DK138642B - Fremgangsmåde til fremstilling af stereoisomere af 1-(1'-(o-chlorbenzyl)-2'-pyrryl)-2-disek.-butylaminoethanol eller salte deraf. - Google Patents
Fremgangsmåde til fremstilling af stereoisomere af 1-(1'-(o-chlorbenzyl)-2'-pyrryl)-2-disek.-butylaminoethanol eller salte deraf.Info
- Publication number
- DK138642B DK138642B DK533472AA DK533472A DK138642B DK 138642 B DK138642 B DK 138642B DK 533472A A DK533472A A DK 533472AA DK 533472 A DK533472 A DK 533472A DK 138642 B DK138642 B DK 138642B
- Authority
- DK
- Denmark
- Prior art keywords
- butylaminoethanol
- disec
- pyrryl
- chlorobenzyl
- stereoisomers
- Prior art date
Links
- 125000006282 2-chlorobenzyl group Chemical group [H]C1=C([H])C(Cl)=C(C([H])=C1[H])C([H])([H])* 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/335—Radicals substituted by nitrogen atoms not forming part of a nitro radical
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D207/00—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom
- C07D207/02—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D207/30—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members
- C07D207/32—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/33—Heterocyclic compounds containing five-membered rings not condensed with other rings, with one nitrogen atom as the only ring hetero atom with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having two double bonds between ring members or between ring members and non-ring members with only hydrogen atoms, hydrocarbon or substituted hydrocarbon radicals, directly attached to ring carbon atoms with substituted hydrocarbon radicals, directly attached to ring carbon atoms
- C07D207/337—Radicals substituted by carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Pyrrole Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| IT3058571 | 1971-10-30 | ||
| IT3058771 | 1971-10-30 | ||
| IT3058871 | 1971-10-30 | ||
| IT3058671 | 1971-10-30 | ||
| IT2656472A IT1044847B (it) | 1972-07-04 | 1972-07-04 | Benzil pirril aminoetanolo dotato di attivita antagonista nei con fronti della capacita ad indurre dipendenza fisica di composti dotati di attivita analgesica |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK138642B true DK138642B (da) | 1978-10-09 |
| DK138642C DK138642C (member.php) | 1979-03-12 |
Family
ID=27517845
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK533472AA DK138642B (da) | 1971-10-30 | 1972-10-27 | Fremgangsmåde til fremstilling af stereoisomere af 1-(1'-(o-chlorbenzyl)-2'-pyrryl)-2-disek.-butylaminoethanol eller salte deraf. |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US3857857A (member.php) |
| JP (1) | JPS5418247B2 (member.php) |
| AR (1) | AR194281A1 (member.php) |
| AU (1) | AU475877B2 (member.php) |
| BE (1) | BE790747A (member.php) |
| CA (1) | CA974245A (member.php) |
| CH (1) | CH583194A5 (member.php) |
| CS (1) | CS174859B2 (member.php) |
| DE (1) | DE2253150C3 (member.php) |
| DK (1) | DK138642B (member.php) |
| FI (1) | FI54105C (member.php) |
| FR (1) | FR2158056B1 (member.php) |
| GB (1) | GB1405148A (member.php) |
| IE (1) | IE36907B1 (member.php) |
| IL (1) | IL40665A (member.php) |
| NL (1) | NL178073C (member.php) |
| NO (1) | NO137784C (member.php) |
| SE (1) | SE387940B (member.php) |
| SU (1) | SU533334A3 (member.php) |
| YU (1) | YU267272A (member.php) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE848465A (fr) * | 1976-11-18 | 1977-03-16 | Stereo-isomeres de 1-(1'-benzyl-2' pyrryl)-2-disec.butylaminoethanols a activite analgesique et preparations pharmaceutiques qui les contiennent | |
| ES2043943T3 (es) * | 1988-05-20 | 1994-01-01 | Zambon Spa | Procedimiento para la preparacion de compuestos con actividad analgesica central. |
| CA2721944C (en) * | 2008-04-24 | 2016-06-07 | F2G Ltd | Pyrrole antifungal agents |
| PL3221308T3 (pl) | 2014-11-21 | 2019-03-29 | F2G Limited | Środki przeciwgrzybicze |
| GB201609222D0 (en) | 2016-05-25 | 2016-07-06 | F2G Ltd | Pharmaceutical formulation |
| US11819503B2 (en) | 2019-04-23 | 2023-11-21 | F2G Ltd | Method of treating coccidioides infection |
Family Cites Families (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1544722A (fr) * | 1966-05-17 | 1968-11-08 | Whitefin Holding Sa | Dérivés du pyrrole et leur procédé de fabrication |
| GB1154745A (en) * | 1966-05-17 | 1969-06-11 | Whitefin Holding Sa | Haloketones |
-
0
- BE BE790747D patent/BE790747A/xx not_active IP Right Cessation
-
1972
- 1972-10-23 GB GB4878172A patent/GB1405148A/en not_active Expired
- 1972-10-24 US US00299726A patent/US3857857A/en not_active Expired - Lifetime
- 1972-10-25 IL IL40665A patent/IL40665A/xx unknown
- 1972-10-27 DK DK533472AA patent/DK138642B/da not_active IP Right Cessation
- 1972-10-27 SE SE7213899A patent/SE387940B/xx unknown
- 1972-10-27 AR AR244847A patent/AR194281A1/es active
- 1972-10-27 NL NLAANVRAGE7214580,A patent/NL178073C/xx not_active IP Right Cessation
- 1972-10-27 CA CA155,097A patent/CA974245A/en not_active Expired
- 1972-10-27 YU YU02672/72A patent/YU267272A/xx unknown
- 1972-10-27 NO NO3880/72A patent/NO137784C/no unknown
- 1972-10-30 SU SU1848312A patent/SU533334A3/ru active
- 1972-10-30 FI FI3006/72A patent/FI54105C/fi active
- 1972-10-30 CS CS7290A patent/CS174859B2/cs unknown
- 1972-10-30 CH CH1582572A patent/CH583194A5/xx not_active IP Right Cessation
- 1972-10-30 JP JP10808572A patent/JPS5418247B2/ja not_active Expired
- 1972-10-30 AU AU48321/72A patent/AU475877B2/en not_active Expired
- 1972-10-30 IE IE1460/72A patent/IE36907B1/xx unknown
- 1972-10-30 DE DE2253150A patent/DE2253150C3/de not_active Expired
- 1972-10-30 FR FR7238462A patent/FR2158056B1/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| IL40665A0 (en) | 1972-12-29 |
| NO137784C (no) | 1978-04-26 |
| IE36907L (en) | 1973-04-30 |
| FI54105B (fi) | 1978-06-30 |
| AR194281A1 (es) | 1973-06-29 |
| FR2158056B1 (member.php) | 1976-04-23 |
| BE790747A (fr) | 1973-02-15 |
| AU475877B2 (en) | 1976-09-09 |
| CH583194A5 (member.php) | 1976-12-31 |
| DE2253150C3 (de) | 1982-02-11 |
| NL7214580A (member.php) | 1973-05-02 |
| SU533334A3 (ru) | 1976-10-25 |
| US3857857A (en) | 1974-12-31 |
| NO137784B (no) | 1978-01-16 |
| CS174859B2 (member.php) | 1977-04-29 |
| JPS5418247B2 (member.php) | 1979-07-06 |
| DE2253150B2 (de) | 1981-03-19 |
| FR2158056A1 (member.php) | 1973-06-08 |
| IL40665A (en) | 1975-06-25 |
| SE387940B (sv) | 1976-09-20 |
| DE2253150A1 (de) | 1973-05-10 |
| DK138642C (member.php) | 1979-03-12 |
| NL178073B (nl) | 1985-08-16 |
| FI54105C (fi) | 1978-10-10 |
| JPS4852764A (member.php) | 1973-07-24 |
| GB1405148A (en) | 1975-09-03 |
| CA974245A (en) | 1975-09-09 |
| IE36907B1 (en) | 1977-03-16 |
| NL178073C (nl) | 1986-01-16 |
| YU267272A (en) | 1982-02-28 |
| AU4832172A (en) | 1974-05-02 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK143227C (da) | Analogifremgangsmaade til fremstilling af substituerede 2,2'-methylendiphenoler eller farmakologisk acceptable salte deraf | |
| DK131725B (da) | Analogifremgangsmåde til fremstilling af 2,4-diaminoquinazoliner eller salte deraf. | |
| DK132172B (da) | Analogifremgangsmåde til fremstilling af 6,7-benzomorphaner eller salte deraf. | |
| DK136060B (da) | Analogifremgangsmåde til fremstilling af 3-substituerede 1,4,5,6-tetrahydropyridiner eller salte deraf. | |
| DK140836B (da) | Analogifremgangsmåde til fremstilling af 1-(4-hydroxy-3-dimethylaminosulfonamidophenyl)-1-hydroxy-2-aminoethanderivater i form af racemater eller optiske antipoder, eller syreadditionssalte deraf. | |
| DK129650B (da) | Analogifremgangsmåde til fremstilling af 1-phenoxy-2-hydroxy-3-amino-propaner eller salte deraf. | |
| DK136213B (da) | Fremgangsmåde til fremstilling af d,d'-2,2'-(ethylendiimino)-di-1-butanol-dihydrochlorid. | |
| DK128078B (da) | Analogifremgangsmåde til fremstilling af 1,2,3,4-tetrahydroisoquinolinderivater eller salte deraf. | |
| AT320604B (de) | Verfahren zur Herstellung von (+)-2,2'-(Äthylendiimino)-di-butan-1-ol | |
| DK138020B (da) | Analogifremgangsmåde til fremstilling af pyrazolodiazepinforbindelser eller salte deraf. | |
| DK138642B (da) | Fremgangsmåde til fremstilling af stereoisomere af 1-(1'-(o-chlorbenzyl)-2'-pyrryl)-2-disek.-butylaminoethanol eller salte deraf. | |
| DK135503B (da) | Analogifremgangsmåde til fremstilling af 1-(sulfamoylfenyl)-pyrrolidinoner eller salte deraf. | |
| DK130978B (da) | Analogifremgangsmåde til fremstilling af 2-methylamino-4'-methyl-4-piperazinyl-6-chlor-5-methylthiopyrimidin eller salte deraf. | |
| DK138797B (da) | Analogifremgangsmåde til fremstilling af 1,4-benzodiazepin-derivater eller N-oxider eller salte deraf. | |
| DK132628C (da) | Analogifremgangsmade til fremstilling af 1-(2-delta2-imidazolinyl)-2,2-diarylcyclopropaner eller syreadditionssalte deraf | |
| DK131374B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepinderivater eller salte deraf. | |
| DK130837B (da) | Fremgangsmåde til fremstilling af 21-desoxy-21-N-(N'-metylpiperazinyl)-prednisolon eller mono-syreadditionssalte heraf. | |
| DK127778B (da) | Fremgangsmåde til fremstilling af 3',4'-dideoxy-kenamycin B. | |
| DK138425B (da) | Analogifremgangsmåde til fremstilling af 6-aza-3H-1,4-benzodiazepiner eller 6-aza-1,2-dihydro-3H-1,4-benzodiazepiner eller salte heraf. | |
| DK136906B (da) | Analogifremgangsmåde til fremstilling af dibenzoxyrenazepinderivater eller salte deraf. | |
| DK137954B (da) | Analogifremgangsmåde til fremstilling af substituerede piperidiner eller optisk aktive antipoder eller salte deraf. | |
| AT309421B (de) | Verfahren zur Herstellung von neuen 1-(1,3,4-Thiadiazol-2-yl)-imidazolininon-(2)-Derivaten | |
| DK136038B (da) | Analogifremgangsmåde til fremstilling af substituerede quinoliner eller salte deraf. | |
| DK137237B (da) | Analogifremgangsmåde til fremstilling af 1,4-benzodiazepinforbindelser eller 4-N-oxider eller salte heraf. | |
| DK139265B (da) | Analogifremgangsmåde til fremstilling af 1,2,4-oxadiazolforbindelser eller farmaceutisk acceptable salte deraf. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |