DK105708C - Fremgangsmåde til fremstilling af vanduopløselige monoazofarvestoffer. - Google Patents
Fremgangsmåde til fremstilling af vanduopløselige monoazofarvestoffer.Info
- Publication number
- DK105708C DK105708C DK191164AA DK641164A DK105708C DK 105708 C DK105708 C DK 105708C DK 191164A A DK191164A A DK 191164AA DK 641164 A DK641164 A DK 641164A DK 105708 C DK105708 C DK 105708C
- Authority
- DK
- Denmark
- Prior art keywords
- preparation
- water
- monoazo dyes
- insoluble monoazo
- insoluble
- Prior art date
Links
- 239000000975 dye Substances 0.000 title 1
- NYGZLYXAPMMJTE-UHFFFAOYSA-M metanil yellow Chemical group [Na+].[O-]S(=O)(=O)C1=CC=CC(N=NC=2C=CC(NC=3C=CC=CC=3)=CC=2)=C1 NYGZLYXAPMMJTE-UHFFFAOYSA-M 0.000 title 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08K—Use of inorganic or non-macromolecular organic substances as compounding ingredients
- C08K5/00—Use of organic ingredients
- C08K5/16—Nitrogen-containing compounds
- C08K5/34—Heterocyclic compounds having nitrogen in the ring
- C08K5/3442—Heterocyclic compounds having nitrogen in the ring having two nitrogen atoms in the ring
- C08K5/3445—Five-membered rings
- C08K5/3447—Five-membered rings condensed with carbocyclic rings
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Coloring (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF39512A DE1281606B (de) | 1963-04-18 | 1963-04-18 | Verfahren zur Herstellung von wasserunloeslichen Monoazofarbstoffen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DK105708C true DK105708C (da) | 1966-10-31 |
Family
ID=7097803
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DK191164AA DK105708C (da) | 1963-04-18 | 1964-04-17 | Fremgangsmåde til fremstilling af vanduopløselige monoazofarvestoffer. |
Country Status (7)
| Country | Link |
|---|---|
| US (1) | US3328384A (enExample) |
| AT (1) | AT246875B (enExample) |
| BE (1) | BE646790A (enExample) |
| DE (1) | DE1281606B (enExample) |
| DK (1) | DK105708C (enExample) |
| GB (1) | GB1039962A (enExample) |
| NL (1) | NL6404017A (enExample) |
Families Citing this family (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE1808015C3 (de) * | 1968-11-09 | 1973-11-15 | Farbwerke Hoechst Ag, Vormals Meister Lucius & Bruening, 6000 Frankfurt | Wasserunlösliche Monoazofarbstoffe, Verfahren zu ihrer Herstellung und Ver wendung |
| US4024124A (en) * | 1969-08-02 | 1977-05-17 | Hoechst Aktiengesellschaft | Monoazo acetoacetylaminobenzimidazolone pigments containing carboxy group |
| DE1955808A1 (de) * | 1969-11-06 | 1971-06-09 | Hoechst Ag | Neue wasserunloesliche Monoazofarbstoffe und Verfahren zu ihrer Herstellung |
| US4150019A (en) * | 1970-03-24 | 1979-04-17 | Hoechst Aktiengesellschaft | Water-insoluble yellow terephthalate-azo-acetoacetylamido-benzimidazolone dyestuffs |
| US4080321A (en) * | 1973-08-01 | 1978-03-21 | Hoechst Aktiengesellschaft | Monoazo pigments from diazotized acylamino-anilines and acetoacetylamino benzimidazolones |
| US4370269A (en) * | 1974-04-04 | 1983-01-25 | Hoechst Aktiengesellschaft | Monoazo pigment derived from acetoacetylamino benzimidazolone |
| CH627200A5 (en) * | 1977-01-11 | 1981-12-31 | Ciba Geigy Ag | Process for preparing new monoazo pigments and use thereof for pigmenting macromolecular organic material |
| CH627775A5 (de) * | 1977-02-03 | 1982-01-29 | Ciba Geigy Ag | Verfahren zur umwandlung eines pigments oder dispersionsfarbstoffs in eine andere modifikation. |
| DE2845947A1 (de) * | 1978-10-21 | 1980-04-30 | Hoechst Ag | Azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung |
| DE2845946A1 (de) * | 1978-10-21 | 1980-04-30 | Hoechst Ag | Azoverbindungen, verfahren zu ihrer herstellung und ihre verwendung |
| DE2847284A1 (de) * | 1978-10-31 | 1980-05-14 | Hoechst Ag | Monoazoverbindungen, verfahren zu ihrer herstellung und ihre verwendung |
| DE3140141A1 (de) * | 1981-10-09 | 1983-04-28 | Hoechst Ag, 6230 Frankfurt | Verfahren zur herstellung eines azopigments |
Family Cites Families (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE845374C (de) * | 1950-01-21 | 1952-07-31 | Naphtol Chemie Offenbach | Verfahren zur Herstellung von wasserunloeslichen Monoazofarbstoffen |
| US3102879A (en) * | 1958-09-30 | 1963-09-03 | Basf Ag | Production of cationic dyestuffs |
| DE1200979B (de) * | 1960-11-04 | 1965-09-16 | Hoechst Ag | Verfahren zur Herstellung von wasserunloeslichen Monoazofarbstoffen |
| US3109842A (en) * | 1961-09-14 | 1963-11-05 | Hoechst Ag | Water-insoluble benzeneazo-5-aceto-acetylaminobenzimidazolone dyestuffs |
-
0
- BE BE646790D patent/BE646790A/xx unknown
-
1963
- 1963-04-18 DE DEF39512A patent/DE1281606B/de active Pending
-
1964
- 1964-04-09 US US358623A patent/US3328384A/en not_active Expired - Lifetime
- 1964-04-14 NL NL6404017A patent/NL6404017A/xx unknown
- 1964-04-15 GB GB15614/64A patent/GB1039962A/en not_active Expired
- 1964-04-16 AT AT333264A patent/AT246875B/de active
- 1964-04-17 DK DK191164AA patent/DK105708C/da active
Also Published As
| Publication number | Publication date |
|---|---|
| US3328384A (en) | 1967-06-27 |
| NL6404017A (enExample) | 1965-03-25 |
| AT246875B (de) | 1966-05-10 |
| DE1281606B (de) | 1968-10-31 |
| BE646790A (enExample) | |
| GB1039962A (en) | 1966-08-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DK105542C (da) | Fremgangsmåde til fremstilling af vanduopløselige farvestoffer. | |
| DK108500C (da) | Fremgangsmåde til fremstilling af 1-glykosyl-5-azacytosiner. | |
| DK105708C (da) | Fremgangsmåde til fremstilling af vanduopløselige monoazofarvestoffer. | |
| DK111889B (da) | Fremgangsmåde til fremstilling af 3-N-substituerede tricycloundecaner. | |
| DK105485C (da) | Fremgangsmåde til fremstilling af vanduopløselige monoazofarvestoffer. | |
| DK103085C (da) | Fremgangsmåde til fremstilling af vanduopløselige monoazofarvestoffer. | |
| DK104187C (da) | Fremgangsmåde til fremstilling af monoazofarvestoffer. | |
| DK104461C (da) | Fremgangsmåde til fremstilling af 3-amino-isoxazoler. | |
| DK103522C (da) | Fremgangsmåde til fremstilling af vanduopløselige monoazofarvestoffer. | |
| DK107031C (da) | Fremgangsmåde til fremstilling af 2-halogenmethyl-quinazolin-3-oxider. | |
| DK108649C (da) | Fremgangsmåde til fremstilling af vandopløselige phthalocyaninfarvestoffer. | |
| DK103582C (da) | Fremgangsmåde til fremstilling af vanduoploselige monoazofarvestoffer. | |
| DK104571C (da) | Fremgangsmåde til fremstilling af trans-2-phenyl-3-methylmorpholin. | |
| DK106809C (da) | Fremgangsmåde til fremstilling af reaktive monoazofarvestoffer. | |
| DK102974C (da) | Fremgangsmåde til fremstilling af vanduopløselige monoazofarvestoffer. | |
| DK106627C (da) | Fremgangsmåde til fremstilling af et vanduopløseligt monoazofarvestof. | |
| DK101373C (da) | Fremgangsmåde til fremstilling af vandopløselige monoazofarvestoffer. | |
| DK109459C (da) | Fremgangsmåde til fremstilling af vanduopløselige monoazofarvestoffer. | |
| DK109137C (da) | Fremgangsmåde til fremstilling af propionaldehyd. | |
| DK109962C (da) | Fremgangsmåde til fremstilling af vanduopløselige disazofarvestoffer. | |
| DK104581C (da) | Fremgangsmåde til fremstilling af et vanduopløseligt azofarvestof. | |
| DK108153C (da) | Fremgangsmåde til fremstilling af 1-alkyl-5-nitroimidazol-2-carboxylater. | |
| DK101372C (da) | Fremgangsmåde til fremstilling af vanduopløselige monoazofarvestoffer. | |
| DK100746C (da) | Fremgangsmåde til fremstilling af vanduopløselige monoazofarvestoffer. | |
| DK100510C (da) | Fremgangsmåde til fremstilling af monoazofarvestoffer. |