DK471474A - Cephalosporin-og penicillin-derivater og fremgangsmade til fremstilling deraf - Google Patents
Cephalosporin-og penicillin-derivater og fremgangsmade til fremstilling derafInfo
- Publication number
- DK471474A DK471474A DK471474A DK471474A DK471474A DK 471474 A DK471474 A DK 471474A DK 471474 A DK471474 A DK 471474A DK 471474 A DK471474 A DK 471474A DK 471474 A DK471474 A DK 471474A
- Authority
- DK
- Denmark
- Prior art keywords
- cephalosporine
- manufacturing procedures
- penicillin derivatives
- penicillin
- derivatives
- Prior art date
Links
- HOKIDJSKDBPKTQ-UHFFFAOYSA-N 3-(acetyloxymethyl)-7-[(5-amino-5-carboxypentanoyl)amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid Chemical compound S1CC(COC(=O)C)=C(C(O)=O)N2C(=O)C(NC(=O)CCCC(N)C(O)=O)C12 HOKIDJSKDBPKTQ-UHFFFAOYSA-N 0.000 title 1
- 238000004519 manufacturing process Methods 0.000 title 1
- 238000000034 method Methods 0.000 title 1
- 150000002960 penicillins Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP10085673 | 1973-09-07 | ||
| JP10085673A JPS554115B2 (da) | 1973-09-07 | 1973-09-07 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK471474A true DK471474A (da) | 1975-05-05 |
| DK153845B DK153845B (da) | 1988-09-12 |
| DK153845C DK153845C (da) | 1989-01-23 |
Family
ID=14284936
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK471474A DK153845C (da) | 1973-09-07 | 1974-09-06 | Fremgangsmaade til fremstilling af cephalosporin- eller penicillinderivater |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US4016155A (da) |
| JP (1) | JPS554115B2 (da) |
| CA (1) | CA1052373A (da) |
| CH (1) | CH609986A5 (da) |
| DE (1) | DE2442540C2 (da) |
| DK (1) | DK153845C (da) |
| FR (1) | FR2243198B1 (da) |
| GB (1) | GB1469830A (da) |
| NL (1) | NL180010C (da) |
| SE (1) | SE421127B (da) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS5113788A (en) * | 1974-07-24 | 1976-02-03 | Sankyo Co | Beetaaa rakutamukoseibutsushitsuno arukokishudotaino seiho |
| JPS5159890A (en) * | 1974-11-15 | 1976-05-25 | Sankyo Co | 77 arukokishisefuarosuhorinjudotaino seizoho |
| US4197402A (en) * | 1976-08-09 | 1980-04-08 | Shionogi & Co., Ltd. | Cephalosporin analogues |
| EP0389176A3 (en) * | 1989-03-18 | 1992-01-15 | Beecham Group p.l.c. | Beta-lactams and processes for their preparation |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3775410A (en) * | 1971-11-29 | 1973-11-27 | B Christensen | Process for preparing cephalosporin compounds |
| US3843641A (en) * | 1971-11-29 | 1974-10-22 | Merck & Co Inc | Process for preparing penicillin and cephalosporin compounds |
| US3780037A (en) * | 1971-11-29 | 1973-12-18 | Merck & Co Inc | Process for preparing cephalosporin compounds |
| DE2221035C2 (de) * | 1972-04-28 | 1982-03-25 | Merck & Co., Inc., 07065 Rahway, N.J. | Verfahren zur Herstellung von substituierten 6-Iminopenicillinen und 7-Iminocephalosporinen |
| US3910902A (en) * | 1972-12-06 | 1975-10-07 | Squibb & Sons Inc | Method for preparing 7-substituted cephalosporins by replacement of oxygen containing groups |
| US3897424A (en) * | 1973-07-23 | 1975-07-29 | Lilly Co Eli | Process for 7-{62 -amino-7-{60 -methoxy-cephalosporanic acid esters and related compounds |
-
1973
- 1973-09-07 JP JP10085673A patent/JPS554115B2/ja not_active Expired
-
1974
- 1974-08-28 US US05/501,245 patent/US4016155A/en not_active Expired - Lifetime
- 1974-09-02 GB GB3828974A patent/GB1469830A/en not_active Expired
- 1974-09-04 CA CA208,401A patent/CA1052373A/en not_active Expired
- 1974-09-05 DE DE2442540A patent/DE2442540C2/de not_active Expired
- 1974-09-05 SE SE7411221A patent/SE421127B/xx not_active IP Right Cessation
- 1974-09-06 DK DK471474A patent/DK153845C/da not_active IP Right Cessation
- 1974-09-06 CH CH1218074A patent/CH609986A5/xx not_active IP Right Cessation
- 1974-09-09 FR FR7430460A patent/FR2243198B1/fr not_active Expired
- 1974-09-09 NL NLAANVRAGE7411970,A patent/NL180010C/xx not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NL180010B (nl) | 1986-07-16 |
| FR2243198A1 (da) | 1975-04-04 |
| US4016155A (en) | 1977-04-05 |
| JPS554115B2 (da) | 1980-01-29 |
| DE2442540C2 (de) | 1982-12-02 |
| NL180010C (nl) | 1986-12-16 |
| JPS5050394A (da) | 1975-05-06 |
| CA1052373A (en) | 1979-04-10 |
| SE421127B (sv) | 1981-11-30 |
| CH609986A5 (da) | 1979-03-30 |
| DE2442540A1 (de) | 1975-03-13 |
| NL7411970A (nl) | 1975-03-11 |
| DK153845B (da) | 1988-09-12 |
| GB1469830A (en) | 1977-04-06 |
| SE7411221L (da) | 1975-03-10 |
| FR2243198B1 (da) | 1979-10-12 |
| DK153845C (da) | 1989-01-23 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| FI56611B (fi) | Aetbart korvskinn framstaellt av kollagen fraon skinn | |
| AT351592B (de) | Verstaerker | |
| FI65492B (fi) | Anordning foer detektering av elektromagnetiska vaogor | |
| SE405782B (sv) | Icke-linjer forsterkare | |
| SE405781B (sv) | Forsterkarkoppling | |
| FI55526B (fi) | Foerfarande foer metallaongbelaeggning av plastfolier | |
| AT343182B (de) | Verstarker | |
| DOP1974002166A (es) | Antilidas heterociclicas | |
| DK471474A (da) | Cephalosporin-og penicillin-derivater og fremgangsmade til fremstilling deraf | |
| DK582775A (da) | Cephalosporinderivater og fremgangsmade til fremstilling deraf | |
| FI53973B (fi) | Foerfarande foer framstaellning av 6-aminopenicillansyra | |
| FI54813B (fi) | Foerfarande foer framstaellning av kortfibrer fraon termoplaster | |
| FI56743B (fi) | Anordning foer spridning av ventilationsluft | |
| BR7403455D0 (pt) | Penicilinas | |
| FI53679C (fi) | Foerfarande foer framstaellning av skivor av traematerial | |
| FR2285127A1 (fr) | Penicillines | |
| BE821477A (fr) | Nouvelles penicillines | |
| FI56098C (fi) | Anvaendning av 1-etylimidazoler saosom fungicida vaextskyddsaemnen | |
| FI58365B (fi) | Foerfarande foer reglering av en pappersmaskin | |
| FI55021C (fi) | Framstaellning av alkalimetallamider | |
| BE813876A (fr) | Nouvelles penicillines | |
| FI53494C (fi) | Foerfarande foer framstaellning av staolstomme | |
| FI60197B (fi) | Nytt foerfarande foer framstaellning av bensamider | |
| IT1056242B (it) | Farmaco epatoprotettore | |
| SU483763A1 (ru) | Усилитель класса д |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PUP | Patent expired |