DEF0039236MA - - Google Patents
Info
- Publication number
- DEF0039236MA DEF0039236MA DEF0039236MA DE F0039236M A DEF0039236M A DE F0039236MA DE F0039236M A DEF0039236M A DE F0039236MA
- Authority
- DE
- Germany
- Prior art keywords
- urea
- formaldehyde
- resin
- resins
- phenolic
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 claims description 16
- 229920001568 phenolic resin Polymers 0.000 claims description 9
- 239000005011 phenolic resin Substances 0.000 claims description 8
- 238000000034 method Methods 0.000 claims description 6
- 229920001807 Urea-formaldehyde Polymers 0.000 claims description 5
- BGJSXRVXTHVRSN-UHFFFAOYSA-N 1,3,5-trioxane Chemical compound C1OCOCO1 BGJSXRVXTHVRSN-UHFFFAOYSA-N 0.000 claims description 3
- KXGFMDJXCMQABM-UHFFFAOYSA-N 2-methoxy-6-methylphenol Chemical compound [CH]OC1=CC=CC([CH])=C1O KXGFMDJXCMQABM-UHFFFAOYSA-N 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 238000006243 chemical reaction Methods 0.000 claims description 2
- 229920003987 resole Polymers 0.000 claims 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 6
- 229920005989 resin Polymers 0.000 description 6
- 239000011347 resin Substances 0.000 description 6
- AMIMRNSIRUDHCM-UHFFFAOYSA-N Isopropylaldehyde Chemical compound CC(C)C=O AMIMRNSIRUDHCM-UHFFFAOYSA-N 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 4
- 150000002989 phenols Chemical class 0.000 description 4
- 239000004848 polyfunctional curative Substances 0.000 description 4
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 239000007795 chemical reaction product Substances 0.000 description 3
- 238000009833 condensation Methods 0.000 description 3
- 238000005516 engineering process Methods 0.000 description 3
- 239000000203 mixture Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- 229930185605 Bisphenol Natural products 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 150000001299 aldehydes Chemical class 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 230000005494 condensation Effects 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 239000003110 molding sand Substances 0.000 description 2
- 235000013824 polyphenols Nutrition 0.000 description 2
- QTWJRLJHJPIABL-UHFFFAOYSA-N 2-methylphenol;3-methylphenol;4-methylphenol Chemical compound CC1=CC=C(O)C=C1.CC1=CC=CC(O)=C1.CC1=CC=CC=C1O QTWJRLJHJPIABL-UHFFFAOYSA-N 0.000 description 1
- VPWNQTHUCYMVMZ-UHFFFAOYSA-N 4,4'-sulfonyldiphenol Chemical class C1=CC(O)=CC=C1S(=O)(=O)C1=CC=C(O)C=C1 VPWNQTHUCYMVMZ-UHFFFAOYSA-N 0.000 description 1
- -1 alkylphenols Chemical class 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 238000005266 casting Methods 0.000 description 1
- 238000005119 centrifugation Methods 0.000 description 1
- 239000003795 chemical substances by application Substances 0.000 description 1
- 238000004939 coking Methods 0.000 description 1
- 229930003836 cresol Natural products 0.000 description 1
- 150000001993 dienes Chemical class 0.000 description 1
- 238000004043 dyeing Methods 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007849 furan resin Substances 0.000 description 1
- LBADSVWKHVCNCZ-UHFFFAOYSA-N furan;urea Chemical compound NC(N)=O.C=1C=COC=1 LBADSVWKHVCNCZ-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 229920003986 novolac Polymers 0.000 description 1
- ODGAOXROABLFNM-UHFFFAOYSA-N polynoxylin Chemical class O=C.NC(N)=O ODGAOXROABLFNM-UHFFFAOYSA-N 0.000 description 1
- 150000008442 polyphenolic compounds Chemical class 0.000 description 1
- 238000004382 potting Methods 0.000 description 1
- 239000013049 sediment Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE102004057671B4 (de) | Phenol-Formaldehydharze und Verfahren zu deren Herstellung | |
| EP0021409B1 (de) | Schwindungsarme säurehärtende Mischungen für Furankitte und Verfahren zu deren Herstellung | |
| EP0047992B1 (de) | Verfahren zur Herstellung von Kunstharzen auf der Basis von Resorcin-Verbindungen | |
| DEF0039236MA (enExample) | ||
| EP0290551B1 (de) | Kalthärtendes formstoff-bindemittel und dessen verwendung | |
| DE1570415C3 (de) | Verfahren zur Herstellung polymerer Borverbindungen | |
| DE1057332B (de) | Waermehaertbare Form-, UEberzugs- und Klebmasse auf Epoxyharzbasis | |
| EP0156043A2 (de) | Härtbare Formmassen und ihre Verwendung | |
| AT245802B (de) | Verfahren zur Herstellung von Formkörpern aus Gemischen von härtbaren, lagerfähigen Harnstofformaldehyd- und Phenolformaldehyd-Harzen | |
| EP0152760A2 (de) | Säurehärtbare Mischung für schwindungsarme Furankitte und Verfahren zu deren Herstellung | |
| DE1177817B (de) | Verfahren zur Herstellung von Formkoerpern aus Gemischen von Harnstofformaldehyd- und Phenolformaldehyd-Harzen | |
| DE1961156A1 (de) | Verfahren zur Herstellung von Giessformen oder -kernen | |
| DE1570419C3 (de) | Verfahren zur Herstellung polymerer Borverbindungen | |
| DE890852C (de) | Verfahren zur Herstellung eines wasserloeslichen Bindemittels fuer faserige Materialien | |
| DE972367C (de) | Verfahren zur Herstellung chemikalienbestaendiger Kitte, Bindemittel, Form- und UEberzugsmassen | |
| EP0139864A2 (de) | Verfahren zur Herstellung eines Phenolresolharzes | |
| DE1694848B2 (de) | Verfahren zur Härtung saurehartbarer Bindemittel fur Form- und Kernsand auf Basis von Phenolharzen oder Harnstoffharzen | |
| EP0615985B1 (de) | Bindemittelsystem | |
| DE2439828A1 (de) | Waermehaertbare massen zum herstellen von giessereikernen und -formen | |
| AT210140B (de) | Verfahren zur Herstellung von alkohollöslichen Ligninharzen | |
| DE4226327A1 (de) | Ligninmodifizierte bindemittel | |
| DE1231889B (de) | Gegen Hitzeeinwirkung stabilisierte Formmassen aus waermehaertbaren Phenol-Aldehyd-Kondensationsprodukten | |
| EP0653450A1 (de) | Schadstoffarme Resole für Kitte | |
| DD257073A1 (de) | Verfahren zur herstellung von pf-giessereiharzen | |
| DE1121331B (de) | Verfahren zur Herstellung rasch haertender, gegebenenfalls durch Weichmachung haertungsverzoegerter Resole |