DK138497B - Analogifremgangsmåde til fremstilling af 4-hydroxy-4-(3,4-methylen-dioxyphenyl)piperidiner eller salte deraf. - Google Patents
Analogifremgangsmåde til fremstilling af 4-hydroxy-4-(3,4-methylen-dioxyphenyl)piperidiner eller salte deraf.Info
- Publication number
- DK138497B DK138497B DK485274AA DK485274A DK138497B DK 138497 B DK138497 B DK 138497B DK 485274A A DK485274A A DK 485274AA DK 485274 A DK485274 A DK 485274A DK 138497 B DK138497 B DK 138497B
- Authority
- DK
- Denmark
- Prior art keywords
- methylenedioxyphenyl
- piperidines
- hydroxy
- salts
- preparation
- Prior art date
Links
- GNFZJVBZEUFDSF-UHFFFAOYSA-N 4-(1,3-benzodioxol-5-yl)piperidin-4-ol Chemical class C=1C=C2OCOC2=CC=1C1(O)CCNCC1 GNFZJVBZEUFDSF-UHFFFAOYSA-N 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D317/00—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms
- C07D317/08—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3
- C07D317/44—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems
- C07D317/46—Heterocyclic compounds containing five-membered rings having two oxygen atoms as the only ring hetero atoms having the hetero atoms in positions 1 and 3 ortho- or peri-condensed with carbocyclic rings or ring systems condensed with one six-membered ring
- C07D317/48—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring
- C07D317/62—Methylenedioxybenzenes or hydrogenated methylenedioxybenzenes, unsubstituted on the hetero ring with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to atoms of the carbocyclic ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH1371873A CH583730A5 (enExample) | 1973-09-25 | 1973-09-25 |
Publications (3)
| Publication Number | Publication Date |
|---|---|
| DK485274A DK485274A (enExample) | 1975-05-12 |
| DK138497B true DK138497B (da) | 1978-09-18 |
| DK138497C DK138497C (enExample) | 1979-02-19 |
Family
ID=4394721
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK485274AA DK138497B (da) | 1973-09-25 | 1974-09-16 | Analogifremgangsmåde til fremstilling af 4-hydroxy-4-(3,4-methylen-dioxyphenyl)piperidiner eller salte deraf. |
Country Status (23)
| Country | Link |
|---|---|
| US (1) | US3982001A (enExample) |
| JP (1) | JPS5058079A (enExample) |
| AT (1) | AT349468B (enExample) |
| BE (1) | BE820240A (enExample) |
| CA (1) | CA1064035A (enExample) |
| CH (1) | CH583730A5 (enExample) |
| DD (1) | DD113912A5 (enExample) |
| DE (1) | DE2444972A1 (enExample) |
| DK (1) | DK138497B (enExample) |
| ES (1) | ES430319A0 (enExample) |
| FI (1) | FI270674A7 (enExample) |
| FR (1) | FR2244512B1 (enExample) |
| GB (1) | GB1478374A (enExample) |
| HU (1) | HU167977B (enExample) |
| IE (1) | IE41462B1 (enExample) |
| IL (1) | IL45702A (enExample) |
| NL (1) | NL7412446A (enExample) |
| NO (1) | NO743347L (enExample) |
| NZ (2) | NZ180745A (enExample) |
| PH (1) | PH11198A (enExample) |
| SE (1) | SE402292B (enExample) |
| SU (1) | SU531486A3 (enExample) |
| ZA (1) | ZA746101B (enExample) |
Families Citing this family (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4219560A (en) * | 1978-04-17 | 1980-08-26 | Sandoz, Inc. | Piperidine and pyrrolidine alcohols |
| GB8430581D0 (en) * | 1984-12-04 | 1985-01-09 | Ferrosan As | Treatment |
| EP0651746B1 (en) * | 1992-07-24 | 2002-03-27 | The Regents of the University of California | Drugs that enhance synaptic responses mediated by ampa receptors |
| US5852008A (en) * | 1995-01-24 | 1998-12-22 | The Regents Of The University Of California | Heteroatom substituted benzoyl derivatives that enhance synaptic response mediated by receptors |
| US6096763A (en) * | 1995-02-23 | 2000-08-01 | Merck & Co., Inc. | α1a adrenergic receptor antagonists |
| HU221921B1 (hu) * | 1996-07-08 | 2003-02-28 | Richter Gedeon Vegyészeti Gyár Rt. | N-benzil-piperidin- és tetrahidropiridinszármazékok és eljárás azok előállítására |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2880211A (en) * | 1959-03-31 | Chcoochj | ||
| NL93927C (enExample) * | 1954-12-28 | |||
| US2966491A (en) * | 1955-08-16 | 1960-12-27 | Merck & Co Inc | Nu-para substituted-phenylethyl-4-phenyl-4-carbalkoxy piperidines |
| US2978454A (en) * | 1955-09-12 | 1961-04-04 | Sterling Drug Inc | Lower alkyl-4-phenyl-1-[(diloweralkoxy phenyl)-aliphatic] piperidine-4-carboxylates |
| US3183235A (en) * | 1961-06-27 | 1965-05-11 | Sterling Drug Inc | 1-[3-, 2-, and 1-indolyl-lower-alkanoyl] piperidines |
| US3192229A (en) * | 1962-07-03 | 1965-06-29 | Colgate Palmolive Co | Phenylcyclopropyl amides |
| US3157650A (en) * | 1962-09-04 | 1964-11-17 | Cilag Chemie | Amides of 2-aryl-ethanoic acids |
| US3189600A (en) * | 1963-01-03 | 1965-06-15 | Ciba Geigy Corp | Alpha-halogen-gamma tertiary aminobutyrophenones and the corresponding thophenes |
-
1973
- 1973-09-25 CH CH1371873A patent/CH583730A5/xx not_active IP Right Cessation
-
1974
- 1974-09-16 DK DK485274AA patent/DK138497B/da unknown
- 1974-09-17 NO NO743347A patent/NO743347L/no unknown
- 1974-09-17 FI FI2706/74A patent/FI270674A7/fi unknown
- 1974-09-18 SE SE7411740A patent/SE402292B/xx unknown
- 1974-09-19 US US05/507,449 patent/US3982001A/en not_active Expired - Lifetime
- 1974-09-20 NL NL7412446A patent/NL7412446A/xx not_active Application Discontinuation
- 1974-09-20 DE DE19742444972 patent/DE2444972A1/de not_active Withdrawn
- 1974-09-23 CA CA209,774A patent/CA1064035A/en not_active Expired
- 1974-09-23 NZ NZ180745A patent/NZ180745A/xx unknown
- 1974-09-23 IE IE1967/74A patent/IE41462B1/en unknown
- 1974-09-23 IL IL45702A patent/IL45702A/xx unknown
- 1974-09-23 BE BE148810A patent/BE820240A/xx unknown
- 1974-09-23 HU HUWA306A patent/HU167977B/hu unknown
- 1974-09-23 PH PH16318A patent/PH11198A/en unknown
- 1974-09-23 ES ES430319A patent/ES430319A0/es active Pending
- 1974-09-23 NZ NZ175497A patent/NZ175497A/xx unknown
- 1974-09-24 DD DD181288A patent/DD113912A5/xx unknown
- 1974-09-24 FR FR7432203A patent/FR2244512B1/fr not_active Expired
- 1974-09-24 AT AT767974A patent/AT349468B/de not_active IP Right Cessation
- 1974-09-24 JP JP49108922A patent/JPS5058079A/ja active Pending
- 1974-09-24 GB GB4157774A patent/GB1478374A/en not_active Expired
- 1974-09-25 SU SU2071222A patent/SU531486A3/ru active
- 1974-09-25 ZA ZA00746101A patent/ZA746101B/xx unknown
Also Published As
| Publication number | Publication date |
|---|---|
| ZA746101B (en) | 1976-04-28 |
| GB1478374A (en) | 1977-06-29 |
| NZ180745A (en) | 1978-04-03 |
| FR2244512B1 (enExample) | 1977-11-04 |
| PH11198A (en) | 1977-10-28 |
| AU7365474A (en) | 1976-04-01 |
| IE41462B1 (en) | 1980-01-16 |
| IL45702A (en) | 1978-10-31 |
| NL7412446A (nl) | 1975-03-27 |
| HU167977B (en) | 1986-01-28 |
| CA1064035A (en) | 1979-10-09 |
| US3982001A (en) | 1976-09-21 |
| FR2244512A1 (enExample) | 1975-04-18 |
| SE402292B (sv) | 1978-06-26 |
| DK485274A (enExample) | 1975-05-12 |
| JPS5058079A (enExample) | 1975-05-20 |
| IE41462L (en) | 1975-03-25 |
| DD113912A5 (enExample) | 1975-07-05 |
| DE2444972A1 (de) | 1975-04-03 |
| IL45702A0 (en) | 1974-11-29 |
| FI270674A7 (enExample) | 1975-03-26 |
| SE7411740L (enExample) | 1975-03-26 |
| ES430319A0 (es) | 1977-02-01 |
| ATA767974A (de) | 1978-09-15 |
| SU531486A3 (ru) | 1976-10-05 |
| NO743347L (enExample) | 1975-04-21 |
| NZ175497A (en) | 1978-04-03 |
| AT349468B (de) | 1979-04-10 |
| DK138497C (enExample) | 1979-02-19 |
| CH583730A5 (enExample) | 1977-01-14 |
| BE820240A (fr) | 1975-03-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK137327B (da) | Analogifremgangsmåde til fremstilling af olefiniske 4-substituerede piperidinoderivater eller salte deraf. | |
| DK131725C (da) | Analogifremgangsmade til fremstilling af 2,4-diaminoquinazoliner eller salte deraf | |
| DK132172B (da) | Analogifremgangsmåde til fremstilling af 6,7-benzomorphaner eller salte deraf. | |
| DK140461B (da) | Analogifremgangsmåde til fremstilling af 8-azapurin-6-oner eller salte deraf. | |
| DK136060B (da) | Analogifremgangsmåde til fremstilling af 3-substituerede 1,4,5,6-tetrahydropyridiner eller salte deraf. | |
| DK128078B (da) | Analogifremgangsmåde til fremstilling af 1,2,3,4-tetrahydroisoquinolinderivater eller salte deraf. | |
| DK138020B (da) | Analogifremgangsmåde til fremstilling af pyrazolodiazepinforbindelser eller salte deraf. | |
| DK138497B (da) | Analogifremgangsmåde til fremstilling af 4-hydroxy-4-(3,4-methylen-dioxyphenyl)piperidiner eller salte deraf. | |
| DK136816B (da) | Analogifremgangsmåde til fremstilling af phenoxypropylaminderivater eller af deres salte. | |
| DK136470B (da) | Analogifremgangsmåde til fremstilling af 2,4-diamino-5-benzylpyrimidinderivater eller salte deraf. | |
| DK135683B (da) | Analogifremgangsmåde til fremstilling af 2,4-diamino-5-benzyl-pyrimidinderivater eller salte af disse forbindelser. | |
| DK140533B (da) | Analogifremgangsmåde til fremstilling af 4-hydroxy-2H-naphtho-(2,1-e)-1,2-thiazin-3-carboxamid-1, 1-dioxider såvel som salte deraf. | |
| DK138797B (da) | Analogifremgangsmåde til fremstilling af 1,4-benzodiazepin-derivater eller N-oxider eller salte deraf. | |
| DK140841B (da) | Analogifremgangsmåde til fremstilling af isoquinolinderivater eller salte deraf. | |
| DK128017B (da) | Fremgangsmåde til fremstilling af antibiotikum A 16886, dets komponenter A 16886I eller A 16886II eller salte heraf. | |
| DK133979B (da) | Analogifremgangsmåde til fremstilling af 5-methyl-10-(beta-alkylaminethyl)-dibenzo(b,f)-azepiner eller salte deraf. | |
| DK134233B (da) | Analogifremgangsmåde til fremstilling af substituerede benzimidazolinoner eller triazaspiro-/4,5/-decan-4-oner eller syreadditionssalte deraf. | |
| DK138449B (da) | Fremgangsmåde til fremstilling af D(-)-penicillamin eller salte deraf. | |
| DK135504B (da) | Analogifremgangsmåde til fremstilling af 6-substituerede 3-carbethoxyhydrazinopyridaziner eller salte deraf. | |
| DK137797B (da) | Analogifremgangsmåde til fremstilling af 2,4-diamino-5-benzylpyrimidinderivater eller salte deraf. | |
| DK133694B (da) | Analogifremgangsmåde til fremstilling af 4-imino-1,4-dihydropyridin-forbindelser eller salte deraf. | |
| DK134486B (da) | Analogifremgangsmåde til fremstilling af 3-hydrazonomethyl-rifamycin-derivater eller 25-desacetyl- eller 16, 17, 18, 19, 28, 29-hexahydroderivater deraf. | |
| DK131374B (da) | Fremgangsmåde til fremstilling af 1,4-benzodiazepinderivater eller salte deraf. | |
| DK135374B (da) | Analogifremgangsmåde til fremstilling af 2,4-diamino-5-benzylpyrimidiner eller syreadditionssalte deraf. | |
| DK136906B (da) | Analogifremgangsmåde til fremstilling af dibenzoxyrenazepinderivater eller salte deraf. |