DK142875B - Fremgangsmåde til fremstilling af adenin. - Google Patents
Fremgangsmåde til fremstilling af adenin. Download PDFInfo
- Publication number
- DK142875B DK142875B DK171777A DK171777A DK142875B DK 142875 B DK142875 B DK 142875B DK 171777 A DK171777 A DK 171777A DK 171777 A DK171777 A DK 171777A DK 142875 B DK142875 B DK 142875B
- Authority
- DK
- Denmark
- Prior art keywords
- adenine
- reaction
- preparation
- diamino
- yield
- Prior art date
Links
- 229930024421 Adenine Natural products 0.000 title description 24
- GFFGJBXGBJISGV-UHFFFAOYSA-N Adenine Chemical compound NC1=NC=NC2=C1N=CN2 GFFGJBXGBJISGV-UHFFFAOYSA-N 0.000 title description 24
- 229960000643 adenine Drugs 0.000 title description 24
- 238000002360 preparation method Methods 0.000 title description 13
- 238000000034 method Methods 0.000 title description 9
- ZHNUHDYFZUAESO-UHFFFAOYSA-N Formamide Chemical compound NC=O ZHNUHDYFZUAESO-UHFFFAOYSA-N 0.000 description 22
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 21
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 20
- 238000006243 chemical reaction Methods 0.000 description 20
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 11
- 229910021529 ammonia Inorganic materials 0.000 description 10
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 8
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 239000002904 solvent Substances 0.000 description 8
- 150000003863 ammonium salts Chemical class 0.000 description 7
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- 239000003054 catalyst Substances 0.000 description 6
- QWPPOHNGKGFGJK-UHFFFAOYSA-N hypochlorous acid Chemical compound ClO QWPPOHNGKGFGJK-UHFFFAOYSA-N 0.000 description 6
- 239000000741 silica gel Substances 0.000 description 6
- 229910002027 silica gel Inorganic materials 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 5
- -1 ammonium halide Chemical class 0.000 description 5
- 125000003118 aryl group Chemical group 0.000 description 5
- 238000005984 hydrogenation reaction Methods 0.000 description 5
- KLMBASWITNCMTF-UHFFFAOYSA-N 2-phenyldiazenylpropanedinitrile Chemical compound N#CC(C#N)N=NC1=CC=CC=C1 KLMBASWITNCMTF-UHFFFAOYSA-N 0.000 description 4
- XVFXUMLDSMFSPX-UHFFFAOYSA-N 5-phenyl-2-(pyrimidin-2-yldiazenyl)pyrimidine-4,6-diamine Chemical compound N=1C(N)=C(C=2C=CC=CC=2)C(N)=NC=1N=NC1=NC=CC=N1 XVFXUMLDSMFSPX-UHFFFAOYSA-N 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 235000019270 ammonium chloride Nutrition 0.000 description 4
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 3
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 229910052739 hydrogen Inorganic materials 0.000 description 3
- 239000001257 hydrogen Substances 0.000 description 3
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000000126 substance Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 3
- 238000010626 work up procedure Methods 0.000 description 3
- USFZMSVCRYTOJT-UHFFFAOYSA-N Ammonium acetate Chemical compound N.CC(O)=O USFZMSVCRYTOJT-UHFFFAOYSA-N 0.000 description 2
- 239000005695 Ammonium acetate Substances 0.000 description 2
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 2
- 239000007868 Raney catalyst Substances 0.000 description 2
- 229910000564 Raney nickel Inorganic materials 0.000 description 2
- NPXOKRUENSOPAO-UHFFFAOYSA-N Raney nickel Chemical compound [Al].[Ni] NPXOKRUENSOPAO-UHFFFAOYSA-N 0.000 description 2
- 235000019257 ammonium acetate Nutrition 0.000 description 2
- 229940043376 ammonium acetate Drugs 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- DIOQZVSQGTUSAI-UHFFFAOYSA-N decane Chemical compound CCCCCCCCCC DIOQZVSQGTUSAI-UHFFFAOYSA-N 0.000 description 2
- 238000001035 drying Methods 0.000 description 2
- 235000019441 ethanol Nutrition 0.000 description 2
- 239000012065 filter cake Substances 0.000 description 2
- 239000012535 impurity Substances 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000012452 mother liquor Substances 0.000 description 2
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 2
- WSLDOOZREJYCGB-UHFFFAOYSA-N 1,2-Dichloroethane Chemical compound ClCCCl WSLDOOZREJYCGB-UHFFFAOYSA-N 0.000 description 1
- XZXYQEHISUMZAT-UHFFFAOYSA-N 2-[(2-hydroxy-5-methylphenyl)methyl]-4-methylphenol Chemical compound CC1=CC=C(O)C(CC=2C(=CC=C(C)C=2)O)=C1 XZXYQEHISUMZAT-UHFFFAOYSA-N 0.000 description 1
- GXDKXRIMUVUELI-UHFFFAOYSA-N 2-aminopropanedinitrile Chemical compound N#CC(N)C#N GXDKXRIMUVUELI-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- HYRMTKMNWGMXHV-UHFFFAOYSA-N 4-[2-(pyrimidin-2-yldiazenyl)pyrimidin-4-yl]benzene-1,3-diamine Chemical compound NC1=CC(N)=CC=C1C1=CC=NC(N=NC=2N=CC=CN=2)=N1 HYRMTKMNWGMXHV-UHFFFAOYSA-N 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-L Carbonate Chemical compound [O-]C([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-L 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- 229910002651 NO3 Inorganic materials 0.000 description 1
- NHNBFGGVMKEFGY-UHFFFAOYSA-N Nitrate Chemical compound [O-][N+]([O-])=O NHNBFGGVMKEFGY-UHFFFAOYSA-N 0.000 description 1
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 description 1
- CZPWVGJYEJSRLH-UHFFFAOYSA-N Pyrimidine Chemical compound C1=CN=CN=C1 CZPWVGJYEJSRLH-UHFFFAOYSA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- DHXVGJBLRPWPCS-UHFFFAOYSA-N Tetrahydropyran Chemical compound C1CCOCC1 DHXVGJBLRPWPCS-UHFFFAOYSA-N 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229940107816 ammonium iodide Drugs 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 125000004104 aryloxy group Chemical group 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 1
- 238000010531 catalytic reduction reaction Methods 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 125000004093 cyano group Chemical group *C#N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 230000003292 diminished effect Effects 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- 229910052736 halogen Inorganic materials 0.000 description 1
- 150000002367 halogens Chemical class 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 238000002955 isolation Methods 0.000 description 1
- 239000011133 lead Substances 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000004811 liquid chromatography Methods 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 150000007522 mineralic acids Chemical class 0.000 description 1
- 229910052757 nitrogen Inorganic materials 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 229910052697 platinum Inorganic materials 0.000 description 1
- 230000002028 premature Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000004064 recycling Methods 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 238000012958 reprocessing Methods 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229920006395 saturated elastomer Polymers 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 238000004809 thin layer chromatography Methods 0.000 description 1
- 239000003039 volatile agent Substances 0.000 description 1
Landscapes
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK171777A DK142875B (da) | 1977-04-19 | 1977-04-19 | Fremgangsmåde til fremstilling af adenin. |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK171777 | 1977-04-19 | ||
| DK171777A DK142875B (da) | 1977-04-19 | 1977-04-19 | Fremgangsmåde til fremstilling af adenin. |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK171777A DK171777A (cs) | 1978-10-20 |
| DK142875B true DK142875B (da) | 1981-02-16 |
| DK142875C DK142875C (cs) | 1981-09-21 |
Family
ID=8107480
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK171777A DK142875B (da) | 1977-04-19 | 1977-04-19 | Fremgangsmåde til fremstilling af adenin. |
Country Status (1)
| Country | Link |
|---|---|
| DK (1) | DK142875B (cs) |
-
1977
- 1977-04-19 DK DK171777A patent/DK142875B/da not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DK142875C (cs) | 1981-09-21 |
| DK171777A (cs) | 1978-10-20 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2122991A1 (de) | Cytidine | |
| WO2015180585A1 (en) | Method of producing thiamethoxam | |
| HUP0300241A2 (hu) | Eljárások torszemid intermedier előállítására | |
| DK142875B (da) | Fremgangsmåde til fremstilling af adenin. | |
| EP2303855B1 (en) | Catalytic process for asymmetric hydrogenation | |
| US3886176A (en) | Process for preparing imidazole-4,5-dicarboxamide | |
| US5686618A (en) | Method for preparing 3-amino-2-chloro-4-alkylpyridine or-4-arylpyridine | |
| HU198179B (en) | Process for producing n-methyl-1-alkylthio-2-nitroethenamine derivatives | |
| RU2238272C1 (ru) | Способ получения 1-алкил-6,6-диметил-2,4-диоксо-2,3,4,5,6,7-гексагидро-1h-индол-3-спиро-2-( 1-арил-3-ароил-4-гидрокси-5-оксо-2,5-дигидропирролов) | |
| US3494921A (en) | 1,4-disubstituted pyridazino(4,5-d) pyridazines | |
| NO312593B1 (no) | Fremgangsmåte til fremstilling av et deoksyuridinderivat | |
| WO2001017974A1 (en) | Process for preparing a 1-substituted 5-hydroxymethyl imidazole | |
| SU598900A1 (ru) | Способ получени производных 8-азаксантинов | |
| SU1011644A1 (ru) | Способ получени 1-алкил-4-нитроимидазолов | |
| EP0054892B1 (en) | Synthesis of indolines | |
| JPS6396175A (ja) | 2,4−ジアミノ −3−オキシ −6−ピペリジルピリミジンの製造方法 | |
| SU332632A1 (cs) | ||
| US5169955A (en) | Process for producing 2-hydroxyquinoxaline derivatives | |
| US4225719A (en) | Process for preparing 2-amino-5-formylthiazole and its hydrobromide salt | |
| KR20250117368A (ko) | (z)-3-(2-(5-브로모-1h-인돌-3-일)-2-시아노비닐)-4-메톡시벤조니트릴의제조 방법 | |
| IE45046B1 (en) | Method of producing 5-fluorouracil derivatives | |
| Bobkov et al. | Reaction of 8-bromotheophylline with pyridine and alkylpyridines. 8-Pyridiniotheophyllinates | |
| SU463672A1 (ru) | Способ получени гипоксантина или аденина | |
| KR20250073306A (ko) | 실로시빈 유도체의 개선된 합성 | |
| RU2243971C1 (ru) | Способ получения хлоридов 2,4-диалкилиндоло[2,3-h]-1-оксаазуления |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| B1 | Patent granted (law 1993) | ||
| PBP | Patent lapsed |