DK162638C - Analogifremgangsmaade til fremstilling af 6-fluor-1,4-dihydro-4-oxo-3-quinolincarboxylsyrederivater og udgangsmateriale til brug ved fremgangsmaaden - Google Patents
Analogifremgangsmaade til fremstilling af 6-fluor-1,4-dihydro-4-oxo-3-quinolincarboxylsyrederivater og udgangsmateriale til brug ved fremgangsmaadenInfo
- Publication number
- DK162638C DK162638C DK145983A DK145983A DK162638C DK 162638 C DK162638 C DK 162638C DK 145983 A DK145983 A DK 145983A DK 145983 A DK145983 A DK 145983A DK 162638 C DK162638 C DK 162638C
- Authority
- DK
- Denmark
- Prior art keywords
- analogy
- dihydro
- oxo
- fluoro
- procedures
- Prior art date
Links
- 238000000034 method Methods 0.000 title 3
- KCEJQAATYWQMMQ-UHFFFAOYSA-N 6-fluoro-4-oxo-1h-quinoline-3-carboxylic acid Chemical class C1=C(F)C=C2C(=O)C(C(=O)O)=CNC2=C1 KCEJQAATYWQMMQ-UHFFFAOYSA-N 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D401/00—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom
- C07D401/02—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings
- C07D401/04—Heterocyclic compounds containing two or more hetero rings, having nitrogen atoms as the only ring hetero atoms, at least one ring being a six-membered ring with only one nitrogen atom containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D215/00—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems
- C07D215/58—Heterocyclic compounds containing quinoline or hydrogenated quinoline ring systems with hetero atoms directly attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D413/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms
- C07D413/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings
- C07D413/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and oxygen atoms as the only ring hetero atoms containing two hetero rings directly linked by a ring-member-to-ring-member bond
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D417/00—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00
- C07D417/02—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings
- C07D417/04—Heterocyclic compounds containing two or more hetero rings, at least one ring having nitrogen and sulfur atoms as the only ring hetero atoms, not provided for by group C07D415/00 containing two hetero rings directly linked by a ring-member-to-ring-member bond
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US36387682A | 1982-03-31 | 1982-03-31 | |
| US36387682 | 1982-03-31 | ||
| US46609583 | 1983-02-14 | ||
| US06/466,095 US4499091A (en) | 1982-03-31 | 1983-02-14 | 1-Amino (or substituted amino)-1,4-dihydro-4-oxo-6-fluoro-7-heterylquinoline-3-carboxylic acids and their use as antibacterial agents |
Publications (4)
| Publication Number | Publication Date |
|---|---|
| DK145983D0 DK145983D0 (da) | 1983-03-30 |
| DK145983A DK145983A (da) | 1983-10-01 |
| DK162638B DK162638B (da) | 1991-11-25 |
| DK162638C true DK162638C (da) | 1992-04-21 |
Family
ID=27002249
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK145983A DK162638C (da) | 1982-03-31 | 1983-03-30 | Analogifremgangsmaade til fremstilling af 6-fluor-1,4-dihydro-4-oxo-3-quinolincarboxylsyrederivater og udgangsmateriale til brug ved fremgangsmaaden |
Country Status (14)
| Country | Link |
|---|---|
| US (1) | US4499091A (enExample) |
| KR (1) | KR880002353B1 (enExample) |
| AU (1) | AU557534B2 (enExample) |
| CA (1) | CA1198425A (enExample) |
| DK (1) | DK162638C (enExample) |
| ES (1) | ES8405390A1 (enExample) |
| FI (1) | FI77855C (enExample) |
| GR (1) | GR77906B (enExample) |
| IE (1) | IE54898B1 (enExample) |
| IL (1) | IL68236A (enExample) |
| NO (1) | NO158060C (enExample) |
| NZ (1) | NZ203621A (enExample) |
| PH (1) | PH18392A (enExample) |
| PT (1) | PT76456B (enExample) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4665079A (en) * | 1984-02-17 | 1987-05-12 | Warner-Lambert Company | Antibacterial agents |
| US4730000A (en) * | 1984-04-09 | 1988-03-08 | Abbott Laboratories | Quinoline antibacterial compounds |
| DE3409922A1 (de) * | 1984-03-17 | 1985-09-26 | Bayer Ag, 5090 Leverkusen | 1,7-diamino-1,4-dihydro-4-oxo-3-(aza)chinolincarbonsaeuren, verfahren zu ihrer herstellung sowie ihre verwendung bei der bekaempfung bakterieller erkrankungen |
| FR2574404B1 (fr) * | 1984-12-12 | 1987-04-24 | Provesan Sa | Derives 1-substitues de l'acide 6-fluoro-7-(pyrrol-1-yl)-1,4-dihydro-4-oxoquinoleine-3-carboxylique, leur preparation et leur application en tant que medicaments |
| US4578473A (en) * | 1985-04-15 | 1986-03-25 | Warner-Lambert Company | Process for quinoline-3-carboxylic acid antibacterial agents |
| IN166416B (enExample) * | 1985-09-18 | 1990-05-05 | Pfizer | |
| US4692454A (en) * | 1986-02-03 | 1987-09-08 | Warner-Lambert Company | Opthalmic use of quinolone antibiotics |
| DE3606698A1 (de) * | 1986-03-01 | 1987-09-03 | Bayer Ag | 7-(1-pyrrolidinyl)-chinoloncarbonsaeure -derivate |
| US5153204A (en) * | 1986-03-01 | 1992-10-06 | Bayer Aktiengesellschaft | 7-(1-Pyrrolidinyl)-quinolonecarboxylic acid derivatives |
| JPS62215572A (ja) * | 1986-03-17 | 1987-09-22 | Kyorin Pharmaceut Co Ltd | キノロンカルボン酸誘導体 |
| EP0251308B1 (de) * | 1986-07-04 | 1990-11-22 | Chemie Linz Gesellschaft m.b.H. | 4-Chinolon-3-carbonsäurederivate, Verfahren zu ihrer Herstellung und diese enthaltende pharmazeutische Präparate |
| ES2059335T3 (es) * | 1986-09-12 | 1994-11-16 | Hoffmann La Roche | Derivados de pirido(3,2,1-ij)-1,3,4-benzoxadiazina, procedimiento para su obtencion, preparados farmaceuticos correspondientes y productos intermedios utilizables en el procedimiento. |
| US4929613A (en) * | 1987-08-26 | 1990-05-29 | Warner-Lambert Company | Antibacterial agents |
| US4868305A (en) * | 1988-02-16 | 1989-09-19 | Sterling Drug Inc. | Improvement in the preparation of intermediates for quinoline antibacterial agents |
| US4959363A (en) * | 1989-06-23 | 1990-09-25 | Sterling Drug Inc. | Quinolonecarboxamide compounds, their preparation and use as antivirals. |
| US5532239A (en) * | 1993-08-02 | 1996-07-02 | Assistance Publique - Hopitaux De Paris | Therapeutic application of fluoroquinolone derivatives |
| DE4416622A1 (de) * | 1994-05-11 | 1995-11-16 | Bayer Ag | 8-Amino-10-(azabicycloalkyl)-pyrido[1,2,3-d.e] [1,3,4]benzoxa-diazinderivate |
| US6326391B1 (en) | 1998-12-04 | 2001-12-04 | Influx, Inc. | Inhibitors of multidrug transporters |
| US6262072B1 (en) | 1999-10-12 | 2001-07-17 | Yung Shin Pharmaceutical Industrial Co. Ltd. | Orally administered antimicrobial pharmaceutical formulations of ciprofloxacin |
| US6957105B2 (en) * | 2002-03-26 | 2005-10-18 | Cardiac Pacemakers, Inc. | Method and apparatus for detecting oscillations in cardiac rhythm with electrogram signals |
| US7973022B2 (en) * | 2006-02-17 | 2011-07-05 | Idexx Laboratories, Inc. | Fluoroquinolone carboxylic acid salt compositions |
| US20070196398A1 (en) * | 2006-02-17 | 2007-08-23 | Murthy Yerramilli V S | Fluoroquinolone fatty acid salt compositions |
| US20070197548A1 (en) * | 2006-02-17 | 2007-08-23 | Murthy Yerramilli V S | Fluoroquinolone compositions |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS53141286A (en) * | 1977-05-16 | 1978-12-08 | Kyorin Seiyaku Kk | Novel substituted quinolinecarboxylic acid |
| CA1175836A (en) * | 1977-09-20 | 1984-10-09 | Marcel Pesson | Production of 1,4-dihydroquinoline-3-carboxylic acid derivatives |
| DE2808070A1 (de) * | 1978-02-24 | 1979-08-30 | Bayer Ag | Verfahren zur herstellung von 4-pyridon-3-carbonsaeuren und/oder deren derivaten |
-
1983
- 1983-02-14 US US06/466,095 patent/US4499091A/en not_active Expired - Fee Related
- 1983-03-18 NZ NZ203621A patent/NZ203621A/en unknown
- 1983-03-21 IE IE608/83A patent/IE54898B1/en not_active IP Right Cessation
- 1983-03-23 AU AU12722/83A patent/AU557534B2/en not_active Ceased
- 1983-03-24 IL IL68236A patent/IL68236A/xx unknown
- 1983-03-24 NO NO831056A patent/NO158060C/no unknown
- 1983-03-25 PH PH28704A patent/PH18392A/en unknown
- 1983-03-25 PT PT76456A patent/PT76456B/pt not_active IP Right Cessation
- 1983-03-28 GR GR70901A patent/GR77906B/el unknown
- 1983-03-30 ES ES521153A patent/ES8405390A1/es not_active Expired
- 1983-03-30 KR KR1019830001302A patent/KR880002353B1/ko not_active Expired
- 1983-03-30 FI FI831102A patent/FI77855C/fi not_active IP Right Cessation
- 1983-03-30 DK DK145983A patent/DK162638C/da not_active IP Right Cessation
- 1983-03-30 CA CA000424875A patent/CA1198425A/en not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| FI77855C (fi) | 1989-05-10 |
| NO831056L (no) | 1983-10-03 |
| IE830608L (en) | 1983-09-30 |
| FI831102A0 (fi) | 1983-03-30 |
| NO158060C (no) | 1988-07-06 |
| CA1198425A (en) | 1985-12-24 |
| IE54898B1 (en) | 1990-03-14 |
| DK145983D0 (da) | 1983-03-30 |
| IL68236A (en) | 1986-09-30 |
| NO158060B (no) | 1988-03-28 |
| DK162638B (da) | 1991-11-25 |
| NZ203621A (en) | 1986-01-24 |
| IL68236A0 (en) | 1983-06-15 |
| ES521153A0 (es) | 1984-06-01 |
| DK145983A (da) | 1983-10-01 |
| KR840004102A (ko) | 1984-10-06 |
| FI831102L (fi) | 1983-10-01 |
| KR880002353B1 (ko) | 1988-10-29 |
| GR77906B (enExample) | 1984-09-25 |
| US4499091A (en) | 1985-02-12 |
| PH18392A (en) | 1985-06-21 |
| FI77855B (fi) | 1989-01-31 |
| ES8405390A1 (es) | 1984-06-01 |
| PT76456B (en) | 1985-12-10 |
| AU557534B2 (en) | 1986-12-24 |
| PT76456A (en) | 1983-04-01 |
| AU1272283A (en) | 1983-10-06 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK162638C (da) | Analogifremgangsmaade til fremstilling af 6-fluor-1,4-dihydro-4-oxo-3-quinolincarboxylsyrederivater og udgangsmateriale til brug ved fremgangsmaaden | |
| DK163305C (da) | Analogifremgangsmaade til fremstilling af 1-normon-2-yl-heterocycliske forbindelser og mellemprodukter til anvendelse ved fremgangsmaaden | |
| DK112283A (da) | Fremgangsmaade til forstaerkning af organopolysiloxanelastomeres klaebeevne | |
| DK164899C (da) | Analogifremgangsmaade til fremstilling af 2-substituerede-3-hydroxy-1,4-naphthoquinoner og udgangsmaterialer til brug ved fremgangsmaaden | |
| DK153948C (da) | Analogifremgangsmaade til fremstilling af vandoploeselige associationsprodukter af (+)-katekin med en aminosyre og eventuelt tillige en anden syre | |
| DK160562C (da) | Analogifremgangsmaade til fremstilling af antistoffer specifikke for linseepithelceller og middel til brug ved fremgangsmaaden | |
| DK281490A (da) | Analogifremgangsmaade til fremstilling af mitosanderivater | |
| DK32383D0 (da) | Phosphinsyrederivater og fremgangsmade til fremstilling af disse | |
| NO834461L (no) | Fremgangsmaate ved fremstilling av l-carnitin og utgangsmaterialer anvendt ved fremgangsmaaten | |
| DK536281A (da) | Fremgangsmaade til fremstilling af carbonsyrederivater | |
| DK163580C (da) | Analogifremgangsmaade til fremstilling af cyclohexancarboxylsyrederivater | |
| DK407383A (da) | Diaminopyrimidiner, fremgangsmaader til deres fremstilling, deres anvendelse og mellemprodukter anvendelige ved forbindelsernes fremstilling | |
| DK152363C (da) | Analogifremgangsmaade til fremstilling af 3-(omega-piperazinylalkyl)-alkylendioxybenzenderivater | |
| DK271183A (da) | Fremgangsmaade til fremstilling af dihydropyridinderivater | |
| NO833369L (no) | Heterocykliske forbindelser, fremgangsmaate til fremstilling derav og preparat inneholdende slike forbindelser | |
| DK367683D0 (da) | Fremgangsmade til fremstilling af n-substituerede 1-oxido-nicotinamider og salte deraf | |
| DK154021C (da) | Analogifremgangsmaade til fremstilling af phenoxy-aminopropanolderivater og epoxider til anvendelse som udgangsmateriale ved denne fremgangsmaade | |
| DK156219C (da) | Analogifremgangsmaade til fremstilling af spirothiazolidinylpiperazinderivater | |
| DK142683A (da) | N,n,n-trialkylammonium-derivater af n-epoxymethan, fremgangsmaade til fremstilling af saadanne derivater og anvendelse heraf til behandling af polyhydroxylerede og polyaminerede polymere | |
| DK163582C (da) | Mellemprodukter til brug ved fremstilling af 2-(2-amino-thiazol-4-yl)glyoxylsyrederivater eller salte heraf og fremgangsmaade til fremstilling af mellemprodukterne | |
| DK333279A (da) | Fremgangsmaade til fremstilling af thiosubstitituerede diazacycloalkener og salte deraf | |
| DK151022C (da) | Analogifremgangsmaade til fremstilling af apovincaminol-3',4',5'-trimethoxybenzoatderivater og apovincaminolderivater til anvendelse ved fremgangsmaadenn | |
| DK164160C (da) | Alkyl-6-amino-5-nitro-4-oe(2-oxo-2-phenylethyl)aminoaapyridin-2-ylcarbamatderivater og analogifremgangsmaade til fremstilling af 1,2-dihydropyridooe3,4-baapyraziner under anvendelse af pyridinylcarbamaterne | |
| DK400984A (da) | Pyrimido(4-5-g)quinolin-derivater, fremgangsmaade til fremstilling heraf og mellemprodukt til brug ved fremgangsmaaden | |
| DK236781A (da) | Fremgangsmaade til fremstilling af indoleddikesyrederivater |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed | ||
| PBP | Patent lapsed |