DK170947B1 - Fortyknet, sur, vandig komposition til sanitær rengøring og fremgangsmåde til fremstilling af samme. - Google Patents
Fortyknet, sur, vandig komposition til sanitær rengøring og fremgangsmåde til fremstilling af samme. Download PDFInfo
- Publication number
- DK170947B1 DK170947B1 DK469287A DK469287A DK170947B1 DK 170947 B1 DK170947 B1 DK 170947B1 DK 469287 A DK469287 A DK 469287A DK 469287 A DK469287 A DK 469287A DK 170947 B1 DK170947 B1 DK 170947B1
- Authority
- DK
- Denmark
- Prior art keywords
- acid
- betaine
- weight
- salt
- composition
- Prior art date
Links
- 239000000203 mixture Substances 0.000 title claims abstract description 59
- 230000002378 acidificating effect Effects 0.000 title claims abstract description 8
- 238000004140 cleaning Methods 0.000 title claims abstract description 8
- 238000000034 method Methods 0.000 title 1
- KWIUHFFTVRNATP-UHFFFAOYSA-N glycine betaine Chemical compound C[N+](C)(C)CC([O-])=O KWIUHFFTVRNATP-UHFFFAOYSA-N 0.000 claims abstract description 59
- 229960003237 betaine Drugs 0.000 claims abstract description 31
- 239000002304 perfume Substances 0.000 claims abstract description 22
- 150000003839 salts Chemical class 0.000 claims abstract description 17
- 239000002253 acid Substances 0.000 claims abstract description 16
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims abstract description 9
- 230000000844 anti-bacterial effect Effects 0.000 claims abstract description 6
- 125000000217 alkyl group Chemical group 0.000 claims abstract description 3
- 239000003899 bactericide agent Substances 0.000 claims abstract description 3
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical group [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 claims description 20
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 16
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 claims description 12
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 claims description 12
- 239000011780 sodium chloride Substances 0.000 claims description 10
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 claims description 9
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 8
- 235000019253 formic acid Nutrition 0.000 claims description 8
- 229910052784 alkaline earth metal Inorganic materials 0.000 claims description 6
- 229910000147 aluminium phosphate Inorganic materials 0.000 claims description 6
- RGHNJXZEOKUKBD-SQOUGZDYSA-N D-gluconic acid Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@@H](O)C(O)=O RGHNJXZEOKUKBD-SQOUGZDYSA-N 0.000 claims description 4
- 235000011054 acetic acid Nutrition 0.000 claims description 4
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 claims description 4
- 150000001342 alkaline earth metals Chemical class 0.000 claims description 4
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 claims description 4
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 claims description 3
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 claims description 3
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 claims description 3
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 claims description 3
- 235000015165 citric acid Nutrition 0.000 claims description 3
- 150000003467 sulfuric acid derivatives Chemical class 0.000 claims description 3
- BJEPYKJPYRNKOW-REOHCLBHSA-N (S)-malic acid Chemical compound OC(=O)[C@@H](O)CC(O)=O BJEPYKJPYRNKOW-REOHCLBHSA-N 0.000 claims description 2
- RGHNJXZEOKUKBD-UHFFFAOYSA-N D-gluconic acid Natural products OCC(O)C(O)C(O)C(O)C(O)=O RGHNJXZEOKUKBD-UHFFFAOYSA-N 0.000 claims description 2
- 239000001361 adipic acid Substances 0.000 claims description 2
- 235000011037 adipic acid Nutrition 0.000 claims description 2
- BJEPYKJPYRNKOW-UHFFFAOYSA-N alpha-hydroxysuccinic acid Natural products OC(=O)C(O)CC(O)=O BJEPYKJPYRNKOW-UHFFFAOYSA-N 0.000 claims description 2
- 239000000174 gluconic acid Substances 0.000 claims description 2
- 235000012208 gluconic acid Nutrition 0.000 claims description 2
- 239000004615 ingredient Substances 0.000 claims description 2
- 239000004310 lactic acid Substances 0.000 claims description 2
- 235000014655 lactic acid Nutrition 0.000 claims description 2
- 239000001630 malic acid Substances 0.000 claims description 2
- 235000011090 malic acid Nutrition 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 239000003513 alkali Substances 0.000 claims 1
- 150000003841 chloride salts Chemical class 0.000 claims 1
- 239000003086 colorant Substances 0.000 abstract 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 229910052783 alkali metal Inorganic materials 0.000 description 5
- 150000001340 alkali metals Chemical class 0.000 description 5
- 239000002562 thickening agent Substances 0.000 description 5
- 150000007513 acids Chemical class 0.000 description 4
- 238000009792 diffusion process Methods 0.000 description 3
- 150000004820 halides Chemical class 0.000 description 3
- 235000008733 Citrus aurantifolia Nutrition 0.000 description 2
- VZCYOOQTPOCHFL-OWOJBTEDSA-N Fumaric acid Chemical compound OC(=O)\C=C\C(O)=O VZCYOOQTPOCHFL-OWOJBTEDSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 235000011941 Tilia x europaea Nutrition 0.000 description 2
- -1 alkaline earth metal sulfates Chemical class 0.000 description 2
- 125000003368 amide group Chemical group 0.000 description 2
- 239000003945 anionic surfactant Substances 0.000 description 2
- 239000001913 cellulose Chemical class 0.000 description 2
- 229920002678 cellulose Chemical class 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 238000009472 formulation Methods 0.000 description 2
- 238000009434 installation Methods 0.000 description 2
- 239000004571 lime Substances 0.000 description 2
- JHJLBTNAGRQEKS-UHFFFAOYSA-M sodium bromide Chemical compound [Na+].[Br-] JHJLBTNAGRQEKS-UHFFFAOYSA-M 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- 230000008719 thickening Effects 0.000 description 2
- 125000000954 2-hydroxyethyl group Chemical group [H]C([*])([H])C([H])([H])O[H] 0.000 description 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-M Aminoacetate Chemical compound NCC([O-])=O DHMQDGOQFOQNFH-UHFFFAOYSA-M 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 239000003570 air Substances 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 239000012080 ambient air Substances 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000000129 anionic group Chemical group 0.000 description 1
- 230000001580 bacterial effect Effects 0.000 description 1
- 150000003842 bromide salts Chemical class 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 230000015556 catabolic process Effects 0.000 description 1
- 150000001805 chlorine compounds Chemical class 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000001530 fumaric acid Substances 0.000 description 1
- 239000000499 gel Substances 0.000 description 1
- 150000004694 iodide salts Chemical class 0.000 description 1
- 239000002736 nonionic surfactant Substances 0.000 description 1
- 229920000847 nonoxynol Polymers 0.000 description 1
- SNQQPOLDUKLAAF-UHFFFAOYSA-N nonylphenol Chemical class CCCCCCCCCC1=CC=CC=C1O SNQQPOLDUKLAAF-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000002453 shampoo Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C11—ANIMAL OR VEGETABLE OILS, FATS, FATTY SUBSTANCES OR WAXES; FATTY ACIDS THEREFROM; DETERGENTS; CANDLES
- C11D—DETERGENT COMPOSITIONS; USE OF SINGLE SUBSTANCES AS DETERGENTS; SOAP OR SOAP-MAKING; RESIN SOAPS; RECOVERY OF GLYCEROL
- C11D1/00—Detergent compositions based essentially on surface-active compounds; Use of these compounds as a detergent
- C11D1/88—Ampholytes; Electroneutral compounds
- C11D1/90—Betaines
Landscapes
- Chemical & Material Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Engineering & Computer Science (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Oil, Petroleum & Natural Gas (AREA)
- Wood Science & Technology (AREA)
- Organic Chemistry (AREA)
- Detergent Compositions (AREA)
- Cosmetics (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Catching Or Destruction (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| FR8612571A FR2603601B1 (fr) | 1986-09-08 | 1986-09-08 | Composition de nettoyage d'installations sanitaires |
| FR8612571 | 1986-09-08 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK469287D0 DK469287D0 (da) | 1987-09-08 |
| DK469287A DK469287A (da) | 1988-03-09 |
| DK170947B1 true DK170947B1 (da) | 1996-03-25 |
Family
ID=9338774
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK469287A DK170947B1 (da) | 1986-09-08 | 1987-09-08 | Fortyknet, sur, vandig komposition til sanitær rengøring og fremgangsmåde til fremstilling af samme. |
Country Status (8)
| Country | Link |
|---|---|
| EP (1) | EP0260205B1 (enrdf_load_stackoverflow) |
| AT (1) | ATE83796T1 (enrdf_load_stackoverflow) |
| DE (1) | DE3783185T2 (enrdf_load_stackoverflow) |
| DK (1) | DK170947B1 (enrdf_load_stackoverflow) |
| ES (1) | ES2044967T3 (enrdf_load_stackoverflow) |
| FR (1) | FR2603601B1 (enrdf_load_stackoverflow) |
| GR (1) | GR3007440T3 (enrdf_load_stackoverflow) |
| NO (1) | NO174674C (enrdf_load_stackoverflow) |
Families Citing this family (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4900467A (en) * | 1988-05-20 | 1990-02-13 | The Clorox Company | Viscoelastic cleaning compositions with long relaxation times |
| EP0649834A1 (en) * | 1993-10-20 | 1995-04-26 | Kao Corporation | Carboxybetaine and sulfobetaine and detergent composition and cosmetic containing the same |
| DE19742285C1 (de) * | 1997-09-25 | 1999-04-29 | Henkel Kgaa | Verwendung von ungesättigten Betaintensiden als Verdickungsmittel |
| DE19922040A1 (de) * | 1999-03-11 | 2000-11-30 | Drom Fragrances Internat Kg | Zubereitung, insbesondere für WC-Erfrischer |
| NZ529554A (en) | 2003-11-14 | 2006-08-31 | Fonterra Cooperative Group Ltd | Dairy product and process |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2024962B2 (de) * | 1970-05-22 | 1975-09-11 | Kao Soap Co., Ltd., Tokio | Flussige Reinigungsmittelmischung |
| US4375421A (en) * | 1981-10-19 | 1983-03-01 | Lever Brothers Company | Viscous compositions containing amido betaines and salts |
| NZ214410A (en) * | 1984-12-18 | 1988-07-28 | Colgate Palmolive Co | Built aqueous detergent compositions containing nonionic and amphoteric detergents |
| DE3542970A1 (de) * | 1985-12-05 | 1987-06-11 | Benckiser Gmbh Joh A | Fluessige sanitaerreinigungs- und entkalkungsmittel und verfahren zu deren herstellung |
-
1986
- 1986-09-08 FR FR8612571A patent/FR2603601B1/fr not_active Expired
-
1987
- 1987-09-07 NO NO873732A patent/NO174674C/no unknown
- 1987-09-07 DE DE8787420234T patent/DE3783185T2/de not_active Expired - Lifetime
- 1987-09-07 EP EP87420234A patent/EP0260205B1/fr not_active Expired - Lifetime
- 1987-09-07 ES ES87420234T patent/ES2044967T3/es not_active Expired - Lifetime
- 1987-09-07 AT AT87420234T patent/ATE83796T1/de not_active IP Right Cessation
- 1987-09-08 DK DK469287A patent/DK170947B1/da active IP Right Grant
-
1993
- 1993-03-23 GR GR930400627T patent/GR3007440T3/el unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ATE83796T1 (de) | 1993-01-15 |
| DE3783185D1 (de) | 1993-02-04 |
| DK469287D0 (da) | 1987-09-08 |
| FR2603601A1 (fr) | 1988-03-11 |
| NO174674B (no) | 1994-03-07 |
| NO174674C (no) | 1994-06-15 |
| ES2044967T3 (es) | 1994-01-16 |
| EP0260205A3 (en) | 1989-02-22 |
| NO873732L (no) | 1988-03-09 |
| FR2603601B1 (fr) | 1988-11-10 |
| NO873732D0 (no) | 1987-09-07 |
| DK469287A (da) | 1988-03-09 |
| DE3783185T2 (de) | 1993-07-01 |
| EP0260205B1 (fr) | 1992-12-23 |
| EP0260205A2 (fr) | 1988-03-16 |
| GR3007440T3 (enrdf_load_stackoverflow) | 1993-07-30 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| CA1186966A (en) | Viscous compositions containing amidobetaines and salts | |
| FI85874B (fi) | Vaetskeformiga sanitetsrengoerings- och avkalkningsmedel. | |
| CA2228626C (en) | Cleaning and disinfecting compositions with electrolytic disinfecting booster | |
| CN103459575B (zh) | 多效洗涤剂组合物 | |
| CN1189552C (zh) | 液体清洗剂或洗涤剂组合物 | |
| EP3186347B1 (en) | Liquid detergent composition | |
| US6153572A (en) | Acidic liquid toilet bowl cleaner | |
| JP2017008137A (ja) | 衣料用液体洗浄剤組成物 | |
| GB2341870A (en) | Acidic hard surface cleaning compositions | |
| EP0147943B1 (en) | Bleaching compositions | |
| AU2006215837B2 (en) | Aqueous liquid bleach compositions | |
| DK170947B1 (da) | Fortyknet, sur, vandig komposition til sanitær rengøring og fremgangsmåde til fremstilling af samme. | |
| TW201226552A (en) | Liquid detergent composition for food processing equipment and/or cooking equipment | |
| JP5422882B2 (ja) | 殺菌洗浄剤組成物 | |
| EP0079697B2 (en) | Cleaning compositions | |
| EP0110544A1 (en) | Bleaching compositions | |
| US5439615A (en) | Thickened cleaner compositions | |
| JPH0762154B2 (ja) | 漂白組成物 | |
| EP0274885B1 (en) | Bleaching compositions | |
| EP0968272A1 (en) | Improvements in or relating to organic compositions | |
| JP2002511521A (ja) | 耐紫外光容器を備えた食器洗い用洗剤製品 | |
| JPH07305099A (ja) | 漂白剤組成物 | |
| JP3684503B2 (ja) | 洗浄剤組成物 | |
| KR20170017551A (ko) | 곰팡이 제거 및 탈취용 세정제 조성물 | |
| WO2008043638A1 (en) | Aqueous liquid bleach compositions |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| B1 | Patent granted (law 1993) |