DK118403C - Alfa-aminopenicillinderivater og salte deraf til anvendelse som mellemprodukter ved fremstilling af alfa-aminopenicilliner. - Google Patents
Alfa-aminopenicillinderivater og salte deraf til anvendelse som mellemprodukter ved fremstilling af alfa-aminopenicilliner. Download PDFInfo
- Publication number
- DK118403C DK118403C DK400568AA DK400568A DK118403C DK 118403 C DK118403 C DK 118403C DK 400568A A DK400568A A DK 400568AA DK 400568 A DK400568 A DK 400568A DK 118403 C DK118403 C DK 118403C
- Authority
- DK
- Denmark
- Prior art keywords
- acid
- aminopenicillin
- derivatives
- amino
- salts
- Prior art date
Links
- 150000003839 salts Chemical class 0.000 title claims description 17
- 239000000543 intermediate Substances 0.000 title claims description 6
- 238000002360 preparation method Methods 0.000 title claims description 6
- -1 1,4-butylene Chemical group 0.000 claims description 34
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 15
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 6
- 229910052739 hydrogen Inorganic materials 0.000 claims description 4
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 4
- 239000001257 hydrogen Substances 0.000 claims description 3
- 125000000068 chlorophenyl group Chemical group 0.000 claims description 2
- 125000001301 ethoxy group Chemical group [H]C([H])([H])C([H])([H])O* 0.000 claims description 2
- 125000001207 fluorophenyl group Chemical group 0.000 claims description 2
- 125000004464 hydroxyphenyl group Chemical group 0.000 claims description 2
- 125000000956 methoxy group Chemical group [H]C([H])([H])O* 0.000 claims description 2
- 125000004372 methylthioethyl group Chemical group [H]C([H])([H])SC([H])([H])C([H])([H])* 0.000 claims description 2
- 125000006501 nitrophenyl group Chemical group 0.000 claims description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 32
- 239000000243 solution Substances 0.000 description 25
- 159000000000 sodium salts Chemical class 0.000 description 22
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 20
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 20
- 239000000203 mixture Substances 0.000 description 19
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- 239000002253 acid Substances 0.000 description 15
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 14
- 150000008064 anhydrides Chemical class 0.000 description 12
- 239000011734 sodium Substances 0.000 description 12
- NGHVIOIJCVXTGV-UHFFFAOYSA-N 6beta-amino-penicillanic acid Natural products OC(=O)C1C(C)(C)SC2C(N)C(=O)N21 NGHVIOIJCVXTGV-UHFFFAOYSA-N 0.000 description 11
- 239000011541 reaction mixture Substances 0.000 description 11
- NGHVIOIJCVXTGV-ALEPSDHESA-N 6-aminopenicillanic acid Chemical compound [O-]C(=O)[C@H]1C(C)(C)S[C@@H]2[C@H]([NH3+])C(=O)N21 NGHVIOIJCVXTGV-ALEPSDHESA-N 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 230000007062 hydrolysis Effects 0.000 description 9
- 238000006460 hydrolysis reaction Methods 0.000 description 9
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 9
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 8
- 229930182555 Penicillin Natural products 0.000 description 8
- 229910052783 alkali metal Inorganic materials 0.000 description 8
- 235000001014 amino acid Nutrition 0.000 description 7
- 150000001413 amino acids Chemical class 0.000 description 7
- 239000003054 catalyst Substances 0.000 description 7
- 238000001704 evaporation Methods 0.000 description 7
- 238000003756 stirring Methods 0.000 description 7
- 239000000725 suspension Substances 0.000 description 7
- SJRJJKPEHAURKC-UHFFFAOYSA-N N-Methylmorpholine Chemical compound CN1CCOCC1 SJRJJKPEHAURKC-UHFFFAOYSA-N 0.000 description 6
- JGSARLDLIJGVTE-MBNYWOFBSA-N Penicillin G Chemical compound N([C@H]1[C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)C(=O)CC1=CC=CC=C1 JGSARLDLIJGVTE-MBNYWOFBSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 6
- YRKCREAYFQTBPV-UHFFFAOYSA-N acetylacetone Chemical compound CC(=O)CC(C)=O YRKCREAYFQTBPV-UHFFFAOYSA-N 0.000 description 6
- AZUYLZMQTIKGSC-UHFFFAOYSA-N 1-[6-[4-(5-chloro-6-methyl-1H-indazol-4-yl)-5-methyl-3-(1-methylindazol-5-yl)pyrazol-1-yl]-2-azaspiro[3.3]heptan-2-yl]prop-2-en-1-one Chemical compound ClC=1C(=C2C=NNC2=CC=1C)C=1C(=NN(C=1C)C1CC2(CN(C2)C(C=C)=O)C1)C=1C=C2C=NN(C2=CC=1)C AZUYLZMQTIKGSC-UHFFFAOYSA-N 0.000 description 5
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 5
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 5
- 230000008020 evaporation Effects 0.000 description 5
- 238000000034 method Methods 0.000 description 5
- PAMIQIKDUOTOBW-UHFFFAOYSA-N 1-methylpiperidine Chemical compound CN1CCCCC1 PAMIQIKDUOTOBW-UHFFFAOYSA-N 0.000 description 4
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 4
- 150000007513 acids Chemical class 0.000 description 4
- ZGUNAGUHMKGQNY-UHFFFAOYSA-N alpha-phenylglycine Chemical compound OC(=O)C(N)C1=CC=CC=C1 ZGUNAGUHMKGQNY-UHFFFAOYSA-N 0.000 description 4
- 125000003277 amino group Chemical group 0.000 description 4
- 239000007864 aqueous solution Substances 0.000 description 4
- 238000006243 chemical reaction Methods 0.000 description 4
- YWEUIGNSBFLMFL-UHFFFAOYSA-N diphosphonate Chemical compound O=P(=O)OP(=O)=O YWEUIGNSBFLMFL-UHFFFAOYSA-N 0.000 description 4
- 229940049954 penicillin Drugs 0.000 description 4
- 150000002960 penicillins Chemical class 0.000 description 4
- DLYUQMMRRRQYAE-UHFFFAOYSA-N phosphorus pentoxide Inorganic materials O1P(O2)(=O)OP3(=O)OP1(=O)OP2(=O)O3 DLYUQMMRRRQYAE-UHFFFAOYSA-N 0.000 description 4
- 125000001424 substituent group Chemical group 0.000 description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- WRQNANDWMGAFTP-UHFFFAOYSA-N Methylacetoacetic acid Chemical compound COC(=O)CC(C)=O WRQNANDWMGAFTP-UHFFFAOYSA-N 0.000 description 3
- RWRDLPDLKQPQOW-UHFFFAOYSA-N Pyrrolidine Chemical compound C1CCNC1 RWRDLPDLKQPQOW-UHFFFAOYSA-N 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- AVKUERGKIZMTKX-NJBDSQKTSA-N ampicillin Chemical compound C1([C@@H](N)C(=O)N[C@H]2[C@H]3SC([C@@H](N3C2=O)C(O)=O)(C)C)=CC=CC=C1 AVKUERGKIZMTKX-NJBDSQKTSA-N 0.000 description 3
- 239000008346 aqueous phase Substances 0.000 description 3
- 150000001728 carbonyl compounds Chemical class 0.000 description 3
- 239000000460 chlorine Substances 0.000 description 3
- 229910052801 chlorine Inorganic materials 0.000 description 3
- NEHMKBQYUWJMIP-UHFFFAOYSA-N chloromethane Chemical compound ClC NEHMKBQYUWJMIP-UHFFFAOYSA-N 0.000 description 3
- 238000010168 coupling process Methods 0.000 description 3
- 239000013078 crystal Substances 0.000 description 3
- 125000004494 ethyl ester group Chemical group 0.000 description 3
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 3
- 238000000605 extraction Methods 0.000 description 3
- 239000000706 filtrate Substances 0.000 description 3
- 229910052500 inorganic mineral Inorganic materials 0.000 description 3
- 238000002844 melting Methods 0.000 description 3
- 230000008018 melting Effects 0.000 description 3
- 235000010755 mineral Nutrition 0.000 description 3
- 239000011707 mineral Substances 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- AVKUERGKIZMTKX-YXLKDIQASA-N (2s,5r)-6-[(2-amino-2-phenylacetyl)amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid Chemical compound C1([C@H]2SC([C@@H](N2C1=O)C(O)=O)(C)C)NC(=O)C(N)C1=CC=CC=C1 AVKUERGKIZMTKX-YXLKDIQASA-N 0.000 description 2
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- 150000001718 carbodiimides Chemical class 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000009833 condensation Methods 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- 230000008878 coupling Effects 0.000 description 2
- 238000005859 coupling reaction Methods 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 150000002081 enamines Chemical group 0.000 description 2
- XYIBRDXRRQCHLP-UHFFFAOYSA-N ethyl acetoacetate Chemical compound CCOC(=O)CC(C)=O XYIBRDXRRQCHLP-UHFFFAOYSA-N 0.000 description 2
- RIFGWPKJUGCATF-UHFFFAOYSA-N ethyl chloroformate Chemical compound CCOC(Cl)=O RIFGWPKJUGCATF-UHFFFAOYSA-N 0.000 description 2
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 2
- 239000012074 organic phase Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 238000010647 peptide synthesis reaction Methods 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 102000004196 processed proteins & peptides Human genes 0.000 description 2
- 108090000765 processed proteins & peptides Proteins 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 235000017557 sodium bicarbonate Nutrition 0.000 description 2
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- RXYPXQSKLGGKOL-UHFFFAOYSA-N 1,4-dimethylpiperazine Chemical compound CN1CCN(C)CC1 RXYPXQSKLGGKOL-UHFFFAOYSA-N 0.000 description 1
- NCXUNZWLEYGQAH-UHFFFAOYSA-N 1-(dimethylamino)propan-2-ol Chemical compound CC(O)CN(C)C NCXUNZWLEYGQAH-UHFFFAOYSA-N 0.000 description 1
- VCOJPHPOVDIRJK-UHFFFAOYSA-N 1-Methylpyrrolidine-2-methanol Chemical compound CN1CCCC1CO VCOJPHPOVDIRJK-UHFFFAOYSA-N 0.000 description 1
- AVFZOVWCLRSYKC-UHFFFAOYSA-N 1-methylpyrrolidine Chemical compound CN1CCCC1 AVFZOVWCLRSYKC-UHFFFAOYSA-N 0.000 description 1
- CVBUKMMMRLOKQR-UHFFFAOYSA-N 1-phenylbutane-1,3-dione Chemical compound CC(=O)CC(=O)C1=CC=CC=C1 CVBUKMMMRLOKQR-UHFFFAOYSA-N 0.000 description 1
- FKASAVXZZLJTNX-UHFFFAOYSA-N 2-(dimethylamino)acetic acid;hydrochloride Chemical compound [Cl-].C[NH+](C)CC(O)=O FKASAVXZZLJTNX-UHFFFAOYSA-N 0.000 description 1
- QQZOPKMRPOGIEB-UHFFFAOYSA-N 2-Oxohexane Chemical compound CCCCC(C)=O QQZOPKMRPOGIEB-UHFFFAOYSA-N 0.000 description 1
- LQLJZSJKRYTKTP-UHFFFAOYSA-N 2-dimethylaminoethyl chloride hydrochloride Chemical compound Cl.CN(C)CCCl LQLJZSJKRYTKTP-UHFFFAOYSA-N 0.000 description 1
- PYSGFFTXMUWEOT-UHFFFAOYSA-N 3-(dimethylamino)propan-1-ol Chemical compound CN(C)CCCO PYSGFFTXMUWEOT-UHFFFAOYSA-N 0.000 description 1
- GSNKRSKIWFBWEG-UHFFFAOYSA-N 3-ethylpentan-2-one Chemical compound CCC(CC)C(C)=O GSNKRSKIWFBWEG-UHFFFAOYSA-N 0.000 description 1
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- RENMDAKOXSCIGH-UHFFFAOYSA-N Chloroacetonitrile Chemical compound ClCC#N RENMDAKOXSCIGH-UHFFFAOYSA-N 0.000 description 1
- 239000004470 DL Methionine Substances 0.000 description 1
- BWLUMTFWVZZZND-UHFFFAOYSA-N Dibenzylamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=C1 BWLUMTFWVZZZND-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical class C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- SECXISVLQFMRJM-UHFFFAOYSA-N N-Methylpyrrolidone Chemical compound CN1CCCC1=O SECXISVLQFMRJM-UHFFFAOYSA-N 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- AHVYPIQETPWLSZ-UHFFFAOYSA-N N-methyl-pyrrolidine Natural products CN1CC=CC1 AHVYPIQETPWLSZ-UHFFFAOYSA-N 0.000 description 1
- OAICVXFJPJFONN-UHFFFAOYSA-N Phosphorus Chemical compound [P] OAICVXFJPJFONN-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- 239000005703 Trimethylamine hydrochloride Substances 0.000 description 1
- JVVXZOOGOGPDRZ-SLFFLAALSA-N [(1R,4aS,10aR)-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthren-1-yl]methanamine Chemical compound NC[C@]1(C)CCC[C@]2(C)C3=CC=C(C(C)C)C=C3CC[C@H]21 JVVXZOOGOGPDRZ-SLFFLAALSA-N 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 230000010933 acylation Effects 0.000 description 1
- 238000005917 acylation reaction Methods 0.000 description 1
- 238000005904 alkaline hydrolysis reaction Methods 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 150000001370 alpha-amino acid derivatives Chemical class 0.000 description 1
- 235000008206 alpha-amino acids Nutrition 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 239000012431 aqueous reaction media Substances 0.000 description 1
- JUHORIMYRDESRB-UHFFFAOYSA-N benzathine Chemical compound C=1C=CC=CC=1CNCCNCC1=CC=CC=C1 JUHORIMYRDESRB-UHFFFAOYSA-N 0.000 description 1
- 235000014121 butter Nutrition 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- PFKFTWBEEFSNDU-UHFFFAOYSA-N carbonyldiimidazole Chemical compound C1=CN=CN1C(=O)N1C=CN=C1 PFKFTWBEEFSNDU-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 239000000356 contaminant Substances 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 235000019253 formic acid Nutrition 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- FFEARJCKVFRZRR-UHFFFAOYSA-N methionine Chemical compound CSCCC(N)C(O)=O FFEARJCKVFRZRR-UHFFFAOYSA-N 0.000 description 1
- 235000006109 methionine Nutrition 0.000 description 1
- 229930182817 methionine Natural products 0.000 description 1
- CQDGTJPVBWZJAZ-UHFFFAOYSA-N monoethyl carbonate Chemical group CCOC(O)=O CQDGTJPVBWZJAZ-UHFFFAOYSA-N 0.000 description 1
- SFBHPFQSSDCYSL-UHFFFAOYSA-N n,n-dimethyltetradecan-1-amine Chemical compound CCCCCCCCCCCCCCN(C)C SFBHPFQSSDCYSL-UHFFFAOYSA-N 0.000 description 1
- 150000007524 organic acids Chemical class 0.000 description 1
- 230000037361 pathway Effects 0.000 description 1
- 235000019371 penicillin G benzathine Nutrition 0.000 description 1
- 229940056360 penicillin g Drugs 0.000 description 1
- 239000003208 petroleum Substances 0.000 description 1
- 229960003424 phenylacetic acid Drugs 0.000 description 1
- 239000003279 phenylacetic acid Substances 0.000 description 1
- 239000011574 phosphorus Substances 0.000 description 1
- 229910052698 phosphorus Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- MFDFERRIHVXMIY-UHFFFAOYSA-N procaine Chemical compound CCN(CC)CCOC(=O)C1=CC=C(N)C=C1 MFDFERRIHVXMIY-UHFFFAOYSA-N 0.000 description 1
- 229960004919 procaine Drugs 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 description 1
- 239000012429 reaction media Substances 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 125000000547 substituted alkyl group Chemical group 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 238000005809 transesterification reaction Methods 0.000 description 1
- SZYJELPVAFJOGJ-UHFFFAOYSA-N trimethylamine hydrochloride Chemical compound Cl.CN(C)C SZYJELPVAFJOGJ-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D499/00—Heterocyclic compounds containing 4-thia-1-azabicyclo [3.2.0] heptane ring systems, i.e. compounds containing a ring system of the formula:, e.g. penicillins, penems; Such ring systems being further condensed, e.g. 2,3-condensed with an oxygen-, nitrogen- or sulfur-containing hetero ring
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
- Nitrogen And Oxygen Or Sulfur-Condensed Heterocyclic Ring Systems (AREA)
Priority Applications (17)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB8176/63A GB991586A (en) | 1963-02-28 | 1963-02-28 | Process for the preparation of penicillins |
| BE644157D BE644157A (index.php) | 1963-02-28 | 1964-02-21 | |
| BR157033/64A BR6457033D0 (pt) | 1963-02-28 | 1964-02-24 | Um processo para a preparacao de aminoacetil-penicilinas |
| US347031A US3325479A (en) | 1963-02-28 | 1964-02-24 | Derivatives of aminoacylpenicillins and a process for their preparation |
| US347062A US3316247A (en) | 1963-02-28 | 1964-02-24 | Process for the preparation of penicillins |
| SE02309/64A SE337026B (index.php) | 1963-02-28 | 1964-02-25 | |
| CH238264A CH476018A (de) | 1963-02-28 | 1964-02-26 | Verfahren zur Herstellung von Penicillinen |
| AT165264A AT255647B (de) | 1963-02-28 | 1964-02-26 | Verfahren zur Herstellung von Penicillinen |
| CH337968A CH486488A (de) | 1963-02-28 | 1964-02-26 | Verfahren zur Herstellung von N-geschützten Penicillinen |
| YU28164A YU32993B (en) | 1963-02-28 | 1964-02-27 | Postupak za dobijanje penicilina |
| FR965343A FR1481029A (fr) | 1963-02-28 | 1964-02-27 | Procédé de préparation de pénicillines |
| DK98564A DK116283B (da) | 1963-02-28 | 1964-02-28 | Fremgangsmåde til fremstilling af α-aminopenicilliner eller salte deraf. |
| NL6401976A NL6401976A (index.php) | 1963-02-28 | 1964-02-28 | |
| FI640420A FI45662C (fi) | 1963-02-28 | 1964-02-28 | Menetelmä fysiologisesti arvokkaiden penisilliinien valmistamiseksi. |
| DE19641302847D DE1302847C2 (de) | 1963-02-28 | 1964-02-28 | Verfahren zur herstellung von alphaaminobenzylpenicillin |
| DK400568AA DK118403C (da) | 1963-02-28 | 1968-08-19 | Alfa-aminopenicillinderivater og salte deraf til anvendelse som mellemprodukter ved fremstilling af alfa-aminopenicilliner. |
| FI682460A FI47107C (fi) | 1963-02-28 | 1968-09-02 | Menetelmä penisilliinien valmistamiseksi. |
Applications Claiming Priority (5)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| GB817763 | 1963-02-28 | ||
| GB8176/63A GB991586A (en) | 1963-02-28 | 1963-02-28 | Process for the preparation of penicillins |
| GB4757763 | 1963-12-03 | ||
| DK98564A DK116283B (da) | 1963-02-28 | 1964-02-28 | Fremgangsmåde til fremstilling af α-aminopenicilliner eller salte deraf. |
| DK400568AA DK118403C (da) | 1963-02-28 | 1968-08-19 | Alfa-aminopenicillinderivater og salte deraf til anvendelse som mellemprodukter ved fremstilling af alfa-aminopenicilliner. |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DK118403B DK118403B (index.php) | 1970-08-17 |
| DK118403C true DK118403C (da) | 1983-03-07 |
Family
ID=27512829
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK400568AA DK118403C (da) | 1963-02-28 | 1968-08-19 | Alfa-aminopenicillinderivater og salte deraf til anvendelse som mellemprodukter ved fremstilling af alfa-aminopenicilliner. |
Country Status (11)
| Country | Link |
|---|---|
| US (2) | US3316247A (index.php) |
| AT (1) | AT255647B (index.php) |
| BE (1) | BE644157A (index.php) |
| BR (1) | BR6457033D0 (index.php) |
| CH (2) | CH476018A (index.php) |
| DE (1) | DE1302847C2 (index.php) |
| DK (1) | DK118403C (index.php) |
| FI (2) | FI45662C (index.php) |
| GB (1) | GB991586A (index.php) |
| NL (1) | NL6401976A (index.php) |
| SE (1) | SE337026B (index.php) |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1241844A (en) * | 1968-08-23 | 1971-08-04 | Beecham Group Ltd | Penicillins |
| GB1332306A (en) * | 1969-12-23 | 1973-10-03 | Glaxo Lab Ltd | Antibiotics |
| US4123611A (en) * | 1970-10-21 | 1978-10-31 | President Of Osaka University | N-protected amino compounds |
| FR2218340B1 (index.php) * | 1973-02-16 | 1978-09-29 | Rhone Poulenc Ind | |
| GB1494902A (en) * | 1974-05-09 | 1977-12-14 | Glaxo Lab Ltd | Penicillins |
| US4277465A (en) * | 1978-08-26 | 1981-07-07 | Kyoto Yakuhin Kogyo Kabushiki Kaisha | Adjuvant for promoting absorption of therapeutically active substances through the digestive tract |
| US4231954A (en) * | 1979-04-20 | 1980-11-04 | American Home Products Corporation | Dane salt and process for preparing aminopenicillins therefrom |
| US4301072A (en) * | 1979-04-20 | 1981-11-17 | American Home Products Corporation | Process for preparing aminopenicillins |
| US4317775A (en) * | 1980-01-07 | 1982-03-02 | Hoffmann-La Roche Inc. | Amoxicillin derivatives |
| US4366098A (en) * | 1980-11-26 | 1982-12-28 | American Home Products Corporation | Process for preparing aminopenicillins |
| IT1190897B (it) * | 1982-06-29 | 1988-02-24 | Opos Biochimica Srl | Procedimento per la preparazione dell'estere 1-etossicarbonilossietilico dell'acido 6-(d(-)-alfa aminoalfa fenilacetamido)-penicillanico |
| US4868297A (en) * | 1982-12-06 | 1989-09-19 | Pfizer Inc. | Process for preparing sultamicillin and analogs |
| GB2240102B (en) * | 1990-01-22 | 1993-10-20 | Biochemie Gmbh | Improvements in or relating to beta lactam production |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2985648A (en) * | 1958-10-06 | 1961-05-23 | Doyle Frank Peter | Alpha-aminobenzylpenicillins |
| US3007920A (en) * | 1960-10-28 | 1961-11-07 | Rech Et Ind Therapeutiques En | New 6-aminopenicillanic acid derivatives |
| US3053831A (en) * | 1961-05-05 | 1962-09-11 | American Home Prod | Dialkoxynaphthyl penicillins |
| US3173911A (en) * | 1961-10-30 | 1965-03-16 | Smith Kline French Lab | Process for the preparation of penicillin esters |
-
1963
- 1963-02-28 GB GB8176/63A patent/GB991586A/en not_active Expired
-
1964
- 1964-02-21 BE BE644157D patent/BE644157A/xx unknown
- 1964-02-24 US US347062A patent/US3316247A/en not_active Expired - Lifetime
- 1964-02-24 US US347031A patent/US3325479A/en not_active Expired - Lifetime
- 1964-02-24 BR BR157033/64A patent/BR6457033D0/pt unknown
- 1964-02-25 SE SE02309/64A patent/SE337026B/xx unknown
- 1964-02-26 CH CH238264A patent/CH476018A/de not_active IP Right Cessation
- 1964-02-26 AT AT165264A patent/AT255647B/de active
- 1964-02-26 CH CH337968A patent/CH486488A/de not_active IP Right Cessation
- 1964-02-28 DE DE19641302847D patent/DE1302847C2/de not_active Expired
- 1964-02-28 FI FI640420A patent/FI45662C/fi active
- 1964-02-28 NL NL6401976A patent/NL6401976A/xx unknown
-
1968
- 1968-08-19 DK DK400568AA patent/DK118403C/da active
- 1968-09-02 FI FI682460A patent/FI47107C/fi active
Also Published As
| Publication number | Publication date |
|---|---|
| DE1302847C2 (de) | 1973-01-04 |
| AT255647B (de) | 1967-07-10 |
| BE644157A (index.php) | 1964-06-15 |
| GB991586A (en) | 1965-05-12 |
| DE1302847B (index.php) | 1972-06-08 |
| FI47107C (fi) | 1973-09-10 |
| NL6401976A (index.php) | 1964-08-31 |
| FI47107B (index.php) | 1973-05-31 |
| CH476018A (de) | 1969-07-31 |
| SE337026B (index.php) | 1971-07-26 |
| FI45662B (index.php) | 1972-05-02 |
| CH486488A (de) | 1970-02-28 |
| BR6457033D0 (pt) | 1973-08-14 |
| DK118403B (index.php) | 1970-08-17 |
| FI45662C (fi) | 1972-08-10 |
| US3316247A (en) | 1967-04-25 |
| US3325479A (en) | 1967-06-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK118403C (da) | Alfa-aminopenicillinderivater og salte deraf til anvendelse som mellemprodukter ved fremstilling af alfa-aminopenicilliner. | |
| US2734904A (en) | Xcxnhxc-nh | |
| US4486358A (en) | Process for producing N-phosphonomethylglycine | |
| US3322785A (en) | Substituted isoindolenine derivatives | |
| EP0276329B1 (en) | 2,3-diaminoacrylonitrile derivatives | |
| US4587356A (en) | Process for the production of nuclear substituted cinnamoylanthranilic acid derivatives | |
| US3103513A (en) | Process for preparing hexadehy- | |
| US2749346A (en) | Tetrahydropyridine compounds | |
| US3433802A (en) | 3-(n-lower-alkylanilino)pyrrolidines | |
| JPS61183263A (ja) | ピロリジン誘導体の製造方法 | |
| US4250313A (en) | Process for preparing 4-piperidone spiroketal compounds | |
| AU680989B2 (en) | Method of preparing 6-aryloxymethyl-1-hydroxy-4-methyl-2-pyridones | |
| KR20010030637A (ko) | 아미노피페라진 유도체의 신규한 제조방법 | |
| KR920005828B1 (ko) | 2-[(2-아미노에틸)-티오메틸]-5-디메틸아미노메틸 푸란의 산부가염의 제조방법 | |
| DK141502B (da) | Fremgangsmåde til fremstilling af en 7-acylamido-3-methyl-3-cephem-4-carboxylsyreester. | |
| EP0146102A2 (en) | Process for preparing benzothiazine compounds | |
| US3535337A (en) | 1-p-chlorobenzoyl-2-methyl-3-metallo-methyl indoles | |
| KR100515905B1 (ko) | 피롤아미드의 새로운 제조방법 | |
| US3997558A (en) | Process of producing 1-acyl-2-methyl-indolyl-3-alkanoic acids | |
| EP0163506B1 (en) | Process for the preparation of a pyridil-propanoic acid | |
| SU617010A3 (ru) | Способ получени бис-(2-метил-3окси-5-винилпиридил-4-метил)дисульфида или его солей | |
| US1075581A (en) | Anhydrid of salicylic acid and process of preparing the same. | |
| KR910007966B1 (ko) | 염기성 티오에테르 및 그의 염의 제조방법 | |
| US2517496A (en) | Preparation of symmetrical monoaminodihydroxytoluene | |
| SU253685A1 (ru) | Способ получения замещенных карбоксамидотиазолов |