DEA0018986MA - - Google Patents
Info
- Publication number
- DEA0018986MA DEA0018986MA DEA0018986MA DE A0018986M A DEA0018986M A DE A0018986MA DE A0018986M A DEA0018986M A DE A0018986MA
- Authority
- DE
- Germany
- Prior art keywords
- explosive
- explosion
- agent
- reducing agent
- tank
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Active
Links
- 239000002360 explosive Substances 0.000 claims description 30
- 238000004880 explosion Methods 0.000 claims description 16
- 239000007800 oxidant agent Substances 0.000 claims description 9
- 239000003638 chemical reducing agent Substances 0.000 claims description 7
- IWOUKMZUPDVPGQ-UHFFFAOYSA-N barium nitrate Chemical compound [Ba+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O IWOUKMZUPDVPGQ-UHFFFAOYSA-N 0.000 claims description 6
- 239000000428 dust Substances 0.000 claims description 6
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 5
- TZRXHJWUDPFEEY-UHFFFAOYSA-N Pentaerythritol Tetranitrate Chemical compound [O-][N+](=O)OCC(CO[N+]([O-])=O)(CO[N+]([O-])=O)CO[N+]([O-])=O TZRXHJWUDPFEEY-UHFFFAOYSA-N 0.000 claims description 3
- 239000003795 chemical substances by application Substances 0.000 claims description 3
- 230000003647 oxidation Effects 0.000 claims 1
- 238000007254 oxidation reaction Methods 0.000 claims 1
- 239000000203 mixture Substances 0.000 description 13
- 239000002828 fuel tank Substances 0.000 description 9
- 230000000694 effects Effects 0.000 description 7
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 6
- 239000012634 fragment Substances 0.000 description 4
- 239000000446 fuel Substances 0.000 description 4
- 239000011230 binding agent Substances 0.000 description 3
- 229910052751 metal Inorganic materials 0.000 description 3
- 239000002184 metal Substances 0.000 description 3
- 238000007789 sealing Methods 0.000 description 3
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- 238000004898 kneading Methods 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000000843 powder Substances 0.000 description 2
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 239000000020 Nitrocellulose Substances 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 230000006735 deficit Effects 0.000 description 1
- 239000003502 gasoline Substances 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 229920001220 nitrocellulos Polymers 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 230000001681 protective effect Effects 0.000 description 1
- 239000000700 radioactive tracer Substances 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 238000007873 sieving Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000002966 varnish Substances 0.000 description 1
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 1
Family
ID=
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0164732B1 (de) | Einrichtung zur Erzeugung einer Scheinzielwolke, insbesondere einer Infrarot-Scheinzielwolke | |
| DE2752946B2 (de) | Verwendung einer Brandmasse für Brandgeschosse | |
| DE2414310C2 (enrdf_load_stackoverflow) | ||
| DE2530208A1 (de) | Brandsatz | |
| US4438700A (en) | White smoke spotting composition for training ammunition | |
| DE29622620U1 (de) | Schnellnebelhandgranate | |
| DE2552950A1 (de) | Brandmunition | |
| EP1286129B1 (de) | Brandsatz für ein flügelstabilisiertes Wuchtgeschoss | |
| DE102004047231B4 (de) | Wirkkörper | |
| DE957370C (de) | Sprengsatz | |
| DEA0018986MA (enrdf_load_stackoverflow) | ||
| DE2530206A1 (de) | Splitterbrandsatz | |
| DE19846511C2 (de) | Feuerwerkskörper mit nicht explosionsgefährlicher Effektfüllung | |
| DE3541399C3 (de) | Uebungsgeschoss fuer mittelkalibrige bis grosskalibrige uebungspatronen | |
| DE3879918T2 (de) | Projektil mit unter-munitionen. | |
| DE2720695A1 (de) | Brandmasse fuer brandgeschosse | |
| DE10152023B4 (de) | Schockunempfindliche Nebelwurfkörper | |
| DE102004043991C5 (de) | Infrarot-Täuschkörper und seine Verwendung | |
| DE69608644T2 (de) | Dispersions- oder Auftragungsverfahren eines aktiven Materials, Zusammensetzung und Gemäss diesem Verfahren hergestelltes Geschoss | |
| DE102013003172B4 (de) | Sprengstoffwirkmasse, deren Verwendung und Gefechtsmunition | |
| DE102020004562B4 (de) | Reizstoffpatronen 40 mm und 1,5 Zoll | |
| EP2602239B1 (de) | Wirkmasse für ein beim Abbrand im Wesentlichen spektral strahlendes Infrarotscheinziel mit Raumwirkung | |
| Holzwarth et al. | Combination of inert and energetic materials in reactive armor against shaped charge jets | |
| DE10258247B3 (de) | Schrotpatrone, Schrot und Verfahren zur Herstellung des Schrots | |
| DE3523777C1 (en) | Underwater charge producing powerful shock wave - has a small prim. charge and a large sec. charge contg. micro-balloons |