DK118506B - Fremgangsmåde til fremstilling af 7-aminocephalosporansyre eller estere deraf. - Google Patents
Fremgangsmåde til fremstilling af 7-aminocephalosporansyre eller estere deraf.Info
- Publication number
- DK118506B DK118506B DK72864A DK72864A DK118506B DK 118506 B DK118506 B DK 118506B DK 72864 A DK72864 A DK 72864A DK 72864 A DK72864 A DK 72864A DK 118506 B DK118506 B DK 118506B
- Authority
- DK
- Denmark
- Prior art keywords
- esters
- preparation
- aminocephalosporanic acid
- aminocephalosporanic
- acid
- Prior art date
Links
- HSHGZXNAXBPPDL-HZGVNTEJSA-N 7beta-aminocephalosporanic acid Chemical compound S1CC(COC(=O)C)=C(C([O-])=O)N2C(=O)[C@@H]([NH3+])[C@@H]12 HSHGZXNAXBPPDL-HZGVNTEJSA-N 0.000 title 1
- 150000002148 esters Chemical class 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D501/00—Heterocyclic compounds containing 5-thia-1-azabicyclo [4.2.0] octane ring systems, i.e. compounds containing a ring system of the formula:, e.g. cephalosporins; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
- C07D501/14—Compounds having a nitrogen atom directly attached in position 7
- C07D501/16—Compounds having a nitrogen atom directly attached in position 7 with a double bond between positions 2 and 3
- C07D501/18—7-Aminocephalosporanic or substituted 7-aminocephalosporanic acids
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Cephalosporin Compounds (AREA)
Priority Applications (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19651545704 DE1545704C3 (de) | 1964-02-14 | 1965-10-07 | Verfahren zur Herstellung von 7-Aminocephalosporansäure |
| FR34084A FR89317E (fr) | 1964-02-14 | 1965-10-07 | Nouveau procédé de préparation de composés aminés, en particulier de l'acide 7-amino-céphalosporanique |
| IT2233965A IT1050651B (it) | 1964-02-14 | 1965-10-07 | Procedimento per produrre acido 7 amminocefalosporanico ed i suoi derivati |
| DK516765A DK141847B (da) | 1964-02-14 | 1965-10-08 | Fremgangsmåde til fremstilling af 7-amino-cephalosporansyre. |
| NL6513095A NL148610B (nl) | 1963-02-18 | 1965-10-08 | Werkwijze ter bereiding van cefalosporanzuur. |
| GB4310765A GB1119806A (en) | 1963-02-18 | 1965-10-11 | Process for the manufacture of 7-amino-cephalosporanic acid |
| US200511A US3697515A (en) | 1963-02-18 | 1971-11-19 | Process for splitting the 7-n-acyl group from cephalosporin compounds |
| US293906A US3875151A (en) | 1963-02-18 | 1972-10-02 | Process for the manufacture of amino-compounds |
Applications Claiming Priority (8)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| CH199263A CH433316A (de) | 1963-02-18 | 1963-02-18 | Neues Verfahren zur Herstellung von 7-Aminocephalosporanverbindungen |
| CH267563A CH504471A (de) | 1963-11-25 | 1963-03-01 | Neues Verfahren zur Herstellung von 7-Aminocephalosporanverbindungen |
| CH424963 | 1963-04-03 | ||
| CH735863 | 1963-06-13 | ||
| CH824663 | 1963-07-02 | ||
| CH1211263 | 1963-10-02 | ||
| CH1360063 | 1963-11-06 | ||
| CH73064 | 1964-01-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK118506B true DK118506B (da) | 1970-08-31 |
Family
ID=27570319
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK72864A DK118506B (da) | 1963-02-18 | 1964-02-14 | Fremgangsmåde til fremstilling af 7-aminocephalosporansyre eller estere deraf. |
Country Status (7)
| Country | Link |
|---|---|
| BE (1) | BE643899A (enExample) |
| BR (1) | BR6456924D0 (enExample) |
| DK (1) | DK118506B (enExample) |
| GB (1) | GB1041985A (enExample) |
| IT (1) | IT1060055B (enExample) |
| NL (1) | NL142165B (enExample) |
| SE (1) | SE347003B (enExample) |
Families Citing this family (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CH517119A (de) * | 1967-09-01 | 1971-12-31 | Ciba Geigy Ag | Neues Verfahren zur Herstellung von 7-Aminocephalosporansäure |
| GB1459212A (en) * | 1973-08-01 | 1976-12-22 | Glaxo Lab Ltd | N-deacylation of 7-acylamido-3-hydroxy-methyl cephalosporins |
| IE49377B1 (en) * | 1979-02-01 | 1985-10-02 | Lilly Co Eli | Process for preparation of beta-lactam compounds |
| AT378774B (de) * | 1982-08-06 | 1985-09-25 | Biochemie Gmbh | Verfahren zur deacylierung von penicillinen und cephalosporinen |
-
1964
- 1964-02-14 DK DK72864A patent/DK118506B/da unknown
- 1964-02-17 BE BE643899A patent/BE643899A/xx unknown
- 1964-02-17 NL NL6401421A patent/NL142165B/xx not_active IP Right Cessation
- 1964-02-17 SE SE190164A patent/SE347003B/xx unknown
- 1964-02-17 IT IT336364A patent/IT1060055B/it active
- 1964-02-18 GB GB679964A patent/GB1041985A/en not_active Expired
- 1964-02-18 BR BR15692464A patent/BR6456924D0/pt unknown
Also Published As
| Publication number | Publication date |
|---|---|
| IT1060055B (it) | 1982-07-10 |
| BE643899A (enExample) | 1964-08-17 |
| NL6401421A (enExample) | 1964-08-19 |
| SE347003B (enExample) | 1972-07-24 |
| BR6456924D0 (pt) | 1973-08-28 |
| NL142165B (nl) | 1974-05-15 |
| GB1041985A (en) | 1966-09-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK125421B (da) | Analogifremgangsmåde til fremstilling af 5-substituerede-aza-dibenzo-cycloheptener eller syreadditionssalte deraf. | |
| DK108972C (da) | Fremgangsmåde til fremstilling af lipoylpyridoxamin eller syreadditionssalte deraf. | |
| DK106797C (da) | Fremgangsmåde til fremstilling af 3-hydroxy-5-aminomethyl-isoxazol eller syreadditionssalte deraf. | |
| DK121855B (da) | Fremgangsmåde til fremstilling af trans-chrysantheminsyre eller estere eller nitriler deraf. | |
| DK111113B (da) | Fremgangsmåde til fremstilling af 3-methylflavon-8-carboxylsyre. | |
| DK124334B (da) | Fremgangsmåde til fremstilling af derivater af 7-aminocephalosporansyre. | |
| DK107357C (da) | Fremgangsmåde til fremstilling af basiske estere eller syreadditionssalte deraf. | |
| DK120493B (da) | Analogifremgangsmåde til fremstilling af amino-halogen-benzylaminer eller syreadditionssalte heraf. | |
| DK125701B (da) | Analogifremgangsmåde til fremstilling af N-monosubstituerede 1-aminoindaner eller syreadditionssalte deraf. | |
| DK111894B (da) | Fremgangsmåde til fremstilling af diphenylalkylaminer eller syreadditionssalte deraf. | |
| DK118506B (da) | Fremgangsmåde til fremstilling af 7-aminocephalosporansyre eller estere deraf. | |
| DK108730C (da) | Fremgangsmåde til fremstilling af basiske estere af substituerede α-phenylglycolsyrer eller syreadditionssalte deraf. | |
| DK108394C (da) | Fremgangsmåde til fremstilling af substituerede imidazo- eller pyrimido-quinazoliner eller syreadditionssalte deraf. | |
| DK118821B (da) | Fremgangsmåde til fremstilling af 7-amino-cephalosporansyre eller estere deraf. | |
| DK108973C (da) | Fremgangsmåde til fremstilling af kinolinforbindelser eller syreadditionssaltene deraf. | |
| DK116213B (da) | Fremgangsmåde til fremstilling af dibenzocycloheptenylestre eller syreadditionssalte heraf. | |
| DK113080B (da) | Fremgangsmåde til fremstilling af monophosphorsyreesteren af hexachlorophen eller salte heraf. | |
| DK111018B (da) | Fremgangsmåde til fremstilling af naphthoxypropanolaminestere eller syreadditionssalte deraf. | |
| DK105649C (da) | Fremgangsmåde til fremstilling af 2-dimethylaminopyrazin eller syreadditionssalte deraf. | |
| DK111893B (da) | Fremgangsmåde til fremstilling af substituerede methylhydraziner eller syreadditionssalte deraf. | |
| DK118235B (da) | Fremgangsmåde til fremstilling af acrylsyreestere. | |
| DK105112C (da) | Fremgangsmåde til fremstilling af 2-carbonhydridsubstituerede 17-oxygenerede-A-nor-5α-androstan-2-oler eller estere deraf. | |
| DK119309B (da) | Analogifremgangsmåde til fremstilling af phenylcyclohexylalkylaminer eller syreadditionssalte deraf. | |
| DK135037B (da) | Analogifremgangsmåde til fremstilling af amino-halogen-benzylaminer eller syreadditionssalte heraf. | |
| DK123863B (da) | Analogifremgangsmåde til fremstilling af N-monophenylethylneomycin B eller syreadditionssalte heraf. |