DK139912B - Insecticidt acaricidt og nematodicidt virksomme pyrimidinyl-(thiono) (thiol)-phosphor (phosphon)-syreestere eller esteramider til plantebeskyttelse eller andre tekniske formaal - Google Patents
Insecticidt acaricidt og nematodicidt virksomme pyrimidinyl-(thiono) (thiol)-phosphor (phosphon)-syreestere eller esteramider til plantebeskyttelse eller andre tekniske formaalInfo
- Publication number
- DK139912B DK139912B DK481375A DK481375A DK139912B DK 139912 B DK139912 B DK 139912B DK 481375 A DK481375 A DK 481375A DK 481375 A DK481375 A DK 481375A DK 139912 B DK139912 B DK 139912B
- Authority
- DK
- Denmark
- Prior art keywords
- insecticidic
- esteramids
- nematodicides
- phosphon
- efficients
- Prior art date
Links
- IVHVNMLJNASKHW-UHFFFAOYSA-M Chlorphonium chloride Chemical compound [Cl-].CCCC[P+](CCCC)(CCCC)CC1=CC=C(Cl)C=C1Cl IVHVNMLJNASKHW-UHFFFAOYSA-M 0.000 title 1
- -1 PYRIMIDINYL- (THIONO) Chemical class 0.000 title 1
- 239000000642 acaricide Substances 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 150000003573 thiols Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07F—ACYCLIC, CARBOCYCLIC OR HETEROCYCLIC COMPOUNDS CONTAINING ELEMENTS OTHER THAN CARBON, HYDROGEN, HALOGEN, OXYGEN, NITROGEN, SULFUR, SELENIUM OR TELLURIUM
- C07F9/00—Compounds containing elements of Groups 5 or 15 of the Periodic Table
- C07F9/02—Phosphorus compounds
- C07F9/547—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom
- C07F9/645—Heterocyclic compounds, e.g. containing phosphorus as a ring hetero atom having two nitrogen atoms as the only ring hetero atoms
- C07F9/6509—Six-membered rings
- C07F9/6512—Six-membered rings having the nitrogen atoms in positions 1 and 3
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Life Sciences & Earth Sciences (AREA)
- Biochemistry (AREA)
- General Health & Medical Sciences (AREA)
- Molecular Biology (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19742450951 DE2450951A1 (de) | 1974-10-26 | 1974-10-26 | Pyrimidinyl(thiono)(thiol)phosphor (phosphon)-saeureester bzw. -esteramide, verfahren zu ihrer herstellung und ihre verwendung als insektizide, akarizide und nematizide |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK481375A DK481375A (da) | 1976-04-27 |
| DK139912B true DK139912B (da) | 1979-05-14 |
Family
ID=5929250
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK481375A DK139912B (da) | 1974-10-26 | 1975-10-24 | Insecticidt acaricidt og nematodicidt virksomme pyrimidinyl-(thiono) (thiol)-phosphor (phosphon)-syreestere eller esteramider til plantebeskyttelse eller andre tekniske formaal |
Country Status (25)
| Country | Link |
|---|---|
| US (1) | US4053594A (OSRAM) |
| JP (2) | JPS5163946A (OSRAM) |
| AR (1) | AR206237A1 (OSRAM) |
| AT (1) | AT333310B (OSRAM) |
| AU (1) | AU8595675A (OSRAM) |
| BE (1) | BE834842A (OSRAM) |
| BR (1) | BR7506981A (OSRAM) |
| CH (1) | CH612685A5 (OSRAM) |
| DD (1) | DD125710A5 (OSRAM) |
| DE (1) | DE2450951A1 (OSRAM) |
| DK (1) | DK139912B (OSRAM) |
| ES (1) | ES442050A1 (OSRAM) |
| FR (1) | FR2289518A1 (OSRAM) |
| GB (1) | GB1465667A (OSRAM) |
| IE (1) | IE42174B1 (OSRAM) |
| IL (1) | IL48355A (OSRAM) |
| LU (1) | LU73647A1 (OSRAM) |
| NL (1) | NL7512438A (OSRAM) |
| NO (1) | NO753441L (OSRAM) |
| OA (1) | OA05143A (OSRAM) |
| PL (1) | PL95242B1 (OSRAM) |
| SE (1) | SE7511974L (OSRAM) |
| SU (1) | SU591125A3 (OSRAM) |
| TR (1) | TR18492A (OSRAM) |
| ZA (1) | ZA756697B (OSRAM) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE2501769A1 (de) * | 1975-01-17 | 1976-07-22 | Bayer Ag | Substituierte pyrimidinyl(thiono)(thiol)-phosphor (phosphon)-saeureester, verfahren zu ihrer herstellung sowie ihre verwendung als insektizide, akarizide und nematozide |
| DE2507702A1 (de) * | 1975-02-22 | 1976-09-02 | Bayer Ag | Pyrimidin(2)yl-thionophosphorsaeureester, verfahren zu ihrer herstellung sowie ihre verwendung als insektizide und akarizide |
| GB1561290A (en) * | 1975-10-16 | 1980-02-20 | Nyegaard & Co As | Pyrimid - 2 - ones |
| US4326058A (en) * | 1979-02-05 | 1982-04-20 | Sumitomo Chemical Company, Limited | Organo-phosphoric esters and their production and use |
| DE3426007A1 (de) * | 1984-07-14 | 1986-01-16 | Bayer Ag, 5090 Leverkusen | Pyrimidinyl-thionophosphorsaeureester |
| EP2497768B1 (en) * | 2009-11-02 | 2016-04-20 | SNU R & DB Foundation | Novel 2, 4-pyrimidine derivatives and use thereof |
| US10662740B2 (en) | 2016-04-14 | 2020-05-26 | Downing Wellhead Equipment, Llc | Valve apparatus |
| US10689938B2 (en) | 2017-12-14 | 2020-06-23 | Downing Wellhead Equipment, Llc | Subterranean formation fracking and well workover |
Family Cites Families (3)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3313814A (en) * | 1965-07-14 | 1967-04-11 | Stauffer Chemical Co | Phosphorus-containing esters of 2-thiomethyl mercapto pyrimidines |
| US3741968A (en) * | 1971-11-12 | 1973-06-26 | Hercules Inc | Certain o-(2-pyrimidyl) phosphates and their use as insecticides |
| US3823235A (en) * | 1971-11-12 | 1974-07-09 | Hercules Inc | Certain o-(2-pyrimidyl)phosphates and their use as insecticides |
-
1974
- 1974-10-26 DE DE19742450951 patent/DE2450951A1/de active Pending
-
1975
- 1975-01-01 AR AR260924A patent/AR206237A1/es active
- 1975-10-08 GB GB4124475A patent/GB1465667A/en not_active Expired
- 1975-10-10 NO NO753441A patent/NO753441L/no unknown
- 1975-10-16 SU SU752180262A patent/SU591125A3/ru active
- 1975-10-20 US US05/624,219 patent/US4053594A/en not_active Expired - Lifetime
- 1975-10-21 CH CH1362975A patent/CH612685A5/xx not_active IP Right Cessation
- 1975-10-23 IL IL48355A patent/IL48355A/xx unknown
- 1975-10-23 TR TR18492A patent/TR18492A/xx unknown
- 1975-10-23 AU AU85956/75A patent/AU8595675A/en not_active Expired
- 1975-10-23 NL NL7512438A patent/NL7512438A/xx not_active Application Discontinuation
- 1975-10-24 BE BE161226A patent/BE834842A/xx unknown
- 1975-10-24 IE IE2323/75A patent/IE42174B1/en unknown
- 1975-10-24 FR FR7532661A patent/FR2289518A1/fr active Granted
- 1975-10-24 JP JP50127574A patent/JPS5163946A/ja active Pending
- 1975-10-24 AT AT812675A patent/AT333310B/de not_active IP Right Cessation
- 1975-10-24 OA OA55644A patent/OA05143A/xx unknown
- 1975-10-24 PL PL1975184231A patent/PL95242B1/pl unknown
- 1975-10-24 BR BR7506981*A patent/BR7506981A/pt unknown
- 1975-10-24 JP JP50127573A patent/JPS5165777A/ja active Pending
- 1975-10-24 LU LU73647A patent/LU73647A1/xx unknown
- 1975-10-24 DD DD189044A patent/DD125710A5/xx unknown
- 1975-10-24 ES ES442050A patent/ES442050A1/es not_active Expired
- 1975-10-24 DK DK481375A patent/DK139912B/da unknown
- 1975-10-24 ZA ZA00756697A patent/ZA756697B/xx unknown
- 1975-10-27 SE SE7511974A patent/SE7511974L/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| US4053594A (en) | 1977-10-11 |
| CH612685A5 (OSRAM) | 1979-08-15 |
| NO753441L (OSRAM) | 1976-04-27 |
| NL7512438A (nl) | 1976-04-28 |
| BR7506981A (pt) | 1976-08-17 |
| IE42174L (en) | 1976-04-26 |
| GB1465667A (en) | 1977-02-23 |
| IL48355A0 (en) | 1975-12-31 |
| DK481375A (da) | 1976-04-27 |
| JPS5163946A (en) | 1976-06-02 |
| AT333310B (de) | 1976-11-10 |
| BE834842A (fr) | 1976-04-26 |
| FR2289518A1 (fr) | 1976-05-28 |
| AR206237A1 (es) | 1976-07-07 |
| IL48355A (en) | 1978-04-30 |
| OA05143A (fr) | 1981-01-31 |
| IE42174B1 (en) | 1980-06-18 |
| AU8595675A (en) | 1977-04-28 |
| JPS5165777A (en) | 1976-06-07 |
| SU591125A3 (ru) | 1978-01-30 |
| SE7511974L (sv) | 1976-04-27 |
| PL95242B1 (OSRAM) | 1977-09-30 |
| ES442050A1 (es) | 1977-04-01 |
| DD125710A5 (OSRAM) | 1977-05-11 |
| LU73647A1 (OSRAM) | 1976-08-19 |
| TR18492A (tr) | 1977-02-24 |
| ZA756697B (en) | 1976-10-27 |
| FR2289518B1 (OSRAM) | 1979-06-29 |
| DE2450951A1 (de) | 1976-05-06 |
| ATA812675A (de) | 1976-03-15 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| IT1031162B (it) | Impianto di distribuzione con convosliatori di scarico | |
| IT1031940B (it) | Apparecchio manipolatore | |
| DK143698C (da) | Analogifremgangsmaade til fremstilling af 1-aminoalkyl-2-aryl-cyclohexylalkoholer og estere eller salte deraf | |
| SE432009B (sv) | Plantetning eller -packning | |
| DK139596C (da) | Anlaeg til udvinding af metal | |
| DK50579A (da) | Anlaeg til haandtering af daasestumme | |
| DK139912B (da) | Insecticidt acaricidt og nematodicidt virksomme pyrimidinyl-(thiono) (thiol)-phosphor (phosphon)-syreestere eller esteramider til plantebeskyttelse eller andre tekniske formaal | |
| DK138124C (da) | Insecticidt,acaricidt og nematodicidt virksomme pyrimidinylthionophosphonsyreestere til anvendelse ved plantebeskyttelse og andre tekniske formaal | |
| DK137749C (da) | Insecticidt,nematodicidt og acaricidt virksomme n-sulfenylerede oximcarbamater til anvendelse ved plantebeskyttelse og andre tekniske formaal | |
| DK140019C (da) | Insecticidt,acaricidt og nematodicidt virksomme 1-fluor-2-halogen-ethyl-phosphor(phosphon)-syreestere til anvendelse ved plantebeskyttelse og andre tekniske formaal | |
| DK141052B (da) | Insecticidt akaricidt og nematodicidt virksomme o-(1-fluor-2-chlor-ethyl) (thiono) phosphor (phosphon)-syreesteramider til anvendelse ved plantebeskyttelse eller andre tekniske formaal | |
| SU513661A1 (ru) | Кассета дл растений | |
| DK138231B (da) | Insecticidt acaricidt og nematodicidt virksomme o-triazolyl-(thiono)-phosphor (phosphon)-syreestere eller esteramider til anvendelse ved plantebeskyttelse og andre tekniske formaal | |
| DK138271C (da) | Insecticidt,acaricidt og nematodicidt virksomme o-triazolyl-(thiono)-phosphor(phosphon,phosphin)-syreestere eller -esteramider til anvendelse ved plantebeskyttelse og andre tekniske formaal | |
| DK137063C (da) | Insecticidt og acaricidt virksomme o-triazolylthionophosphor(phosphon)-syreestere eller-esteramider | |
| DK136530B (da) | Insecticidt, acaricidt og nematodicidt virksomme 0-triazolyl(thiono)-phosphor(phosphon)-syreestere eller -esteramider | |
| TR18462A (tr) | Zararli bitki oeldueruecue madde | |
| SE7609840L (sv) | Plantetning | |
| AT338843B (de) | Rekuperatoranlage | |
| SU557025A1 (ru) | Способ укреплени пучка бревен | |
| DK530775A (da) | O-vinylthiono(thiol)phosphor(phosphon)-syreestere samt fremgangsmade til disses fremstilling og anvendelse | |
| DK533776A (da) | Fremgangsmade og anleg til fremstilling af genstande af agglomererede treagtige partikler | |
| IT1043092B (it) | Reattivo standardizzato per deter minazioni enzimataiche | |
| SU513460A1 (ru) | Электронна турбина | |
| SU522916A1 (ru) | Способ обработки плоскостей |