DK462183D0 - Fremgangsmade til fremstilling af 3-(heterocyclyl eller aryl)methylthio-2-phenyl-1-(1h-1,2,4-triazol-1-yl)-2-propanol-forbindelser eller farmaceutisk acceptable syreadditionssalte deraf - Google Patents
Fremgangsmade til fremstilling af 3-(heterocyclyl eller aryl)methylthio-2-phenyl-1-(1h-1,2,4-triazol-1-yl)-2-propanol-forbindelser eller farmaceutisk acceptable syreadditionssalte derafInfo
- Publication number
- DK462183D0 DK462183D0 DK4621/83A DK462183A DK462183D0 DK 462183 D0 DK462183 D0 DK 462183D0 DK 4621/83 A DK4621/83 A DK 4621/83A DK 462183 A DK462183 A DK 462183A DK 462183 D0 DK462183 D0 DK 462183D0
- Authority
- DK
- Denmark
- Prior art keywords
- triazol
- heterocyclyl
- methylthio
- aryl
- phenyl
- Prior art date
Links
- LJTLZJBOPVWFDL-UHFFFAOYSA-N 1-methylsulfanyl-2-phenyl-1-(1,2,4-triazol-1-yl)propan-2-ol Chemical class CSC(C(C)(O)C1=CC=CC=C1)N1N=CN=C1 LJTLZJBOPVWFDL-UHFFFAOYSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D231/00—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings
- C07D231/02—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings
- C07D231/10—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members
- C07D231/12—Heterocyclic compounds containing 1,2-diazole or hydrogenated 1,2-diazole rings not condensed with other rings having two or three double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61P—SPECIFIC THERAPEUTIC ACTIVITY OF CHEMICAL COMPOUNDS OR MEDICINAL PREPARATIONS
- A61P31/00—Antiinfectives, i.e. antibiotics, antiseptics, chemotherapeutics
- A61P31/04—Antibacterial agents
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/56—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms or radicals containing only hydrogen and carbon atoms, attached to ring carbon atoms
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D249/00—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms
- C07D249/02—Heterocyclic compounds containing five-membered rings having three nitrogen atoms as the only ring hetero atoms not condensed with other rings
- C07D249/08—1,2,4-Triazoles; Hydrogenated 1,2,4-triazoles
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Communicable Diseases (AREA)
- Oncology (AREA)
- Chemical Kinetics & Catalysis (AREA)
- General Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Nuclear Medicine, Radiotherapy & Molecular Imaging (AREA)
- Pharmacology & Pharmacy (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8228920 | 1982-10-09 | ||
| GB8228920 | 1982-10-09 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK462183D0 true DK462183D0 (da) | 1983-10-07 |
| DK462183A DK462183A (da) | 1984-04-10 |
| DK169178B1 DK169178B1 (da) | 1994-09-05 |
Family
ID=10533495
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK462183A DK169178B1 (da) | 1982-10-09 | 1983-10-07 | Fremgangsmåde til fremstilling af 3-(heterocyclyl eller aryl)-methylthio-2-phenyl-1-(1H-1,2,4-triazol-1-yl)-2-propanol-forbindelser eller farmaceutisk acceptable syreadditionssalte deraf |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US4505919A (da) |
| EP (1) | EP0107392B1 (da) |
| JP (1) | JPS5998072A (da) |
| DE (1) | DE3377354D1 (da) |
| DK (1) | DK169178B1 (da) |
| GR (1) | GR79013B (da) |
| IE (1) | IE56055B1 (da) |
Families Citing this family (14)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FI74431C (fi) * | 1984-08-23 | 1988-02-08 | Partek Ab | Anordning foer lastning ett lastutrymme pao ett fordon och foer avlaegsning fraon det. |
| KR930004193B1 (ko) * | 1984-10-02 | 1993-05-21 | 스미또모 세이야꾸 가부시끼가이샤 | N-치환된 트리아졸 유도체의 제조방법 |
| GB8701515D0 (en) * | 1987-01-23 | 1987-02-25 | Ici Plc | Heterocyclic compounds |
| DE3835742A1 (de) * | 1988-10-20 | 1990-05-10 | Lentia Gmbh | Neue nitroalkylazole |
| IE903395A1 (en) * | 1989-09-26 | 1991-04-10 | Takeda Chemical Industries Ltd | Triazole compounds, their production and use |
| TW206224B (da) * | 1989-12-14 | 1993-05-21 | Takeda Pharm Industry Co Ltd | |
| FR2656612B1 (fr) * | 1989-12-28 | 1992-03-27 | Rhone Poulenc Agrochimie | Herbicides a groupe alcenyle ou heteroaryle thio, sulfone, sulfoxyde. |
| GB9002375D0 (en) * | 1990-02-02 | 1990-04-04 | Pfizer Ltd | Triazole antifungal agents |
| WO1993017003A1 (en) * | 1992-02-26 | 1993-09-02 | Smithkline Beecham Corporation | Retroviral protease inhibitors |
| US5239082A (en) * | 1992-08-03 | 1993-08-24 | Warner-Lambert Company | Sulfonamide tetrazole ACAT inhibitors |
| CA2145458A1 (en) * | 1994-03-28 | 1995-09-29 | Hiroki Kodama | Triazole compound and production process and use thereof |
| ATE206410T1 (de) * | 1995-04-06 | 2001-10-15 | Sankyo Co | Triazole als fungizide mittel. |
| IT1283038B1 (it) * | 1996-02-28 | 1998-04-07 | Zambon Spa | Composti azolici ad attivita' antimicotica per uso umano e veterinario |
| US20100111881A1 (en) * | 2006-01-27 | 2010-05-06 | Xinyu Huang | Polymeric anti-microbial agents |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4036970A (en) * | 1975-07-28 | 1977-07-19 | Syntex (U.S.A.) Inc. | Imidazol-1-yl propane derivatives |
| DE2735314A1 (de) * | 1977-08-05 | 1979-02-22 | Basf Ag | Alpha-azolylsulfide und deren derivate |
| DE2821829A1 (de) * | 1978-05-19 | 1979-11-22 | Basf Ag | Mittel zur regulierung des pflanzenwachstums |
| DE2908378A1 (de) * | 1979-03-03 | 1980-09-11 | Hoechst Ag | Derivate des 1,2,4-triazols |
| DE2926096A1 (de) * | 1979-06-28 | 1981-01-08 | Basf Ag | Fungizide beta -triazolylether, ihre herstellung und verwendung |
| AU542623B2 (en) * | 1980-05-16 | 1985-02-28 | Bayer Aktiengesellschaft | 1-hydroxyethyl-azole derivatives |
| EP0046633A1 (en) * | 1980-08-22 | 1982-03-03 | Imperial Chemical Industries Plc | Heterocyclic compounds useful as pesticides and processes for making them |
| DE3048267A1 (de) * | 1980-12-20 | 1982-07-15 | Bayer Ag, 5090 Leverkusen | Substituierte 1-azolyl-butan-2-ole, verfahren zu ihrer herstellung und ihre verwendung als pflanzenschutzmittel sowie als zwischenprodukte |
| CA1162540A (en) * | 1980-12-24 | 1984-02-21 | Ikutaro Saji | Imidazolylpropanol compounds and their acid addition salts, and production and use thereof |
| DE3279417D1 (en) * | 1981-03-18 | 1989-03-09 | Ici Plc | Triazole compounds, a process for preparing them, their use as plant fungicides and fungicidal compositions containing them |
-
1983
- 1983-03-28 US US06/479,526 patent/US4505919A/en not_active Expired - Lifetime
- 1983-09-29 DE DE8383305871T patent/DE3377354D1/de not_active Expired
- 1983-09-29 EP EP83305871A patent/EP0107392B1/en not_active Expired
- 1983-10-05 GR GR72627A patent/GR79013B/el unknown
- 1983-10-07 DK DK462183A patent/DK169178B1/da active
- 1983-10-07 IE IE2361/83A patent/IE56055B1/en not_active IP Right Cessation
- 1983-10-11 JP JP58189794A patent/JPS5998072A/ja active Granted
Also Published As
| Publication number | Publication date |
|---|---|
| JPS6346069B2 (da) | 1988-09-13 |
| JPS5998072A (ja) | 1984-06-06 |
| IE56055B1 (en) | 1991-03-27 |
| GR79013B (da) | 1984-10-02 |
| US4505919A (en) | 1985-03-19 |
| DE3377354D1 (en) | 1988-08-18 |
| EP0107392B1 (en) | 1988-07-13 |
| EP0107392A1 (en) | 1984-05-02 |
| DK169178B1 (da) | 1994-09-05 |
| IE832361L (en) | 1984-04-09 |
| DK462183A (da) | 1984-04-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK252282A (da) | Fremgangsmaade til fremstilling af 1,3-bis-(1,2,4-triazol-1-yl)-2-(2,4-difluorphenyl)propan-2-ol eller far aceutisk acceptable salte deraf | |
| DK337383A (da) | Fremgangsmaade til fremstilling af 4-amino-6,7-dimethoxyquinolin-forbindelser eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK74282A (da) | Fremgangsmaade til fremstilling af imidazodiazepiner eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK106882A (da) | Fremgangsmaade til fremstilling af 3,4-dihydro-5h-2,3-benzodiazepin-derivater eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK462183A (da) | Fremgangsmaade til fremstilling af 3-(heterocyclyl eller aryl)methylthio-2-phenyl-1-(1h-1,2,4-triazol-1-yl)-2-propanol-forbindelser eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK148795C (da) | Anologifremgangsmaade til fremstilling af 3-(2-morpholino-ethyl-amino)-5-phenyl-pyridazin eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK552581A (da) | Fremgangsmaade til fremstilling af 3-pyridylaklyl-indol-forbindelser eller farmaceutisk acceptable salte deraf | |
| DK405881A (da) | Fremgangsmaade til fremstilling af 7beta-aminothiadiazolylacetylamino3-ammoniomethyl-3-cephem-4-carboxylsyreforbindelser eller salte deraf | |
| DK162842C (da) | Analogifremgangsmaade til fremstilling af 1-perfluoralkyl-2-(1,2,4-triazol-1-yl)-ethanol-forbindelser eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK453181A (da) | Fremgangsmaade til fremstilling af 2-quanidino-4-heteroaryl-thiazolforbindelser eller syreadditionssalte deraf | |
| DK413783A (da) | Fremgangsmaade til fremstilling af 20-amino-macrolidderivater eller syreadditionssalte deraf | |
| DK287380A (da) | Fremgangsmaade til fremstilling af 2-phenyl-2-hydroxy-1-(1-imidazolyl)alkan- eller- alkenforbindelser eller syreadditionssalte deraf | |
| DK98383A (da) | Fremgangsmaade til fremstilling af 1,2,4-triazol-forbindelser eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK77880A (da) | Fremgangsmaade til fremstilling af 2-(imidazol-1-ylmethyl) pyrroler eller salte deraf | |
| DK157451C (da) | Analogifremgangsmaade til fremstilling af 2,4-diamino-6-alkoxybenzyl-5-methylpyridooe2,3-daapyrimidiner eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK275383A (da) | Fremgangsmaade til fremstilling af 1-(2-heterocyclyl-2-(5-chlor-2-pyridyl)-2-hydroxy-ethyl)-1,2,4-triazol-forbindelser eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK533881A (da) | Fremgangsmaade til fremstilling af 3,4-bis-substituerede 1,2,5-oxidazol-2-oxider eller farmekologisk acceptable syreadditionsforbindelser | |
| DK154216C (da) | Analogifremgangsmaade til fremstilling af 1-(3-(2-hydroxy-3-alkylaminopropoxy)-2-thienyl)-3-phenyl-1-propanoner eller syreadditionssalte deraf | |
| DK152754C (da) | Analogifremgangsmaade til fremstilling af 1-acyl-8-(3-amino-2-hydroxypropoxy)-1,2,3,4-tetrahydroquinoliner eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK162046C (da) | Analogifremgangsmaade til fremstilling af 2-(halogensubstitueret phenyl)-2-chlor-1-(1h-1,2,4-triazol-1-yl)-omega,omega,omega-trifluoralkan-forbindelse eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK157928C (da) | Analogifremgangsmaade til fremstilling af 2-amino-2-phenyl-1,3-bis(1h-1,2,4-triazol-1-yl)propan-forbindelser eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK386882A (da) | Fremgangsmaade til fremstilling af 5'-(2-amino-4-pyridyl)-1',2',4'-triazol-forbindelser eller farmaceutisk acceptable syreadditionssalte deraf | |
| DK357683A (da) | Fremgangsmaade til fremstilling af 1-(5-chlorpyrid-2-yl)-1-(2,4-dihalogenphenyl)-2-(1,2,4-triazol-1-yl)-ethanol-forbindelser eller deres farmaceutisk acceptable syreadditionssalte | |
| DK234182A (da) | Fremgangsmaade til fremstilling af heterocyclisk substitueredeamidoximer eller syreadditionssalte deraf | |
| DK398283D0 (da) | Fremgangsmade til fremstilling af 1,4-dihydropyridinderivater eller farmaceutisk acceptable syreadditionssalte deraf |