DK153845C - Fremgangsmaade til fremstilling af cephalosporin- eller penicillinderivater - Google Patents
Fremgangsmaade til fremstilling af cephalosporin- eller penicillinderivaterInfo
- Publication number
- DK153845C DK153845C DK471474A DK471474A DK153845C DK 153845 C DK153845 C DK 153845C DK 471474 A DK471474 A DK 471474A DK 471474 A DK471474 A DK 471474A DK 153845 C DK153845 C DK 153845C
- Authority
- DK
- Denmark
- Prior art keywords
- cephalosporine
- preparing
- penicillin derivatives
- penicillin
- derivatives
- Prior art date
Links
- HOKIDJSKDBPKTQ-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[(5-amino-5-carboxypentanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C(NC(=O)CCCC(N)C(O)=O)C12 HOKIDJSKDBPKTQ-UHFFFAOYSA-N 0.000 title 1
- 150000002960 penicillins Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP10085673A JPS554115B2 (show.php) | 1973-09-07 | 1973-09-07 | |
| JP10085673 | 1973-09-07 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK471474A DK471474A (da) | 1975-05-05 |
| DK153845B DK153845B (da) | 1988-09-12 |
| DK153845C true DK153845C (da) | 1989-01-23 |
Family
ID=14284936
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK471474A DK153845C (da) | 1973-09-07 | 1974-09-06 | Fremgangsmaade til fremstilling af cephalosporin- eller penicillinderivater |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4016155A (show.php) |
| JP (1) | JPS554115B2 (show.php) |
| CA (1) | CA1052373A (show.php) |
| CH (1) | CH609986A5 (show.php) |
| DE (1) | DE2442540C2 (show.php) |
| DK (1) | DK153845C (show.php) |
| FR (1) | FR2243198B1 (show.php) |
| GB (1) | GB1469830A (show.php) |
| NL (1) | NL180010C (show.php) |
| SE (1) | SE421127B (show.php) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5113788A (en) * | 1974-07-24 | 1976-02-03 | Sankyo Co | Beetaaa rakutamukoseibutsushitsuno arukokishudotaino seiho |
| JPS5159890A (en) * | 1974-11-15 | 1976-05-25 | Sankyo Co | 77 arukokishisefuarosuhorinjudotaino seizoho |
| US4197402A (en) * | 1976-08-09 | 1980-04-08 | Shionogi & Co., Ltd. | Cephalosporin analogues |
| EP0389176A3 (en) * | 1989-03-18 | 1992-01-15 | Beecham Group p.l.c. | Beta-lactams and processes for their preparation |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3780037A (en) * | 1971-11-29 | 1973-12-18 | Merck & Co Inc | Process for preparing cephalosporin compounds |
| US3775410A (en) * | 1971-11-29 | 1973-11-27 | B Christensen | Process for preparing cephalosporin compounds |
| US3843641A (en) * | 1971-11-29 | 1974-10-22 | Merck & Co Inc | Process for preparing penicillin and cephalosporin compounds |
| DE2221035C2 (de) * | 1972-04-28 | 1982-03-25 | Merck & Co., Inc., 07065 Rahway, N.J. | Verfahren zur Herstellung von substituierten 6-Iminopenicillinen und 7-Iminocephalosporinen |
| US3910902A (en) * | 1972-12-06 | 1975-10-07 | Squibb & Sons Inc | Method for preparing 7-substituted cephalosporins by replacement of oxygen containing groups |
| US3897424A (en) * | 1973-07-23 | 1975-07-29 | Lilly Co Eli | Process for 7-{62 -amino-7-{60 -methoxy-cephalosporanic acid esters and related compounds |
-
1973
- 1973-09-07 JP JP10085673A patent/JPS554115B2/ja not_active Expired
-
1974
- 1974-08-28 US US05/501,245 patent/US4016155A/en not_active Expired - Lifetime
- 1974-09-02 GB GB3828974A patent/GB1469830A/en not_active Expired
- 1974-09-04 CA CA208,401A patent/CA1052373A/en not_active Expired
- 1974-09-05 DE DE2442540A patent/DE2442540C2/de not_active Expired
- 1974-09-05 SE SE7411221A patent/SE421127B/xx not_active IP Right Cessation
- 1974-09-06 CH CH1218074A patent/CH609986A5/xx not_active IP Right Cessation
- 1974-09-06 DK DK471474A patent/DK153845C/da not_active IP Right Cessation
- 1974-09-09 NL NLAANVRAGE7411970,A patent/NL180010C/xx not_active IP Right Cessation
- 1974-09-09 FR FR7430460A patent/FR2243198B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DK471474A (da) | 1975-05-05 |
| NL180010C (nl) | 1986-12-16 |
| NL180010B (nl) | 1986-07-16 |
| GB1469830A (en) | 1977-04-06 |
| SE421127B (sv) | 1981-11-30 |
| SE7411221L (show.php) | 1975-03-10 |
| US4016155A (en) | 1977-04-05 |
| CA1052373A (en) | 1979-04-10 |
| DK153845B (da) | 1988-09-12 |
| DE2442540A1 (de) | 1975-03-13 |
| FR2243198A1 (show.php) | 1975-04-04 |
| JPS5050394A (show.php) | 1975-05-06 |
| JPS554115B2 (show.php) | 1980-01-29 |
| CH609986A5 (show.php) | 1979-03-30 |
| DE2442540C2 (de) | 1982-12-02 |
| NL7411970A (nl) | 1975-03-11 |
| FR2243198B1 (show.php) | 1979-10-12 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| SE429234B (sv) | Forfarande for framstellning av cefalosporinderivat | |
| DK145157C (da) | Analogifremgangsmaade til fremstilling af penicilliner | |
| BG25797A3 (bg) | Метод за получаване на азапуринони | |
| DK150514C (da) | Fremgangsmaade til fremstilling af et penicillin eller cephalosporin | |
| SE410607B (sv) | Sett att framstella pregnan-21-syraderivat | |
| DK343275A (da) | Fremgangsmade til fremstilling af cephalosporinderivater | |
| DK152673C (da) | Fremgangsmaade til fremstilling af nicotinonitril | |
| DK151810C (da) | Fremgangsmaade til fremstilling af cephalosporansyrederivater | |
| DK146539C (da) | Analogifremgangsmaade til fremstilling af 7alfa-methoxycephalosporin-derivater | |
| SE403373B (sv) | Sett att framstella aminosubstituerade tetracykliska foreningar | |
| BG26396A3 (bg) | Метод за получаване на поли-n-алкилиминоалани | |
| SE401187B (sv) | Sett att framstella delta4-3-ketosteroid-17-propiolakton | |
| DK153845C (da) | Fremgangsmaade til fremstilling af cephalosporin- eller penicillinderivater | |
| SE428802B (sv) | Forfarande for framstellning av cefalosporinderivat | |
| SE433850B (sv) | Forfarande for framstellning av cefalosporinderivat | |
| DK296175A (da) | Fremgangsmade til fremstilling af cephalosporinderivater | |
| SE416952B (sv) | Forfarande for framstellning av substituerade fenylamidinokarbamidforeningar | |
| DK435375A (da) | Fremgangsmade til fremstilling af cephalosporinderivater | |
| DK153394C (da) | Fremgangsmaade til fremstilling af alfa-6-deoxy-5-oxytetracyclin-forbindelser | |
| NO144018C (no) | Fremgangsmaate for fremstilling av heterocykliske forbindelser | |
| SE7703567L (sv) | Forfarande for framstellning av aminoacyldipeptidpenicilliner | |
| NO141721C (no) | Stabiliserte formmasser av polyoksymetylener | |
| SE7512658L (sv) | Forfarande for framstellning av penicillinderivat | |
| NO139788C (no) | Fremgangsmaate til fremstilling av antibiotikum a-27106 | |
| DK143027C (da) | Analogifremgangsmaade til fremstilling af isoxazolderivater |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PUP | Patent expired |