DK140283B - Fremgangsmåde til fremstilling af (+)-vincamin eller vincaminanaloger eller optiske antipoder af sådanne forbindelser. - Google Patents
Fremgangsmåde til fremstilling af (+)-vincamin eller vincaminanaloger eller optiske antipoder af sådanne forbindelser.Info
- Publication number
- DK140283B DK140283B DK224272AA DK224272A DK140283B DK 140283 B DK140283 B DK 140283B DK 224272A A DK224272A A DK 224272AA DK 224272 A DK224272 A DK 224272A DK 140283 B DK140283 B DK 140283B
- Authority
- DK
- Denmark
- Prior art keywords
- vincamine
- analogues
- compounds
- preparation
- optical antipodes
- Prior art date
Links
- RXPRRQLKFXBCSJ-GIVPXCGWSA-N vincamine Chemical compound C1=CC=C2C(CCN3CCC4)=C5[C@@H]3[C@]4(CC)C[C@](O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-GIVPXCGWSA-N 0.000 title 2
- 150000001875 compounds Chemical class 0.000 title 1
- RXPRRQLKFXBCSJ-UHFFFAOYSA-N dl-Vincamin Natural products C1=CC=C2C(CCN3CCC4)=C5C3C4(CC)CC(O)(C(=O)OC)N5C2=C1 RXPRRQLKFXBCSJ-UHFFFAOYSA-N 0.000 title 1
- 230000003287 optical effect Effects 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D471/00—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00
- C07D471/12—Heterocyclic compounds containing nitrogen atoms as the only ring hetero atoms in the condensed system, at least one ring being a six-membered ring with one nitrogen atom, not provided for by groups C07D451/00 - C07D463/00 in which the condensed system contains three hetero rings
- C07D471/14—Ortho-condensed systems
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D461/00—Heterocyclic compounds containing indolo [3,2,1-d,e] pyrido [3,2,1,j] [1,5]-naphthyridine ring systems, e.g. vincamine
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| HURI430A HU163143B (oth) | 1971-05-07 | 1971-05-07 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK140283B true DK140283B (da) | 1979-07-23 |
| DK140283C DK140283C (oth) | 1979-12-17 |
Family
ID=11000865
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK224272AA DK140283B (da) | 1971-05-07 | 1972-05-05 | Fremgangsmåde til fremstilling af (+)-vincamin eller vincaminanaloger eller optiske antipoder af sådanne forbindelser. |
Country Status (22)
| Country | Link |
|---|---|
| US (1) | US3755333A (oth) |
| JP (2) | JPS587636B1 (oth) |
| AT (1) | AT326838B (oth) |
| BE (1) | BE782973A (oth) |
| BG (1) | BG22840A3 (oth) |
| CA (1) | CA998051A (oth) |
| CH (1) | CH588490A5 (oth) |
| CS (1) | CS163277B2 (oth) |
| DD (1) | DD97889A5 (oth) |
| DK (1) | DK140283B (oth) |
| EG (1) | EG10514A (oth) |
| FI (1) | FI53823C (oth) |
| FR (1) | FR2143657B1 (oth) |
| GB (1) | GB1369934A (oth) |
| HU (1) | HU163143B (oth) |
| IL (1) | IL39304A (oth) |
| NL (1) | NL145859B (oth) |
| PL (1) | PL82316B1 (oth) |
| RO (3) | RO62705A7 (oth) |
| SE (1) | SE400288B (oth) |
| SU (1) | SU460626A3 (oth) |
| YU (1) | YU35022B (oth) |
Families Citing this family (20)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2176516B1 (oth) * | 1972-03-22 | 1975-03-14 | Synthelabo | |
| FR2179620B1 (oth) * | 1972-04-14 | 1975-12-26 | Roussel Uclaf | |
| FR2192107A1 (en) * | 1972-04-20 | 1974-02-08 | Sandoz Sa | Vincamine and apovincamine synthesis - via novel inters |
| FR2228479B1 (oth) * | 1973-05-07 | 1976-05-14 | Synthelabo | |
| FR2276048A1 (fr) * | 1974-06-27 | 1976-01-23 | Synthelabo | Nouveaux esters du cyclohexanol, leurs sels, leur preparation et les medicaments qui les renferment |
| HU171165B (hu) * | 1974-11-26 | 1977-11-28 | Richter Gedeon Vegyeszet | Sposob poluchenija proizvodnykh oktagidro-indolo-skobka-2,3-a-skobka zakryta-kinolizina |
| AU499923B2 (en) * | 1975-06-27 | 1979-05-03 | Richter Gedeon Vegyeszeti Gyar N | Indoloquinolizine derivatives & their production |
| HU175527B (hu) * | 1977-03-28 | 1980-08-28 | Richter Gedeon Vegyeszet | Sposob dlja totalsinteze slozhnykh efirov apovinkaminnojj kisloty i gomologov |
| US4131058A (en) * | 1977-10-06 | 1978-12-26 | R. A. Pearson Company | End tab folding mechanism for cartons |
| US4315011A (en) * | 1978-07-12 | 1982-02-09 | Richter Gedeon Vegyeszeti Gyar Rt. | 1-Alkyl-9-bromohexahydroindolo quinolizium salts and use thereof to increase blood flow |
| FR2459799A1 (fr) * | 1979-06-22 | 1981-01-16 | Synthelabo | Synthese de la ()-vincamine |
| HU181495B (en) * | 1979-05-31 | 1983-07-28 | Richter Gedeon Vegyeszet | Process for producing hydroxy-imino-eburnane derivatives |
| US4446139A (en) * | 1979-05-31 | 1984-05-01 | Richter Gedeon Vegyeszeti Gyar R.T. | Hexahydroindoloquinolizinium and octahydroindoloquinolizine esters, and method of increasing blood flow in an animal with hydroxyamino-eburnane derivatives |
| EP0025069B1 (de) * | 1979-09-06 | 1982-06-16 | Kali-Chemie Pharma GmbH | Neues Pentylspartein-Salz, dieses enthaltendes Arzneimittel und Verfahren zur Herstellung eines solchen Arzneimittels |
| IT1132307B (it) * | 1980-08-04 | 1986-07-02 | Mora Paolo Corvi | Procedimento per la sintesi di vincamina ed alcaloidi indolici correlati |
| HU186891B (en) * | 1981-06-12 | 1985-10-28 | Richter Gedeon Vegyeszet | Process for producing esters of apovincaminic acid |
| HU182380B (en) * | 1981-09-30 | 1983-12-28 | Richter Gedeon Vegyeszet | Process for producing esters of vincaminic acid |
| JPS6149779U (oth) * | 1984-09-04 | 1986-04-03 | ||
| JPS61154283U (oth) * | 1985-03-18 | 1986-09-25 | ||
| JPS6283088U (oth) * | 1985-11-14 | 1987-05-27 |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3454583A (en) * | 1965-07-19 | 1969-07-08 | Us Health Education & Welfare | Synthesis of vincamine |
| US3542796A (en) * | 1969-07-07 | 1970-11-24 | Miles Lab | Certain hexahydro-1,12-trimethylene-indolo(2,3-a)quinolizines |
-
1971
- 1971-05-07 HU HURI430A patent/HU163143B/hu unknown
-
1972
- 1972-04-25 EG EG166/72A patent/EG10514A/xx active
- 1972-04-25 IL IL39304A patent/IL39304A/en unknown
- 1972-04-26 GB GB1946773A patent/GB1369934A/en not_active Expired
- 1972-04-28 FR FR7215376A patent/FR2143657B1/fr not_active Expired
- 1972-05-01 CA CA140,932A patent/CA998051A/en not_active Expired
- 1972-05-02 US US00249492A patent/US3755333A/en not_active Expired - Lifetime
- 1972-05-03 BE BE782973A patent/BE782973A/xx not_active IP Right Cessation
- 1972-05-04 FI FI1269/72A patent/FI53823C/fi active
- 1972-05-04 SE SE7205901A patent/SE400288B/xx unknown
- 1972-05-04 YU YU1170/72A patent/YU35022B/xx unknown
- 1972-05-05 CH CH669672A patent/CH588490A5/xx not_active IP Right Cessation
- 1972-05-05 SU SU1783305A patent/SU460626A3/ru active
- 1972-05-05 CS CS3051A patent/CS163277B2/cs unknown
- 1972-05-05 PL PL1972155188A patent/PL82316B1/pl unknown
- 1972-05-05 DK DK224272AA patent/DK140283B/da unknown
- 1972-05-05 AT AT391472A patent/AT326838B/de not_active IP Right Cessation
- 1972-05-06 RO RO7200079743A patent/RO62705A7/ro unknown
- 1972-05-06 RO RO70791A patent/RO59092A/ro unknown
- 1972-05-06 RO RO7200079742A patent/RO62704A/ro unknown
- 1972-05-06 JP JP47044947A patent/JPS587636B1/ja active Granted
- 1972-05-06 BG BG020416A patent/BG22840A3/xx unknown
- 1972-05-08 NL NL727206174A patent/NL145859B/xx not_active IP Right Cessation
- 1972-05-08 DD DD162803A patent/DD97889A5/xx unknown
-
1981
- 1981-05-12 JP JP56070246A patent/JPS5827276B2/ja not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| CA998051A (en) | 1976-10-05 |
| CH588490A5 (oth) | 1977-06-15 |
| PL82316B1 (oth) | 1975-10-31 |
| RO59092A (oth) | 1976-05-15 |
| AU4176272A (en) | 1973-11-08 |
| IL39304A0 (en) | 1972-06-28 |
| YU117072A (en) | 1979-12-31 |
| FR2143657A1 (oth) | 1973-02-09 |
| HU163143B (oth) | 1973-06-28 |
| FI53823C (fi) | 1978-08-10 |
| NL145859B (nl) | 1975-05-15 |
| BG22840A3 (bg) | 1977-04-20 |
| GB1369934A (en) | 1974-10-09 |
| EG10514A (en) | 1976-05-31 |
| RO62704A (fr) | 1978-05-15 |
| JPS587636B1 (oth) | 1983-02-10 |
| IL39304A (en) | 1976-03-31 |
| ATA391472A (de) | 1975-03-15 |
| RO62705A7 (fr) | 1978-04-15 |
| CS163277B2 (oth) | 1975-08-29 |
| DD97889A5 (oth) | 1973-05-20 |
| SU460626A3 (ru) | 1975-02-15 |
| JPS5827276B2 (ja) | 1983-06-08 |
| FI53823B (fi) | 1978-05-02 |
| AT326838B (de) | 1975-12-29 |
| YU35022B (en) | 1980-06-30 |
| JPS5798282A (en) | 1982-06-18 |
| FR2143657B1 (oth) | 1975-02-07 |
| US3755333A (en) | 1973-08-28 |
| DK140283C (oth) | 1979-12-17 |
| NL7206174A (oth) | 1972-11-09 |
| DE2222186B2 (de) | 1977-06-30 |
| SE400288B (sv) | 1978-03-20 |
| BE782973A (oth) | 1972-09-01 |
| DE2222186A1 (de) | 1972-11-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK133751B (da) | Analogifremgangsmåde til fremstilling af benzopyraner. | |
| DK138419B (da) | Fremgangsmåde til fremstilling af 1alfa-hydroxycholecalciferol. | |
| DK140283B (da) | Fremgangsmåde til fremstilling af (+)-vincamin eller vincaminanaloger eller optiske antipoder af sådanne forbindelser. | |
| DK133976B (da) | Analogifremgangsmåde til fremstilling af tricykliske forbindelser eller disse forbindelsers additionssalte. | |
| DK128854B (da) | Analogifremgangsmåde til fremstilling af adenosinderivater. | |
| DK145059C (da) | Fremgangsmaade til fremstilling af 7alfa-substituerede cephalosporinforbindelser eller 6alfa-substituerede penicillinforbindelser | |
| DK131867B (da) | Analogifremgangsmåde til fremstilling af adenosinderivater. | |
| DK131287B (da) | Analogifremgangsmåde til fremstilling af 2-phenylimino-imidazolidiner eller syreadditionssalte deraf. | |
| DK129987B (da) | Analogifremgangsmåde til fremstilling af guanidiner. | |
| DK127119B (da) | Analogifremgangsmåde til fremstilling af 6-amino-9-benzylpurin-forbindelser. | |
| DK138641B (da) | Analogifremgangsmåde til fremstilling af tricycliske forbindelser eller syreadditionssalte deraf. | |
| DK133470B (da) | Fremgangsmåde til fremstilling af 3alfa-hydroxy-5alfa-steroider. | |
| DK130212B (da) | Analogifremgangsmåde til fremstilling af 7-aminoindazolderivater. | |
| DK138229B (da) | Fremgangsmåde til fremstilling af (+)(-)-eburnamonin. | |
| DK137757B (da) | Analogifremgangsmåde til fremstilling af pyridylpiperaziner eller syreadditionssalte deraf. | |
| DK131465B (da) | Analogifremgangsmåde til fremstilling af pyrimidinon-forbindelser. | |
| DK134915B (da) | Analogifremgangsmåde til fremstilling af N-halogenalkyl-N-nitrosocarbamater eller N4-halogenalkyl-N4-nitrosoallophanater af steroidforbindelser. | |
| DK131857B (da) | Analogifremgangsmåde til fremstilling af 4-hydroxymethyl-1-phthalazonderivater eller syreadditionssalte deraf. | |
| DK133975B (da) | Analogifremgangsmåde til fremstilling af aminspirodibenzocykloheptenforbindelser eller syreadditionssalte deraf. | |
| DK130745B (da) | Fremgangsmåde til fremstilling af transparente copolyamider. | |
| DK130344B (da) | Analogifremgangsmåde til fremstilling af benzofuranderivater eller syreadditionssalte deraf. | |
| DK129794B (da) | Analogifremgangsmåde til fremstilling af N-acyl-3-(piperazinoethyl)-pyrazoler. | |
| DK137897B (da) | Analogifremgangsmåde til fremstilling af tetrahydrocarbazoler eller syreadditionssalte heraf. | |
| DK133464B (da) | Analogifremgangsmåde til fremstilling af nitrosourinstofderivater. | |
| DK133682B (da) | Analogifremgangsmåde til fremstilling af 3alfa-hydroxy-5alfa-pregn-1-en-20-oner eller 3alfa-hydroxy-17beta-alkoxykarbonyl-5alfa-androst-1-ener. |