DEK0017052MA - - Google Patents
Info
- Publication number
- DEK0017052MA DEK0017052MA DEK0017052MA DE K0017052M A DEK0017052M A DE K0017052MA DE K0017052M A DEK0017052M A DE K0017052MA
- Authority
- DE
- Germany
- Prior art keywords
- aluminum
- fluorides
- thioesters
- thiophenolates
- inorganic acids
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 150000002222 fluorine compounds Chemical class 0.000 claims description 9
- 238000000034 method Methods 0.000 claims description 6
- 150000007970 thio esters Chemical class 0.000 claims description 6
- DTMSXUNYWQMRBI-UHFFFAOYSA-K aluminum;benzenethiolate Chemical class [Al+3].[S-]C1=CC=CC=C1.[S-]C1=CC=CC=C1.[S-]C1=CC=CC=C1 DTMSXUNYWQMRBI-UHFFFAOYSA-K 0.000 claims description 5
- 150000007522 mineralic acids Chemical class 0.000 claims description 4
- 230000000737 periodic effect Effects 0.000 claims description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 15
- RMVRSNDYEFQCLF-UHFFFAOYSA-N thiophenol Chemical compound SC1=CC=CC=C1 RMVRSNDYEFQCLF-UHFFFAOYSA-N 0.000 description 6
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 239000003513 alkali Substances 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- KLZUFWVZNOTSEM-UHFFFAOYSA-K Aluminum fluoride Inorganic materials F[Al](F)F KLZUFWVZNOTSEM-UHFFFAOYSA-K 0.000 description 3
- 238000004519 manufacturing process Methods 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- IRPGOXJVTQTAAN-UHFFFAOYSA-N 2,2,3,3,3-pentafluoropropanal Chemical compound FC(F)(F)C(F)(F)C=O IRPGOXJVTQTAAN-UHFFFAOYSA-N 0.000 description 2
- VXEGSRKPIUDPQT-UHFFFAOYSA-N 4-[4-(4-methoxyphenyl)piperazin-1-yl]aniline Chemical compound C1=CC(OC)=CC=C1N1CCN(C=2C=CC(N)=CC=2)CC1 VXEGSRKPIUDPQT-UHFFFAOYSA-N 0.000 description 2
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 2
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 2
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 2
- 229910052782 aluminium Inorganic materials 0.000 description 2
- 229910052785 arsenic Inorganic materials 0.000 description 2
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 2
- 229910052796 boron Inorganic materials 0.000 description 2
- 238000006243 chemical reaction Methods 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000013078 crystal Substances 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- NROKBHXJSPEDAR-UHFFFAOYSA-M potassium fluoride Chemical compound [F-].[K+] NROKBHXJSPEDAR-UHFFFAOYSA-M 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 229910052710 silicon Inorganic materials 0.000 description 2
- 239000010703 silicon Substances 0.000 description 2
- 239000005049 silicon tetrachloride Substances 0.000 description 2
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 2
- 239000007787 solid Substances 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- 229910016569 AlF 3 Inorganic materials 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- CQXADFVORZEARL-UHFFFAOYSA-N Rilmenidine Chemical compound C1CC1C(C1CC1)NC1=NCCO1 CQXADFVORZEARL-UHFFFAOYSA-N 0.000 description 1
- XSTXAVWGXDQKEL-UHFFFAOYSA-N Trichloroethylene Chemical group ClC=C(Cl)Cl XSTXAVWGXDQKEL-UHFFFAOYSA-N 0.000 description 1
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- YYRMJZQKEFZXMX-UHFFFAOYSA-N calcium;phosphoric acid Chemical compound [Ca+2].OP(O)(O)=O.OP(O)(O)=O YYRMJZQKEFZXMX-UHFFFAOYSA-N 0.000 description 1
- 238000003776 cleavage reaction Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910001610 cryolite Inorganic materials 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000003254 gasoline additive Substances 0.000 description 1
- 239000000543 intermediate Substances 0.000 description 1
- 230000007775 late Effects 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- PPPLOTGLKDTASM-UHFFFAOYSA-A pentasodium;pentafluoroaluminum(2-);tetrafluoroalumanuide Chemical compound [F-].[F-].[F-].[F-].[F-].[F-].[F-].[F-].[F-].[F-].[F-].[F-].[F-].[F-].[Na+].[Na+].[Na+].[Na+].[Na+].[Al+3].[Al+3].[Al+3] PPPLOTGLKDTASM-UHFFFAOYSA-A 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- FSLNIRNUDDVRGY-UHFFFAOYSA-N phenylsulfanylboronic acid Chemical compound OB(O)SC1=CC=CC=C1 FSLNIRNUDDVRGY-UHFFFAOYSA-N 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 229920003023 plastic Polymers 0.000 description 1
- 229920001296 polysiloxane Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 235000003270 potassium fluoride Nutrition 0.000 description 1
- 239000011698 potassium fluoride Substances 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000007017 scission Effects 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 239000002426 superphosphate Substances 0.000 description 1
- -1 thioesters Acids Chemical class 0.000 description 1
- XSCIEFUPKGHAAM-UHFFFAOYSA-N thiosilicic acid Chemical compound O[Si](O)(O)S XSCIEFUPKGHAAM-UHFFFAOYSA-N 0.000 description 1
- OPSWAWSNPREEFQ-UHFFFAOYSA-K triphenoxyalumane Chemical class [Al+3].[O-]C1=CC=CC=C1.[O-]C1=CC=CC=C1.[O-]C1=CC=CC=C1 OPSWAWSNPREEFQ-UHFFFAOYSA-K 0.000 description 1
- 238000005292 vacuum distillation Methods 0.000 description 1
- 229910052726 zirconium Inorganic materials 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0638575B1 (de) | Verfahren zur Herstellung von Diorganodialkoxysilanen | |
| DE69106751T2 (de) | Zweistufiges Herstellungsverfahren für Monoethylenglykol. | |
| EP0065770A1 (de) | Verfahren zur Herstellung von p-Nitrophenetol | |
| EP0063731B1 (de) | Verfahren zur Herstellung von optisch aktiven Carbonsäuren | |
| EP0056981A1 (de) | Verfahren zur Herstellung von optisch aktiven 2-Chlorpropionsäureestern | |
| DE950640C (de) | Verfahren zur Herstellung von Thioestern anorganischer Saeuren | |
| DEK0017052MA (enrdf_load_stackoverflow) | ||
| EP0293753A2 (de) | Verfahren zur Herstellung von E-2-Propyl-2-pentensäure und physiologisch verträglichen Salzen derselben | |
| DE1156809B (de) | Verfahren zur Herstellung von Cyanalkylfluorsilanen | |
| DE3415475A1 (de) | Verfahren zur herstellung von alkoxymethylenverbindungen von essigestern und substituierten essigestern | |
| EP0590459B1 (de) | Verfahren zur Herstellung von Difluor- und Chlorfluorbenzodioxolen | |
| EP0413264B1 (de) | Verfahren zur Herstellung von Chlorcarbonsäurechloriden | |
| EP1077210B1 (de) | Verfahren zur Herstellung von 4,6-Dichlor-5-fluorpyrimidin und seine Verwendung als Biocid | |
| DE2141881A1 (de) | Verfahren zur Herstellung von Chlor silanen aus Disiloxanen | |
| EP0171046B1 (de) | Verfahren zur Herstellung von Pantolacton | |
| EP0133663B1 (de) | Neue Pyrimidine und ein Verfahren zur Herstellung von Pyrimidinen | |
| EP0112497B1 (de) | Verfahren zur Herstellung von Alkanphosphonigsäureestern | |
| DE2609126C2 (de) | Verfahren zur Herstellung von [2-(Halogenformyl)-vinyl] organyl-phosphinsäurehalogeniden | |
| DE69005000T2 (de) | Verfahren zur Herstellung von Acrylsäurechlorid. | |
| DE3112265A1 (de) | "verfahren zur herstellung von tetrasubstituierten cyclopropan-derivaten und hiernach erhaltene neue produkte" | |
| DE60102113T2 (de) | Ammonium-3,5,6-trihydroxyhexansäure-Derivate und Methoden zu ihrer Herstellung | |
| DEK0020558MA (enrdf_load_stackoverflow) | ||
| EP0499930B1 (de) | Verfahren zur Herstellung von 5-Fluorpyrimidinen | |
| EP0293752A2 (de) | Verfahren zur Herstellung von E-2-Propyl-2-pentensäure und physiologisch verträglichen Salzen derselben | |
| DE1247294B (de) | Verfahren zur Herstellung von 2-Chlor-3-oxobuttersaeureamiden |