4-5); (I-257) + (S7-1); (I-257) + (S11-1 ); (I-257) + (S11-2); (I-257) + (S11- 3); (I-257) + (S12-1); (I-257) + (S13-1 ); (I-257) + (S13-2); (I-257) + (S13-3); (I-257) + (S13-4): (I-257) + (S13-5); (I-257) + (S13-6); (I-257) + (S13-7); (I-257) + (S13-8); (I-257) + (S13-9); (I-257) + (S14-1 )
(I-258) + (S1-1); (I-258) + (S1-2); (I-258) + (S1-3); (I-258) + (S1-4); (I-258) + (S1- 5); (I-258) + (S1-6); (I-258) + (S1-7); (I-258) + (S1-8); (I-258) + (S1-9); (I-258) + (S1-10); (I-258) + (S1-11 ); (I-258) + (S1-12); (I-258) + (S1-13); (I-258) + (S2-1 ); (I-
258) + (S2-2); (I-258) + (S2-3); (I-258) + (S2-4); (I-258) + (S2-5); (I-258) + (S2-6); (I-258) + (S2-7); (I-258) + (S2-8); (I-258) + (S2-9); (I-258) + (S2-10); (I-258) + (S3- 1); (I-258) + (S3-2); (I-258) + (S3-3); (I-258) + (S3-4); (I-258) + (S3-5); (I-258) + (S3-6); (I-258) + (S3-7); (I-258) + (S3-8); (I-258) + (S3-9); (I-258) + (S3-10); (I-258) + (S3-11); (I-258) + (S4-1); (I-258) + (S4-2); (I-258) + (S4-3); (I-258) + (S4-4); (I-
258) + (S4-5); (I-258) + (S7-1); (I-258) + (S11-1); (I-258) + (S11-2); (I-258) + (S11- 3); (I-258) + (S12-1 ); (I-258) + (S13-1 ); (I-258) + (S13-2); (I-258) + (S13-3); (I-258) + (S13-4): (I-258) + (S13-5); (I-258) + (S13-6); (I-258) + (S13-7); (I-258) + (S13-8); (I-258) + (S13-9); (I-258) + (S14-1)
(I-259) + (S1-1); (I-259) + (S1-2); (I-259) + (S1-3); (I-259) + (S1-4); (I-259) + (S1- 5); (I-259) + (S1-6); (I-259) + (S1-7); (I-259) + (S1-8); (I-259) + (S1-9); (I-259) + (S1-10); (I-259) + (S1-11); (I-259) + (S1-12); (I-259) + (S1-13); (I-259) + (S2-1 ); (I-
259) + (S2-2); (I-259) + (S2-3); (I-259) + (S2-4); (I-259) + (S2-5); (I-259) + (S2-6); (I-259) + (S2-7); (I-259) + (S2-8); (I-259) + (S2-9); (I-259) + (S2-10); (I-259) + (S3- 1); (I-259) + (S3-2); (I-259) + (S3-3); (I-259) + (S3-4); (I-259) + (S3-5); (I-259) + (S3-6); (I-259) + (S3-7); (I-259) + (S3-8); (I-259) + (S3-9); (I-259) + (S3-10); (I-259) + (S3-11); (I-259) + (S4-1); (I-259) + (S4-2); (I-259) + (S4-3); (I-259) + (S4-4); (I-
259) + (S4-5); (I-259) + (S7-1); (I-259) + (S11-1); (I-259) + (S11-2); (I-259) + (S11- 3); (I-259) + (S12-1); (I-259) + (S13-1 ); (I-259) + (S13-2); (I-259) + (S13-3); (I-259) + (S13-4): (I-259) + (S13-5); (I-259) + (S13-6); (I-259) + (S13-7); (I-259) + (S13-8); (I-259) + (S13-9); (I-259) + (S14-1)
(I-260) + (S1-1); (I-260) + (S1-2); (I-260) + (S1-3); (I-260) + (S1-4); (I-260) + (S1- 5); (I-260) + (S1-6); (I-260) + (S1-7); (I-260) + (S1-8); (I-260) + (S1-9); (I-260) + (S1-10); (I-260) + (S1-11); (I-260) + (S1-12); (I-260) + (S1-13); (I-260) + (S2-1 ); (I-
260) + (S2-2); (I-260) + (S2-3); (I-260) + (S2-4); (I-260) + (S2-5); (I-260) + (S2-6); (I-260) + (S2-7); (I-260) + (S2-8); (I-260) + (S2-9); (I-260) + (S2-10); (I-260) + (S3- 1); (I-260) + (S3-2); (I-260) + (S3-3); (I-260) + (S3-4); (I-260) + (S3-5); (I-260) + (S3-6); (I-260) + (S3-7); (I-260) + (S3-8); (I-260) + (S3-9); (I-260) + (S3-10); (I-260) + (S3-11); (I-260) + (S4-1); (I-260) + (S4-2); (I-260) + (S4-3); (I-260) + (S4-4); (I- 260) + (S4-5); (I-260) + (S7-1 ); (I-260) + (S11-1 ); (I-260) + (S11-2); (I-260) + (S11- 3); (I-260) + (S12-1); (I-260) + (S13-1 ); (I-260) + (S13-2); (I-260) + (S13-3); (I-260) + (S13-4): (I-260) + (S13-5); (I-260) + (S13-6); (I-260) + (S13-7); (I-260) + (S13-8);
(I-260) + (S13-9); (I-260) + (S14-1 )
(1-261 ) + (S1-1); (1-261) + (S1-2); (1-261) + (S1-3); (1-261) + (S1-4); (1-261) + (S1- 5); (1-261) + (S1-6); (1-261 ) + (S1-7); (1-261) + (S1-8); (1-261) + (S1-9); (1-261 ) + (S1-10); (1-261) + (S1-11 ); (1-261) + (S1-12); (1-261) + (S1-13); (1-261) + (S2-1 ); (I- 261) + (S2-2); (1-261 ) + (S2-3); (1-261 ) + (S2-4); (1-261 ) + (S2-5); (1-261) + (S2-6); (1-261 ) + (S2-7); (1-261) + (S2-8); (1-261) + (S2-9); (1-261) + (S2-10); (1-261 ) + (S3- 1); (1-261) + (S3-2); (1-261 ) + (S3-3); (1-261) + (S3-4); (1-261) + (S3-5); (1-261) + (S3-6); (1-261) + (S3-7); (1-261) + (S3-8); (1-261) + (S3-9); (1-261) + (S3-10); (1-261) + (S3-11); (1-261) + (S4-1 ); (1-261) + (S4-2); (1-261) + (S4-3); (1-261 ) + (S4-4); (I-
261) + (S4-5); (1-261 ) + (S7-1); (1-261 ) + (S11-1); (1-261) + (S11-2); (1-261) + (S11- 3); (1-261) + (S12-1 ); (1-261) + (S13-1 ); (1-261) + (S13-2); (1-261 ) + (S13-3); (1-261 ) + (S13-4): (1-261) + (S13-5); (1-261) + (S13-6); (1-261) + (S13-7); (1-261) + (S13-8); (1-261) + (S13-9); (1-261) + (S14-1 )
(I-262) + (S1-1 ); (I-262) + (S1-2); (I-262) + (S1-3); (I-262) + (S1-4); (I-262) + (S1- 5); (I-262) + (S1-6); (I-262) + (S1-7); (I-262) + (S1-8); (I-262) + (S1-9); (I-262) + (S1-10); (I-262) + (S1-11 ); (I-262) + (S1-12); (I-262) + (S1-13); (I-262) + (S2-1); (I-
262) + (S2-2); (I-262) + (S2-3); (I-262) + (S2-4); (I-262) + (S2-5); (I-262) + (S2-6); (I-262) + (S2-7); (I-262) + (S2-8); (I-262) + (S2-9); (I-262) + (S2-10); (I-262) + (S3- 1); (I-262) + (S3-2); (I-262) + (S3-3); (I-262) + (S3-4); (I-262) + (S3-5); (I-262) + (S3-6); (I-262) + (S3-7); (I-262) + (S3-8); (I-262) + (S3-9); (I-262) + (S3-10); (I-262) + (S3-11); (I-262) + (S4-1); (I-262) + (S4-2); (I-262) + (S4-3); (I-262) + (S4-4); (I-
262) + (S4-5); (I-262) + (S7-1 ); (I-262) + (S11-1); (I-262) + (S11-2); (I-262) + (S11- 3); (I-262) + (S12-1); (I-262) + (S13-1); (I-262) + (S13-2); (I-262) + (S13-3); (I-262) + (S13-4): (I-262) + (S13-5); (I-262) + (S13-6); (I-262) + (S13-7); (I-262) + (S13-8); (I-262) + (S13-9); (I-262) + (S14-1)
(I-263) + (S1-1); (I-263) + (S1-2); (I-263) + (S1-3); (I-263) + (S1-4); (I-263) + (S1- 5); (I-263) + (S1-6); (I-263) + (S1-7); (I-263) + (S1-8); (I-263) + (S1-9); (I-263) + (S1-10); (I-263) + (S1-11); (I-263) + (S1-12); (I-263) + (S1-13); (I-263) + (S2-1 ); (I-
263) + (S2-2); (I-263) + (S2-3); (I-263) + (S2-4); (I-263) + (S2-5); (I-263) + (S2-6); (I-263) + (S2-7); (I-263) + (S2-8); (I-263) + (S2-9); (I-263) + (S2-10); (I-263) + (S3- 1 ); (I-263) + (S3-2); (I-263) + (S3-3); (I-263) + (S3-4); (I-263) + (S3-5); (I-263) + (S3-6); (I-263) + (S3-7); (I-263) + (S3-8); (I-263) + (S3-9); (I-263) + (S3-10); (I-263)
+ (S3-11); (I-263) + (S4-1); (I-263) + (S4-2); (I-263) + (S4-3); (I-263) + (S4-4); (I-
263) + (S4-5); (I-263) + (S7-1 ); (I-263) + (S11-1); (I-263) + (S11-2); (I-263) + (S11- 3); (I-263) + (S12-1 ); (I-263) + (S13-1 ); (I-263) + (S13-2); (I-263) + (S13-3); (I-263) + (S13-4): (I-263) + (S13-5); (I-263) + (S13-6); (I-263) + (S13-7); (I-263) + (S13-8); (I-263) + (S13-9); (I-263) + (S14-1)
(I-264) + (S1-1 ); (I-264) + (S1-2); (I-264) + (S1-3); (I-264) + (S1-4); (I-264) + (S1- 5); (I-264) + (S1-6); (I-264) + (S1-7); (I-264) + (S1-8); (I-264) + (S1-9); (I-264) + (S1-10); (I-264) + (S1-11); (I-264) + (S1-12); (I-264) + (S1-13); (I-264) + (S2-1 ); (I-
264) + (S2-2); (I-264) + (S2-3); (I-264) + (S2-4); (I-264) + (S2-5); (I-264) + (S2-6); (I-264) + (S2-7); (I-264) + (S2-8); (I-264) + (S2-9); (I-264) + (S2-10); (I-264) + (S3- 1); (I-264) + (S3-2); (I-264) + (S3-3); (I-264) + (S3-4); (I-264) + (S3-5); (I-264) + (S3-6); (I-264) + (S3-7); (I-264) + (S3-8); (I-264) + (S3-9); (I-264) + (S3-10); (I-264) + (S3-11); (I-264) + (S4-1); (I-264) + (S4-2); (I-264) + (S4-3); (I-264) + (S4-4); (I- 264) + (S4-5); (I-264) + (S7-1 ); (I-264) + (S11-1); (I-264) + (S11-2); (I-264) + (S11- 3); (I-264) + (S12-1); (I-264) + (S13-1 ); (I-264) + (S13-2); (I-264) + (S13-3); (I-264) + (S13-4): (I-264) + (S13-5); (I-264) + (S13-6); (I-264) + (S13-7); (I-264) + (S13-8); (I-264) + (S13-9); (I-264) + (S14-1)
Im Rahmen der vorliegenden Erfindung sind insbesondere Kombinationen der Verbindungen der allgemeinen Formel (I) mit den folgenden Safenern bevorzugt: Daimuron (S14-1), Benoxacor (S3-4), Furilazol [(S3-10) bzw. (S3-11)], Fluxofenim (S11-2), Fenchlorazol(-ethylester) (S1-7), Mefenpyr-diethyl (S1-1), Cloquintocet- mexyl (S2-1), Isoxadifen-ethyl (S1-11), Cyprosulfamide (S4-1), Flurazole (S13-3), Oxabetrinil (S11-1), Dichlormid (S3-1) und Dietholate (S13-8).
Im Rahmen der vorliegenden Erfindung sind noch bevorzugter Kombinationen der Verbindungen der allgemeinen Formel (I) mit den folgenden Safenern: Mefenpyr- diethyl (S1-1), Isoxadifen-ethyl (S1-11), Cyprosulfamide (S4-1), Fenchlorazol- ethylester (S1-7), Benoxacor (S3-4), Cloquintocet-mexyl (S2-1), Fluxofenim (S11-2) und Furilazol [(S3-10) bzw. (S3-11)].
Im Rahmen der vorliegenden Erfindung sind insbesondere Kombinationen
bevorzugt, die als Komponente (A) eine Verbindung der Formel (I) ausgewählt aus Methyl-4-amino-3,5-dichlor-6-cyclopropyl-2-pyridincarboxylat, 4-Amino-3,5-dichlor-6- cyclopropyl-2-pyridincarbonsäure, Methyl 4-amino-3-chlor-6-cyclopropyl-2- pyridincarboxylat, 4-Amino-3-chlor-6-cyclopropyl-2-pyridincarbonsäure, Methyl-4- amino-3-chlor-6-cyclopropyl-5-fluor-2-pyridincarboxylat und 4-Amino-3-chlor-6- cyclopropyl-δ-fluor^-pyridincarbonsäure enthalten und als Komponente (B) einen Safener ausgewählt aus Mefenpyr-diethyl (S1-1), Isoxadifen-ethyl (S1-11), Cyprosulfamide (S4-1), Fenchlorazol-ethylester (S1-7), Benoxacor (S3-4), Cloquintocet-mexyl (S2-1), Fluxofenim (S11-2) und Furilazol [(S3-10) bzw. (S3-11)].
Bevorzugt sind Herbizid-Safener-Kombinationen, enthaltend (A) eine herbizid wirksame Menge an einer oder mehrerer Verbindungen der Formel (I) oder deren Salzen, und (B) eine antidotisch-wirksame Menge an einem oder mehreren Safenern.
Herbizid wirksame Menge bedeutet im Sinne der Erfindung eine Menge an einem oder mehreren Herbiziden, die geeignet ist, den Pflanzenwuchs negativ zu beeinflussen. Antidotisch wirksame Menge bedeutet im Sinne der Erfindung eine Menge an einem oder mehreren Safenern, die geeignet ist, die phytotoxische Wirkung von Pflanzenschutzmittelwirkstoffen (z.B. von Herbiziden) an Kulturpflanzen zu reduzieren.
Die Safener (B) eignen sich zur Reduktion phytotoxischer Effekte, die beim Einsatz von Herbiziden der allgemeinen Formel (I) in Nutzpflanzenkulturen auftreten können, ohne die Wirksamkeit dieser herbiziden Wirkstoffe gegen Schadpflanzen wesentlich zu beeinträchtigen. Hierdurch kann das Einsatzgebiet herkömmlicher Pflanzenschutzmittel ganz erheblich erweitert z.B. auf Kulturen, in denen bisher ein Einsatz der Herbizide nicht möglich oder nur beschränkt möglich war.
Die benötigten Aufwandmengen der Safener können je nach Indikation und verwendetem herbiziden Wirkstoff innerhalb weiter Grenzen schwanken und sind in
der Regel im Bereich von 0,001 bis 5 kg, vorzugsweise 0,005 bis 2,5 kg Wirkstoff je Hektar.
Die herbiziden Wirkstoffe (A) der allgemeinen Formel (I) und die Safener (B) können zusammen (z.B. als fertige Formulierung oder im Tank-mix-Verfahren) oder in beliebiger Reihenfolge nacheinander ausgebracht werden, z.B. durch Sprüh-, Gieß- und Spritzanwendung oder durch Granulatstreuung. Das Gewichtsverhältnis Herbizid der allgemeinen Formel (I) (A) : Safener (B) kann innerhalb weiter Grenzen variieren und liegt vorzugsweise im Bereich von 1 :10000 bis 10000:1 , insbesondere von 1 :1000 bis 1000:1. Die jeweils optimalen Mengen an der allgemeinen Formel (I)
(A) und Safener (B) sind vom Typ des verwendeten Herbizids und des verwendeten Safeners sowie von der Art und dem Entwicklungsstadium des zu behandelnden Pflanzenbestandes abhängig und lassen sich von Fall zu Fall durch einfache, routinemäßige Vorversuche ermitteln.
Die in der erfindungsgemäßen Herbizid-Safener-Kombination enthaltenen Safener
(B) können je nach ihren Eigenschaften zur Vorbehandlung des Saatgutes der Kulturpflanze (z.B. zur Beizung des Saatguts) verwendet werden oder vor der Saat in die Saatfurchen eingebracht oder zusammen mit dem Herbizid vor oder nach dem Auflaufen der Pflanzen angewendet werden. Vorauf laufbehand Iu ng schließt sowohl die Behandlung der Anbaufläche (einschließlich eventuell auf der Anbaufläche befindlichen Wassers, z.B. bei Reisapplikationen) vor der Aussaat als auch die Behandlung der angesäten, aber noch nicht bewachsenen Anbauflächen ein. Bevorzugt ist die gemeinsame Anwendung mit dem Herbizid. Hierzu können Tankmischungen oder Fertigformulierungen eingesetzt werden.
In einer bevorzugten Ausführungsform werden das Saatgut (z.B. Körner, Samen oder vegetative Vermehrungsorgane wie Knollen oder Sprossteile mit Knospen) oder Setzlinge mit den Safenern (B), gegebenenfalls in Kombination mit anderen agrochemischen Wirkstoffen, vorbehandelt. Zur Vorbehandlung des Saatguts können die Wirkstoffe z.B. durch Beizung an das Saatgut gebracht oder die Wirkstoffe und das Saatgut können in Wasser oder andere Lösungsmittel gegeben,
und die Wirkstoffe z.B. durch Anlagerung oder Diffusion im Tauchverfahren oder durch Quellen oder Vorkeimen aufgenommen werden. Zur Vorbehandlung von Setzlingen können die jungen Pflanzen z.B. durch Spritzen, Tauchen oder Gießen mit den Safenern, gegebenenfalls in Kombination mit anderen agrochemischen Wirkstoffen, in Kontakt gebracht und anschließend verpflanzt und gegebenenfalls mit den Herbiziden (A) nachbehandelt werden.
Die Saatgut- oder Setzlingsbehandlung kann mit den Safenern (B) alleine oder gemeinsam mit anderen agrochemischen Wirkstoffen - wie Fungiziden, Insektiziden oder Mitteln zur Pflanzenstärkung, Düngung oder zur Beschleunigung der Quell- und Keimungsvorgänge - erfolgen. Dabei können die Safener nach der Vorbehandlungsanwendung anschließend nochmals vor, nach oder gemeinsam mit einem oder mehreren Herbiziden der Formel (I) eventuell auch in Kombination mit anderen bekannten Herbiziden angewandt werden. Durch die Vorbehandlung des Saatguts oder der Setzlinge kann eine verbesserte Langzeitwirkung der Safener erzielt werden.
Gegenstand der vorliegenden Erfindung ist somit weiterhin ein Verfahren zur Bekämpfung von unerwünschten Pflanzen in Pflanzenkulturen, das dadurch gekennzeichnet ist, dass die Komponenten (A) und (B) der erfindungsgemäßen
Herbizid-Safener-Kombination auf die Pflanzen (z.B. Schadpflanzen wie mono- oder dikotyle Unkräuter oder unerwünschte Kulturpflanzen), das Saatgut (z.B. Körner, Samen oder vegetative Vermehrungsorgane wie Knollen oder Sprossteile mit Knospen) oder die Fläche, auf der die Pflanzen wachsen (z.B. die Anbaufläche), ausgebracht werden, z.B. gemeinsam oder getrennt. Dabei können einer oder mehrere Safener (B), vorzugsweise eine oder mehrere, insbesondere eine, Verbindung der Gruppen (S1) bis (S14) vor, nach oder gleichzeitig mit dem oder den Herbizid(en) der allgemeinen Formel (I) (A) auf die Pflanzen, das Saatgut oder die Fläche, auf der die Pflanzen wachsen (z.B. die Anbaufläche), appliziert werden. In einer bevorzugten Ausführungsform werden die Safener (B) zur Saatgutbehandlung eingesetzt.
Unter unerwünschten Pflanzen sind alle Pflanzen zu verstehen, die an Orten wachsen, wo sie unerwünscht sind. Dies können z.B. Schadpflanzen (z.B. mono- oder dikotyle Unkräuter oder unerwünschte Kulturpflanzen) sein, z.B. auch solche, die gegen bestimmte herbizide Wirkstoffe wie Glyphosate, Atrazin, Glufosinate oder Imidazolinon-Herbizide resistent sind.
Monokotyle Unkräuter entstammen z.B. den Gattungen Echinochloa, Setaria, Panicum, Digitaria, Phleum, Poa, Festuca, Eleusine, Brachiaria, Lolium, Bromus, Avena, Cyperus, Sorghum, Agropyron, Cynodon, Monochoria, Fimbristylis, Sagittaria, Eleocharis, Scirpus, Paspalum, Ischaemum, Sphenoclea, Dactyloctenium, Agrostis, Alopecurus, Apera. Dikotyle Unkräuter entstammen z.B. den Gattungen Sinapis, Lepidium, Galium, Stellaria, Matricaria, Anthemis, Galinsoga, Chenopodium, Urtica, Senecio, Amaranthus, Portulaca, Xanthium, Convolvulus, Ipomoea, Polygonum, Sesbania, Ambrosia, Cirsium, Carduus, Sonchus, Solanum, Rorippa, Rotala, Lindernia, Lamium, Veronica, Abutilon, Emex, Datura, Viola, Galeopsis, Papaver, Centaurea, Trifolium, Ranunculus, Taraxacum, Euphorbia.
Bevorzugt wird in dem erfindungsgemäßen Verfahren eine wirksame Menge der Komponenten (A) und (B) zur Bekämpfung von Schadpflanzen angewendet in Pflanzenkulturen, beispielsweise in wirtschaftlich bedeutenden Ackerbaukulturen z.B. monokotylen Ackerbaukulturen wie Getreide (z.B. Weizen, Gerste, Roggen, Hafer), Reis, Mais, Hirse, oder dikotylen Ackerbaukulturen wie Zuckerrübe, Raps, Baumwolle, Sonnenblumen und Leguminosen z.B. der Gattungen Glycine (z.B. Glycine max. wie nicht-transgene Glycine max. (z.B. konventionelle Sorten wie STS- Sorten) oder transgene Glycine max. (z.B. RR-Soja oder LL-Soja) und deren Kreuzungen), Phaseolus, Pisum, Vicia und Arachis, oder Gemüsekulturen aus verschiedenen botanischen Gruppen wie Kartoffel, Lauch, Kohl, Karotte, Tomate, Zwiebel, sowie Dauer- und Plantagenkulturen wie Kern- und Steinobst, Beerenobst, Wein, Hevea, Bananen, Zuckerrohr, Kaffee, Tee, Citrus, Nussplantagen, Rasen, Palmenkulturen und Forstkulturen.
Gegenstand der Erfindung ist auch die Verwendung der erfindungsgemäßen Herbizid-Safener-Kombinationen zur Bekämpfung von unerwünschtem Pflanzenwuchs, vorzugsweise in Pflanzenkulturen.
Die erfindungsgemäßen Herbizid-Safener-Kombinationen können nach bekannten Verfahren z.B. als Mischformulierungen der Einzelkomponenten, gegebenenfalls mit weiteren Wirkstoffen, Zusatzstoffen und/oder üblichen Formulierungshilfsmitteln hergestellt werden, die dann in üblicher Weise mit Wasser verdünnt zur Anwendung gebracht werden, oder als sogenannte Tankmischungen durch gemeinsame Verdünnung der getrennt formulierten oder partiell getrennt formulierten
Einzelkomponenten mit Wasser hergestellt werden. Ebenfalls möglich ist die zeitlich versetzte Anwendung (Splitapplikation) der getrennt formulierten oder partiell getrennt formulierten Einzelkomponenten. Möglich ist auch die Anwendung der Einzelkomponenten oder der Herbizid-Safener-Kombinationen in mehreren Portionen (Sequenzanwendung), z. B. nach Anwendungen im Vorauflauf, gefolgt von Nachauflauf-Applikationen oder nach frühen Nachauflaufanwendungen, gefolgt von Applikationen im mittleren oder späten Nachauflauf. Bevorzugt ist dabei die gemeinsame oder die zeitnahe Anwendung der Wirkstoffe der jeweiligen Kombination.
Die erfindungsgemäße Herbizid-Safener-Kombination kann auch zur Bekämpfung von Schadpflanzen in Kulturen von bekannten oder noch zu entwickelnden gentechnisch veränderten Pflanzen eingesetzt werden.
Die transgenen Pflanzen zeichnen sich in der Regel durch besondere vorteilhafte Eigenschaften aus, beispielsweise durch Resistenzen gegenüber bestimmten Pestiziden, vor allem bestimmten Herbiziden, Resistenzen gegenüber Pflanzenkrankheiten oder Erregern von Pflanzenkrankheiten wie bestimmten Insekten oder Mikroorganismen wie Pilzen, Bakterien oder Viren. Andere besondere Eigenschaften betreffen z. B. das Erntegut hinsichtlich Menge, Qualität,
Lagerfähigkeit, Zusammensetzung und spezieller Inhaltsstoffe. So sind transgene Pflanzen mit erhöhtem Stärkegehalt oder veränderter Qualität der Stärke oder
solche mit anderer Fettsäurezusammensetzung des Ernteguts bekannt. Weitere besondere Eigenschaften können in einer Toleranz oder Resistenz gegen abiotische Stressoren z. B. Hitze, Kälte, Trockenheit, Salz und ultraviolette Strahlung liegen.
Bevorzugt ist die Anwendung der erfindungsgemäßen Herbizid-Safener- Kombinationen oder deren Salze in wirtschaftlich bedeutenden transgenen Kulturen von Nutz-und Zierpflanzen, z. B. von Getreide wie Weizen, Gerste, Roggen, Hafer, Hirse, Reis, Maniok und Mais oder auch Kulturen von Zuckerrübe, Baumwolle, Soja, Raps, Kartoffel, Tomate, Erbse und anderen Gemüsesorten. Vorzugsweise können die Verbindungen der Formel (I) als Herbizide in
Nutzpflanzenkulturen eingesetzt werden, welche gegenüber den phytotoxischen Wirkungen der Herbizide resistent sind bzw. gentechnisch resistent gemacht worden sind.
Herkömmliche Wege zur Herstellung neuer Pflanzen, die im Vergleich zu bisher vorkommenden Pflanzen modifizierte Eigenschaften aufweisen, bestehen beispielsweise in klassischen Züchtungsverfahren und der Erzeugung von Mutanten. Alternativ können neue Pflanzen mit veränderten Eigenschaften mit Hilfe gentechnischer Verfahren erzeugt werden (siehe z. B. EP-A-0221044, EP-A- 0131624). Beschrieben wurden beispielsweise in mehreren Fällen
gentechnische Veränderungen von Kulturpflanzen zwecks Modifikation der in den Pflanzen synthetisierten Stärke (z. B. WO 92/1 1376, WO 92/14827, WO
91/19806), - transgene Kulturpflanzen, welche gegen bestimmte Herbizide vom Typ
Glufosinate (vgl. z. B. EP-A-0242236, EP-A-242246) oder Glyphosate (WO
92/00377) oder der Sulfonylharnstoffe (EP-A-0257993, US-A-5013659) resistent sind, transgene Kulturpflanzen, beispielsweise Baumwolle, mit der Fähigkeit Bacillus thuringiensis-Toxine (Bt-Toxine) zu produzieren, welche die
Pflanzen gegen bestimmte Schädlinge resistent machen (EP-A-0142924, EP-
A-0193259).
transgene Kulturpflanzen mit modifizierter Fettsäurezusammensetzung (WO 91/13972). gentechnisch veränderte Kulturpflanzen mit neuen Inhalts- oder Sekundärstoffen z. B. neuen Phytoalexinen, die eine erhöhte Krankheitsresistenz verursachen (EPA 309862, EPA0464461) gentechnisch veränderte Pflanzen mit reduzierter Photorespiration, die höhere Erträge und höhere Stresstoleranz aufweisen (EPA 0305398). Transgene Kulturpflanzen, die pharmazeutisch oder diagnostisch wichtige Proteine produzieren („molecular pharming") - transgene Kulturpflanzen, die sich durch höhere Erträge oder bessere Qualität auszeichnen transgene Kulturpflanzen die sich durch eine Kombinationen z. B. der o. g. neuen Eigenschaften auszeichnen („gene stacking")
Zahlreiche molekularbiologische Techniken, mit denen neue transgene Pflanzen mit veränderten Eigenschaften hergestellt werden können, sind im Prinzip bekannt; siehe z. B. I. Potrykus und G. Spangenberg (eds.) Gene Transfer to Plants, Springer Lab Manual (1995), Springer Verlag Berlin, Heidelberg, oder Christou, "Trends in Plant Science" 1 (1996) 423-431).
Für derartige gentechnische Manipulationen können Nucleinsäuremoleküle in Plasmide eingebracht werden, die eine Mutagenese oder eine Sequenzveränderung durch Rekombination von DNA-Sequenzen erlauben. Mit Hilfe von Standardverfahren können z. B. Basenaustausche vorgenommen, Teilsequenzen entfernt oder natürliche oder synthetische Sequenzen hinzugefügt werden. Für die Verbindung der DNA-Fragmente untereinander können an die Fragmente Adaptoren oder Linker angesetzt werden, siehe z. B. Sambrook et al., 1989, Molecular Cloning, A Laboratory Manual, 2. Aufl. CoId Spring Harbor Laboratory Press, CoId Spring Harbor, NY; oder Winnacker "Gene und Klone", VCH Weinheim 2. Auflage 1996
Die Herstellung von Pflanzenzellen mit einer verringerten Aktivität eines Genprodukts kann beispielsweise erzielt werden durch die Expression mindestens
einer entsprechenden antisense-RNA, einer sense-RNA zur Erzielung eines Cosuppressionseffektes oder die Expression mindestens eines entsprechend konstruierten Ribozyms, das spezifisch Transkripte des obengenannten Genprodukts spaltet.
Hierzu können zum einen DNA-Moleküle verwendet werden, die die gesamte codierende Sequenz eines Genprodukts einschließlich eventuell vorhandener flankierender Sequenzen umfassen, als auch DNA-Moleküle, die nur Teile der codierenden Sequenz umfassen, wobei diese Teile lang genug sein müssen, um in den Zellen einen antisense-Effekt zu bewirken. Möglich ist auch die Verwendung von DNA-Sequenzen, die einen hohen Grad an Homologie zu den codierenden Sequenzen eines Genprodukts aufweisen, aber nicht vollkommen identisch sind.
Bei der Expression von Nucleinsäuremolekülen in Pflanzen kann das synthetisierte Protein in jedem beliebigen Kompartiment der pflanzlichen Zelle lokalisiert sein. Um aber die Lokalisation in einem bestimmten Kompartiment zu erreichen, kann z. B. die codierende Region mit DNA-Sequenzen verknüpft werden, die die Lokalisierung in einem bestimmten Kompartiment gewährleisten. Derartige Sequenzen sind dem Fachmann bekannt (siehe beispielsweise Braun et al., EMBO J. 11 (1992), 3219- 3227; Wolter et al., Proc. Natl. Acad. Sei. USA 85 (1988), 846-850; Sonnewald et al., Plant J. 1 (1991), 95-106). Die Expression der Nukleinsäuremoleküle kann auch in den Organellen der Pflanzenzellen stattfinden.
Die transgenen Pflanzenzellen können nach bekannten Techniken zu ganzen Pflanzen regeneriert werden. Bei den transgenen Pflanzen kann es sich prinzipiell um Pflanzen jeder beliebigen Pflanzenspezies handeln, d.h., sowohl monokotyle als auch dikotyle Pflanzen.
So sind transgene Pflanzen erhältlich, die veränderte Eigenschaften durch Überexpression, Suppression oder Inhibierung homologer (= natürlicher) Gene oder Gensequenzen oder Expression heterologer (= fremder) Gene oder Gensequenzen aufweisen.
Vorzugsweise können die erfindungsgemäßen Herbizid-Safener-Kombinationen in transgenen Kulturen eingesetzt werden, welche gegen Wuchsstoffe, wie z. B. Dicamba oder gegen Herbizide, die essentielle Pflanzenenzyme, z. B. Acetolactatsynthasen (ALS), EPSP Synthasen, Glutaminsynthasen (GS) oder
Hydroxyphenylpyruvat Dioxygenasen (HPPD) hemmen, respektive gegen Herbizide aus der Gruppe der Sulfonylharnstoffe, der Glyphosate, Glufosinate oder Benzoylisoxazole und analogen Wirkstoffe, resistent sind.
Bei der Anwendung der erfindungsgemäßen Herbizid-Safener-Kombinationen in transgenen Kulturen treten neben den in anderen Kulturen zu beobachtenden Wirkungen gegenüber Schadpflanzen oftmals Wirkungen auf, die für die Applikation in der jeweiligen transgenen Kultur spezifisch sind, beispielsweise ein verändertes oder speziell erweitertes Unkrautspektrum, das bekämpft werden kann, veränderte Aufwandmengen, die für die Applikation eingesetzt werden können, vorzugsweise gute Kombinierbarkeit mit den Herbiziden, gegenüber denen die transgene Kultur resistent ist, sowie Beeinflussung von Wuchs und Ertrag der transgenen Kulturpflanzen.
Gegenstand der Erfindung ist deshalb auch die Verwendung der erfindungsgemäßen Herbizid-Safener-Kombinationen zur Bekämpfung von Schadpflanzen in transgenen Kulturpflanzen.
Bevorzugt ist die Anwendung der erfindungsgemäßen Kombinationen in wirtschaftlich bedeutenden transgenen Kulturen von Nutz- und Zierpflanzen, z. B. von Getreide (z.B. Weizen, Gerste, Roggen, Hafer), Hirse, Reis, Maniok und Mais oder auch Kulturen von Zuckerrübe, Baumwolle, Soja, Raps, Kartoffel, Tomate, Erbse und anderen Gemüsekulturen.
Gegenstand der Erfindung ist deshalb auch die Verwendung der erfindungsgemäßen Herbizid-Safener-Kombinationen zur Bekämpfung von
Schadpflanzen in transgenen Kulturpflanzen oder Kulturpflanzen, die Toleranz durch Selektionszüchtung aufweisen.
Die Herbizide (A) und die Safener (B) können gemeinsam oder getrennt in übliche Formulierungen z.B. zur Sprüh-, Gieß-, Spritz- und Saatgutbeizanwendung übergeführt werden, wie Lösungen, Emulsionen, Suspensionen, Pulver, Schäume, Pasten, Granulate, Aerosole, Wirkstoff-imprägnierte Natur- und synthetische Stoffe, Feinstverkapselungen in polymeren Stoffen. Die Formulierungen können die üblichen Hilfs- und Zusatzstoffe enthalten.
Diese Formulierungen werden in bekannter Weise hergestellt, z.B. durch Vermischen der Wirkstoffe mit Streckmitteln, also flüssigen Lösungsmitteln, unter Druck stehenden verflüssigten Gasen und/oder festen Trägerstoffen, gegebenenfalls unter Verwendung von oberflächenaktiven Mitteln, also Emulgiermitteln und/oder Dispergiermitteln und/oder schaumerzeugenden Mitteln.
Im Falle der Benutzung von Wasser als Streckmittel könne z.B. auch organische Lösungsmittel als Hilfslösungsmittel verwendet werden. Als flüssige Lösungsmittel kommen im wesentlichen infrage: Aromaten, wie XyIoI, Toluol, Alkylnaphthaline, chlorierte Aromaten oder chlorierte aliphatische Kohlenwasserstoffe, wie
Chlorbenzole, Chlorethylene, oder Methylenchlorid, aliphatische Kohlenwasserstoffe, wie Cyclohexan oder Paraffine, z.B. Erdölfraktionen, mineralische und pflanzliche Öle, Alkohole, wie Butanol oder Glykol sowie deren Ether und Ester, Ketone, wie Aceton, Methylethylketon, Methylisobutylketon oder Cyclohexanon, stark polare Lösungsmittel, wie Dimethylformamid oder Dimethylsulfoxid, sowie Wasser.
Als feste Trägerstoffe kommen in Frage: z.B. Ammoniumsalze und natürliche Gesteinsmehle, wie Kaoline, Tonerden, Talkum, Kreide, Quarz, Attapulgit, Montmorillonit oder Diatomeenerde und synthetische Gesteinsmehle, wie hochdisperse Kieselsäure, Aluminiumoxid und Silikate; als feste Trägerstoffe für Granulate kommen infrage: z.B. gebrochene und fraktionierte natürliche Gesteine wie Calcit, Marmor, Bims, Sepiolith, Dolomit sowie synthetische Granulate aus
anorganischen und organischen Mehlen sowie Granulate aus organischem Material wie Sägemehl, Kokosnußschalen, Maiskolben und Tabakstengel; als Emulgier- und/oder schaumerzeugende Mittel kommen infrage: z.B. nicht ionogene und anionische Emulgatoren, wie Polyoxyethylen-Fettsäureester, Polyoxyethylen- Fettalkohol-Ether, z.B. Alkylarylpolyglykolether, Alkylsulfonate, Alkylsulfate,
Arylsulfonate sowie Eiweißhydrolysate; als Dispergiermittel kommen infrage: z.B. Ligninsulfitablaugen und Methylcellulose.
Es können in den Formulierungen Haftmittel wie Carboxymethylcellulose, natürliche und synthetische, pulverige, körnige oder latexförmige Polymere verwendet werden, wie Gummiarabicum, Polyvinylalkohol, Polyvinylacetat, sowie natürliche Phospholipide, wie Kephaline und Lecithine und synthetische Phospholipide. Weitere Additive können mineralische und vegetabile Öle sein.
Es können Farbstoffe wie anorganische Pigmente, z.B. Eisenoxid, Titanoxid, Ferrocyanblau und organische Farbstoffe, wie Alizarin-, Azo- und Metallphthalocyaninfarbstoffe und Spurennährstoffe wie Salze von Eisen, Mangan, Bor, Kupfer, Kobalt, Molybdän und Zink verwendet werden.
Die Formulierungen enthalten im Allgemeinen zwischen 0,1 und 95 Gew.-% Wirkstoff, vorzugsweise zwischen 0,5 und 90 Gew.-%.
Die Herbizide (A) und die Safener (B) können als solche oder in ihren Formulierungen auch in Mischung mit anderen agrochemischen Wirkstoffen, wie bekannten Herbiziden, zur Bekämpfung von unerwünschtem Pflanzenwuchs, z.B. zur Unkrautbekämpfung oder zur Bekämpfung von unerwünschten Kulturpflanzen Verwendung finden, wobei z.B. Fertigformulierungen oder Tankmischungen möglich sind.
Auch Mischungen mit anderen bekannten Wirkstoffen wie Fungiziden, Insektiziden, Akariziden, Nematiziden, Schutzstoffen gegen Vogelfraß, Pflanzennährstoffen und
Bodenstrukturverbesserungsmitteln sind möglich, ebenso mit im Pflanzenschutz üblichen Zusatzstoffen und Formulierungshilfsmitteln.
Die Herbizide (A) und die Safener (B) können als solche, in Form ihrer Formulierungen oder den daraus durch weiteres Verdünnen bereiteten
Anwendungsformen, wie gebrauchsfertige Lösungen, Suspensionen, Emulsionen, Pulver, Pasten und Granulate angewandt werden. Die Anwendung geschieht üblicherweise, z.B. durch Gießen, Spritzen, Sprühen, Streuen.
Die Wirkstoffe können auf die Pflanzen, Pflanzenteile, das Saatgut oder die
Anbaufläche (Ackerboden) ausgebracht werden, vorzugsweise auf das Saatgut oder die grünen Pflanzen und Pflanzenteile und gegebenenfalls zusätzlich auf den Ackerboden. Eine Möglichkeit der Anwendung ist die gemeinsame Ausbringung der Wirkstoffe in Form von Tankmischungen, wobei die optimal formulierten konzentrierten Formulierungen der Einzelwirkstoffe gemeinsam im Tank mit Wasser gemischt und die erhaltene Spritzbrühe ausgebracht wird.
Eine gemeinsame Formulierung der erfindungsgemäßen Kombination an Wirkstoffen (A) und (B) hat den Vorteil der leichteren Anwendbarkeit, weil die Mengen der Komponenten bereits im optimalen Verhältnis zueinander eingestellt werden können. Außerdem können die Hilfsmittel in der Formulierung aufeinander optimal abgestimmt werden.
Als Kombinationspartner für die erfindungsgemäße Herbizid-Safener-Kombination in Mischungsformulierungen oder im Tank-Mix sind beispielsweise bekannte, vorzugsweise herbizide Wirkstoffe, die auf einer Inhibition von beispielsweise Acetolactat-Synthase, Acetyl-Coenzym-A-Carboxylase, PS I1 PS II, HPPD, Phytoene-Desaturase, Protoporphyrinogen-Oxidase, Glutamine-Synthetase, Cellulosebiosynthese, 5-Enolpyruvylshikimat-3-phosphat-Synthetase beruhen, einsetzbar. Solche Verbindungen und auch andere einsetzbare Verbindungen mit teilweise unbekanntem oder anderem Wirkungsmechanismus sind z.B. in Weed Research 26, 441-445 (1986), oder in dem Handbuch "The Pesticide Manual", 12.
Auflage 2000, oder 13. Auflage 2003 oder 14. Auflage 2006/2007, oder in dem entsprechenden „e-Pesticide Manual", Version 4.1 (2007-08), jeweils herausgegeben vom British Crop Protection Council, (im Folgenden auch kurz "PM"), und dort zitierter Literatur beschrieben. Listen von „Common names" sind auch in „The Compendium of Pesticide Common Names" im Internet verfügbar. Als literaturbekannte Herbizide, die mit den erfindungsgemäßen Mischungen kombiniert werden können, sind z.B. folgende Wirkstoffe zu nennen (Anmerkung: Die Verbindungen sind entweder mit dem "common name" nach der International Organization for Standard ization (ISO) oder mit dem chemischen Namen, ggf. zusammen mit einer üblichen Codenummer bezeichnet und umfassen stets sämtliche Anwendungsformen wie Säuren, Salze, Ester und Isomere wie Stereoisomere und optische Isomere. Dabei sind eine und zum Teil auch mehrere Anwendungsformen genannt):
2,4-D, Acetochlor, Acifluorfen, Acifluorfen-sodium, Aclonifen, Alachlor, Alloxydim, Alloxydim-sodium, Ametryn, Amicarbazone, Amidosulfuron, Aminocyclopyrachlor, Aminopyralid, Amitrole, Anilofos, Asulam, Atrazine, Azafenidin, Azimsulfuron, Beflubutamid, Benazolin, Benazolin-ethyl, Benfuresate, Bensulfuron-methyl, Bentazone, Benzfendizone, Benzobicyclon, Benzofenap, Bicyclopyrone, Bifenox, Bilanafos, Bispyribac-natrium, Bromacil, Bromobutide, Bromofenoxim, Bromoxynil, Butachlor, Butafenacil, Butenachlor, Butralin, Butroxydim, Butylate, Cafenstrole, Carbetamide, Carfentrazone-ethyl, Chlomethoxyfen, Chloridazon, Chlorimuron-ethyl, Chlornitrofen, Chlorotoluron, Chlorsulfuron, Cinidon-ethyl, Cinmethylin, Cinosulfuron, Clefoxydim, Clethodim, Clodinafop-propargyl, Clomazone, Clomeprop, Clopyralid, Cloransulam-methyl, Cumyluron, Cyanazine, Cyclosulfamuron, Cycloxydim,
Cyhalofop-butyl, Desmedipham, Dicamba, Dichlobenil, Dichlorprop, Dichlorprop-P, Diclofop-methyl, Diclosulam, Difenzoquat, Diflufenican, Diflufenzopyr, Dikegulac- sodium, Dimefuron, Dimepiperate, Dimethachlor, Dimethametryn, Dimethenamid, Triaziflam, Diquat-dibromide, Dithiopyr, Diuron, Dymron, EPTC, Esprocarb, Ethalfluralin, Ethametsulfuron-methyl, Ethofumesate, Ethoxyfen, Ethoxysulfuron, Etobenzanid, Fenoxaprop-ethyl, Fenoxaprop-P-ethyl, Fenoxasulfone, Fentrazamide, Flamprop-M-isopropyl, Flamprop-M-methyl, Flazasulfuron, Florasulam, Fluazifop,
Fluazifop-butyl, Fluazifop-P-butyl, Fluazolate, Flucarbazone-sodium, Flucetosulfuron, Fluchloralin, Flufenacet, Flufenpyr, Flumetsulam, Flumiclorac-pentyl, Flumioxazin, Fluometuron, Fluorochloridone, Fluoroglycofen-ethyl, Flupoxam, Flupyrsulfuron- methyl-sodium, Fluridone, Fluroxypyr, Fluroxypyr-butoxypropyl, Fluroxypyr-meptyl, Flurprimidol, Flurtamone, Fluthiacet-methyl, Fomesafen, Foramsulfuron, Glufosinate, Glufosinate-P, Glufosinate-ammonium, Glufosinate-P-ammonium, Glufosinate-P- sodium, Glyphosate, Halosulfuron-methyl, Haloxyfop, Haloxyfop-ethoxyethyl, Haloxyfop-methyl, Haloxyfop-P-methyl, Hexazinone, Imazamethabenz-methyl, Imazamox, Imazapic, Imazapyr, Imazaquin, Imazethapyr, Imazosulfuron, Indanofan, Indaziflam, lodosulfuron-methyl-natrium, loxynil, Isoproturon, Isouron, Isoxaben, Isoxachlortole, Isoxaflutole, Ketospiradox, Lactofen, Lenacil, Linuron, MCPA, Mecoprop, Mecoprop-P, Mefenacet, Mesosulfuron-methyl, Mesotrione, Metamifop, Metamitron, Metazachlor, Metazosulfuron, Methabenzthiazuron, Methiozolin, Methyldymron, Metobromuron, Metolachlor, Metosulam, Metoxuron, Metribuzin, Metsulfuron-methyl, Molinate, Monolinuron, Naproanilide, Napropamide, Neburon, Nicosulfuron, Norflurazon, Orbencarb, Oryzalin, Oxadiargyl, Oxadiazon, Oxasulfuron, Oxaziclomefone, Oxyfluorfen, Paraquat, Pelargonie acid, Pendimethalin, Pendralin, Penoxsulam, Pentoxazone, Pethoxamid, Phenmedipham, Picloram, Picolinafen, Pinoxaden, Piperophos, Pretilachlor, Primisulfuron-methyl, Profluazol, Profoxydim, Prometryn, Propachlor, Propanil, Propaquizafop, Propisochlor, Propoxycarbazone-sodium, Propyrisulfuron, Propyzamide, Prosulfocarb, Prosulfuron, Pyraclonil, Pyraflufen-ethyl, Pyrazolate, Pyrazosulfuron- ethyl, Pyrazoxyfen, Pyribenzoxim, Pyributicarb, Pyridafol, Pyridate, Pyriftalid, Pyriminobac-methyl, Pyrithiobac-sodium, Quinclorac, Quinmerac, Quinoclamine, Quizalofop-ethyl, Quizalofop-P-ethyl, Quizalofop-P-tefuryl, Rimsulfuron, Saflufenacil, Sethoxydim, Simazine, Simetryn, S-Metolachlor, Sulcotrione, Sulfentrazone, Sulfometuron-methyl, Sulfosate, Sulfosulfuron, Tebuthiuron, Tepraloxydim, Terbuthylazine, Terbutryn, Thenylchlor, Thiazopyr, Thifensulfuron-methyl, Thiobencarb, Tiocarbazil, Tralkoxydim, Triallate, Triasulfuron, Tribenuron-methyl, Triclopyr, Tridiphane, Trifloxysulfuron, Trifluralin, Triflusulfuron-methyl und Tritosulfuron.
Weitere mögliche Mischungspartner sind
Pyroxasulfone, Pyroxsulam, Orthosulfamuron, Pyrimisulfan, Prohexadione-Calcium, Bencarbazone, SYN-523, IDH-100, SYP-249, Monosulfuron, Ipfencarbazone (HOK- 201), Pyribambenz-Isopropyl, Tefuryltrione, Bencarbazone, Tembotrione, Pyrasulfotole, Thiencarbazone-Methyl, Methyl-4-amino-3-chlor-6-(4-chlor-2-fluor-3- methoxyphenyl)pyridin-2-carboxylat und 4-Amino-3-chlor-6-(4-chlor-2-fluor-3- methoxyphenyl)pyridin-2-carbonsäure.
Zur Anwendung werden die in handelsüblicher Form vorliegenden Formulierungen gegebenenfalls in üblicher weise verdünnt, z.B. bei Spritzpulvern, emulgierbaren Konzentraten, Dispersionen und wasserdispergierbaren Granulaten mittels Wasser. Staubförmige Zubereitungen, Boden- bzw. Streugranulate sowie versprühbare Lösungen werden vor der Anwendung üblicherweise nicht mehr mit weiteren inerten Stoffen verdünnt.
Biologische Beispiele:
Herbizidwirkung und Safenerwirkung im Nachauflauf
Samen bzw. Rhizomstücke von mono- und dikotylen Schadpflanzen und von Kulturpflanzen werden in Torftöpfen in sandiger Lehmerde ausgelegt, mit Erde abgedeckt und im Gewächshaus unter guten Wachstumsbedingungen angezogen. Alternativ hierzu werden im Paddy-Reisanbau vorkommende Schadpflanzen in Töpfen kultiviert, in denen Wasser bis zu 2 cm über der Bodenoberfläche steht. Zehn bis zwanzig Tage nach der Aussaat werden die Versuchspflanzen im ein bis Dreiblattstadium behandelt. Die als wasserlösliche Pulver oder Suspensionen formulierten erfindungsgemäßen Herbizid-Safener-Wirkstoffkombinationen sowie in parallelen Versuchen die entsprechend formulierten Einzelwirkstoffe werden in verschiedenen Dosierungen mit einer Wasseraufwandmenge von umgerechnet 300 l/ha auf die grünen Pflanzenteile gesprüht und nach 2-3 Wochen Standzeit der Versuchspflanzen im Gewächshaus unter optimalen Wachstumsbedingungen die Wirkung der Präparate optisch im Vergleich zu unbehandelten Kontrollen bonitiert.
Bei Reis oder bei Schadpflanzen, die im Reisanbau vorkommen, werden die Wirkstoffe auch direkt ins Bewässerungswasser gegeben (Applikation in Analogie zur sogenannten Granulatanwendung) oder auf Pflanzen und ins Bewässerungswasser gesprüht.
Herbizidwirkung und Safenerwirkung im Vorauflauf
Samen bzw. Rhizomstücke von mono- und dikotylen Unkrautpflanzen und Kulturpflanzen wurden in Torftöpfen in sandiger Lehmerde ausgelegt und mit Erde abgedeckt. Die als wasserlösliche Pulver oder Suspensionen formulierten erfindungsgemäßen Herbizid-Safener-Wirkstoffkombinationen sowie in parallelen
Versuchen die entsprechend formulierten Einzelwirkstoffe wurden dann in verschiedenen Dosierungen mit einer Wasseraufwandmenge von umgerechnet 600 bis 800 l/ha auf die Oberfläche der Abdeckerde appliziert.
Weizen (Triso)
Ol
Gerste (Adonis)
CJl
Reis (Ballila)
Mais (Aventura)
OO
Claims
1. Zusammensetzung, enthaltend
(A) eine oder mehrere Verbindungen der Formel (I), deren N-Oxide oder deren Salze,
in welchen
R1 für Wasserstoff, Fluor oder Chlor steht;
R für Wasserstoff, d-C4-Alkyl optional substituiert mit ein bis zwei
Resten R7, C2-C4-Alkenyl optional substituiert mit ein bis zwei Resten R8, C2-C4-Alkinyl optional substituiert mit ein bis zwei Resten R9, C(=O)R10, Nitro, OR11, SO2R12, NR13R14 oder N=CR15R16 steht;
R3 für Wasserstoff, Ci-C4-Alkyl optional substituiert mit ein bis zwei
Resten R >117' oder C(=O)R 110U steht; oder
R2 und R3 zusammen für -(CH2)4-, -(CH2)5-, -CH2CH=CHCH2- oder -
(CH2)2O(CH2)2-, wobei jeder dieser vier letztgenannten Reste optional mit ein bis zwei Resten R18 substituiert ist, stehen; oder stehen;
R4 für Halogen steht; R5 für COOH oder ein herbizid-aktives Derivat von COOH steht;
R6 unabhängig voneinander für Halogen, CrC6-Alkyl, Ci-C6-Haloalkyl, C2- Cβ-Alkenyl, C2-C6-Haloalkenyl, Ci-C3-Alkoxy, C1-C2-HaIOaIkOXy, Ci-C3- Alkylthio oder Ci-C2-Haloalkylthio steht;
R7, R8 und R9 jeweils unabhängig voneinander für Halogen, Ci-C3-
Alkoxy, Ci-C3-Haloalkoxy, Ci-C3-Alkylthio, CrC3-Haloalkylthio, Arnino, Ci-C3-Alkylamino, C2-C4-Dialkylamino oder C2-C4- Alkoxycarbonyl stehen;
R10 unabhängig voneinander für Wasserstoff, CrCu-Alkyl, Ci-C3-Haloalkyl, Ci-C4-Alkoxy, Phenyl, Phenoxy oder Benzyloxy steht;
R11 für Wasserstoff, C1-C4-AIk^, CrC3-Haloalkyl oder CHR24C(O)OR25 steht;
R12 für Ci-C4-Alkyl oder Ci-C3-Haloalkyl steht;
R13 für Wasserstoff, Ci-C4-Alkyl oder C(=O)R26 steht;
R14 für Wasserstoff oder CrC4-Alkyl steht;
R15 für Wasserstoff, C-ι-C4-Alkyl oder Phenyl optional substituiert mit ein bis drei Resten R27 steht;
R16 für Wasserstoff oder C1-C4-Alkyl steht; oder
R15 und R16 zusammen für -(CH2)4- oder -(CH2)5- stehen;
R17 unabhängig voneinander für Halogen, C1-C3-AIkOXy, CrC3-Haloalkoxy, CrCrAlkylthio, d-CrHaloalkylthio, Amino, Ci-C3-Alkylamino, C2-C4- Dialkylamino oder C2-C4-Alkoxycarbonyl stehen;
R18 unabhängig voneinander für Halogen, CrC3-Alkyl, Ci-C3-Alkoxy, C1-
C3-Haloalkoxy, CrC3-Alkylthio, CrC3-Haloalkylthio, Amino, C1-C3- Alkylamino, C2-C4-Dialkylamino oder C2-C4-Alkoxycarbonyl stehen;
R19 für Wasserstoff oder C1-C4-A^yI steht;
R20 und R21 unabhängig voneinander für Wasserstoff oder CrCt-Alkyl stehen; oder
R20 und R21 zusammen für -(CH2)4-, -(CH2)5-, -CH2CH=CHCH2- oder - (CH2)2O(CH2)2- stehen;
R22 für Wasserstoff oder C1-C4-A^yI steht;
R >2"3 für C1-C4-AKyI steht;
R24 für Wasserstoff, C1-C4-AKyI oder C1-C4-AIkOXy steht;
R25 für Wasserstoff, C1-C4-A^yI oder Benzyl steht;
R26 für Wasserstoff, Ci-Ci4-Alkyl, Ci-C3-Haloalkyl, C1-C4-AIkOXy, Phenyl, Phenoxy oder Benzyloxy steht;
R27 unabhängig voneinander für Methyl, Chlor oder Methoxy steht;
p für 0, 1 , 2, 3, 4 oder 5 steht;
und
(B) einen oder mehrere Safener, ausgewählt aus der Gruppe, bestehend aus S1) Verbindungen aus der Gruppe heterocyclischer Carbonsäurederivate, welche besteht aus: S1a) Verbindungen vom Typ der
Dichlorphenylpyrazolin-3-carbonsäure (S1a),
S1b) Derivate der Dichlorphenylpyrazolcarbonsäure (S1b),
S1C) Derivate der 1 ,5-Diphenylpyrazol-3-carbonsäure (S1C),
S1d) Verbindungen vom Typ der Thazolcarbonsäuren (S1d),
S1e) Verbindungen vom Typ der 5-Benzyl- oder
5-Phenyl-2-isoxazolin-3- carbonsäure, oder der 5,5-Diphenyl-2- isoxazolin-3-carbonsäure(S1e),
S4) Verbindungen aus der Klasse der Acylsulfonamide (S4), welche besteht aus: S4a) N-Acylsulfonamide der Formel (S4a) und deren Salze
worin
RA1 (C1-C6)AIKyI, (C3-C6)Cycloalkyl, wobei die 2 letztgenannten Reste durch vA Substituenten aus der Gruppe Halogen, (Cr C4)AIkOXy, (Ci-C6)Haloalkoxy und (CrC4)Alkylthio und im Falle cyclischer Reste auch durch (CrC4)Alkyl und (C-ι-C4)Haloalkyl substituiert sind;
RA 2 Halogen, (d-C4)Alkyl, (Ci-C4)Alkoxy, CF3; rnA 1 oder 2; vA ist 0, 1 , 2 oder 3 bedeuten; S4b) Verbindungen vom Typ der 4-(Benzoylsulfamoyl)benzamide der Formel (S4b) und deren Salze,
worin RB1, RB2 unabhängig voneinander Wasserstoff, (CrCβJAlkyl,
(C3-C6)Cycloalkyl, (C3-C6)Alkenyl, (C3-C6)Alkinyl, RB 3 Halogen, (CrC^Alkyl, (d-C4)Haloalkyl oder (CrC4)Alkoxy und mB 1 oder 2 bedeuten,
S4C) Verbindungen aus der Klasse der
Benzoylsulfamoylphenylharnstoffe der Formel (S4C),
worin
Rc1, Rc2 unabhängig voneinander Wasserstoff, (Ci-C8)-Alkyl, (C3-C8)-Cycloalkyl, (C3-C6)-Alkenyl, (C3-C6)-Alkinyl,
R0 3 Halogen, (Ci-C4)Alkyl, (C 1 -C4)AI koxy, CF3 mc 1 oder 2 bedeuten;
S2) Verbindungen aus der Gruppe der 8-Chinolinyloxyderivate (S2), welche besteht aus: S2a) Verbindungen vom Typ der 8-Chinolinoxyessigsäure (S2a),
S2b) Verbindungen vom Typ der (5-Chlor-8-chinolinoxy)malonsäure (S2b), S3) Wirkstoffe vom Typ der Dichloracetamide (S3),
55) Wirkstoffe aus der Klasse der Hydroxyaromaten und der aromatisch- aliphatischen Carbonsäurederivate (S5),
56) Wirkstoffe aus der Klasse der 1 ,
2-Dihydrochinoxalin-2-one (S6),
57) Verbindungen aus der Klasse der Diphenylmethoxyessigsäurederivate (S7),
58) Verbindungen der Formel (S8),
worin die Symbole und Indizes folgende Bedeutungen haben:
R0 1 ist Halogen, (d-C4)Alkyl, (Ci-C4)Haloalkyl, (CrC4)Alkoxy, (C1- C4)Haloalkoxy,
RD2 ist Wasserstoff oder (Ci-C4)Alkyl
RD3 ist Wasserstoff, (CrC8)Alkyl, (C2-C4)Alkenyl, (C2-C4)Alkinyl, oder Aryl, wobei jeder der vorgenannten C-haltigen Reste unsubstituiert oder durch einen oder mehrere gleiche oder verschiedene Reste aus der Gruppe, bestehend aus Halogen und Alkoxy substituiert ist; oder deren Salze nD ist eine ganze Zahl von 0 bis 2.
S9) Wirkstoffe aus der Klasse der 3-(5-Tetrazolylcarbonyl)-2-chinolone (S9),
S10) Verbindungen der Formeln (S10a) oder (S10b)
(S10a) (S10b) worin
RE1 Halogen, (C1-C4)AIKyI, Methoxy, Nitro, Cyano, CF3, OCF3
YE, ZE unabhängig voneinander O oder S, nE eine ganze Zahl von 0 bis 4,
RE 2 (Ci-C16)Alkyl, (C2-C6)Alkenyl, (C3-C6)Cycloalkyl, Aryl; Benzyl,
Halogenbenzyl, RE3 Wasserstoff oder (C1-C6)AIKyI bedeuten.
S11) Wirkstoffe vom Typ der Oxyimino-Verbindungen (S11), die als Saatbeizmittel bekannt sind,
S12) Wirkstoffe aus der Klasse der Isothiochromanone (S12),
S13) Eine oder mehrere Verbindungen aus Gruppe (S13):
"Naphthalic anhydrid" (1 ,8-Naphthalindicarbonsäureanhydrid) (S13-1), "Fenclorim" (4,6-Dichlor-2-phenylpyrimidin) (S13-2), "Flurazole" (Benzyl-2-chlor-4-trifluormethyl-1 ,3-thiazol-5-carboxylat) (S13-3), "CL 304415" (CAS-Reg.Nr. 31541-57-8)
(4-Carboxy-3,4-dihydro-2H-1 -benzopyran-4-essigsäure) (S13-4), "MG 191" (CAS-Reg.Nr. 96420-72-3) (2-Dichlormethyl-2-methyl-1 ,3- dioxolan) (S13-5),
"MG-838" (CAS-Reg.Nr. 133993-74-5)
(2-propenyl 1-oxa-4-azaspiro[4.5]decane-4-carbodithioate) (S13-6) , "Disulfoton" (O,O-Diethyl S-2-ethylthioethyl phosphordithioat) (S13-7), "Dietholate" (O.O-Diethyl-O-phenylphosphorotioat) (S13-8), "Mephenate" (4-Chlorphenyl-methylcarbamat) (S13-9). S14) Wirkstoffe, die neben einer herbiziden Wirkung gegen Schadpflanzen auch Safenerwirkung an Kulturpflanzen wie Reis aufweisen, wie z. B. "Dimepiperate" oder "MY-93" (S-1-Methyl-1-phenylethyl-piperidin-1- carbothioat),
"Daimuron" oder 11SK 23" (1-(1-Methyl-1-phenylethyl)-3-p-tolyl- harnstoff), (S14-1),
"Cumyluron" = "JC-940" (3-(2-Chlorphenylmethyl)-1-(1-methyl-1- phenyl-ethyl)harnstoff, "Methoxyphenon" oder "NK 049" (S.S'-DimethyM-methoxy- benzophenon),
"CSB" (1-Brom-4-(chlormethylsulfonyl)benzol) (CAS-Reg.Nr. 54091- 06-4).
Zusammensetzung nach Anspruch 1 , dadurch gekennzeichnet, dass in der Verbindung der allgemeinen Formel (I)
R5 gleich CO2R29, CH2OR30, CH(OR31)(OR32), CHO, C(=NOR33)H,
C(=NNR34R35)H, C(=O)N(R36)R37, C(=S)OR38, C(=O)SR39, C(=S)SR40 oder
C(=NR41)YR42 ist;
R29 gleich Wasserstoff, -CH[C(O)O(CH2)m], -N=C(R43)R44 oder ein Rest, welcher ausgewählt ist aus der Gruppe, bestehend aus C-ι-Ci4-Alkyl, C3-Ci2-Cycloalkyl, C4-Ci2-Alkylcycloalkyl, C4-Ci2-Cycloalkylalkyl, C2-
Ci4-Alkenyl, C2-Ci4-Alkynyl und Phenyl, wobei jeder Rest gegebenenfalls mit 1 bis 3 Resten R45 substituiert sein kann; ist oder
R29 einen zweiwertigen Rest darstellt, welcher die Carboxylester-Funktion CO2R29 von zwei Pyridinringsysteme der allgemeinen Formel (I) verbindet, und der zweiwertige Rest ausgewählt ist aus der Gruppe, bestehend aus -CH2-, -(CH2)2-, -(CH2)3- und -CH(CH3)CH2-;
R30 gleich Wasserstoff; C-i-Cio-Alkyl, welches gegebenenfalls mit 1 bis 3
Resten R46 substituiert sein kann; oder Benzyl ist;
R31 und R32 unabhängig voneinander CrC4-Alkyl oder C1-C3-HaIOaIkYl sind; oder
R31 und R32 zusammen als -CH2CH2-, -CH2CH(CH3)- oder -(CH2)3- darstellen;
R33 gleich Wasserstoff, d-C4-Alkyl, Ci-C4-Haloalkyl oder Benzyl ist;
R34 gleich Wasserstoff, Ci-C4-Alkyl, Ci-C4-Haloalkyl, C2-C4-Alkylcarbonyl, C2-C4_Alkoxycarbonyl oder Benzyl ist;
R35 gleich Wasserstoff, Ci-C4-Alkyl oder Ci-C4-Haloalkyl ist;
R36 gleich Wasserstoff, C1-C4-AIkYl, Hydroxy, C1-C4-AIkOXy oder S(O)2R47 ist;
R37 gleich Wasserstoff oder C1-C4 Alkyl ist;
R38, R39 und R40 gleich Wasserstoff oder ein Rest sind, welcher ausgewählt ist aus der Gruppe, bestehend aus C1-C14-
Alkyl, C3-C12-Cycloalkyl, C4-C12-Alkylcycloalkyl, C4-C12- Cycloalkylalkyl, C2-C14-Alkenyl und C2-C14-Alkinyl, wobei jeder Rest gegebenenfalls mit 1 bis 3 Resten R45 substituiert sein kann;
Y gleich O, S oder NR48 ist; R41 gleich Wasserstoff, CrC3-Alkyl, Ci-C3-Haloalkyl, C2-C4-Alkoxyalkyl, OH oder Ci-C3-AIkOXy ist;
gleich Ci-C3-Alkyl, Ci-C3-Haloalkyl oder C2-C4-Alkoxyalkyl ist; oder
R41 und R42 zusammen -(CH2J2-, -CH2CH(CH3)- oder -(CH2J3- bilden;
R43and R44 unabhängig voneinander ausgewählt werden aus der Gruppe, bestehend aus Ci-C4-Alkyl;
jedes R 45 unabhängig voneinander ausgewählt wird aus der Gruppe, bestehend aus Halogen, Cyano, Hydroxycarbonyl, C2-C4- Alkoxycarbonyl, Hydroxy, CrC4-Alkoxy, Ci-C4-Haloalkoxy, C1- C4-Alkylthio, CrC4-Haloalkylthio, Amino, Ci-C4-Alkylamino, C2- C4-Dialkylamino, -CH[-O(CH2)n-] und Phenyl, welches gegebenenfalls mit 1 bis 3 Resten R49 substituiert sein kann; oder zwei R45 zusammen -OC(O)O- bilden oder -O(C(R50)(R50))i-2O-; oder
zwei R45 ein Sauerstoffatom bilden, um mit dem Kohlenstoffatom, an welches sie gebunden sind, einen Carbonylrest bilden;
jedes R46 unabhängig voneinander ausgewählt wird aus der Gruppe, bestehend aus Halogen, CrC4-Alkoxy, Ci-C4-Haloalkoxy, Cr C4-Alkylthio, CrC4-Haloalkylthio, Amino, C^C^AIkylamino und C2-C4-Dialkylamino; oder
zwei R46 ein Sauerstoffatom bilden, um mit dem Kohlenstoffatom, an welches sie gebunden sind, einen Carbonylrest bilden;
R ,447' gleich d-C4-Alkyl, Ci-C3-Haloalkyl oder NR 5011RD5"2 ist; R48 gleich Wasserstoff, d-C3-Alkyl, C1-C3-HaIOaIKyI oder C2-C4 Alkoxyalkyl ist;
jedes R49 unabhängig voneinander ausgewählt wird aus der Gruppe, bestehend aus Halogen, d-C4-Alkyl, Ci-C3-Haloalkyl, Hydroxy,
Ci-C4-Alkoxy, CrC3-Haloalkoxy, Ci-C3-Alkylthio, Ci-C3- Haloalkylthio, Amino, Ci-C3-Alkylamino, C2-C4-Dialkylamino und Nitro; jedes R50 unabhängig voneinander ausgewählt wird aus der Gruppe, bestehend aus Wasserstoff und CrC4-Alkyl;
R51 und R52 unabhängig voneinander Wasserstoff oder Ci-C4 Alkyl sind;
m eine ganze Zahl von 2 bis 3 ist; und
n eine ganze Zahl von 1 bis 4 ist;
3. Zusammensetzung nach Anspruch 1 oder 2, dadurch gekennzeichnet, dass in der Verbindung der allgemeinen Formel (I) p gleich 0 ist;
4. Zusammensetzung nach einem der Ansprüche 1 bis 3, dadurch gekennzeichnet, dass in der Verbindung der allgemeinen Formel (I) R5 gleich CO2R29, CH2OR30 oder CHO ist;
5. Zusammensetzung nach einem der Ansprüche 1 bis 4, dadurch gekennzeichnet, dass in der Verbindung der allgemeinen Formel (I) R2 gleich Wasserstoff, CH3 oder C(O)R10 ist;
R3 gleich Wasserstoff oder CH3 ist; oder R2 und R3 zusammen =C(R19)N(R20)R21 bilden; und
R10, R19, R20 und R21 jeweils unabhängig voneinander Wasserstoff oder
CH3 sind;
6. Zusammensetzung nach einem der Ansprüche 1 bis 5, dadurch gekennzeichnet, dass in der Verbindung der allgemeinen Formel (I) R5 gleich CO2R29 ist; und R2 und R3 gleich Wasserstoff sind;
7. Zusammensetzung nach einem der Ansprüche 1 bis 6, dadurch gekennzeichnet, dass in der Verbindung der allgemeinen Formel (I) R29 gleich Wasserstoff, Ci-C4-Alkyl oder Benzyl ist.
8. Zusammensetzung nach einem der Ansprüche 1 bis 7, dadurch gekennzeichnet, dass der Safener ausgewählt ist aus der Gruppe, bestehend aus Mefenpyr-diethyl (S1-1 ), Isoxadifen-ethyl (S1-11), Cyprosulfamide (S4-1 ), Fenchlorazol-ethylester (S1-7), Benoxacor (S3-4), Cloquintocet-mexyl (S2-1 ), Fluxofenim (S1 1-2) und Furilazol [(S3-10) bzw. (S3-1 1)].
9. Zusammensetzung nach Anspruch 1 , enthaltend als Komponente (A) eine Verbindung der Formel (I) ausgewählt aus Methyl-4-amino-3,5-dichlor-6- cyclopropyl-2-pyridincarboxylat, 4-Amino-3,5-dichlor-6-cyclopropyl-2- pyridincarbonsäure, Methyl 4-amino-3-chlor-6-cyclopropyl-2-pyridincarboxylat,
4-Amino-3-chlor-6-cyclopropyl-2-pyridincarbonsäure, Methyl-4-amino-3-chlor- δ-cyclopropyl-δ-fluor^-pyridincarboxylat und 4-Amino-3-chlor-6-cyclopropyl-5- fluor-2-pyridincarbonsäure und als Komponente (B) einen Safener ausgewählt aus Mefenpyr-diethyl, Isoxadifen-ethyl, Cyprosulfamide, Fenchlorazol- ethylester, Benoxacor, Cloquintocet-mexyl, Fluxofenim und Furilazol.
10. Verfahren zur Bekämpfung von unerwünschten Pflanzen, worin die Verbindung der allgemeinen Formel (I) und mindestens eine Verbindung aus der Gruppe (B) gemäß einem der Ansprüche 1 bis 9, gemeinsam oder getrennt appliziert werden.
11. Verfahren gemäß Anspruch 10 zur Bekämpfung von unerwünschten Pflanzen in Pflanzenkulturen aus der Gruppe der Ackerbaukulturen, Gemüsekulturen oder Dauer- und Plantagenkulturen.
12. Verfahren gemäß Anspruch 11 , dadurch gekennzeichnet, dass die
Pflanzenkulturen transgen sind oder Toleranz durch Selektionszüchtung aufweisen.
13. Verwendung einer Zusammensetzung gemäß einem der Ansprüche 1 bis 9 zur Bekämpfung von Schadpflanzen.
Priority Applications (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
EP09756682A EP2369927A2 (de) | 2008-11-29 | 2009-11-21 | Herbizid-safener-kombination |
Applications Claiming Priority (3)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
EP08020781A EP2210492A1 (de) | 2008-11-29 | 2008-11-29 | Herbizid-Safener-Kombination |
EP09756682A EP2369927A2 (de) | 2008-11-29 | 2009-11-21 | Herbizid-safener-kombination |
PCT/EP2009/008302 WO2010060579A2 (de) | 2008-11-29 | 2009-11-21 | Herbizid-safener-kombination |
Publications (1)
Publication Number | Publication Date |
---|---|
EP2369927A2 true EP2369927A2 (de) | 2011-10-05 |
Family
ID=40793079
Family Applications (2)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
EP08020781A Withdrawn EP2210492A1 (de) | 2008-11-29 | 2008-11-29 | Herbizid-Safener-Kombination |
EP09756682A Withdrawn EP2369927A2 (de) | 2008-11-29 | 2009-11-21 | Herbizid-safener-kombination |
Family Applications Before (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
EP08020781A Withdrawn EP2210492A1 (de) | 2008-11-29 | 2008-11-29 | Herbizid-Safener-Kombination |
Country Status (7)
Country | Link |
---|---|
US (1) | US20100137136A1 (de) |
EP (2) | EP2210492A1 (de) |
JP (1) | JP2012510435A (de) |
CN (1) | CN102223795A (de) |
AR (1) | AR075482A1 (de) |
BR (1) | BRPI0922081A2 (de) |
WO (1) | WO2010060579A2 (de) |
Families Citing this family (6)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
GB2486717A (en) * | 2010-12-22 | 2012-06-27 | Syngenta Ltd | Substituted 4-aminopicolinate herbicides with safeners |
PL2964027T3 (pl) * | 2013-03-05 | 2019-10-31 | Bayer Cropscience Ag | Zastosowanie kombinacji zawierających klokwintocet meksylowy do poprawy wydajności roślin |
CN103814895B (zh) * | 2014-03-20 | 2016-03-30 | 黑龙江省农业科学院植物保护研究所 | 一种减低除草剂残留药害的拌种剂及其制备方法 |
TWI685302B (zh) * | 2014-09-15 | 2020-02-21 | 美商陶氏農業科學公司 | 包含吡啶羧酸除草劑之安全的除草組成物 |
TWI694770B (zh) | 2014-09-15 | 2020-06-01 | 美商陶氏農業科學公司 | 包含吡啶羧酸除草劑之安全的除草組成物(二) |
CN115298287B (zh) * | 2020-04-21 | 2024-05-14 | 组合化学工业株式会社 | 甲烷生成抑制剂组合物及抑制甲烷生成的方法 |
Family Cites Families (47)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
MA19709A1 (fr) | 1982-02-17 | 1983-10-01 | Ciba Geigy Ag | Application de derives de quinoleine a la protection des plantes cultivees . |
DE3382743D1 (de) | 1982-05-07 | 1994-05-11 | Ciba Geigy | Verwendung von Chinolinderivaten zum Schützen von Kulturpflanzen. |
WO1984002919A1 (en) | 1983-01-17 | 1984-08-02 | Monsanto Co | Plasmids for transforming plant cells |
BR8404834A (pt) | 1983-09-26 | 1985-08-13 | Agrigenetics Res Ass | Metodo para modificar geneticamente uma celula vegetal |
JPS6087254A (ja) | 1983-10-19 | 1985-05-16 | Japan Carlit Co Ltd:The | 新規尿素化合物及びそれを含有する除草剤 |
DE3525205A1 (de) | 1984-09-11 | 1986-03-20 | Hoechst Ag, 6230 Frankfurt | Pflanzenschuetzende mittel auf basis von 1,2,4-triazolderivaten sowie neue derivate des 1,2,4-triazols |
BR8600161A (pt) | 1985-01-18 | 1986-09-23 | Plant Genetic Systems Nv | Gene quimerico,vetores de plasmidio hibrido,intermediario,processo para controlar insetos em agricultura ou horticultura,composicao inseticida,processo para transformar celulas de plantas para expressar uma toxina de polipeptideo produzida por bacillus thuringiensis,planta,semente de planta,cultura de celulas e plasmidio |
EP0191736B1 (de) | 1985-02-14 | 1991-07-17 | Ciba-Geigy Ag | Verwendung von Chinolinderivaten zum Schützen von Kulturpflanzen |
ATE80182T1 (de) | 1985-10-25 | 1992-09-15 | Monsanto Co | Pflanzenvektoren. |
ES2018274T5 (es) | 1986-03-11 | 1996-12-16 | Plant Genetic Systems Nv | Celulas vegetales resistentes a los inhibidores de glutamina sintetasa, preparadas por ingenieria genetica. |
IL83348A (en) | 1986-08-26 | 1995-12-08 | Du Pont | Nucleic acid fragment encoding herbicide resistant plant acetolactate synthase |
US5013659A (en) | 1987-07-27 | 1991-05-07 | E. I. Du Pont De Nemours And Company | Nucleic acid fragment encoding herbicide resistant plant acetolactate synthase |
DE3633840A1 (de) | 1986-10-04 | 1988-04-14 | Hoechst Ag | Phenylpyrazolcarbonsaeurederivate, ihre herstellung und verwendung als pflanzenwachstumsregulatoren und safener |
DE3775527D1 (de) | 1986-10-22 | 1992-02-06 | Ciba Geigy Ag | 1,5-diphenylpyrazol-3-carbonsaeurederivate zum schuetzen von kulturpflanzen. |
DE3733017A1 (de) | 1987-09-30 | 1989-04-13 | Bayer Ag | Stilbensynthase-gen |
DE3808896A1 (de) | 1988-03-17 | 1989-09-28 | Hoechst Ag | Pflanzenschuetzende mittel auf basis von pyrazolcarbonsaeurederivaten |
DE3817192A1 (de) | 1988-05-20 | 1989-11-30 | Hoechst Ag | 1,2,4-triazolderivate enthaltende pflanzenschuetzende mittel sowie neue derivate des 1,2,4-triazols |
EP0365484B1 (de) | 1988-10-20 | 1993-01-07 | Ciba-Geigy Ag | Sulfamoylphenylharnstoffe |
DE3939010A1 (de) | 1989-11-25 | 1991-05-29 | Hoechst Ag | Isoxazoline, verfahren zu ihrer herstellung und ihre verwendung als pflanzenschuetzende mittel |
DE3939503A1 (de) | 1989-11-30 | 1991-06-06 | Hoechst Ag | Neue pyrazoline zum schutz von kulturpflanzen gegenueber herbiziden |
ATE241007T1 (de) | 1990-03-16 | 2003-06-15 | Calgene Llc | Dnas, die für pflanzliche desaturasen kodieren und deren anwendungen |
EP0536293B1 (de) | 1990-06-18 | 2002-01-30 | Monsanto Technology LLC | Erhöhter stärkegehalt in pflanzen |
AU655197B2 (en) | 1990-06-25 | 1994-12-08 | Monsanto Technology Llc | Glyphosate tolerant plants |
DE4107396A1 (de) | 1990-06-29 | 1992-01-02 | Bayer Ag | Stilbensynthase-gene aus weinrebe |
SE467358B (sv) | 1990-12-21 | 1992-07-06 | Amylogene Hb | Genteknisk foeraendring av potatis foer bildning av staerkelse av amylopektintyp |
EP0492366B1 (de) | 1990-12-21 | 1997-03-26 | Hoechst Schering AgrEvo GmbH | Neue 5-Chlorchinolin-8-oxyalkancarbonsäurederivate, Verfahren zu ihrer Herstellung und ihre Verwendung als Antidots von Herbiziden |
DE4104782B4 (de) | 1991-02-13 | 2006-05-11 | Bayer Cropscience Gmbh | Neue Plasmide, enthaltend DNA-Sequenzen, die Veränderungen der Karbohydratkonzentration und Karbohydratzusammensetzung in Pflanzen hervorrufen, sowie Pflanzen und Pflanzenzellen enthaltend dieses Plasmide |
TW259690B (de) | 1992-08-01 | 1995-10-11 | Hoechst Ag | |
DE4331448A1 (de) | 1993-09-16 | 1995-03-23 | Hoechst Schering Agrevo Gmbh | Substituierte Isoxazoline, Verfahren zu deren Herstellung, diese enthaltende Mittel und deren Verwendung als Safener |
DE19621522A1 (de) | 1996-05-29 | 1997-12-04 | Hoechst Schering Agrevo Gmbh | Neue N-Acylsulfonamide, neue Mischungen aus Herbiziden und Antidots und deren Verwendung |
AR009811A1 (es) | 1996-09-26 | 2000-05-03 | Novartis Ag | Compuestos herbicidas, proceso para su produccion, proceso para la produccion de intermediarios, compuestos intermediarios para su exclusivo usoen dicho proceso, composicion que tiene actividad herbicida selectiva y proceso para el control selectivo de malas hierbas y gramineas en cultivos de planta |
DE19652961A1 (de) | 1996-12-19 | 1998-06-25 | Hoechst Schering Agrevo Gmbh | Neue 2-Fluoracrylsäurederivate, neue Mischungen aus Herbiziden und Antidots und deren Verwendung |
US6071856A (en) | 1997-03-04 | 2000-06-06 | Zeneca Limited | Herbicidal compositions for acetochlor in rice |
DE19727410A1 (de) | 1997-06-27 | 1999-01-07 | Hoechst Schering Agrevo Gmbh | 3-(5-Tetrazolylcarbonyl)-2-chinolone und diese enthaltende nutzpflanzenschützende Mittel |
DE19742951A1 (de) * | 1997-09-29 | 1999-04-15 | Hoechst Schering Agrevo Gmbh | Acylsulfamoylbenzoesäureamide, diese enthaltende nutzpflanzenschützende Mittel und Verfahren zu ihrer Herstellung |
HUP0301968A3 (en) * | 1999-11-17 | 2004-06-28 | Bayer Ag | Selective and synergistic herbicide compositions containing 2,6-disubstituted pyridine derivatives, preparation and use thereof |
AR031027A1 (es) | 2000-10-23 | 2003-09-03 | Syngenta Participations Ag | Composiciones agroquimicas |
US6635306B2 (en) * | 2001-06-22 | 2003-10-21 | University Of Cincinnati | Light emissive display with a black or color dielectric layer |
AR037228A1 (es) | 2001-07-30 | 2004-11-03 | Dow Agrosciences Llc | Compuestos del acido 6-(aril o heteroaril)-4-aminopicolinico, composicion herbicida que los comprende y metodo para controlar vegetacion no deseada |
MXPA05010296A (es) | 2003-03-26 | 2005-11-17 | Bayer Cropscience Gmbh | Utilizacion de compuestos hidroxilicos aromaticos como antidotos. |
DE10335725A1 (de) | 2003-08-05 | 2005-03-03 | Bayer Cropscience Gmbh | Safener auf Basis aromatisch-aliphatischer Carbonsäuredarivate |
DE10335726A1 (de) | 2003-08-05 | 2005-03-03 | Bayer Cropscience Gmbh | Verwendung von Hydroxyaromaten als Safener |
DE102004023332A1 (de) | 2004-05-12 | 2006-01-19 | Bayer Cropscience Gmbh | Chinoxalin-2-on-derivate, diese enthaltende nutzpflanzenschützende Mittel und Verfahren zu ihrer Herstellung und deren Verwendung |
WO2006062979A1 (en) | 2004-12-06 | 2006-06-15 | E.I. Dupont De Nemours And Company | Herbicidal 6-cyclopropyl-substitute 4-aminopicolinic acid derivatives |
WO2007023719A1 (ja) | 2005-08-22 | 2007-03-01 | Kumiai Chemical Industry Co., Ltd. | 薬害軽減剤及び薬害が軽減された除草剤組成物 |
JPWO2007023764A1 (ja) | 2005-08-26 | 2009-02-26 | クミアイ化学工業株式会社 | 薬害軽減剤及び薬害が軽減された除草剤組成物 |
KR101379625B1 (ko) * | 2006-01-13 | 2014-03-31 | 다우 아그로사이언시즈 엘엘씨 | 6-(다-치환 아릴)-4-아미노피콜리네이트 및 그의제초제로서의 용도 |
-
2008
- 2008-11-29 EP EP08020781A patent/EP2210492A1/de not_active Withdrawn
-
2009
- 2009-11-21 WO PCT/EP2009/008302 patent/WO2010060579A2/de active Application Filing
- 2009-11-21 EP EP09756682A patent/EP2369927A2/de not_active Withdrawn
- 2009-11-21 BR BRPI0922081-0A patent/BRPI0922081A2/pt not_active IP Right Cessation
- 2009-11-21 CN CN2009801470745A patent/CN102223795A/zh active Pending
- 2009-11-21 JP JP2011537880A patent/JP2012510435A/ja not_active Withdrawn
- 2009-11-25 US US12/625,925 patent/US20100137136A1/en not_active Abandoned
- 2009-11-26 AR ARP090104570A patent/AR075482A1/es not_active Application Discontinuation
Non-Patent Citations (1)
Title |
---|
See references of WO2010060579A3 * |
Also Published As
Publication number | Publication date |
---|---|
AR075482A1 (es) | 2011-04-06 |
WO2010060579A3 (de) | 2010-07-29 |
JP2012510435A (ja) | 2012-05-10 |
WO2010060579A2 (de) | 2010-06-03 |
EP2210492A1 (de) | 2010-07-28 |
CN102223795A (zh) | 2011-10-19 |
BRPI0922081A2 (pt) | 2015-08-11 |
US20100137136A1 (en) | 2010-06-03 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
EP3638665B1 (de) | Herbizid wirksame 3-phenylisoxazolin-5-carboxamide von tetrahydro- und dihydrofurancarbonsäuren und -estern | |
EP3668845B1 (de) | Herbizid wirksame 3-phenyl-5-trifluormethylisoxazolin-5-carboxamide von cyclopentylcarbonsäuren und -estern | |
EP2369929A2 (de) | Herbizid-safener-kombination | |
EP2369922A2 (de) | Herbizid-safener-kombination | |
EP2773208A1 (de) | Herbizid-safener-zusammensetzungen enthaltend n-(tetrazol-5-yl)- und n-(triazol-5-yl)arylcarbonsäureamide | |
WO2019219587A1 (de) | 2-brom-6-alkoxyphenyl-substituierte pyrrolin-2-one und deren verwendung als herbizide | |
EP2369927A2 (de) | Herbizid-safener-kombination | |
EP3599857B1 (de) | Herbizide mischungen | |
EP3938348A1 (de) | Neue 3-(2-brom-4-alkinyl-6-alkoxyphenyl)-3-pyrrolin-2-one und deren verwendung als herbizide | |
WO2019219584A1 (de) | Neue spirocyclohexylpyrrolin-2-one und deren verwendung als herbizide | |
WO2010060578A2 (de) | Herbizid-safener-kombination | |
EP3823450A1 (de) | Herbizide mischungen enthaltend aclonifen und cinmethylin | |
EP3618620A1 (de) | Herbizid-safener-zusammensetzungen enthaltend chinazolindion-6-carbonylderivate | |
WO2019228787A1 (de) | Speziell substituierte 2-alkyl-6-alkoxyphenyl-3-pyrrolin-2-one und deren verwendung als herbizide | |
WO2019228788A1 (de) | 2-brom-6-alkoxyphenyl-substituierte pyrrolin-2-one und deren verwendung als herbizide | |
WO2019166305A1 (de) | Herbizid wirksame bizyklische benzamide | |
WO2011138280A2 (de) | Herbizid-safener-kombinationen enthaltend arylpyridazinone und safener | |
EP3938346A1 (de) | Speziell substituierte 3-(2-halogen-6-alkyl-4-propinylphenyl)-3-pyrrolin-2-one und deren verwendung als herbizide | |
WO2020187628A1 (de) | Speziell substituierte 3-(2-alkoxy-6-alkyl-4-propinylphenyl)-3-pyrrolin-2-one und deren verwendung als herbizide | |
WO2021209486A1 (de) | Speziell substituierte pyrrolin-2-one und deren verwendung als herbizide | |
WO2019219588A1 (de) | Speziell substituierte 2-alkyl-6-alkoxyphenyl-3-pyrroliin-2-one und deren verwendung als herbizide | |
WO2021239673A1 (de) | Substituierte pyrrolin-2-one und deren verwendung als herbizide | |
EP3938347A1 (de) | Speziell substituierte 3-phenyl-5-spirocyclopentyl-3-pyrrolin-2-one und deren verwendung als herbizide | |
WO2019219585A1 (de) | Neue 3-(4-alkinyl-6-alkoxy-2-chlorphenyl)-3-pyrrolin-2-one und deren verwendung als herbizide | |
EP3360417A1 (de) | Verwendung von sulfonylindol als herbizid |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
PUAI | Public reference made under article 153(3) epc to a published international application that has entered the european phase |
Free format text: ORIGINAL CODE: 0009012 |
|
17P | Request for examination filed |
Effective date: 20110629 |
|
AK | Designated contracting states |
Kind code of ref document: A2 Designated state(s): AT BE BG CH CY CZ DE DK EE ES FI FR GB GR HR HU IE IS IT LI LT LU LV MC MK MT NL NO PL PT RO SE SI SK SM TR |
|
DAX | Request for extension of the european patent (deleted) | ||
17Q | First examination report despatched |
Effective date: 20130603 |
|
STAA | Information on the status of an ep patent application or granted ep patent |
Free format text: STATUS: THE APPLICATION IS DEEMED TO BE WITHDRAWN |
|
18D | Application deemed to be withdrawn |
Effective date: 20131214 |