DK125245B - Fremgangsmåde til fremstilling af γpiperidinobutyrophenonderivater eller syreadditionssalte deraf. - Google Patents
Fremgangsmåde til fremstilling af γpiperidinobutyrophenonderivater eller syreadditionssalte deraf.Info
- Publication number
- DK125245B DK125245B DK368170AA DK368170A DK125245B DK 125245 B DK125245 B DK 125245B DK 368170A A DK368170A A DK 368170AA DK 368170 A DK368170 A DK 368170A DK 125245 B DK125245 B DK 125245B
- Authority
- DK
- Denmark
- Prior art keywords
- γpiperidinobutyrophenone
- derivatives
- preparation
- acid addition
- addition salts
- Prior art date
Links
- WLTFPYVGECWXFO-UHFFFAOYSA-N 1-phenyl-4-piperidin-1-ylbutan-1-one Chemical class C=1C=CC=CC=1C(=O)CCCN1CCCCC1 WLTFPYVGECWXFO-UHFFFAOYSA-N 0.000 title 1
- 239000002253 acid Substances 0.000 title 1
- 150000003839 salts Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D295/00—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms
- C07D295/04—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms
- C07D295/10—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by doubly bound oxygen or sulphur atoms
- C07D295/104—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by doubly bound oxygen or sulphur atoms with the ring nitrogen atoms and the doubly bound oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings
- C07D295/108—Heterocyclic compounds containing polymethylene-imine rings with at least five ring members, 3-azabicyclo [3.2.2] nonane, piperazine, morpholine or thiomorpholine rings, having only hydrogen atoms directly attached to the ring carbon atoms with substituted hydrocarbon radicals attached to ring nitrogen atoms substituted by doubly bound oxygen or sulphur atoms with the ring nitrogen atoms and the doubly bound oxygen or sulfur atoms attached to the same carbon chain, which is not interrupted by carbocyclic rings to an acyclic saturated chain
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/08—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms
- C07D211/10—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms
- C07D211/14—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hydrocarbon or substituted hydrocarbon radicals directly attached to ring carbon atoms with radicals containing only carbon and hydrogen atoms attached to ring carbon atoms with hydrocarbon or substituted hydrocarbon radicals attached to the ring nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/40—Oxygen atoms
- C07D211/44—Oxygen atoms attached in position 4
- C07D211/52—Oxygen atoms attached in position 4 having an aryl radical as the second substituent in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK571871AA DK130965B (da) | 1970-03-20 | 1971-11-22 | Fremgangsmåde til fremstilling af gamma-piperidinobutyrophenonforbindelser eller syreadditionssalte deraf. |
| DK571771AA DK130964B (da) | 1970-03-07 | 1971-11-22 | Fremgangsmåde til fremstilling af gamma-piperidinobutyrophenonderivater eller syreadditionssalte deraf. |
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP5660769 | 1969-07-16 | ||
| JP6214669A JPS504670B1 (enrdf_load_stackoverflow) | 1969-08-05 | 1969-08-05 | |
| JP44062479A JPS504671B1 (enrdf_load_stackoverflow) | 1969-08-06 | 1969-08-06 | |
| JP1940070 | 1970-03-07 | ||
| JP2372370 | 1970-03-20 | ||
| FR7130087A FR2149291B2 (enrdf_load_stackoverflow) | 1969-07-16 | 1971-08-18 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK125245B true DK125245B (da) | 1973-01-22 |
Family
ID=27546325
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK368170AA DK125245B (da) | 1969-07-16 | 1970-07-15 | Fremgangsmåde til fremstilling af γpiperidinobutyrophenonderivater eller syreadditionssalte deraf. |
Country Status (7)
| Country | Link |
|---|---|
| BE (1) | BE753472A (enrdf_load_stackoverflow) |
| DK (1) | DK125245B (enrdf_load_stackoverflow) |
| FI (1) | FI52216C (enrdf_load_stackoverflow) |
| FR (2) | FR2059517B1 (enrdf_load_stackoverflow) |
| GB (1) | GB1304599A (enrdf_load_stackoverflow) |
| NL (1) | NL7010451A (enrdf_load_stackoverflow) |
| SE (1) | SE379348B (enrdf_load_stackoverflow) |
Families Citing this family (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE762563A (fr) * | 1970-02-06 | 1971-07-16 | Sumitomo Chemical Co | Derives de 1,2,3,4-tetrahydroisoquinoleine |
| JPS5755714B2 (enrdf_load_stackoverflow) * | 1972-03-18 | 1982-11-25 | ||
| FI58636C (fi) * | 1972-03-18 | 1981-03-10 | Sumitomo Chemical Co | Foerfarande foer framstaellning av butyrofenonderivat |
| JPS5116677A (ja) * | 1974-07-29 | 1976-02-10 | Sumitomo Chemical Co | Shinkinabuchirofuenonjudotai oyobi sonosanfukaennoseiho |
| JPS596304B2 (ja) * | 1975-11-18 | 1984-02-10 | 住友化学工業株式会社 | シンキナブチロフエノンユウドウタイノセイホウ |
| US4066772A (en) | 1975-07-21 | 1978-01-03 | Janssen Pharmaceutica N.V. | 1,3-Dihydro-1-[3-(1-piperidinyl)propyl]-2H-benzimidazol-2-ones and related compounds |
| US4175129A (en) | 1975-07-21 | 1979-11-20 | Janssen Pharmaceutica N.V. | Antiemetic 1-(benzoxazolylalkyl)-piperidine derivatives |
| US4126688A (en) * | 1976-05-17 | 1978-11-21 | Janssen Pharmaceutica N.V. | Antiemetic 1-(benzotriazolyl-alkyl)-piperidine derivatives |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR1459A (enrdf_load_stackoverflow) * | 1901-10-12 | |||
| FR1458901A (fr) * | 1958-04-22 | 1966-04-29 | Procédé de fabrication de dérivés aroylpipéridiniques et notamment de 1-aroyl alcoyl-4-aryl-4-pipéridinols | |
| DE1695194A1 (de) * | 1966-07-11 | 1971-03-18 | Hoffmann La Roche | Verfahren zur Herstellung von Piperidinderivaten |
| US3476762A (en) * | 1966-12-27 | 1969-11-04 | Aldrich Chem Co Inc | 4' - dimethylamino - 4 - (4 - hydroxy-4-phenyl piperidino)butyrophenones and 4 - (4-phenyl-4-hydroxy - piperidino)-1,1-ethylenedioxy - 1 - (4 - dimethylaminophenyl)butanes |
| US3439991A (en) * | 1967-01-20 | 1969-04-22 | George H Fathauer | Dryer control |
-
1970
- 1970-07-14 GB GB3417870A patent/GB1304599A/en not_active Expired
- 1970-07-14 FI FI701982A patent/FI52216C/fi active
- 1970-07-15 SE SE7009844A patent/SE379348B/xx unknown
- 1970-07-15 NL NL7010451A patent/NL7010451A/xx unknown
- 1970-07-15 DK DK368170AA patent/DK125245B/da not_active IP Right Cessation
- 1970-07-15 BE BE753472D patent/BE753472A/xx unknown
- 1970-07-15 FR FR7026007A patent/FR2059517B1/fr not_active Expired
-
1971
- 1971-08-18 FR FR7130087A patent/FR2149291B2/fr not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| GB1304599A (enrdf_load_stackoverflow) | 1973-01-24 |
| SE379348B (enrdf_load_stackoverflow) | 1975-10-06 |
| FI52216C (fi) | 1977-07-11 |
| FR2149291B2 (enrdf_load_stackoverflow) | 1975-10-31 |
| FI52216B (enrdf_load_stackoverflow) | 1977-03-31 |
| BE753472A (fr) | 1970-12-16 |
| FR2149291A2 (enrdf_load_stackoverflow) | 1973-03-30 |
| DE2033909A1 (de) | 1971-02-04 |
| FR2059517A1 (enrdf_load_stackoverflow) | 1971-06-04 |
| DE2033909B2 (de) | 1976-04-22 |
| NL7010451A (enrdf_load_stackoverflow) | 1971-01-19 |
| FR2059517B1 (enrdf_load_stackoverflow) | 1975-08-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK134984B (da) | Analogifremgangsmåde til fremstilling af alfa-alkylaminopropiophenoner eller syreadditionssalte heraf. | |
| DK124884B (da) | Analogifremgangsmåde til fremstilling af 2-brom-α-ergokryptin eller syreadditionssalte deraf. | |
| DK129446B (da) | Analogifremgangsmåde til fremstilling af fenoxyhydroxypropylaminer eller syreadditionssalte heraf. | |
| DK124547B (da) | Analogifremgangsmåde til fremstilling af (3-amino-2-hydroxy-propyloxy)-thiochromanderivater eller syreadditionssalte deraf. | |
| DK127556B (da) | Analogifremgangsmåde til fremstilling af quinazolinderivater eller syreadditionssalte deraf. | |
| DK139869B (da) | Analogifremgangsmåde til fremstilling af phenyl-imidazolyl-alkansyrederivater eller salte deraf. | |
| DK139717B (da) | Analogifremgangsmåde til fremstilling af beta-aryl-2-aminoalkoxystyroler eller syreadditionssalte heraf. | |
| DK135278B (da) | Analogifremgangsmåde til fremstilling af fenoksyisopropanolaminderivater eller syreadditionssalte deraf. | |
| DK136526B (da) | Analogifremgangsmåde til fremstilling af substituerede naphthylalkylaminer eller syreadditionssalte deraf. | |
| DK129577B (da) | Analogifremgangsmåde til fremstilling af phenacetylguanidiner eller syreadditionssalte deraf. | |
| DK127116B (da) | Analogifremgangsmåde til fremstilling af imidazolidinonderivater eller syreadditionssalte deraf. | |
| DK127644B (da) | Analogifremgangsmåde til fremstilling af ergopeptiner eller syreadditionssalte deraf. | |
| DK125245B (da) | Fremgangsmåde til fremstilling af γpiperidinobutyrophenonderivater eller syreadditionssalte deraf. | |
| DK129346B (da) | Analogifremgangsmåde til fremstilling af imidazolderivater eller syreadditionssalte deraf. | |
| DK125472B (da) | Analogifremgangsmåde til fremstilling af pyrimidopyridazinderivater eller syreadditionssalte deraf. | |
| DK126327B (da) | Analogifremgangsmåde til fremstilling af derivater af p-aminoalkylbenzensulfonamid eller syreadditionssalte deraf. | |
| DK120155B (da) | Analogifremgangsmåde til fremstilling af aminopropiofenoner eller syreadditionssalte deraf. | |
| DK138015B (da) | Fremgangsmåde til fremstilling af substituerede N-cycloalkyl-arylamino-imidazoliner-(2) eller syreadditionssalte deraf. | |
| DK129454B (da) | Analogifremgangsmåde til fremstilling af ergonorcornin eller syreadditionssalte deraf. | |
| DK129164B (da) | Analogifremgangsmåde til fremstilling af 3-alkyl-5-aryloxymethylisoxazoler eller syreadditionssalte deraf. | |
| DK135835B (da) | Analogifremgangsmåde til fremstilling af substituerede alkensyrederivater eller salte deraf. | |
| DK131727B (da) | Analogifremgangsmåde til fremstilling af oxazinobenzoxaziner eller syreadditionssalte deraf. | |
| DK131147B (da) | Fremgangsmåde til fremstilling af butyrophenonderivater eller syreadditionssalte deraf. | |
| DK127642B (da) | Analogifremgangsmåde til fremstilling af benzodioxanderivater eller syreadditionssalte deraf. | |
| DK127117B (da) | Analogifremgangsmåde til fremstilling af imidazolidinonderivater eller syreadditionssalte deraf. |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PBP | Patent lapsed |