DED0021475MA - - Google Patents
Info
- Publication number
- DED0021475MA DED0021475MA DED0021475MA DE D0021475M A DED0021475M A DE D0021475MA DE D0021475M A DED0021475M A DE D0021475MA
- Authority
- DE
- Germany
- Prior art keywords
- sheets
- objects
- layers
- silicate
- water
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000010410 layer Substances 0.000 claims description 24
- 238000000034 method Methods 0.000 claims description 15
- 239000006185 dispersion Substances 0.000 claims description 10
- 238000000137 annealing Methods 0.000 claims description 9
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 claims description 8
- 239000002562 thickening agent Substances 0.000 claims description 7
- 238000005507 spraying Methods 0.000 claims description 6
- 229910052910 alkali metal silicate Inorganic materials 0.000 claims description 5
- 238000001035 drying Methods 0.000 claims description 5
- 229910001385 heavy metal Inorganic materials 0.000 claims description 5
- 235000019353 potassium silicate Nutrition 0.000 claims description 5
- NTHWMYGWWRZVTN-UHFFFAOYSA-N sodium silicate Chemical compound [Na+].[Na+].[O-][Si]([O-])=O NTHWMYGWWRZVTN-UHFFFAOYSA-N 0.000 claims description 5
- 229910000640 Fe alloy Inorganic materials 0.000 claims description 4
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 4
- 229910052742 iron Inorganic materials 0.000 claims description 4
- 150000002736 metal compounds Chemical class 0.000 claims description 4
- 239000000203 mixture Substances 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 4
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 4
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 claims description 3
- 239000011247 coating layer Substances 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 150000004760 silicates Chemical class 0.000 claims description 3
- 229910044991 metal oxide Inorganic materials 0.000 claims description 2
- 150000004706 metal oxides Chemical class 0.000 claims description 2
- 230000001698 pyrogenic effect Effects 0.000 claims description 2
- 239000000377 silicon dioxide Substances 0.000 claims description 2
- 235000012239 silicon dioxide Nutrition 0.000 claims description 2
- 239000000243 solution Substances 0.000 claims 2
- 239000000758 substrate Substances 0.000 claims 2
- 239000007864 aqueous solution Substances 0.000 claims 1
- 229910052751 metal Inorganic materials 0.000 description 8
- 239000002184 metal Substances 0.000 description 8
- 238000000576 coating method Methods 0.000 description 6
- 239000002585 base Substances 0.000 description 5
- 239000011241 protective layer Substances 0.000 description 5
- 239000011248 coating agent Substances 0.000 description 4
- 230000007797 corrosion Effects 0.000 description 3
- 238000005260 corrosion Methods 0.000 description 3
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- 238000005452 bending Methods 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 210000003298 dental enamel Anatomy 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000007789 gas Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 2
- 238000004080 punching Methods 0.000 description 2
- 238000005979 thermal decomposition reaction Methods 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- 229910000851 Alloy steel Inorganic materials 0.000 description 1
- UXVMQQNJUSDDNG-UHFFFAOYSA-L Calcium chloride Chemical compound [Cl-].[Cl-].[Ca+2] UXVMQQNJUSDDNG-UHFFFAOYSA-L 0.000 description 1
- 229910001018 Cast iron Inorganic materials 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- 229910000676 Si alloy Inorganic materials 0.000 description 1
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- XHCLAFWTIXFWPH-UHFFFAOYSA-N [O-2].[O-2].[O-2].[O-2].[O-2].[V+5].[V+5] Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[V+5].[V+5] XHCLAFWTIXFWPH-UHFFFAOYSA-N 0.000 description 1
- 230000001464 adherent effect Effects 0.000 description 1
- 230000002411 adverse Effects 0.000 description 1
- DIZPMCHEQGEION-UHFFFAOYSA-H aluminium sulfate (anhydrous) Chemical compound [Al+3].[Al+3].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O DIZPMCHEQGEION-UHFFFAOYSA-H 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000001639 boron compounds Chemical class 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 239000003518 caustics Substances 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 238000007598 dipping method Methods 0.000 description 1
- 238000010292 electrical insulation Methods 0.000 description 1
- 230000002349 favourable effect Effects 0.000 description 1
- -1 for example Substances 0.000 description 1
- 229910021485 fumed silica Inorganic materials 0.000 description 1
- 238000010438 heat treatment Methods 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- XWHPIFXRKKHEKR-UHFFFAOYSA-N iron silicon Chemical compound [Si].[Fe] XWHPIFXRKKHEKR-UHFFFAOYSA-N 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- 229910052752 metalloid Inorganic materials 0.000 description 1
- 150000002738 metalloids Chemical class 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 230000001590 oxidative effect Effects 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- RVTZCBVAJQQJTK-UHFFFAOYSA-N oxygen(2-);zirconium(4+) Chemical compound [O-2].[O-2].[Zr+4] RVTZCBVAJQQJTK-UHFFFAOYSA-N 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- 229920001592 potato starch Polymers 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000011265 semifinished product Substances 0.000 description 1
- 239000003238 silicate melt Substances 0.000 description 1
- 229910052710 silicon Inorganic materials 0.000 description 1
- 239000010703 silicon Substances 0.000 description 1
- 235000020374 simple syrup Nutrition 0.000 description 1
- 239000002893 slag Substances 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- CGOSIVYNVKVZBK-UHFFFAOYSA-K sodium cobalt(2+) trinitrite Chemical compound [Na+].[Co++].[O-]N=O.[O-]N=O.[O-]N=O CGOSIVYNVKVZBK-UHFFFAOYSA-K 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 239000002344 surface layer Substances 0.000 description 1
- 229910001935 vanadium oxide Inorganic materials 0.000 description 1
- 229910001928 zirconium oxide Inorganic materials 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2440964C3 (de) | Verfahren zum Aufbringen einer Schicht aus kunststoffbeschichteten Teilchen aus anorganischem Material | |
| EP2683843B1 (de) | Stahlflachprodukt und verfahren zum herstellen eines stahlflachprodukts | |
| DE2752803C3 (de) | Wäßriges Überzugsmittel auf der Grundlage von kolloidalem Kieselsäureanhydrid | |
| EP3184228B1 (de) | Verwendung von sauerstoffbarrierebeschichtungen auf metallischen substraten | |
| DE3000731A1 (de) | Schutzueberzugszubereitung und verfahren zum kathodischen schuetzen eines metallsubstrats gegen korrosion unter verwendung dieser schutzueberzugszubereitung | |
| DE2630881A1 (de) | Verfahren zum ueberziehen von metallen | |
| DE3327251A1 (de) | Beschichtungsmassen zum verhindern der oxidation von elektroden waehrend der herstellung von eisenmetallen insbesondere stahl, in elektrischen oefen | |
| DE1621533B2 (de) | Verfahren zur Herstellung eines glasartigen UEberzugs mit hoher elektrischer Isolierfaehigkeit und hoher Hitzebestaendigkeit auf einem Siliciumstahlblech | |
| DE19824792A1 (de) | Verfahren zum Herstellen einer korrosions- und oxidationsbeständigen Schicht | |
| DE2632439A1 (de) | Verfahren zur herstellung eines mit aluminium oder einer aluminiumlegierung beschichteten stahlbleches | |
| DED0021475MA (https=) | ||
| DE3830848C1 (https=) | ||
| DE102007038214A1 (de) | Verfahren zum Korrosionsschutz von Karosserie-, Fahrwerks-, Motorbauteilen oder Abgasanlagen | |
| DE69100441T2 (de) | Beschichtete Magnesiumteilchen zur Entschwefelung von Gusseisen oder Flussstahl. | |
| DD202584A5 (de) | Loesungsmittelhaltiger lack mit farbpigment | |
| DE1669235A1 (de) | Alkalisilikatschutzueberzug | |
| DE2347728A1 (de) | Ueberzugsmasse fuer die verzoegerung der zunderbildung bei temperaturen oberhalb 1177 grad c | |
| EP4093896A1 (de) | Stahlbauteil mit einer manganhaltigen korrosionsschutzschicht | |
| EP3284843A1 (de) | Langzeitstabiler, lagerfähiger schlicker für umweltfreundliche diffusionsbeschichtungen | |
| DE486974C (de) | Herstellung von Metallpulver, insbesondere Blei, enthaltenden Pigmenten | |
| DE19745801A1 (de) | Verfahren zum Beschichten von Metallen und hiermit beschichtetes Metall | |
| AT201386B (de) | Verfahren zur Vorbehandlung von Blechen oder Bändern vor dem Aufbringen einer Phosphatschutzschicht nach dem Einbrennverfahren | |
| DE312947C (https=) | ||
| DE1621533C (de) | Verfahren zur Herstellung eines glas artigen Überzugs mit hoher elektrischer Isolierfähigkeit und hoher Hitzebeständig keit auf einem Sihciumstahlblech | |
| DE582270C (de) | Verfahren zur beschleunigten Erzeugung von Nitrierhaertungsschichten auf Gegenstaenden von Eisen und seinen Legierungen |