DK139198B - Analogifremgangsmåde til fremstilling af 5-nitro-imidazolcarbamater eller syreadditionssalte deraf. - Google Patents
Analogifremgangsmåde til fremstilling af 5-nitro-imidazolcarbamater eller syreadditionssalte deraf.Info
- Publication number
- DK139198B DK139198B DK348966AA DK348966A DK139198B DK 139198 B DK139198 B DK 139198B DK 348966A A DK348966A A DK 348966AA DK 348966 A DK348966 A DK 348966A DK 139198 B DK139198 B DK 139198B
- Authority
- DK
- Denmark
- Prior art keywords
- nitro
- preparation
- acid addition
- addition salts
- analogous process
- Prior art date
Links
- GEPNZFMLBLNJDW-UHFFFAOYSA-N C(N)(O)=O.[N+](=O)([O-])C1=CN=CN1 Chemical class C(N)(O)=O.[N+](=O)([O-])C1=CN=CN1 GEPNZFMLBLNJDW-UHFFFAOYSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D233/00—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings
- C07D233/54—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members
- C07D233/66—Heterocyclic compounds containing 1,3-diazole or hydrogenated 1,3-diazole rings, not condensed with other rings having two double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D233/91—Nitro radicals
- C07D233/92—Nitro radicals attached in position 4 or 5
- C07D233/94—Nitro radicals attached in position 4 or 5 with hydrocarbon radicals, substituted by oxygen or sulfur atoms, attached to other ring members
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Plural Heterocyclic Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen Condensed Heterocyclic Rings (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US47019065A | 1965-07-07 | 1965-07-07 | |
| US55092566A | 1966-05-18 | 1966-05-18 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK139198B true DK139198B (da) | 1979-01-08 |
| DK139198C DK139198C (enExample) | 1979-07-09 |
Family
ID=27043000
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK348966AA DK139198B (da) | 1965-07-07 | 1966-07-06 | Analogifremgangsmåde til fremstilling af 5-nitro-imidazolcarbamater eller syreadditionssalte deraf. |
Country Status (13)
| Country | Link |
|---|---|
| US (1) | US3458528A (enExample) |
| BE (1) | BE683795A (enExample) |
| BR (1) | BR6681061D0 (enExample) |
| CH (1) | CH498125A (enExample) |
| DE (1) | DE1620019A1 (enExample) |
| DK (1) | DK139198B (enExample) |
| ES (1) | ES329174A1 (enExample) |
| FI (1) | FI46071C (enExample) |
| GB (1) | GB1153346A (enExample) |
| IL (1) | IL25952A (enExample) |
| NL (1) | NL6609553A (enExample) |
| NO (1) | NO123529B (enExample) |
| SE (1) | SE328298B (enExample) |
Families Citing this family (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1670916A1 (de) * | 1967-08-29 | 1971-04-08 | Bayer Ag | Verfahren zur Herstellung neuartiger Carbamidsaeureester |
| FR2054504B1 (enExample) * | 1969-07-18 | 1973-06-08 | Rhone Poulenc Sa | |
| US3987053A (en) * | 1971-07-30 | 1976-10-19 | Gruppo Lepetit S.P.A. | 2-nitroimidazol derivatives |
| GB1408367A (en) * | 1972-07-03 | 1975-10-01 | Searle & Co | 2- 2-methyl-5-nitro-1-imidazolyl ethyl dithiocarbamates |
| US3976778A (en) * | 1973-08-13 | 1976-08-24 | Ciba-Geigy Corporation | Imidazoles and processes for their production |
| GB1542840A (en) * | 1975-02-03 | 1979-03-28 | Smith Kline French Lab | Heterocyclic dithiocarbamates and isothioureas |
| GB1526451A (en) * | 1976-01-27 | 1978-09-27 | Lepetit Spa | Alpha,alpha,1-trimethyl-2-nitroimidazole-5-methanol derivatives |
| DE2827351A1 (de) * | 1978-06-22 | 1980-01-10 | Basf Ag | 2-substituierte 1-alykl-nitroimidazole und verfahren zur herstellung von 2-substituierten 1-alkyl-nitroimidazolen |
| US20200031778A1 (en) | 2016-09-29 | 2020-01-30 | Bayer Cropscience Aktiengesellschaft | Novel 5-substituted imidazolylmethyl derivatives |
| CN109553580B (zh) * | 2017-09-25 | 2023-08-11 | 南京长澳医药科技有限公司 | 硝基咪唑类化合物中间体及其盐的制备方法 |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2944061A (en) * | 1957-09-20 | 1960-07-05 | Acyl derivatives and process | |
| US3104256A (en) * | 1962-03-01 | 1963-09-17 | American Home Prod | Alicyclic carbamate and its preparation |
| US3224862A (en) * | 1962-04-02 | 1965-12-21 | Monsanto Co | Controlling vegetation with phenylthionocarbamates |
| US3252986A (en) * | 1963-11-07 | 1966-05-24 | American Cyanamid Co | 2-carbethoxyaminobenzamides |
-
1966
- 1966-05-18 US US550925A patent/US3458528A/en not_active Expired - Lifetime
- 1966-06-12 IL IL25952A patent/IL25952A/xx unknown
- 1966-07-04 GB GB29844/66A patent/GB1153346A/en not_active Expired
- 1966-07-05 FI FI661795A patent/FI46071C/fi active
- 1966-07-06 DE DE19661620019 patent/DE1620019A1/de active Pending
- 1966-07-06 SE SE09273/66A patent/SE328298B/xx unknown
- 1966-07-06 NO NO163799A patent/NO123529B/no unknown
- 1966-07-06 ES ES0329174A patent/ES329174A1/es not_active Expired
- 1966-07-06 DK DK348966AA patent/DK139198B/da unknown
- 1966-07-06 BR BR181061/66A patent/BR6681061D0/pt unknown
- 1966-07-07 BE BE683795D patent/BE683795A/xx unknown
- 1966-07-07 NL NL6609553A patent/NL6609553A/xx unknown
- 1966-07-07 CH CH988766A patent/CH498125A/de not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| NO123529B (no) | 1971-12-06 |
| FI46071B (enExample) | 1972-08-31 |
| ES329174A1 (es) | 1967-05-01 |
| DE1620019A1 (de) | 1970-03-26 |
| BE683795A (enExample) | 1967-01-09 |
| SE328298B (enExample) | 1970-09-14 |
| NL6609553A (enExample) | 1967-01-09 |
| DK139198C (enExample) | 1979-07-09 |
| FI46071C (fi) | 1972-12-11 |
| IL25952A (en) | 1970-11-30 |
| US3458528A (en) | 1969-07-29 |
| GB1153346A (en) | 1969-05-29 |
| BR6681061D0 (pt) | 1973-12-26 |
| CH498125A (de) | 1970-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK112531B (da) | Fremgangsmåde til fremstilling af basisk substituerede phthalaner eller iso-chromaner eller syreadditionssalte deraf. | |
| DK125421B (da) | Analogifremgangsmåde til fremstilling af 5-substituerede-aza-dibenzo-cycloheptener eller syreadditionssalte deraf. | |
| DK125417B (da) | Analogifremgangsmåde til fremstilling af amino-dihalogenphenylethylaminer eller syreadditionssalte deraf. | |
| DK108972C (da) | Fremgangsmåde til fremstilling af lipoylpyridoxamin eller syreadditionssalte deraf. | |
| DK123022B (da) | Analogifremgangsmåde til fremstilling af amino-monohalogen-phenylethanolaminer eller syreadditionssalte deraf. | |
| DK108169C (da) | Fremgangsmåde til fremstilling af 3-hydroxy-5-aminomethyl-isoxasol eller syreadditionssalte deraf. | |
| DK120389B (da) | Fremgangsmåde til fremstilling af 2-cycloalkylaminooxazoliner eller syreadditionssalte deraf. | |
| DK117427B (da) | Fremgangsmåde til fremstilling af phenoxypropanolaminer eller syreadditionssalte deraf. | |
| DK120493B (da) | Analogifremgangsmåde til fremstilling af amino-halogen-benzylaminer eller syreadditionssalte heraf. | |
| DK139198B (da) | Analogifremgangsmåde til fremstilling af 5-nitro-imidazolcarbamater eller syreadditionssalte deraf. | |
| DK119059B (da) | Fremgangsmåde til fremstilling af 2-nitro-imidazolderivater eller syreadditionssalte deraf. | |
| DK114482B (da) | Analogifremgangsmåde til fremstilling af 7-(picolylaminoalkyl)-theophylliner eller syreadditionssalte deraf. | |
| DK129924B (da) | Analogifremgangsmåde til fremstilling af aminoalkylaminobenzophenonderivater eller syreadditionssalte deraf. | |
| DK125701B (da) | Analogifremgangsmåde til fremstilling af N-monosubstituerede 1-aminoindaner eller syreadditionssalte deraf. | |
| DK116662B (da) | Fremgangsmåde til fremstilling af pyrazinamider eller syreadditionssalte deraf. | |
| DK115840B (da) | Fremgangsmåde til fremstilling af phenylcyclohexylalkylaminer eller syreadditionssalte deraf. | |
| DK130587B (da) | Analogifremgangsmåde til fremstilling af difenylpyridazoner eller syreadditionssalt deraf. | |
| DK108394C (da) | Fremgangsmåde til fremstilling af substituerede imidazo- eller pyrimido-quinazoliner eller syreadditionssalte deraf. | |
| DK121171B (da) | Fremgangsmåde til fremstilling af benzensulfonyl-2-amino-Δ-2-tiazolin eller -3-amino-2-iminotiazolidin eller syreadditionssalte deraf. | |
| DK115696B (da) | Fremgangsmåde til fremstilling af 1-cycloalkylidenethyl-4-phenyl-piperidin eller syreadditionssalte heraf. | |
| DK121237B (da) | Fremgangsmåde til fremstilling af (alkylaminoætoksy)-dihalogenaniliner eller syreadditionssalte deraf. | |
| DK122877B (da) | Analogifremgangsmåde til fremstilling af fenylisopropylalkylaminderivater eller syreadditionssalte deraf. | |
| DK121555B (da) | Analogifremgangsmåde til fremstilling af 5-nitro-furfural-piperazinalkanoylhydrazoner eller syreadditionssalte deraf. | |
| DK105649C (da) | Fremgangsmåde til fremstilling af 2-dimethylaminopyrazin eller syreadditionssalte deraf. | |
| DK121603B (da) | Analogifremgangsmåde til fremstilling af arylcarbinoler eller syreadditionssalte deraf. |